447 Commits

Author SHA1 Message Date
Kavish Devar
63b6e2a389 docs: add note for DID hook on android 2025-10-26 20:53:32 +05:30
Kavish Devar
9b950e13d6 android: add a (very important) support dialog
to not be invasive, this only shows up once, and never again.
2025-10-26 20:48:23 +05:30
Kavish Devar
55768beb7c android: improve connection handling 2025-10-26 20:06:06 +05:30
Kavish Devar
cea09b208a android: remove stray eq config in accessibility settings 2025-10-26 20:05:00 +05:30
Kavish Devar
02edb51e41 android: fix a2dp connection 2025-10-22 17:43:43 +05:30
Kavish Devar
10fc96dc94 android: add support for various models
still need to update images or find a way to fetch from apple's cdn
2025-10-22 16:25:09 +05:30
Kavish Devar
1a2f5138a9 android: parse device info 2025-10-22 12:52:46 +05:30
Kavish Devar
ee9de99204 android: fix haze for dialog when enabling hearing aid 2025-10-19 12:54:35 +05:30
Kavish Devar
c83ffca546 docs: add screenshot for hearing test 2025-10-16 13:16:38 +05:30
Kavish Devar
814eba8ed6 android: update title in hearing test screen 2025-10-16 13:13:27 +05:30
Kavish Devar
a9b78efd80 android: implement setting hearing test results 2025-10-16 13:11:21 +05:30
Kavish Devar
942ff82382 android: update animation time on switch tap 2025-10-10 20:54:01 +05:30
Kavish Devar
4a135fa463 android: move navigation button to activity level 2025-10-10 20:39:54 +05:30
Kavish Devar
39a64ec6f2 android: add opensource licenses
should've done this a long time ago!
2025-10-10 17:24:52 +05:30
Kavish Devar
b7cc27f4d3 android: remove unused LOCAL_ADDRESS permission 2025-10-06 18:32:40 +05:30
Kavish Devar
0e0af35103 android: don't crash if self MAC is not available 2025-10-01 20:04:35 +05:30
Kavish Devar
993ba1ba08 android: bump version 2025-10-01 09:50:21 +05:30
Kavish Devar
3a9c118353 android: revert to using relative paths for su
compatibility issues with magisk
2025-10-01 09:48:50 +05:30
Kavish Devar
37313fbb1c android: fix transparency and noise cancellation flags
huh... was it always like this?
2025-10-01 01:50:38 +05:30
Kavish Devar
d9469c2d62 android: not use relative paths for executing commands
i hope it's the same across all skins
2025-10-01 01:34:30 +05:30
Kavish Devar
b799cd1710 android: add option to change camera app id 2025-10-01 01:24:28 +05:30
Kavish Devar
c7dc545ed4 android: add camera control, finally
i got too lazy to find out how to listen to app openings earlier, wasn't too hard
2025-10-01 01:10:37 +05:30
Kavish Devar
342745ee2e android: add accessiblity service for camera control 2025-09-30 23:53:29 +05:30
Kavish Devar
8b49440d6b android: update styled slider thumb 2025-09-30 11:33:46 +05:30
Kavish Devar
993f022087 android: ui tweaks 2025-09-30 11:07:16 +05:30
Kavish Devar
650b128d5d docs: change section title in control cmd doc
Updated section title from 'Control Commands' to 'Identifiers and details'.
2025-09-29 17:18:37 +05:30
Kavish Devar
395feabb13 docs: new control cmds '25 (again) 2025-09-29 16:55:01 +05:30
Kavish Devar
6914dabe59 docs: app3 compatibility 2025-09-29 14:34:27 +05:30
Kavish Devar
78ae31c898 docs: update demo video position 2025-09-29 01:47:44 +05:30
Kavish Devar
b43e5f7526 docs: add new screenshots for android 2025-09-29 01:45:29 +05:30
Kavish Devar
9d60dc3682 docs: add demo video 2025-09-29 01:31:31 +05:30
Kavish Devar
c2ebbef14b docs: update README with new features 2025-09-29 01:00:41 +05:30
Kavish Devar
3a388da48e android: hide media assist, not implemented 2025-09-29 00:22:46 +05:30
Kavish Devar
bdb93efec6 android: prevent hearing aid turning off itself 2025-09-29 00:22:01 +05:30
Kavish Devar
504e70371b android: bring back original confirmation dialog
too lazy to fix/implement properly the glassy one
2025-09-29 00:17:02 +05:30
Kavish Devar
48b715af68 android: fix text color in troubshooting button and pressandhold settings 2025-09-28 18:13:52 +05:30
Kavish Devar
5ec300aad8 android: use lazycolumn in airpods settings for better performance and navigation transitions 2025-09-28 17:10:49 +05:30
Kavish Devar
e158ba1b27 android: don't crash if att not available 2025-09-28 17:01:42 +05:30
Kavish Devar
147e511659 android: show head gestures status in the navigation button 2025-09-28 16:03:55 +05:30
Kavish Devar
e9da7a2a50 android: fix crash in head gestures screen 2025-09-28 16:01:56 +05:30
Kavish Devar
1076218ccc android: add A16's new bluetooth identifier for log collection
just why...
2025-09-28 15:48:36 +05:30
Kavish Devar
55cb69f880 android: remove fade from transition 2025-09-28 15:41:43 +05:30
Kavish Devar
5bc1dd2e1d android: fix switch styling 2025-09-28 13:44:00 +05:30
Kavish Devar
1152f45a6c remove bleonly mode, use CAPod instead 2025-09-28 12:30:09 +05:30
Kavish Devar
3f582b8fcf remove bleonly mode, use CAPod instead 2025-09-28 12:27:42 +05:30
Kavish Devar
08738a1293 android: liquidglass, maybe?
the switch and icon button took quite a while. i forgot the order of modifiers matters!
2025-09-28 12:27:05 +05:30
Kavish Devar
8dc7a97c43 android: update usages for toggle 2025-09-26 14:03:47 +05:30
Kavish Devar
d9795c4d28 merge main into multi-device-and-accessibility 2025-09-26 03:38:29 +05:30
Kavish Devar
56307c98e3 android: revert accidental capitalization on toggle label 2025-09-26 03:27:32 +05:30
Kavish Devar
ab55096051 android: move padding to StyledScaffold's content
because haze needs it
2025-09-26 03:26:25 +05:30
Kavish Devar
86a6a28dc1 android: a very big commit
refactoring ui, mostly
2025-09-26 03:22:01 +05:30
Kavish Devar
7e5ee6726f android: small ui tweaks 2025-09-23 23:58:06 +05:30
Kavish Devar
5f08edd49c android: remove unused strings 2025-09-23 11:14:31 +05:30
Kavish Devar
29a35ceebe android: remove customdeviceactivity from manifest 2025-09-23 11:03:55 +05:30
Kavish Devar
b732c66962 linux: add desktop entry file (#204) 2025-09-23 10:12:37 +05:30
Kavish Devar
173e06c5e7 android: fix hearing aid parsing 2025-09-23 02:53:10 +05:30
Kavish Devar
26de42243f android: little more liquid glass 2025-09-23 01:20:41 +05:30
Kavish Devar
8760757b76 android: improve liquid glass sliders 2025-09-23 00:27:39 +05:30
Kavish Devar
4bc76de750 android: liquidglass sliders 2025-09-23 00:03:03 +05:30
Kavish Devar
4751f70579 android: add hearing aid adjustments 2025-09-22 14:54:54 +05:30
Kavish Devar
ce229bec6e android: add media assist options in hearing aid
ui only
2025-09-22 10:44:48 +05:30
Kavish Devar
fe69082e11 android: add ui for hearing stuff
mostly copied from the transparency settings, which are now updated to match ios <26 ui
2025-09-22 00:59:39 +05:30
Kavish Devar
3ace0e1831 android: move attmanager to service to avoid trying to connect multiple times 2025-09-21 22:15:44 +05:30
Kavish Devar
ecfdc05dbf android: improve dropdowns
ai generated
2025-09-21 01:34:42 +05:30
Kavish Devar
5aeb47b835 android: add microphone setting
also, un-hardcoded strings, and updated text sizes
2025-09-20 22:55:35 +05:30
Kavish Devar
3cca786cf9 docs: a few more control cmds 2025-09-20 01:45:06 +05:30
Kavish Devar
6fd3cc1eb0 android: a small ui fix 2025-09-20 01:44:36 +05:30
Kavish Devar
bb69a74a8e android: add a few options
ik not the right branch/pr but, eh, i am not merging this hook until i test further, and if i don't merge, conflicts, a lot of 'em
2025-09-20 01:43:24 +05:30
Kavish Devar
71a1f834cb android: add delay before starting head tracking again 2025-09-19 23:38:38 +05:30
Kavish Devar
63baa153da android: fix text color in selectors 2025-09-19 18:16:02 +05:30
Kavish Devar
5eff5b9d77 android: update eq sliders style 2025-09-19 18:12:56 +05:30
Kavish Devar
b5103a28e7 android: remove unused composable 2025-09-19 18:10:00 +05:30
Kavish Devar
3699ee6bee android: fix track color in tone volume 2025-09-19 18:08:31 +05:30
Kavish Devar
032b94e3ae android: use device name sent by the connected device in island 2025-09-19 16:27:32 +05:30
Kavish Devar
5c9beeb26d android: add header to ATTManager 2025-09-19 14:29:55 +05:30
Kavish Devar
65d074efe0 android: bring back some accessiblity settings and add listeners for all config 2025-09-19 13:11:04 +05:30
Kavish Devar
93328d281e android: fix balance NaN error when amplification L/R is both zero 2025-09-18 13:56:06 +05:30
Integral
f5742618c7 linux: add desktop entry file 2025-09-17 10:19:52 +08:00
Kavish Devar
792629acb9 docs: add 'has ownership' control cmd 2025-09-15 20:01:46 +05:30
Kavish Devar
5bef8c384e android: add toggle for DID hook 2025-09-15 19:59:43 +05:30
Kavish Devar
9e6d97198b android: add EQ settings for phone and media 2025-09-15 11:49:00 +05:30
Kavish Devar
c53356f77e android: implement the accessiblity settings page 2025-09-11 12:21:23 +05:30
Kavish Devar
fa00620b5b android: clean up a lot of stuff 2025-09-10 12:38:27 +05:30
Kavish Devar
aecbb066b5 android: clean up main service and remove minimum API on head gestures 2025-09-10 11:32:48 +05:30
Kavish Devar
0e9aadd672 android: clean up a bit of AI gen'd code 2025-09-10 11:24:51 +05:30
Kavish Devar
df9f443173 android: add basic multidevice capabilities
use at your own risk, may or may not work
2025-09-10 10:03:52 +05:30
Kavish Devar
d1bf5407c9 android: don't start service every time MainActivity is launched 2025-09-09 16:33:07 +05:30
Kavish Devar
4ee9b2732f docs: update transparency mode format 2025-09-08 00:24:15 +05:30
Kavish Devar
86551be86b android: add accessibility stuff
adds option for customizing transparency mode, amplification, tone, etc.
2025-09-08 00:23:45 +05:30
Kavish Devar
802c2e0220 linux: fix app name 2025-09-03 13:48:57 +05:30
Kavish Devar
f547cc13c0 linux: fix conversational awareness check for phone MAC 2025-09-03 03:28:59 +05:30
TCH
11fa9180e2 CI: add linux ci (#196) 2025-09-03 03:23:15 +05:30
Kavish Devar
73e55a02d6 add instructions for windows for prox keys script 2025-09-03 03:21:41 +05:30
Kavish Devar
325ef1e953 add cross-platform tool for retrieving proxmity key 2025-09-03 03:17:25 +05:30
qlenlen
5e30531514 i18n: add chinese translation (#200) 2025-09-03 03:01:23 +05:30
Kavish Devar
75fa80c17e android,linux: fix random volume jumps (#192)
* android: update feature flags packet data byte to remove adaptive volume
* linux: update feature flags to prevent volume jumps
2025-08-25 21:25:29 +05:30
TCH
eb1b633aff [Linux] Let users edit Phone bluetooth MAC via GUI (#195)
initial commit
2025-08-25 17:45:36 +02:00
Naveen M K
dde5d1e808 linux: update rename function call for airPods (#191)
previously it was failing with an error that renameAirPods is not a function
This should fix that as the function is defined in airPodsTrayApp
2025-08-25 17:55:06 +05:30
TCH
598bd3d7d8 linux: update logging tag (#194)
change linux logs name to librepods
2025-08-25 17:50:29 +05:30
Kavish Devar
46071f17d7 android: remove broken volume panel hook
Removed volume panel hooking logic and related classes.
2025-08-25 17:41:53 +05:30
Kavish Devar
13ab2d1feb docs: add more control commands ('25)
auto-pause when sleeping, system siri message, set recv raw gestures, 2 eq settings, in-case tone volume, allow auto-connect, disable button input
2025-08-14 10:33:52 +05:30
Raspberrynani
72a7637863 linux: fixed build instructions for ubuntu (#183)
Fixed build instructions

Ubuntu/Debian should use libssl-dev as libssl-devel does not exist
2025-07-15 17:30:30 +05:30
Kavish Devar
24686da1f3 android: add ability to launch digital assistant on long press (#180)
* Initial plan

* Implement BLE-only mode toggle and basic functionality

Co-authored-by: kavishdevar <46088622+kavishdevar@users.noreply.github.com>

* Fix BLE-only mode compatibility issues and enhance MAC address handling

Co-authored-by: kavishdevar <46088622+kavishdevar@users.noreply.github.com>

* Address BLE-only mode feedback: hide renaming, add ear detection warning, ensure default is false

Co-authored-by: kavishdevar <46088622+kavishdevar@users.noreply.github.com>

* android: add support for invoking digital assistant on long press

---------

Co-authored-by: copilot-swe-agent[bot] <198982749+Copilot@users.noreply.github.com>
2025-07-13 19:51:37 +05:30
Copilot
d9359cd81a android: add option for alternate head tracking packets (#176)
* Initial plan

* Add option for alternate head tracking packets

Co-authored-by: kavishdevar <46088622+kavishdevar@users.noreply.github.com>

---------

Co-authored-by: copilot-swe-agent[bot] <198982749+Copilot@users.noreply.github.com>
Co-authored-by: kavishdevar <46088622+kavishdevar@users.noreply.github.com>
2025-07-11 10:11:55 +05:30
Mario Borna Mjertan
db563fa75f Fixes and improvements to the Linux readme (#168)
* Add qt development header list for Fedora

* Add openssl development header dependency to Linux readme

* PHONE_MAC_ADDRESS is now an environment variable, not a main.h constant

* The build target is librepods, not applinux
2025-07-05 00:15:21 +05:30
Tim Gromeyer
fb3c8c73a4 [Linux] Start/Stop BLE scan when going to sleep 2025-06-24 13:30:46 +02:00
Tim Gromeyer
05c0a7c88b [Linux] Rename to Librepods 2025-06-16 11:46:50 +02:00
Tim Gromeyer
96ee2410e8 [Linux] Autostart im hidden mode 2025-06-15 12:03:23 +02:00
Tim Gromeyer
c0d915666b [Linux] Remember battery state (closes #149) 2025-06-09 10:54:02 +02:00
Tim Gromeyer
91ffaaa972 [Linux] DBus fixes 2025-06-08 22:06:58 +02:00
Tim Gromeyer
48ae249405 [Linux] Don't use playerctl for current media state 2025-06-08 18:47:47 +02:00
Tim Gromeyer
aaf82c9738 [Linux] Play/Pause via DBus 2025-06-08 18:47:47 +02:00
Tim Gromeyer
38d6f8ceae [Linux] Use DBus for following media playback change 2025-06-08 18:47:47 +02:00
Tim Gromeyer
5754dbfb16 [Linux] New ear detection implementation (#145)
* New ear detection implementation

* [Linux] Improved case battery detection when not connected
2025-06-07 09:19:14 +02:00
Kavish Devar
3b20540c34 android: fix duplicate screenshot in readme 2025-06-05 18:25:43 +05:30
Kavish Devar
595797c703 android: hook libbluetooth_qti.so too 2025-06-05 18:03:09 +05:30
Tim Gromeyer
2e782ba051 [Linux] Fix noise control mode cycling 2025-06-05 10:43:50 +02:00
Tim Gromeyer
3023c706bf [Linux] Fix Adaptive mode not working 2025-06-05 10:43:50 +02:00
Kavish Devar
0d582d890b android: add irk and encryption key from a qr 2025-06-05 13:13:49 +05:30
Tim Gromeyer
9b907fdec4 [Linux] Fix battery sometimes showing 127% (#143) 2025-06-05 09:16:04 +02:00
Tim Gromeyer
43d703423a [Linux] Add Qr-Code to sync irk and enc key (#142) 2025-06-05 09:03:29 +02:00
Kavish Devar
dcb25e2e52 [ImgBot] Optimize images 2025-06-04 17:15:18 +05:30
ImgBotApp
31397f055e [ImgBot] Optimize images
*Total -- 1,009.27kb -> 800.74kb (20.66%)

/imgs/banner.png -- 266.07kb -> 199.11kb (25.17%)
/android/imgs/debug.png -- 174.22kb -> 131.86kb (24.31%)
/android/imgs/customizations-2.png -- 211.58kb -> 162.48kb (23.2%)
/android/imgs/customizations-1.png -- 209.27kb -> 162.84kb (22.19%)
/android/app/src/main/res/drawable/pro_2_right.png -- 36.47kb -> 34.80kb (4.58%)
/android/app/src/main/res/drawable/pro_2_left.png -- 34.88kb -> 33.36kb (4.38%)
/linux/assets/airpods.png -- 76.78kb -> 76.30kb (0.63%)

Signed-off-by: ImgBotApp <ImgBotHelp@gmail.com>
2025-06-04 11:34:04 +00:00
Tim Gromeyer
070713540a [Linux] Fix build 2025-06-04 13:32:53 +02:00
Tim Gromeyer
6574e52195 [Linux] Compress images 2025-06-04 13:32:53 +02:00
Tim Gromeyer
c4633d6871 [Linux] Read AirPods state from BLE broadcast when not connected (#138)
* Fix possible build error

* [Linux] Read AirPods state from BLE broadcast when not connected

* SImplify

* Remove old code

* Remove old code

* Maintain charging state when state is unknown

* Simplify

* Remove unused var
2025-06-04 13:10:55 +02:00
Kavish Devar
5dc7e512ae update readme 2025-06-03 20:35:29 +05:30
Kavish Devar
b8e9765aff merge linux changes with local 2025-06-03 20:12:47 +05:30
Kavish Devar
62aabe80c1 android: add support for settings hook on A16 2025-06-03 20:12:25 +05:30
Kavish Devar
dc0b06a369 android: remove volume panel hook
I've moved away from AOSP and I can't maintain the hook for pixel/AOSP ROMs
2025-06-03 20:11:08 +05:30
Kavish Devar
96baebee28 Update name in linux README 2025-06-03 14:22:57 +05:30
Tim Gromeyer
c05a37bcca [Linux] Fix UI not working (#137)
* Move mac adress to deviceinfo

* Missing changes
2025-06-03 10:31:19 +02:00
Tim Gromeyer
8a69dbe173 [Linux] Move all device related properties to new class (#135)
* Clean up code

* Move all device releated properties to new class
2025-06-03 09:07:30 +02:00
Kavish Devar
b783b86b7a android: add update config for root module 2025-05-30 17:33:47 +05:30
Kavish Devar
445c999208 android: start head gestures after auto-connect 2025-05-30 17:30:30 +05:30
Kavish Devar
96e63cf35e android: fix head gestures not working 2025-05-21 21:52:41 +05:30
Kavish Devar
5472e09293 android: fix island not closing 2025-05-20 22:31:53 +05:30
Kavish Devar
e852182b48 android: use encrypted data from BLE broadcast for accurate battery levels when not connected over AACP 2025-05-20 14:52:05 +05:30
Kavish Devar
5eb13ace0c android: improve ble-based autoconnection 2025-05-20 09:54:18 +05:30
Kavish Devar
2b1fb5b71e android: use broadcasted battery data if not connected via l2cap for popup 2025-05-19 18:26:44 +05:30
Kavish Devar
c95a619465 android: bump version 2025-05-19 17:39:55 +05:30
Kavish Devar
c4bc47c48a merge the a11 fix with local 2025-05-19 17:28:30 +05:30
Kavish Devar
6a026ebab0 android: refactor AACP and add autoconnect based on BLE broadcasts 2025-05-19 17:24:41 +05:30
Kavish Devar
f3ed3bbc70 [Linux] Add One Bud ANC Mode setting (#128) 2025-05-16 18:10:20 +05:30
Tim Gromeyer
5fe123f544 [Linux] Add One Bud ANC Mode setting 2025-05-16 14:08:42 +02:00
Tim Gromeyer
09e1aa1530 [Linux] Reset tray icon when airpods disconnect 2025-05-16 14:08:20 +02:00
Kavish Devar
fd917d3fd0 [Linux] Add more control commands (#127) 2025-05-16 16:51:09 +05:30
Tim Gromeyer
84891a0bdf Remove VoiceTrigger and InCaseTone 2025-05-16 12:10:40 +02:00
Tim Gromeyer
4b3cc92e56 Make the copilot reviewer happy 2025-05-16 08:41:29 +02:00
Kavish Devar
b89d6d9dc2 android: fix support for A11 and lower 2025-05-16 04:46:25 +00:00
Kavish Devar
6985aa4a7b fix typo in AAP docs 2025-05-15 22:54:12 +05:30
Tim Gromeyer
9161f8b294 [Linux] Add more control commands (4c0381968f) 2025-05-15 12:00:01 +02:00
Kavish Devar
4c0381968f docs: create control_commands.md 2025-05-15 02:16:02 +05:30
Kavish Devar
69439257ce android: bump version 2025-05-12 17:16:47 +05:30
Kavish Devar
810a3c90e4 android: add troubleshooter for easier log access 2025-05-12 16:50:26 +05:30
Kavish Devar
0611509782 android: fix the socket error notification showing up even when it connection suceeds 2025-05-11 21:04:42 +05:30
Kavish Devar
116f7dda92 android: separated actual battery notifications from persistent service notif; better error handling when socket isn't connected 2025-05-11 20:42:54 +05:30
Kavish Devar
51ca4c12d1 android: add app description 2025-05-11 20:41:34 +05:30
Kavish Devar
8e670c2481 android: fix last commit; update copyright notice to "LibrePods Contributors" 2025-05-11 19:59:56 +05:30
Kavish Devar
aec9c7192e android: make customizations screen and head tracking screen scrollable 2025-05-11 19:46:43 +05:30
Kavish Devar
01432ce9c7 andoid: add option to not disconnect airpods when none are worn 2025-05-11 19:40:57 +05:30
Kavish Devar
9baa3c9b60 android: update haze uses 2025-05-11 19:38:55 +05:30
Kavish Devar
364a6f4b64 android: fix ear detection when none are in use and either or both are worn
Music would start playing when neither are in ear, but even one is worn. This happens even when the music was not playing when they were removed (or, connected first)
2025-05-11 18:52:33 +05:30
Kavish Devar
9b96218fa9 android: fix mediacontroller fallback volume for conversational awareness 2025-05-10 08:15:00 +05:30
Kavish Devar
98aef13395 android: add sharedpreference listeners to service 2025-05-10 08:13:56 +05:30
Kavish Devar
42e0f48b8b android: fix sharedpreference listener for conversational awareness customizations 2025-05-10 07:55:14 +05:30
Kavish Devar
4c73200f35 android: improve conversational awareness (fixes #122) 2025-05-09 22:37:39 +05:30
Kavish Devar
06de276dca android: initialize shared pref keys on first launch 2025-05-09 22:37:03 +05:30
Kavish Devar
7ffcd68ad9 android: listen for battery in the connected popup window (fix #117) 2025-05-09 09:47:54 +05:30
Kavish Devar
295c49fdc6 android: listen for airpods connection in UI (fix #118) 2025-05-09 09:41:26 +05:30
Kavish Devar
b95962d722 android: rephrase text when requesting permissions 2025-05-09 09:19:02 +05:30
Kavish Devar
45ed8a3a88 android: listen for intents to set anc mode 2025-05-09 08:56:10 +05:30
Kavish Devar
d381adaa09 Merge remote-tracking branch 'refs/remotes/origin/main' 2025-05-08 23:51:03 +05:30
Kavish Devar
58dfed97b3 android: fix the xposed module
skip unecessary parsing the argument for debugging, just return true and hope that it works
2025-05-08 23:50:30 +05:30
Kavish Devar
48e2899564 [Linux] Use Qt 6.4 for compatibility with Debian Stable (#116) 2025-05-04 07:28:28 +05:30
E. S
7f7b439746 linux: Add Debian requirements to the README 2025-05-04 01:20:06 +03:00
E. S
0b4030dd9f linux: Use Qt 6.4 to support Debian 12 2025-05-04 01:18:17 +03:00
Kavish Devar
91675de891 update linux section in readme 2025-05-03 21:58:56 +05:30
Kavish Devar
53433809aa update readme 2025-05-03 21:48:27 +05:30
Kavish Devar
2bd0a3a20c a few small changes 2025-05-03 21:44:45 +05:30
Kavish Devar
7eafb7f013 Merge pull request #111 from jazzysoggy/main
[Linux] Add seperators to tray, add tray option to reopen app and settings, prevent duplicate instances of app from being opened
2025-04-30 07:27:13 +05:30
Tim Gromeyer
96e7a81e46 [Linux] Dynamically find device sink name (#108)
* [Linux] Dynamically find device sink name

* Logging

* WIP

* List cards instead
2025-04-25 19:49:36 +02:00
Henry Cheng
a8f87f37f6 Proper handling of direct kill 2025-04-24 20:04:27 -04:00
Henry Cheng
6376240ce0 Add environmental variable check for phone MAC Address 2025-04-24 19:51:29 -04:00
Henry Cheng
a51efe35dc [Linux] Add reopen to tray options, enhance app tray, add ability to detect duplicate app instances, prevent duplicate app instances, and allow for original instance to be brought to front using the sockets 2025-04-24 19:16:24 -04:00
Tim Gromeyer
1571c6d300 Rewrite Linux section in README 2025-04-24 12:14:44 +02:00
Tim Gromeyer
924efc4faa Delete linux.old directory 2025-04-24 12:14:44 +02:00
Kavish Devar
893bcc97bc fix name in Linux readme 2025-04-24 15:38:19 +05:30
jdholtz
c320b4e27d [Linux] Add CLI flag to hide the window on startup
I like to start this program when connecting to my AirPods and it isn't
necessary for me to have the window pop up. Therefore, using the --hide
flag when starting the program will hide the window on startup.

This could also be a configuration option (e.g. 'Start minimized') but I
went with the CLI flag for simplicity for now. However, if this is a
more viable option (and it may be better in the future), I can implement
this as an option in the settings instead.
2025-04-23 22:46:47 +02:00
Tim Gromeyer
ed0de4d9fa [Linux] Make settings page scrollable 2025-04-22 15:11:30 +02:00
Tim Gromeyer
db763d7290 [Linux] Add setting to change bluetooth retry attempts 2025-04-22 15:11:30 +02:00
Tim Gromeyer
913e1a5aff [Linux] Add setting to disable notifications 2025-04-22 15:11:30 +02:00
Tim Gromeyer
ec1b0c47ca [Linux] Add autostart setting 2025-04-22 15:11:30 +02:00
Tim Gromeyer
1c7bdf987c [Linux] Add cross device setting 2025-04-22 15:11:30 +02:00
Tim Gromeyer
816992fd8a [Linux] Add ear detection behavior setting 2025-04-22 15:11:30 +02:00
Tim Gromeyer
3aeff4d986 [Linux] Add settings page (empty) 2025-04-22 15:11:30 +02:00
Kavish Devar
eacd862ef3 add FUNDING.yml
thought i already added it, apparently not ig
2025-04-22 08:23:31 +05:30
Tim Gromeyer
0846c3eb48 [Linux] Allow setting ear detection behaviour 2025-04-18 18:08:02 +02:00
Tim Gromeyer
c2db0afdf1 [Linux] Activate AirPods as output device when connecting 2025-04-18 18:08:02 +02:00
Tim Gromeyer
f75419748b Remove unused code 2025-04-17 13:05:24 +02:00
Tim Gromeyer
2bb2b0e697 [Linux] Add disconnected indicator 2025-04-17 13:05:24 +02:00
Tim Gromeyer
22e511acf2 [Linux] Battery indicator: automatic color adjustment 2025-04-17 13:05:24 +02:00
Tim Gromeyer
6ad36560a8 Split into multible files (dedup code) 2025-04-17 13:05:24 +02:00
Tim Gromeyer
2fe9724da5 [Linux] Improve connection stability (#98) 2025-04-17 08:30:31 +02:00
Kavish Devar
114c2c7210 Add metadata and BLE doc (#96)
Merge pull request #96 from tim-gromeyer/documentation
2025-04-17 07:52:24 +05:30
Kavish Devar
fa63b9a774 linux: improve disconnection behaviour (#97)
Merge pull request #97 from tim-gromeyer/linux-disconnect-behaviour
2025-04-16 14:27:22 +05:30
Tim Gromeyer
c94295ae1c Reset GUI when airpods disconnect, show notification 2025-04-15 19:55:40 +02:00
Tim Gromeyer
ecab6a9858 [Linux] Pause music when airpods disconnect 2025-04-15 19:37:39 +02:00
Tim Gromeyer
e3a7624d3e Add metadata parsing documentation 2025-04-15 10:41:02 +02:00
Tim Gromeyer
5182befac6 Add documentation for Conversational Awareness state packet format 2025-04-15 10:21:13 +02:00
Tim Gromeyer
7a8b41dfa0 Add Proximity Pairing Message documentation 2025-04-15 09:47:08 +02:00
Tim Gromeyer
e384840bcc [Linux] Implement proper disconnection detection (#95)
* [Linux] Implement proper disconection detection

* Only trigger on airpod devices

* Remove unused code

* [Linux] Fix SegmentedControl text not shown in release build (but debug builds showed text)???
2025-04-14 23:25:02 +02:00
Tim Gromeyer
b1811770a3 [Linux] CA state parsing, robuster handshake, persistent window (#94)
* [Linux] Don't quit app when closing window

* Add magic pairing functionality

* BLE: Allow selecting text

* Parse CA state from airpods

* Add ability to disable cross-device

* More robust handshake/notification request
2025-04-14 12:58:55 +02:00
Kavish Devar
42f91c4c46 android: improve debugging 2025-04-08 08:38:09 +05:30
Kavish Devar
33ba7a2f2d android: ignore values that are unlikely to represent actual head data 2025-04-08 08:38:09 +05:30
Kavish Devar
a41c24a21c Change radare2 download URL to GitHub releases
Merge pull request #93 from kavishdevar/move-radare2-from-hetzner-to-github-releases
2025-04-07 15:19:21 +05:30
Paul
acaf6f2edb Change radare2 download URL to GitHub releases
Was stored on Hetzner beforehand which is not future-proof.
2025-04-07 10:37:57 +02:00
Tim Gromeyer
e0624ce084 [Linux] Use segment control for setting noise control mode (#92)
* [Linux] Enhance GUI with icons

* Improve visibility

* Smarter hiding of battery values

* Add simple opacity based ear detection indication

* Hide disconnected devices

* Add airpods 3 icon

* Support more devices

* Better icons

* Add documentation

* Add segmented control

* Support keyboard navigation

* Fix ear detection when primary pod changes

* Support up to 9 modes with the keyboard

* Redisign

* Use id

* Use correct images

* Remove duplicates

* Use correct image

* Remove more merge conflicts

* Remove unused code

* Remove unused code

* Make all text readbale
2025-04-04 09:40:32 +02:00
Kavish Devar
fb3f948250 Merge pull request #91 from kavishdevar/imgbot
[ImgBot] Optimize images
2025-04-01 08:28:44 +05:45
ImgBotApp
1c745c8e08 [ImgBot] Optimize images
*Total -- 1,568.48kb -> 1,396.36kb (10.97%)

/android/imgs/notification-and-qs.png -- 558.78kb -> 457.84kb (18.07%)
/android/imgs/head-tracking-and-gestures.png -- 155.67kb -> 131.06kb (15.81%)
/linux/assets/pod3.png -- 854.02kb -> 807.46kb (5.45%)

Signed-off-by: ImgBotApp <ImgBotHelp@gmail.com>
2025-03-31 20:58:46 +00:00
Tim Gromeyer
e3dab8feb2 [Linux] Enhance GUI with icons (#90)
* [Linux] Enhance GUI with icons

* Improve visibility

* Smarter hiding of battery values

* Add simple opacity based ear detection indication

* Hide disconnected devices

* Add airpods 3 icon

* Support more devices

* Better icons

* Add documentation
2025-03-31 22:57:12 +02:00
Tim Gromeyer
4e72f6573e [Linux] Add battery indicator (#89)
* [Linux] Expose battery info to QML

* [Linux] Add battery indicator

* [Linux] Dynamically hide case battery level if we have no data for it

* Reduce animation speed
2025-03-30 12:00:13 +02:00
Tim Gromeyer
543362da69 [Linux] Implement renaming airpods (#88)
* [Linux] Implement rename airpods

* [Linux] Get airpods name from airpods metadata

* [Linux] Rename AirPods: Ui improvements

---------

Co-authored-by: Tim Gromeyer <tim.gromeyer@trans4mation.de>
2025-03-28 07:04:17 +01:00
Kavish Devar
5a71d9630d CI: update CI to better format custom update messages 2025-03-27 11:11:25 +05:30
Kavish Devar
09daaaedb2 Merge pull request #85 from tim-gromeyer/linux-adaptive-noise-level
[Linux] Implement adaptive audio noise
2025-03-27 10:59:02 +05:30
Kavish Devar
3b1e91bf05 Merge pull request #86 from tim-gromeyer/linux-detect-primary
[Linux] Detect which pod is the primary
2025-03-27 10:58:06 +05:30
Kavish Devar
d79ce0237d Merge pull request #87 from tim-gromeyer/linux-bug-fixes
[Linux] Fix noise control switches multiple times
2025-03-27 10:57:55 +05:30
Kavish Devar
1cf84bb4a5 CI: add custom update messages when manually run 2025-03-27 10:55:39 +05:30
Kavish Devar
05ff64f4b2 android: improve hooking
set desired flow control mode to basic because for android checking once isn't enough. even after calling l2c_fcr_chk_chan, it again compares the desired and the peer's supported channel modes.
2025-03-27 10:54:12 +05:30
Tim Gromeyer
96c5bd089f [Linux] Fix noise controll switches multiple times 2025-03-26 21:55:43 +01:00
Kavish Devar
0a13ba263b android: add a few instructions to the xposed-based onboarding 2025-03-27 00:35:00 +05:30
Kavish Devar
a206e04ba2 android [experimental]: add xposed based hooking 2025-03-27 00:01:53 +05:30
Kavish Devar
13340485b1 remove tests 2025-03-27 00:01:53 +05:30
Kavish Devar
0463b7901b "clean up" ai comments - will redocument later 2025-03-27 00:01:53 +05:30
Tim Gromeyer
55ba67190d [Linux] Implement adaptive audio noice 2025-03-26 15:06:45 +01:00
Tim Gromeyer
ce3c12f3b2 [Linux] Detect which pod is the primary 2025-03-26 14:59:56 +01:00
Kavish Devar
d004d12bb1 Merge pull request #84 from tim-gromeyer/linux-battery-class
[Linux] Add Battery Class and Fix Battery Level Assignment
2025-03-26 16:17:15 +05:30
Tim Gromeyer
53960417b6 Add battery class 2025-03-25 22:11:43 +01:00
Tim Gromeyer
a6dbbd4f0c Simple code cleanup 2025-03-25 21:33:31 +01:00
Kavish Devar
9ee0f733bc Merge pull request #80 from tim-gromeyer/linux-ble-monitor-app
[Linux] BLE monitor app
2025-03-24 20:26:56 +05:30
Tim Gromeyer
4d07cf4c16 Improved lid state detection 2025-03-24 08:29:18 +01:00
Tim Gromeyer
c74054cc98 Fix charging states 2025-03-23 22:15:52 +01:00
Tim Gromeyer
033e0be08d Fix case battery level 2025-03-23 22:15:40 +01:00
Tim Gromeyer
06f7b6bdb8 Add connection state 2025-03-23 21:49:27 +01:00
Kavish Devar
d5a96f8f5e [CI] Download radare2 module
Merge pull request #83 from tim-gromeyer/patch-1
2025-03-24 01:34:48 +05:30
Tim Gromeyer
654e4adad6 [CI] Download radare2 module 2025-03-23 21:00:46 +01:00
Kavish Devar
51f5a66a0e android: add other function signatures for newer updates of android 2025-03-24 01:28:52 +05:30
Kavish Devar
cd5b69e78c remove the huge precompiled radare2; download it when building module 2025-03-20 09:01:21 +05:30
Kavish Devar
254e6c1fb4 remove backup font file 2025-03-20 08:48:39 +05:30
Kavish Devar
d49a5df2e2 android: fix the font issue introduced when switching to a smaller font file 2025-03-20 08:47:12 +05:30
Kavish Devar
1cc09e203a remove ai’s incorrect stuff 2025-03-19 08:30:45 +05:30
Kavish Devar
ff3c33d1b2 android:add packet parsing to debug screen 2025-03-18 09:58:18 +05:30
Kavish Devar
256a42f2d2 fix link to linux folder 2025-03-18 09:43:01 +05:30
Kavish Devar
705354430a android: remove build files 2025-03-18 09:20:32 +05:30
Kavish Devar
bc8b1cc2b7 merge notification and qs tile screenshot 2025-03-18 09:18:34 +05:30
Kavish Devar
b6d18132fa add head tracking/gestures screenshot 2025-03-18 09:12:50 +05:30
Kavish Devar
446fde56d7 update head tracking readme 2025-03-18 07:10:09 +05:30
Kavish Devar
1babdad9a2 android: prevent a crash 2025-03-18 07:10:09 +05:30
Kavish Devar
6e95d2fea3 android: update transitions 2025-03-18 07:10:09 +05:30
Kavish Devar
56be361829 upload cd demo to github's cdn instead of the repo 2025-03-18 06:20:32 +05:30
Kavish Devar
753f012d89 start head tracking for the first 5 seconds to calibrate 2025-03-17 14:30:44 +05:30
Tim Gromeyer
cb625d0889 Remove old devices 2025-03-15 11:46:50 +01:00
Tim Gromeyer
9e40e6e3fd Show more info 2025-03-15 11:21:11 +01:00
Tim Gromeyer
5b5a62f156 Update 2025-03-14 22:39:21 +01:00
Tim Gromeyer
a6eb62bb77 Add more colors 2025-03-14 21:43:56 +01:00
Tim Gromeyer
4bb19a87c5 Fix device model bytes switched 2025-03-14 20:31:21 +01:00
Tim Gromeyer
2e52eb3d7d Fix AirPods model id 2025-03-14 20:22:57 +01:00
Kavish Devar
be629c16ab Update README.md 2025-03-14 17:40:34 +05:30
Kavish Devar
28b0eac8a9 Merge remote-tracking branch 'refs/remotes/origin/main' 2025-03-14 17:33:47 +05:30
Kavish Devar
22d5ae60b6 android+linux: add head tracking and gestures 2025-03-14 17:32:47 +05:30
Kavish Devar
84b548af14 [Linux] Simplify code, implement tray manager (#81)
Merge pull request #81 from tim-gromeyer/linux-simplify-code
2025-03-10 23:21:29 +05:30
Tim Gromeyer
1946857ca5 [Linux] Simplify code, implement tray manager
Implement tray manager

Bug fixes

Bug fixes
2025-03-10 18:09:06 +01:00
Tim Gromeyer
6fa8b5d611 [Linux] ble - fix charging state was inverted 2025-03-09 20:38:44 +01:00
Kavish Devar
e72b4a116e Merge pull request #79 from tim-gromeyer/organize-mediacontroller
[Linux] Organize code, implement media controller
2025-03-09 16:54:13 +05:30
Tim Gromeyer
4438cdae6f [Linux] BLE monitor app 2025-03-09 11:13:21 +01:00
Tim Gromeyer
7522292c8b [Linux] Organize code, implement media controller 2025-03-08 22:09:13 +01:00
Kavish Devar
1583f35a1e [Linux] Move bt package definitions to extra file
Merge pull request #77 from tim-gromeyer/packet-definitions
2025-03-06 10:27:30 +05:30
Tim Gromeyer
adfa11c660 Move bt package definitions to extra file 2025-03-04 21:55:03 +01:00
Kavish Devar
55d06d2f65 linux: fix the merge 2025-02-28 10:12:10 +05:30
Kavish Devar
96170fc9ce Merge pull request #64 from jay-tau/imgbot
[ImgBot] Optimize images
2025-02-17 00:46:36 +05:30
Kavish Devar
16586981a7 Merge pull request #51 from jay-tau/update-gitignore
feat: Better gitignore
2025-02-14 23:40:00 +05:30
Kavish Devar
ac053a99b9 Merge branch 'main' into update-gitignore 2025-02-14 23:38:55 +05:30
Kavish Devar
d9bf99de8b Merge pull request #53 from jay-tau/linux-readme
feat(linux): init README for Linux
2025-02-14 23:36:08 +05:30
Kavish Devar
9107a43c39 suggestions in android studio -_- 2025-02-10 09:31:10 +05:30
Kavish Devar
6940f9c9e3 fix imports for the last change 2025-02-09 23:00:08 +05:30
Kavish Devar
5908683540 Merge remote-tracking branch 'refs/remotes/origin/main' 2025-02-09 22:46:15 +05:30
Kavish Devar
918f6cfe6c implement #57 2025-02-09 22:43:48 +05:30
Kavish Devar
9ab6a20de2 Merge pull request #56 from kavishdevar/android-remove-ble-stuff
android: remove unused ble broadcast stuff
2025-02-05 21:09:07 +05:30
Kavish Devar
1d3dff175f android: remove unused ble broadcast stuff 2025-02-05 21:08:31 +05:30
Kavish Devar
f5df7e2bd3 add manual root module to gitignore 2025-02-04 17:09:28 +05:30
Kavish Devar
6bfbe0904a Merge pull request #47 from tim-gromeyer/linux-noise-cotrol-enum
[Linux] Use a enum to control the noise control mode
2025-02-02 20:01:04 +05:30
Tim Gromeyer
c493a5b29f [Linux] Use enum to represnet noise control mode 2025-02-02 11:38:29 +01:00
Joel Tony
f11680aaad feat(linux): add README for AirPods Linux Native application with setup and usage instructions 2025-02-02 02:05:53 -07:00
Joel Tony
951180251e feat: update .gitignore to include additional patterns for various IDEs and languages 2025-02-02 01:34:24 -07:00
ImgBotApp
f074462489 [ImgBot] Optimize images
*Total -- 8,888.17kb -> 7,319.00kb (17.65%)

/linux.old/imgs/daemon-log.png -- 648.49kb -> 401.67kb (38.06%)
/android/app/src/main/res/drawable/adaptive.png -- 6.49kb -> 4.16kb (35.94%)
/android/app/src/main/res/drawable/transparency.png -- 13.36kb -> 9.00kb (32.59%)
/android/imgs/long-press.png -- 86.66kb -> 60.00kb (30.76%)
/android/app/src/main/res/drawable/noise_cancellation.png -- 12.20kb -> 8.48kb (30.54%)
/linux.old/imgs/tray-icon-menu.png -- 26.32kb -> 18.62kb (29.23%)
/android/imgs/popup.png -- 1,702.28kb -> 1,223.98kb (28.1%)
/android/imgs/qstile.png -- 225.58kb -> 168.59kb (25.26%)
/android/imgs/settings-2.png -- 200.20kb -> 153.60kb (23.27%)
/android/app/src/main/res/drawable/pro_2.png -- 81.83kb -> 63.39kb (22.53%)
/head-tracking/Extracted Data/1 - 13 to 16.png -- 67.26kb -> 52.79kb (21.51%)
/head-tracking/Extracted Data/1 - 33 to 36.png -- 43.47kb -> 34.22kb (21.28%)
/android/imgs/customizations.png -- 85.53kb -> 68.31kb (20.14%)
/linux.old/icon.png -- 752.47kb -> 604.81kb (19.62%)
/android/app/src/main/res/drawable/pro_2_buds.png -- 752.47kb -> 604.81kb (19.62%)
/android/imgs/settings-1.png -- 212.21kb -> 172.09kb (18.91%)
/head-tracking/Extracted Data/1 - 41 to 44.png -- 55.37kb -> 45.25kb (18.27%)
/linux.old/imgs/read-data.png -- 329.61kb -> 283.91kb (13.86%)
/linux.old/imgs/tray-icon-hover.png -- 12.87kb -> 11.15kb (13.37%)
/android/imgs/debug.png -- 95.95kb -> 83.59kb (12.88%)
/linux.old/imgs/ear-detection.png -- 216.06kb -> 189.74kb (12.18%)
/head-tracking/Extracted Data/1 - 5 to 8.png -- 96.45kb -> 84.82kb (12.06%)
/head-tracking/Extracted Data/1 - 29 to 32.png -- 191.07kb -> 168.13kb (12.01%)
/head-tracking/Extracted Data/1 - 17 to 20.png -- 131.15kb -> 115.45kb (11.97%)
/head-tracking/Extracted Data/1 - 9 to 12.png -- 110.16kb -> 97.15kb (11.81%)
/head-tracking/Extracted Data/1 - 1 to 4.png -- 104.38kb -> 93.01kb (10.89%)
/head-tracking/Extracted Data/1 - 21 to 24.png -- 164.50kb -> 146.61kb (10.88%)
/head-tracking/Extracted Data/1 - 25 to 28.png -- 109.33kb -> 97.44kb (10.87%)
/head-tracking/Extracted Data/1 - 37 to 40.png -- 171.62kb -> 155.91kb (9.16%)
/linux.old/imgs/set-anc.png -- 71.08kb -> 64.87kb (8.74%)
/android/imgs/notification.png -- 450.50kb -> 415.45kb (7.78%)
/android/app/src/main/res/drawable-nodpi/example_appwidget_preview.png -- 3.44kb -> 3.28kb (4.51%)
/android/imgs/widget.png -- 1,447.69kb -> 1,406.83kb (2.82%)
/android/imgs/audio-connected-island.png -- 69.71kb -> 68.89kb (1.17%)
/android/imgs/cd-connected-remotely-island.png -- 69.96kb -> 69.22kb (1.07%)
/android/imgs/cd-moved-to-phone-island.png -- 70.44kb -> 69.78kb (0.94%)

Signed-off-by: ImgBotApp <ImgBotHelp@gmail.com>
2025-02-02 08:31:45 +00:00
Kavish Devar
bda572823a request advertising permissions for crossdevice services on first launch
merge pull request #50 from kavishdevar/android-fix-advertise-permissions
2025-02-02 13:15:10 +05:30
Kavish Devar
2195be741c send only after user completed sliding
merge pull request #49 from kavishdevar/android-fix-tone-volume-slider-packets
2025-02-02 13:14:57 +05:30
Kavish Devar
471bf7ca3b send only after user completed sliding 2025-02-02 13:13:32 +05:30
Kavish Devar
8d6e8d7df7 request advertising permissions for crossdevice services on first launch 2025-02-02 13:12:22 +05:30
Kavish Devar
ed26c4fec5 Merge pull request #46 from tim-gromeyer/linux-airpods-battery-level
[Linux] Show correct battery level when 1 Airpod is disconnected
2025-02-02 10:32:09 +05:30
Tim Gromeyer
46d6cab930 [Linux] Show correct battery level when 1 Airpod is disconnected
It would show 0 previously
2025-02-01 12:47:50 +01:00
Kavish Devar
5efbfa7ab7 Merge pull request #45 from tim-gromeyer/ear-detection-status-in.case
[Linux] Add "in case" as ear detection status
2025-02-01 16:34:25 +05:30
Tim Gromeyer
6cb29e26d0 [Linux] Add "in case" as ear detection status 2025-02-01 11:59:09 +01:00
Kavish Devar
321a3bd3bf finally done with most of the crossdevice stuff! 2025-02-01 03:53:37 +05:30
Kavish Devar
5cee33a354 improve screenshots layout in cd 2025-01-31 03:58:08 +05:30
Kavish Devar
055db073da update video for transitions in android app 2025-01-31 03:55:37 +05:30
Kavish Devar
c7ef31cba6 add cross device stuff (screenshots) in readme 2025-01-31 03:37:02 +05:30
Kavish Devar
de53e840ed for @maxwofford! :) 2025-01-31 01:59:21 +05:30
Kavish Devar
c84195aec8 add info button for when remotely connected 2025-01-30 04:17:07 +05:30
Kavish Devar
43b98f7446 remove some local files 2025-01-30 03:51:32 +05:30
Kavish Devar
b6966f8c39 some progress on cross-device, and new dynamic island thingy! 2025-01-30 03:49:44 +05:30
Kavish Devar
8b57a97a54 Merge pull request #41 from devnoname120/remove-legacy-patchers
Remove legacy patchers
2025-01-28 14:53:23 +05:30
Kavish Devar
2d90898928 actually add the right video to the readme 2025-01-28 11:58:02 +05:30
Kavish Devar
5dc589c8ff add the right video to the readme 2025-01-28 11:53:39 +05:30
Kavish Devar
bbecb15f2e actually fix video in readme 2025-01-28 11:46:49 +05:30
Kavish Devar
3679c6acf6 fix video in readme 2025-01-28 11:38:36 +05:30
Kavish Devar
3f359e0315 bump version to android app 0.0.3 2025-01-28 11:28:28 +05:30
Kavish Devar
189f19ecb3 add transitions to readme 2025-01-28 11:23:32 +05:30
Kavish Devar
35da57f0a5 widgets! 2025-01-28 11:19:55 +05:30
Kavish Devar
ae188a72dc Merge pull request #42 from devnoname120/add-editorconfig-file
Add `.editorconfig` file
2025-01-27 19:23:58 +05:30
Kavish Devar
b607885fd8 Merge pull request #40 from devnoname120/patcher-module-remove-qti-support
Patcher module: abort for qti libraries
2025-01-27 19:22:29 +05:30
Kavish Devar
58b3ee47ed Merge pull request #39 from devnoname120/update-readme-with-on-device-patcher
README — Add instructions for on-device patcher
2025-01-27 19:22:13 +05:30
Kavish Devar
75fd974473 Merge pull request #38 from devnoname120/remove-curl-remains
Remove unused cURL that got reintroduced by error
2025-01-27 19:21:56 +05:30
Paul
b71471e1d5 Add .editorconfig file 2025-01-27 00:41:05 +01:00
Paul
40547919ce Remove legacy patchers 2025-01-27 00:38:16 +01:00
Paul
a5c65a324f Patcher module: abort for qti libraries 2025-01-27 00:28:35 +01:00
Paul
2f9fbdc70e README — Add instructions for on-device patcher 2025-01-27 00:12:19 +01:00
Paul
650a8d7e66 Remove unused cURL that got reintroduced by error 2025-01-26 23:57:51 +01:00
Kavish Devar
f67e5defcf add iOS style battery widget 2025-01-26 19:14:53 +05:30
Kavish Devar
66d7adf22c uhhh, idk how i added this file to git 2025-01-26 16:26:30 +05:30
Kavish Devar
c48c6238ed Merge pull request #36 from tim-gromeyer/fix-ui-text
Fix ui text
2025-01-26 02:01:50 +05:30
Kavish Devar
8d67f54e40 Merge pull request #34 from devnoname120/magisk-module-autopatcher
Add on-device patcher module for Magisk/KernelSU
2025-01-26 01:38:47 +05:30
Paul
ab67d7dc23 Add auto-update metadata to the patcher module 2025-01-25 14:58:32 +01:00
Paul
e1dc2c8925 Create on-device Bluetooth patcher module (arm64)
Tested and working on Android 15 QPR2 (library: `/apex/com.android.btservices/lib64/libbluetooth_jni.so`)
2025-01-25 14:58:32 +01:00
Paul
93838d2d10 Add static arm64 busybox 1.36.1 2025-01-25 14:57:00 +01:00
Paul
29acd203ae Add custom radare2 5.9.9 build for Android
https://github.com/devnoname120/radare2
2025-01-25 14:57:00 +01:00
Paul
e81ae32b1f Get rid of cURL 2025-01-25 14:57:00 +01:00
Kavish Devar
d01fe3938d move files across computers - again! 2025-01-25 13:55:55 +05:30
Kavish Devar
5d364a662c move files across computers 2025-01-25 03:12:23 +05:30
Kavish Devar
a6d7bd704a move files across computers 2025-01-25 00:00:43 +05:30
Tim Gromeyer
2e87a3d66f Fix ui text 2025-01-23 10:10:12 +01:00
Kavish Devar
938278b0b5 try to add cross device stuff 2025-01-21 21:29:16 +05:30
Kavish Devar
3a3074f592 work out the accessiblity settings packets 2025-01-20 20:18:24 +05:30
Kavish Devar
7a06f3055c try to add some cross-device stuff 2025-01-20 04:13:18 +05:30
Kavish Devar
7cac2b037f commit before letting the llm edit the code 2025-01-20 01:43:33 +05:30
Kavish Devar
4b3e1130e8 smth works :D 2025-01-17 04:28:58 +05:30
Kavish Devar
c9b04b24c0 fix typo 2025-01-17 04:14:40 +05:30
Kavish Devar
e1c6677753 add ui for accessibility settings 2025-01-17 03:20:34 +05:30
Kavish Devar
45d2cc302e try making an app; commiting for highseas 2025-01-17 03:20:16 +05:30
Kavish Devar
7bd17635e5 add even more libs for curl 2025-01-15 07:55:11 +05:30
Kavish Devar
39f0ae7106 add libs for curl for CI 2025-01-14 02:13:55 +05:30
Kavish Devar
dfc6dd611b remove issue templates 2025-01-14 02:12:22 +05:30
Kavish Devar
888f1b3616 add better logging to the root module installer 2025-01-14 01:49:03 +05:30
Kavish Devar
9a4d561f23 update link to module in readme 2025-01-14 01:43:58 +05:30
Kavish Devar
ba22d7c2a7 build root module in ci 2025-01-14 01:41:59 +05:30
Kavish Devar
d77142c9a3 remove libcurl-android folder after install 2025-01-14 01:28:16 +05:30
Kavish Devar
f265184abb clean up patching server 2025-01-14 01:23:23 +05:30
Kavish Devar
122e3d6c42 forgot to add zip 2025-01-14 01:01:17 +05:30
Kavish Devar
f6d96b6a09 finally done with the module, tested on my own device 2025-01-14 01:00:22 +05:30
Kavish Devar
d63a2ac632 updated AAP Definitions 2025-01-14 00:54:31 +05:30
Kavish Devar
6564314ce0 hopefully fixed 2025-01-13 15:27:20 +05:30
Kavish Devar
b8054b2189 try fixing the zip again 2025-01-13 09:57:32 +05:30
Kavish Devar
676c1329f3 update link to module in readme 2025-01-13 02:27:07 +05:30
Kavish Devar
6975d519cc forgot to add libraries for curl to gitignore 2025-01-13 02:21:28 +05:30
Kavish Devar
c3e5f9e9c0 why do i forget to fetch and pull everytime i use the web editor :( 2025-01-13 02:19:43 +05:30
Kavish Devar
75d348bc95 move back to server-based patching 2025-01-13 02:19:03 +05:30
Kavish Devar
c61b07d721 try radare2 for on-device patching 2025-01-13 01:46:51 +05:30
Kavish Devar
c93b5e2cdf update workaround instructions and feature list 2025-01-12 09:10:11 +05:30
Kavish Devar
2550aec66d add root module 2025-01-12 09:05:13 +05:30
Kavish Devar
4df1f6f1c5 fix broken symlinks in modules 2025-01-11 01:47:25 +05:30
Kavish Devar
ac2fcd384d fix module log message 2025-01-11 01:44:41 +05:30
Kavish Devar
6c6c6d9390 hopefully this works 2025-01-11 01:38:33 +05:30
Kavish Devar
6c43a69542 llms and depracations pt.2 2025-01-11 01:33:06 +05:30
Kavish Devar
c2ecc93d98 forgot ctrl+z existed 2025-01-11 01:28:36 +05:30
Kavish Devar
a51ac11b29 llms :( 2025-01-11 01:19:49 +05:30
Kavish Devar
57b377d436 llms and depracated stuff 2025-01-11 01:13:49 +05:30
Kavish Devar
a72cbf129f im soo stupid ;-; 2025-01-11 01:10:59 +05:30
Kavish Devar
d197a05a07 try to automate the patching process even further 2025-01-11 00:57:36 +05:30
Kavish Devar
ea403728e2 try to fix stupidity, again 2025-01-11 00:40:01 +05:30
Kavish Devar
383d8b2491 try to fix stupidity 2025-01-11 00:36:06 +05:30
Kavish Devar
f367392824 smth 2025-01-11 00:34:15 +05:30
Kavish Devar
f6ac82357f fix a few things in the patcher server 2025-01-11 00:16:16 +05:30
Kavish Devar
3461179389 add source code link in patcher web 2025-01-11 00:04:35 +05:30
Kavish Devar
a2019d7421 add api for patching 2025-01-10 23:54:06 +05:30
Kavish Devar
5c68e4fcec add support for qualcomm libraries and a README 2025-01-10 23:37:07 +05:30
Kavish Devar
d7b6353bcf add manual patching script and flask server 2025-01-10 21:32:57 +05:30
Kavish Devar
4ef74712b2 remove hook file 2025-01-10 10:59:48 +05:30
Kavish Devar
4c3d3e7286 add screenshot for customizations 2025-01-09 03:36:52 +05:30
Kavish Devar
19a286389b oops: forgot to change the starting screen back to normal 2025-01-09 03:27:57 +05:30
Kavish Devar
f5cc47b53c add an app settings page for customizing functions and un-hardcode strings 2025-01-09 03:25:32 +05:30
Kavish Devar
fc0475e2c0 add commit list to nightly release 2025-01-08 00:04:29 +05:30
Kavish Devar
5362108306 remove something that wasn't supposed to be herr 2025-01-07 23:58:27 +05:30
Kavish Devar
d3a7727fd3 Merge pull request #25 from kavishdevar/release-nightly
something happened
2025-01-07 23:24:56 +05:30
Kavish Devar
4426fe1f4f Merge branch 'main' into release-nightly 2025-01-07 23:23:38 +05:30
Kavish Devar
9838dbd921 fix for pre-tiramisu android versions 2025-01-07 23:22:41 +05:30
Kavish Devar
fda343ca39 fix for pre-tiramisu android versions 2025-01-07 23:22:16 +05:30
Kavish Devar
278dc44796 show airpods name in notification 2025-01-07 22:45:22 +05:30
Kavish Devar
c6863a8d2c Merge pull request #24 from kavishdevar/last-saved-battery
Show last saved battery in notification
2025-01-07 10:23:04 +05:30
Kavish Devar
039a43d15d Untitled
Update `AirPodsService.kt` and `BatteryWidget.kt` to retain and display the last received battery levels when the case or bud gets disconnected.

* **AirPodsService.kt**
  - Comment out the condition that sets battery levels to an empty string if the status is `BatteryStatus.DISCONNECTED`.

* **BatteryWidget.kt**
  - Comment out the condition that sets battery levels to an empty string if the status is `BatteryStatus.DISCONNECTED`.
2025-01-07 10:19:20 +05:30
Kavish Devar
5995c174e1 save name name whn not renamed 2025-01-07 01:34:10 +05:30
Kavish Devar
fad2681869 i'm stupid. fix device name being null when not renamed 2025-01-07 01:32:05 +05:30
Kavish Devar
ed726922af only show battery level if last sent by airpods and not set it to 0 2025-01-07 01:30:01 +05:30
Kavish Devar
5d9f91af6e merge #21 from devnoname120/improve-notification
improve notifications
2025-01-07 01:23:05 +05:30
Kavish Devar
96c4966bc2 Merge branch 'main' into improve-notification 2025-01-07 01:22:00 +05:30
Kavish Devar
5dbfe69ed4 center align title in debugscreen 2025-01-07 01:20:31 +05:30
Kavish Devar
fb4611677e try to add animations 2025-01-07 01:07:24 +05:30
Kavish Devar
af59b70537 do not show "off" option when off listening mode is disabled 2025-01-07 01:07:09 +05:30
Paul
bd473ee589 improve notification to hide L/R/C when missing 2025-01-06 20:17:46 +01:00
Paul
baacc9f1e2 fix service killed by Android battery saver
having an always-on/ongoing notification is required in order for Android not to kill it
2025-01-06 20:16:24 +01:00
Paul
416ae1e974 change service notif to AirPods not connected 2025-01-06 20:15:07 +01:00
Kavish Devar
2c2552a57e show last battery status when a pod or case is disconnected 2025-01-07 00:35:44 +05:30
Kavish Devar
7ed8f9b09c fix: when both airpods are not worn, the settings screen would say not connected 2025-01-06 22:22:15 +05:30
Kavish Devar
140ef0869b improve notification when connected 2025-01-06 22:04:39 +05:30
Kavish Devar
d4e45b221a remove spacing from project name 2025-01-06 18:55:20 +05:30
Kavish Devar
3b1f66370a Update Linux project status, and add QPR1 instructions 2025-01-06 16:05:15 +05:30
Kavish Devar
130b83c91a fetch service UUIDs before checking UUIDs of a bluetooth device when starting service 2025-01-06 14:26:13 +05:30
Kavish Devar
c941d0d320 make conversational awareness volume change smoother and improve media control by ear detection 2025-01-04 18:21:24 +05:30
Kavish Devar
bf1ebd01e4 fix bug where it would occasionally crash when connecting 2025-01-03 21:41:46 +05:30
Kavish Devar
2b577d7a49 fix release link for workaround files 2025-01-03 02:07:54 +05:30
Kavish Devar
66eaa985c8 improve media control logic 2025-01-03 02:05:20 +05:30
Kavish Devar
9fea483d51 bug fix :) 2024-12-30 23:29:45 +05:30
Kavish Devar
55aca982a1 change back license from GPL to AGPL 2024-12-30 20:40:40 +05:30
Kavish Devar
26303192e5 added battery widget screenshot 2024-12-24 03:49:23 +05:30
Kavish Devar
4ad653f064 added battery widget 2024-12-24 03:45:01 +05:30
Kavish Devar
8792e992da small ui changes 2024-12-16 19:03:29 +05:30
Kavish Devar
430e1d6c41 use relative values for lowering volume (conversational awarness) instead of absolute 2024-12-16 19:03:15 +05:30
Kavish Devar
7d3b80292b fix ci?? 2024-12-16 17:22:05 +05:30
Kavish Devar
f5032c5e8e fix ci?? 2024-12-16 17:17:08 +05:30
Kavish Devar
22700b897f maybe fix signing? 2024-12-16 17:05:32 +05:30
Kavish Devar
0f563a60d1 change from text input on workflow dispatch to checkbox 2024-12-16 16:58:48 +05:30
Kavish Devar
6774ca1bb5 add debug keystore for ci 2024-12-16 16:48:25 +05:30
Kavish Devar
5f8f1d2041 fix pathspec for uploading artifact 2024-12-16 16:39:03 +05:30
Kavish Devar
1155a7103d add ci 2024-12-16 16:32:14 +05:30
Kavish Devar
66c550bae5 add ci 2024-12-16 16:29:54 +05:30
Kavish Devar
34ace1fc6e try adding widget; add previews to each composable 2024-12-16 16:13:58 +05:30
Kavish Devar
ff6c72ffa6 fix xda link in readme 2024-12-13 01:43:55 +05:30
Kavish Devar
1f3cd50f11 add xdaforums thread link to readme 2024-12-13 01:42:36 +05:30
Kavish Devar
809818f60d split compose functions, and organize stuff 2024-12-13 01:41:37 +05:30
Kavish Devar
7b03a7e9f0 android: add long press settings to cycle between anc modes 2024-12-11 23:05:22 +05:30
Kavish Devar
95664ed4be smth 2024-12-10 12:51:33 +05:30
Kavish Devar
214c7ac1c9 Merge branch 'main' of github.com:kavishdevar/aln 2024-12-10 12:49:52 +05:30
Kavish Devar
255edc5b08 move files across computers 2024-12-10 12:49:16 +05:30
Kavish Devar
5dfd962ffa update AA(C)P status for tone volume and ANC with single airpod 2024-12-09 00:14:57 +05:30
Kavish Devar
f5c0a02291 move screenshots to the top 2024-12-09 00:10:53 +05:30
Kavish Devar
4d8841205b move packet definitions block from top to bottom in readme 2024-12-06 23:02:31 +05:30
Kavish Devar
1afc61513f change workaround's note from important to caution 2024-12-06 23:01:10 +05:30
Kavish Devar
3b4f887300 update readme 2024-12-06 22:57:51 +05:30
373 changed files with 41829 additions and 8259 deletions

20
.editorconfig Normal file
View File

@@ -0,0 +1,20 @@
# top-most EditorConfig file
root = true
# Unix-style newlines with a newline ending every file
[*]
charset = utf-8
indent_style = space
indent_size = 2
end_of_line = lf
trim_trailing_whitespace = true
insert_final_newline = true
[*.{md,apib}]
indent_size = 4
# In Markdown a trailing double space is interpreted as <br>
trim_trailing_whitespace = false
max_line_length = off
[*.{py,java,r,R,kt,xml,kts}]
indent_size = 4

View File

@@ -1,31 +0,0 @@
---
name: Bug report
about: Create a report to help us improve
title: ''
labels: ''
assignees: ''
---
**Describe the bug**
A clear and concise description of what the bug is.
**To Reproduce**
Steps to reproduce the behavior:
1. Go to '...'
2. Click on '....'
3. Scroll down to '....'
4. See error
**Expected behavior**
A clear and concise description of what you expected to happen.
**Screenshots**
If applicable, add screenshots to help explain your problem.
**Desktop (please complete the following information):**
- Distro: [e.g. Ubuntu, KDE Neon, Arch]
- Version [e.g. 22.04]
**Additional context**
Add any other context about the problem here.

View File

@@ -1,20 +0,0 @@
---
name: Feature request
about: Suggest an idea for this project
title: ''
labels: ''
assignees: ''
---
**Is your feature request related to a problem? Please describe.**
A clear and concise description of what the problem is. Ex. I'm always frustrated when [...]
**Describe the solution you'd like**
A clear and concise description of what you want to happen.
**Describe alternatives you've considered**
A clear and concise description of any alternative solutions or features you've considered.
**Additional context**
Add any other context or screenshots about the feature request here.

98
.github/workflows/ci-android.yml vendored Normal file
View File

@@ -0,0 +1,98 @@
name: Build APK and root module (and create nightly release)
on:
push:
branches:
- '*'
workflow_dispatch:
inputs:
release:
description: 'Create a nightly release'
required: true
type: boolean
default: false
custom_notes:
description: 'Custom updates to add to What''s Changed section'
required: false
type: string
workflow_call:
jobs:
build-debug-apk:
runs-on: ubuntu-latest
steps:
- uses: actions/checkout@v4
with:
submodules: true
- uses: actions/setup-java@v4
with:
distribution: 'zulu'
java-version: 21
- uses: gradle/actions/setup-gradle@v4
- name: Build debug APK
run: ./gradlew assembleDebug
working-directory: android
- name: Upload artifact
uses: actions/upload-artifact@v4
with:
name: Debug APK
path: android/app/build/outputs/apk/**/*.apk
nightly-release:
runs-on: ubuntu-latest
if: github.event_name == 'push' && github.ref == 'refs/heads/release-nightly' || github.event_name == 'workflow_dispatch' && github.event.inputs.release == 'true'
needs: build-debug-apk
permissions:
contents: write
steps:
- uses: actions/checkout@v4
- uses: actions/download-artifact@v4
- name: Export APK_NAME for later use
run: echo "APK_NAME=LibrePods-$(echo ${{ github.sha }} | cut -c1-7).apk" >> $GITHUB_ENV
- name: Rename .apk file
run: mv "./Debug APK/debug/"*.apk "./$APK_NAME"
- name: Decode keystore file
run: echo "${{ secrets.DEBUG_KEYSTORE_FILE }}" | base64 --decode > debug.keystore
- name: Install apksigner
run: sudo apt-get update && sudo apt-get install -y apksigner
- name: Sign APK
run: |
apksigner sign --ks debug.keystore --ks-key-alias androiddebugkey --ks-pass pass:android --key-pass pass:android "./$APK_NAME"
- name: Verify APK
run: apksigner verify "./$APK_NAME"
- name: Fetch the latest non-nightly release tag
id: fetch-tag
run: echo "::set-output name=tag::$(git describe --tags $(git rev-list --tags --max-count=1))"
- name: Retrieve commits since the last release
id: get-commits
run: |
COMMITS=$(git log ${{ steps.fetch-tag.outputs.tag }}..HEAD --pretty=format:"- %s (%h)" --abbrev-commit)
echo "::set-output name=commits::${COMMITS}"
- name: Prepare release notes
id: release-notes
run: |
# Create a temporary file for release notes
NOTES_FILE=$(mktemp)
# Process custom notes if they exist
if [ "${{ github.event_name }}" == "workflow_dispatch" ] && [ -n "${{ github.event.inputs.custom_notes }}" ]; then
CUSTOM_NOTES="${{ github.event.inputs.custom_notes }}"
# Check if custom notes already have bullet points or GitHub-style formatting
if echo "$CUSTOM_NOTES" | grep -q "^\*\|^- \|http.*commit\|in #[0-9]\+"; then
# Already formatted, use as is
echo "$CUSTOM_NOTES" > "$NOTES_FILE"
else
# Add bullet point formatting
echo "- $CUSTOM_NOTES" > "$NOTES_FILE"
fi
fi
echo "notes_file=$NOTES_FILE" >> $GITHUB_OUTPUT
- name: Zip root-module directory
run: sh ./build-magisk-module.sh
- name: Delete release if exist then create release
env:
GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}
run: |
gh release view "nightly" && gh release delete "nightly" -y --cleanup-tag
gh release create "nightly" "./$APK_NAME" "./btl2capfix.zip" -p -t "Nightly Release" --notes-file "${{ steps.release-notes.outputs.notes_file }}" --generate-notes

36
.github/workflows/ci-linux.yml vendored Normal file
View File

@@ -0,0 +1,36 @@
name: Build LibrePods Linux
on:
push:
branches:
- '*'
jobs:
build-linux:
runs-on: ubuntu-latest
steps:
- name: Checkout repository
uses: actions/checkout@v3
- name: Install dependencies
run: |
sudo apt-get update
sudo apt-get install -y build-essential cmake ninja-build \
qt6-base-dev qt6-declarative-dev qt6-svg-dev \
qt6-tools-dev qt6-tools-dev-tools qt6-connectivity-dev \
libxkbcommon-dev
- name: Build project
working-directory: linux
run: |
mkdir build
cd build
cmake .. -G Ninja
ninja
- name: Upload artifact
uses: actions/upload-artifact@v4
with:
name: librepods-linux
path: linux/build/librepods

473
.gitignore vendored
View File

@@ -1,7 +1,17 @@
root-module/radare2-5.9.9-android-aarch64.tar.gz
wak.toml
log.txt
btl2capfix.zip
root-module-manual
.vscode
testing.py testing.py
.DS_Store .DS_Store
CMakeLists.txt.user*
# Android Template # Android Template
### Android ###
# Gradle files # Gradle files
.gradle/ .gradle/
build/ build/
@@ -36,19 +46,284 @@ google-services.json
# Android Profiling # Android Profiling
*.hprof *.hprof
# Python Template ### Android Patch ###
gen-external-apklibs
# Replacement of .externalNativeBuild directories introduced
# with Android Studio 3.5.
### C++ ###
# Prerequisites
*.d
# Compiled Object files
*.slo
*.lo
*.o
*.obj
# Precompiled Headers
*.gch
*.pch
# Compiled Dynamic libraries
*.so
*.dylib
*.dll
# Fortran module files
*.mod
*.smod
# Compiled Static libraries
*.lai
*.la
*.a
*.lib
# Executables
*.exe
*.out
*.app
### CLion ###
# Covers JetBrains IDEs: IntelliJ, RubyMine, PhpStorm, AppCode, PyCharm, CLion, Android Studio, WebStorm and Rider
# Reference: https://intellij-support.jetbrains.com/hc/en-us/articles/206544839
# User-specific stuff
.idea/**/workspace.xml
.idea/**/tasks.xml
.idea/**/usage.statistics.xml
.idea/**/dictionaries
.idea/**/shelf
# AWS User-specific
.idea/**/aws.xml
# Generated files
.idea/**/contentModel.xml
# Sensitive or high-churn files
.idea/**/dataSources/
.idea/**/dataSources.ids
.idea/**/dataSources.local.xml
.idea/**/sqlDataSources.xml
.idea/**/dynamic.xml
.idea/**/uiDesigner.xml
.idea/**/dbnavigator.xml
# Gradle
.idea/**/gradle.xml
.idea/**/libraries
# Gradle and Maven with auto-import
# When using Gradle or Maven with auto-import, you should exclude module files,
# since they will be recreated, and may cause churn. Uncomment if using
# auto-import.
# .idea/artifacts
# .idea/compiler.xml
# .idea/jarRepositories.xml
# .idea/modules.xml
# .idea/*.iml
# .idea/modules
# *.iml
# *.ipr
# CMake
cmake-build-*/
# Mongo Explorer plugin
.idea/**/mongoSettings.xml
# File-based project format
*.iws
# IntelliJ
out/
# mpeltonen/sbt-idea plugin
.idea_modules/
# JIRA plugin
atlassian-ide-plugin.xml
# Cursive Clojure plugin
.idea/replstate.xml
# SonarLint plugin
.idea/sonarlint/
# Crashlytics plugin (for Android Studio and IntelliJ)
com_crashlytics_export_strings.xml
crashlytics.properties
crashlytics-build.properties
fabric.properties
# Editor-based Rest Client
.idea/httpRequests
# Android studio 3.1+ serialized cache file
.idea/caches/build_file_checksums.ser
### CLion Patch ###
# Comment Reason: https://github.com/joeblau/gitignore.io/issues/186#issuecomment-215987721
# *.iml
# modules.xml
# .idea/misc.xml
# *.ipr
# Sonarlint plugin
# https://plugins.jetbrains.com/plugin/7973-sonarlint
.idea/**/sonarlint/
# SonarQube Plugin
# https://plugins.jetbrains.com/plugin/7238-sonarqube-community-plugin
.idea/**/sonarIssues.xml
# Markdown Navigator plugin
# https://plugins.jetbrains.com/plugin/7896-markdown-navigator-enhanced
.idea/**/markdown-navigator.xml
.idea/**/markdown-navigator-enh.xml
.idea/**/markdown-navigator/
# Cache file creation bug
# See https://youtrack.jetbrains.com/issue/JBR-2257
.idea/$CACHE_FILE$
# CodeStream plugin
# https://plugins.jetbrains.com/plugin/12206-codestream
.idea/codestream.xml
# Azure Toolkit for IntelliJ plugin
# https://plugins.jetbrains.com/plugin/8053-azure-toolkit-for-intellij
.idea/**/azureSettings.xml
### Kotlin ###
# Compiled class file
*.class
# Log file
# BlueJ files
*.ctxt
# Mobile Tools for Java (J2ME)
.mtj.tmp/
# Package Files #
*.jar
*.war
*.nar
*.ear
*.zip
*.tar.gz
*.rar
# virtual machine crash logs, see http://www.java.com/en/download/help/error_hotspot.xml
hs_err_pid*
replay_pid*
### Linux ###
*~
# temporary files which can be created if a process still has a handle open of a deleted file
.fuse_hidden*
# KDE directory preferences
.directory
# Linux trash folder which might appear on any partition or disk
.Trash-*
# .nfs files are created when an open file is removed but is still being accessed
.nfs*
### PyCharm ###
# Covers JetBrains IDEs: IntelliJ, RubyMine, PhpStorm, AppCode, PyCharm, CLion, Android Studio, WebStorm and Rider
# Reference: https://intellij-support.jetbrains.com/hc/en-us/articles/206544839
# User-specific stuff
# AWS User-specific
# Generated files
# Sensitive or high-churn files
# Gradle
# Gradle and Maven with auto-import
# When using Gradle or Maven with auto-import, you should exclude module files,
# since they will be recreated, and may cause churn. Uncomment if using
# auto-import.
# .idea/artifacts
# .idea/compiler.xml
# .idea/jarRepositories.xml
# .idea/modules.xml
# .idea/*.iml
# .idea/modules
# *.iml
# *.ipr
# CMake
# Mongo Explorer plugin
# File-based project format
# IntelliJ
# mpeltonen/sbt-idea plugin
# JIRA plugin
# Cursive Clojure plugin
# SonarLint plugin
# Crashlytics plugin (for Android Studio and IntelliJ)
# Editor-based Rest Client
# Android studio 3.1+ serialized cache file
### PyCharm Patch ###
# Comment Reason: https://github.com/joeblau/gitignore.io/issues/186#issuecomment-215987721
# *.iml
# modules.xml
# .idea/misc.xml
# *.ipr
# Sonarlint plugin
# https://plugins.jetbrains.com/plugin/7973-sonarlint
# SonarQube Plugin
# https://plugins.jetbrains.com/plugin/7238-sonarqube-community-plugin
# Markdown Navigator plugin
# https://plugins.jetbrains.com/plugin/7896-markdown-navigator-enhanced
# Cache file creation bug
# See https://youtrack.jetbrains.com/issue/JBR-2257
# CodeStream plugin
# https://plugins.jetbrains.com/plugin/12206-codestream
# Azure Toolkit for IntelliJ plugin
# https://plugins.jetbrains.com/plugin/8053-azure-toolkit-for-intellij
### Python ###
# Byte-compiled / optimized / DLL files # Byte-compiled / optimized / DLL files
__pycache__/ __pycache__/
*.py[cod] *.py[cod]
*$py.class *$py.class
# C extensions # C extensions
*.so
# Distribution / packaging # Distribution / packaging
.Python .Python
build/
develop-eggs/ develop-eggs/
dist/ dist/
downloads/ downloads/
@@ -96,7 +371,6 @@ cover/
*.pot *.pot
# Django stuff: # Django stuff:
*.log
local_settings.py local_settings.py
db.sqlite3 db.sqlite3
db.sqlite3-journal db.sqlite3-journal
@@ -146,10 +420,8 @@ ipython_config.py
#pdm.lock #pdm.lock
# pdm stores project-wide configurations in .pdm.toml, but it is recommended to not include it # pdm stores project-wide configurations in .pdm.toml, but it is recommended to not include it
# in version control. # in version control.
# https://pdm.fming.dev/latest/usage/project/#working-with-version-control # https://pdm.fming.dev/#use-with-ide
.pdm.toml .pdm.toml
.pdm-python
.pdm-build/
# PEP 582; used by e.g. github.com/David-OConnor/pyflow and github.com/pdm-project/pdm # PEP 582; used by e.g. github.com/David-OConnor/pyflow and github.com/pdm-project/pdm
__pypackages__/ __pypackages__/
@@ -200,3 +472,190 @@ cython_debug/
# and can be added to the global gitignore or merged into this file. For a more nuclear # and can be added to the global gitignore or merged into this file. For a more nuclear
# option (not recommended) you can uncomment the following to ignore the entire idea folder. # option (not recommended) you can uncomment the following to ignore the entire idea folder.
#.idea/ #.idea/
### Python Patch ###
# Poetry local configuration file - https://python-poetry.org/docs/configuration/#local-configuration
poetry.toml
# ruff
.ruff_cache/
# LSP config files
pyrightconfig.json
### Qt ###
# C++ objects and libs
*.so.*
# Qt-es
object_script.*.Release
object_script.*.Debug
*_plugin_import.cpp
/.qmake.cache
/.qmake.stash
*.pro.user
*.pro.user.*
*.qbs.user
*.qbs.user.*
*.moc
moc_*.cpp
moc_*.h
qrc_*.cpp
ui_*.h
*.qmlc
*.jsc
Makefile*
*build-*
*.qm
*.prl
# Qt unit tests
target_wrapper.*
# QtCreator
*.autosave
# QtCreator Qml
*.qmlproject.user
*.qmlproject.user.*
# QtCreator CMake
CMakeLists.txt.user*
# QtCreator 4.8< compilation database
compile_commands.json
# QtCreator local machine specific files for imported projects
*creator.user*
*_qmlcache.qrc
### VisualStudioCode ###
.vscode/*
!.vscode/settings.json
!.vscode/tasks.json
!.vscode/launch.json
!.vscode/extensions.json
!.vscode/*.code-snippets
# Local History for Visual Studio Code
.history/
# Built Visual Studio Code Extensions
*.vsix
### VisualStudioCode Patch ###
# Ignore all local history of files
.history
.ionide
### AndroidStudio ###
# Covers files to be ignored for android development using Android Studio.
# Built application files
*.ap_
*.aab
# Files for the ART/Dalvik VM
*.dex
# Java class files
# Generated files
bin/
gen/
# Gradle files
.gradle
# Signing files
.signing/
# Local configuration file (sdk path, etc)
# Proguard folder generated by Eclipse
proguard/
# Log Files
# Android Studio
/*/build/
/*/local.properties
/*/out
/*/*/build
/*/*/production
.navigation/
*.ipr
*.swp
# Keystore files
# Google Services (e.g. APIs or Firebase)
# google-services.json
# Android Patch
# External native build folder generated in Android Studio 2.2 and later
.externalNativeBuild
# NDK
obj/
# IntelliJ IDEA
/out/
# User-specific configurations
.idea/caches/
.idea/libraries/
.idea/shelf/
.idea/workspace.xml
.idea/tasks.xml
.idea/.name
.idea/compiler.xml
.idea/copyright/profiles_settings.xml
.idea/encodings.xml
.idea/misc.xml
.idea/modules.xml
.idea/scopes/scope_settings.xml
.idea/dictionaries
.idea/vcs.xml
.idea/jsLibraryMappings.xml
.idea/datasources.xml
.idea/dataSources.ids
.idea/sqlDataSources.xml
.idea/dynamic.xml
.idea/uiDesigner.xml
.idea/assetWizardSettings.xml
.idea/gradle.xml
.idea/jarRepositories.xml
.idea/navEditor.xml
# Legacy Eclipse project files
.classpath
.project
.cproject
.settings/
# Mobile Tools for Java (J2ME)
# Package Files #
# virtual machine crash logs (Reference: http://www.java.com/en/download/help/error_hotspot.xml)
## Plugin-specific files:
# mpeltonen/sbt-idea plugin
# JIRA plugin
# Mongo Explorer plugin
.idea/mongoSettings.xml
# Crashlytics plugin (for Android Studio and IntelliJ)
### AndroidStudio Patch ###
!/gradle/wrapper/gradle-wrapper.jar
# End of https://www.toptal.com/developers/gitignore/api/qt,c++,clion,kotlin,python,android,pycharm,androidstudio,visualstudiocode,linux
linux/.qmlls.ini

View File

@@ -28,7 +28,7 @@ It also enables the Adaptive Transparency feature. (We can set Adaptive Transpar
# Requesting notifications # Requesting notifications
This packet is necessary to receive notifications from the AirPods like ear detection, noise control mode, conversation awareness, battery status, etc. This packet is necessary to receive notifications from the AirPods like ear detection, noise control mode, conversational awareness, battery status, etc.
*Captured using PacketLogger on an Intel Mac running macOS Sequoia 15.0.1* *Captured using PacketLogger on an Intel Mac running macOS Sequoia 15.0.1*
```plaintext ```plaintext
@@ -134,7 +134,57 @@ AirPods send conversational awareness packets when the person wearing them start
| 03 | Person Stopped Speaking; increase volume back to normal | | 03 | Person Stopped Speaking; increase volume back to normal |
| Intermediate values | Intermediate volume levels | | Intermediate values | Intermediate volume levels |
| 08/09 | Normal Volume | | 08/09 | Normal Volume |
### Reading Conversational Awareness State
After requesting notifications, the AirPods send a packet indicating the current state of Conversational Awareness (CA). This packet is only sent once after notifications are requested, not when the CA state is changed.
The packet format is:
```plaintext
04 00 04 00 09 00 28 [status] 00 00 00
```
- `[status]` is a single byte at offset 7 (zero-based), immediately after the header.
- `0x01` — Conversational Awareness is **enabled**
- `0x02` — Conversational Awareness is **disabled**
- Any other value — Unknown/undetermined state
**Example:**
```plaintext
04 00 04 00 09 00 28 01 00 00 00
```
Here, `01` at the 8th byte (offset 7) means CA is enabled.
## Metadata
This packet contains device information like name, model number, etc. The packet format is:
```plaintext
04 00 04 00 1d [strings...]
```
The strings are null-terminated UTF-8 strings in the following order:
1. Bluetooth advertising name (varies in length)
2. Model number
3. Manufacturer
4. Serial number
5. Firmware version
6. Firmware version 2 (the exact same as before??)
7. Software version (1.0.0 why would we need it?)
8. App identifier (com.apple.accessory.updater.app.71 what?)
9. Serial number 1
10. Serial number 2
11. Unknown numeric value
12. Encrypted data
13. Additional encrypted data
Example packet:
```plaintext
040004001d0002d5000400416972506f64732050726f004133303438004170706c6520496e632e0051584e524848595850360036312e313836383034303030323030303030302e323731330036312e313836383034303030323030303030302e3237313300312e302e3000636f6d2e6170706c652e6163636573736f72792e757064617465722e6170702e3731004859394c5432454632364a59004833504c5748444a32364b3000363335373533360089312a6567a5400f84a3ca234947efd40b90d78436ae5946748d70273e66066a2589300035333935303630363400```
The packet contains device identification and version information followed by some encrypted data whose format is not known.
```
# Writing to the AirPods # Writing to the AirPods
@@ -211,34 +261,49 @@ The level can be any value between 0 and 100, 0 to allow maximum noise (i.e. min
*I find it quite funny how I have greater control over the noise control on the AirPods on non-Apple devices than on Apple devices, becuase on Apple Devices, there are just 3 options More Noise (0), Midway through (50), and Less Noise (100), but here I can set any value between 0 and 100.* *I find it quite funny how I have greater control over the noise control on the AirPods on non-Apple devices than on Apple devices, becuase on Apple Devices, there are just 3 options More Noise (0), Midway through (50), and Less Noise (100), but here I can set any value between 0 and 100.*
# To-Do List ## Accessiblity Settings
- [x] Receive Battery Information ## Headphone Accomodation
- [x] Set/Receive ANC Modes ```
- [x] Set Adaptive Audio Noise settings 04 00 04 00 53 00 84 00 02 02 [Phone] [Media]
- [x] Receive In-Ear detection Status [EQ1][EQ2][EQ3][EQ4][EQ5][EQ6][EQ7][EQ8]
- [ ] Personalized Volume (idk how this works, if it received data from icloud, or is purely from airpods) duplicated thrice for some reason
- [x] Conversational Awareness ```
- [x] Ear Detection
- [ ] Head Gestures | Data | Type | Value range |
- [ ] Siri (Voice assistant on long stem press) |---------------------|---------------|-----------------------------|
- [ ] Hold and Press configuration (this is really weird, mac sends different packets based on what the current status is, instead of a fixed packet for what the current button state is, like common there's only so many to map out numbers to states) | Phone | Decimal | 1 (Enabled) or 2 (Disabled) |
- [ ] Head Tracking (i really want this, could be easy, could be difficult, i'll never know because i don't have a device with apple silicon 😭) | Media | Decimal | 1 (Enabled) or 2 (Disabled) |
- [x] Case Charging Sounds | EQ | Little Endian | 0 to 100 |
- [x] Rename AirPods
- [ ] Mute Unmute Calls ## Customize Transparency mode
- Accessibilty
- [ ] Press Speed ```
- [ ] Press and hold duration 12 18 00 [enabled]
- [ ] Noise Cancellation with one AirPod <left bud>
- [ ] Tone Volume [EQ1][EQ2][EQ3][EQ4][EQ5][EQ6][EQ7][EQ8]
- [ ] Toggle Volume Control on Swipe (APP only, i believe) [Amplification]
- [ ] Volume Swipe (Normal/Longer/Longest) [Tone]
- [ ] Headphone accomodation (I literally can't tell the difference between any samples played, lol, also, idk if this is something that the mac does) [Conversation Boost]
- [ ] Audio Tuning (idk if this is also smth that mac does) [Ambient Noise Reduction]
- [ ] Customize Transparency Mode (This is gonna take some while to parse, it is 103 bytes :(... probably all the 4 sliders and 1 switch under this is sent as a whole) <repeat for right bud>
```
All values are formatted as IEEE 754 floats in little endian order.
| Data | Type | Range |
|-------------------------|---------------|-------|
| Enabled | IEEE754 Float | 0/1 |
| EQ | IEEE754 Float | 0-100 |
| Amplification | IEEE754 Float | 0-2 |
| Tone | IEEE754 Float | 0-2 |
| Conversation Boost | IEEE754 Float | 0/1 |
| Ambient Noise Reduction | IEEE754 Float | 0-1 |
| Ambient Noise Reduction | IEEE754 Float | 0-1 |
> [!IMPORTANT]
> Also send the [Headphone Accomodation](#headphone-accomodation) after this.
# Miscellaneous/Unknown
## Configure Stem Long Press ## Configure Stem Long Press
@@ -310,21 +375,48 @@ The packets sent (based on the previous states) are as follows:
> *i do hate apple for not hardcoding these, like there are literally only 4^2 - ${\binom{4}{1}}$ - $\binom{4}{2}$* > *i do hate apple for not hardcoding these, like there are literally only 4^2 - ${\binom{4}{1}}$ - $\binom{4}{2}$*
## Request something (Probably Head Positions) # Head Tracking
## Start Tracking
This packet initiates head tracking. When sent, the AirPods begin streaming head tracking data (e.g. orientation and acceleration) for live plotting and analysis.
```plaintext ```plaintext
<!-- 04 00 04 00 17 00 00 00 10 00 11 00 08 7C 10 02 42 0B 08 4E 10 02 1A 05 01 40 9C 00 00 -->
04 00 04 00 17 00 00 00 10 00 10 00 08 A1 02 42 0B 08 0E 10 02 1A 05 01 40 9C 00 00 04 00 04 00 17 00 00 00 10 00 10 00 08 A1 02 42 0B 08 0E 10 02 1A 05 01 40 9C 00 00
``` ```
Example packet ## Stop Tracking
```plaintext This packet stops the head tracking data stream.
04 00 04 00 17 00 00 00 10 00 43 00 08 ec 07 10 01 1a 3c 0e 00 01 90 95 5d af 86 19 00 00 03 04 43 94 04 9e 6b 01 00 00 00 d5 a2 06 13 eb 13 03 00 f0 ff 01 00 67 83 67 83 67 83 fe ff fd ff 07 00 b3 01 9c 03 65 00 48 74 2c 37 fd 1e 00 00
```
## Stop whatever was requested
```plaintext ```plaintext
04 00 04 00 17 00 00 00 10 00 11 00 08 7E 10 02 42 0B 08 4E 10 02 1A 05 01 00 00 00 00 04 00 04 00 17 00 00 00 10 00 11 00 08 7E 10 02 42 0B 08 4E 10 02 1A 05 01 00 00 00 00
``` ```
## Received Head Tracking Sensor Data
Once tracking is active, the AirPods stream sensor packets with the following common structure:
| Field | Offset | Length (bytes) |
|--------------------------|--------|----------------|
| orientation 1 | 43 | 2 |
| orientation 2 | 45 | 2 |
| orientation 3 | 47 | 2 |
| Horizontal Acceleration | 51 | 2 |
| Vertical Acceleration | 53 | 2 |
# LICENSE
LibrePods - AirPods liberated from Apples ecosystem
Copyright (C) 2025 LibrePods contributors
This program is free software: you can redistribute it and/or modify
it under the terms of the GNU Affero General Public License as published
by the Free Software Foundation, either version 3 of the License.
This program is distributed in the hope that it will be useful,
but WITHOUT ANY WARRANTY; without even the implied warranty of
MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
GNU Affero General Public License for more details.
You should have received a copy of the GNU Affero General Public License
along with this program. If not, see <https://www.gnu.org/licenses/>.

2
CHANGELOG.md Normal file
View File

@@ -0,0 +1,2 @@
## LibrePods root module changelog
_[See here](https://github.com/kavishdevar/librepods/releases)_

View File

@@ -1,6 +1,6 @@
# Welcome to AirPods Like Normal contributing guide <!-- omit in toc --> # Welcome to LibrePods contributing guide <!-- omit in toc -->
Thank you for considering a contribution to AirPods Like Normal! Your support helps bring Apple-exclusive AirPods features to Linux and Android. Thank you for considering a contribution to LibrePods! Your support helps bring Apple-exclusive AirPods features to Linux and Android.
Read our [Code of Conduct](./CODE_OF_CONDUCT.md) to keep our community approachable and respectful. Read our [Code of Conduct](./CODE_OF_CONDUCT.md) to keep our community approachable and respectful.
@@ -25,11 +25,11 @@ To develop for the Android App, Android Studio is the preferred IDE. And you can
#### Create a new issue #### Create a new issue
If you find a bug or want to suggest a feature, check if an issue already exists by searching through our [existing issues](https://github.com/username/AirPods-Like-Normal/issues). If no relevant issue exists, open a new one and fill in the details. If you find a bug or want to suggest a feature, check if an issue already exists by searching through our [existing issues](https://github.com/kavishdevar/librepods/issues). If no relevant issue exists, open a new one and fill in the details.
#### Solve an issue #### Solve an issue
Browse our [issues list](https://github.com/username/AirPods-Like-Normal/issues) to find an interesting issue to work on. Use labels to filter issues and pick one that matches your expertise. If youd like to work on an issue, open a PR with your solution. Browse our [issues list](https://github.com/kavishdevar/librepods/issues) to find an interesting issue to work on. Use labels to filter issues and pick one that matches your expertise. If youd like to work on an issue, open a PR with your solution.
### Make Changes ### Make Changes
@@ -37,7 +37,7 @@ Browse our [issues list](https://github.com/username/AirPods-Like-Normal/issues)
1. Fork the repository and clone it to your local environment. 1. Fork the repository and clone it to your local environment.
``` ```
git clone https://github.com/your-username/AirPods-Like-Normal.git git clone https://github.com/kavishdevar/librepods.git
cd AirPods-Like-Normal cd AirPods-Like-Normal
``` ```
2. Create a working branch to start your changes. 2. Create a working branch to start your changes.
@@ -67,4 +67,4 @@ Once your PR is open, a team member will review it. They may ask questions or re
### Your PR is merged! ### Your PR is merged!
Congratulations! :tada: Once merged, your contributions will be publicly available in AirPodsLikeNormal. Congratulations! :tada: Once merged, your contributions will be publicly available in LibrePods.

1
FUNDING.yml Normal file
View File

@@ -0,0 +1 @@
github: kavishdevar

161
LICENSE
View File

@@ -1,5 +1,5 @@
GNU GENERAL PUBLIC LICENSE GNU AFFERO GENERAL PUBLIC LICENSE
Version 3, 29 June 2007 Version 3, 19 November 2007
Copyright (C) 2007 Free Software Foundation, Inc. <https://fsf.org/> Copyright (C) 2007 Free Software Foundation, Inc. <https://fsf.org/>
Everyone is permitted to copy and distribute verbatim copies Everyone is permitted to copy and distribute verbatim copies
@@ -7,17 +7,15 @@
Preamble Preamble
The GNU General Public License is a free, copyleft license for The GNU Affero General Public License is a free, copyleft license for
software and other kinds of works. software and other kinds of works, specifically designed to ensure
cooperation with the community in the case of network server software.
The licenses for most software and other practical works are designed The licenses for most software and other practical works are designed
to take away your freedom to share and change the works. By contrast, to take away your freedom to share and change the works. By contrast,
the GNU General Public License is intended to guarantee your freedom to our General Public Licenses are intended to guarantee your freedom to
share and change all versions of a program--to make sure it remains free share and change all versions of a program--to make sure it remains free
software for all its users. We, the Free Software Foundation, use the software for all its users.
GNU General Public License for most of our software; it applies also to
any other work released this way by its authors. You can apply it to
your programs, too.
When we speak of free software, we are referring to freedom, not When we speak of free software, we are referring to freedom, not
price. Our General Public Licenses are designed to make sure that you price. Our General Public Licenses are designed to make sure that you
@@ -26,44 +24,34 @@ them if you wish), that you receive source code or can get it if you
want it, that you can change the software or use pieces of it in new want it, that you can change the software or use pieces of it in new
free programs, and that you know you can do these things. free programs, and that you know you can do these things.
To protect your rights, we need to prevent others from denying you Developers that use our General Public Licenses protect your rights
these rights or asking you to surrender the rights. Therefore, you have with two steps: (1) assert copyright on the software, and (2) offer
certain responsibilities if you distribute copies of the software, or if you this License which gives you legal permission to copy, distribute
you modify it: responsibilities to respect the freedom of others. and/or modify the software.
For example, if you distribute copies of such a program, whether A secondary benefit of defending all users' freedom is that
gratis or for a fee, you must pass on to the recipients the same improvements made in alternate versions of the program, if they
freedoms that you received. You must make sure that they, too, receive receive widespread use, become available for other developers to
or can get the source code. And you must show them these terms so they incorporate. Many developers of free software are heartened and
know their rights. encouraged by the resulting cooperation. However, in the case of
software used on network servers, this result may fail to come about.
The GNU General Public License permits making a modified version and
letting the public access it on a server without ever releasing its
source code to the public.
Developers that use the GNU GPL protect your rights with two steps: The GNU Affero General Public License is designed specifically to
(1) assert copyright on the software, and (2) offer you this License ensure that, in such cases, the modified source code becomes available
giving you legal permission to copy, distribute and/or modify it. to the community. It requires the operator of a network server to
provide the source code of the modified version running there to the
users of that server. Therefore, public use of a modified version, on
a publicly accessible server, gives the public access to the source
code of the modified version.
For the developers' and authors' protection, the GPL clearly explains An older license, called the Affero General Public License and
that there is no warranty for this free software. For both users' and published by Affero, was designed to accomplish similar goals. This is
authors' sake, the GPL requires that modified versions be marked as a different license, not a version of the Affero GPL, but Affero has
changed, so that their problems will not be attributed erroneously to released a new version of the Affero GPL which permits relicensing under
authors of previous versions. this license.
Some devices are designed to deny users access to install or run
modified versions of the software inside them, although the manufacturer
can do so. This is fundamentally incompatible with the aim of
protecting users' freedom to change the software. The systematic
pattern of such abuse occurs in the area of products for individuals to
use, which is precisely where it is most unacceptable. Therefore, we
have designed this version of the GPL to prohibit the practice for those
products. If such problems arise substantially in other domains, we
stand ready to extend this provision to those domains in future versions
of the GPL, as needed to protect the freedom of users.
Finally, every program is threatened constantly by software patents.
States should not allow patents to restrict development and use of
software on general-purpose computers, but in those that do, we wish to
avoid the special danger that patents applied to a free program could
make it effectively proprietary. To prevent this, the GPL assures that
patents cannot be used to render the program non-free.
The precise terms and conditions for copying, distribution and The precise terms and conditions for copying, distribution and
modification follow. modification follow.
@@ -72,7 +60,7 @@ modification follow.
0. Definitions. 0. Definitions.
"This License" refers to version 3 of the GNU General Public License. "This License" refers to version 3 of the GNU Affero General Public License.
"Copyright" also means copyright-like laws that apply to other kinds of "Copyright" also means copyright-like laws that apply to other kinds of
works, such as semiconductor masks. works, such as semiconductor masks.
@@ -549,35 +537,45 @@ to collect a royalty for further conveying from those to whom you convey
the Program, the only way you could satisfy both those terms and this the Program, the only way you could satisfy both those terms and this
License would be to refrain entirely from conveying the Program. License would be to refrain entirely from conveying the Program.
13. Use with the GNU Affero General Public License. 13. Remote Network Interaction; Use with the GNU General Public License.
Notwithstanding any other provision of this License, if you modify the
Program, your modified version must prominently offer all users
interacting with it remotely through a computer network (if your version
supports such interaction) an opportunity to receive the Corresponding
Source of your version by providing access to the Corresponding Source
from a network server at no charge, through some standard or customary
means of facilitating copying of software. This Corresponding Source
shall include the Corresponding Source for any work covered by version 3
of the GNU General Public License that is incorporated pursuant to the
following paragraph.
Notwithstanding any other provision of this License, you have Notwithstanding any other provision of this License, you have
permission to link or combine any covered work with a work licensed permission to link or combine any covered work with a work licensed
under version 3 of the GNU Affero General Public License into a single under version 3 of the GNU General Public License into a single
combined work, and to convey the resulting work. The terms of this combined work, and to convey the resulting work. The terms of this
License will continue to apply to the part which is the covered work, License will continue to apply to the part which is the covered work,
but the special requirements of the GNU Affero General Public License, but the work with which it is combined will remain governed by version
section 13, concerning interaction through a network will apply to the 3 of the GNU General Public License.
combination as such.
14. Revised Versions of this License. 14. Revised Versions of this License.
The Free Software Foundation may publish revised and/or new versions of The Free Software Foundation may publish revised and/or new versions of
the GNU General Public License from time to time. Such new versions will the GNU Affero General Public License from time to time. Such new versions
be similar in spirit to the present version, but may differ in detail to will be similar in spirit to the present version, but may differ in detail to
address new problems or concerns. address new problems or concerns.
Each version is given a distinguishing version number. If the Each version is given a distinguishing version number. If the
Program specifies that a certain numbered version of the GNU General Program specifies that a certain numbered version of the GNU Affero General
Public License "or any later version" applies to it, you have the Public License "or any later version" applies to it, you have the
option of following the terms and conditions either of that numbered option of following the terms and conditions either of that numbered
version or of any later version published by the Free Software version or of any later version published by the Free Software
Foundation. If the Program does not specify a version number of the Foundation. If the Program does not specify a version number of the
GNU General Public License, you may choose any version ever published GNU Affero General Public License, you may choose any version ever published
by the Free Software Foundation. by the Free Software Foundation.
If the Program specifies that a proxy can decide which future If the Program specifies that a proxy can decide which future
versions of the GNU General Public License can be used, that proxy's versions of the GNU Affero General Public License can be used, that proxy's
public statement of acceptance of a version permanently authorizes you public statement of acceptance of a version permanently authorizes you
to choose that version for the Program. to choose that version for the Program.
@@ -631,44 +629,33 @@ to attach them to the start of each source file to most effectively
state the exclusion of warranty; and each file should have at least state the exclusion of warranty; and each file should have at least
the "copyright" line and a pointer to where the full notice is found. the "copyright" line and a pointer to where the full notice is found.
<one line to give the program's name and a brief idea of what it does.> <one line to give the program's name and a brief idea of what it does.>
Copyright (C) <year> <name of author> Copyright (C) <year> <name of author>
This program is free software: you can redistribute it and/or modify This program is free software: you can redistribute it and/or modify
it under the terms of the GNU General Public License as published by it under the terms of the GNU Affero General Public License as published
the Free Software Foundation, either version 3 of the License, or by the Free Software Foundation, either version 3 of the License, or
(at your option) any later version. (at your option) any later version.
This program is distributed in the hope that it will be useful, This program is distributed in the hope that it will be useful,
but WITHOUT ANY WARRANTY; without even the implied warranty of but WITHOUT ANY WARRANTY; without even the implied warranty of
MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
GNU General Public License for more details. GNU Affero General Public License for more details.
You should have received a copy of the GNU General Public License You should have received a copy of the GNU Affero General Public License
along with this program. If not, see <https://www.gnu.org/licenses/>. along with this program. If not, see <https://www.gnu.org/licenses/>.
Also add information on how to contact you by electronic and paper mail. Also add information on how to contact you by electronic and paper mail.
If the program does terminal interaction, make it output a short If your software can interact with users remotely through a computer
notice like this when it starts in an interactive mode: network, you should also make sure that it provides a way for users to
get its source. For example, if your program is a web application, its
<program> Copyright (C) <year> <name of author> interface could display a "Source" link that leads users to an archive
This program comes with ABSOLUTELY NO WARRANTY; for details type `show w'. of the code. There are many ways you could offer source, and different
This is free software, and you are welcome to redistribute it solutions will be better for different programs; see section 13 for the
under certain conditions; type `show c' for details. specific requirements.
The hypothetical commands `show w' and `show c' should show the appropriate
parts of the General Public License. Of course, your program's commands
might be different; for a GUI interface, you would use an "about box".
You should also get your employer (if you work as a programmer) or school, You should also get your employer (if you work as a programmer) or school,
if any, to sign a "copyright disclaimer" for the program, if necessary. if any, to sign a "copyright disclaimer" for the program, if necessary.
For more information on this, and how to apply and follow the GNU GPL, see For more information on this, and how to apply and follow the GNU AGPL, see
<https://www.gnu.org/licenses/>. <https://www.gnu.org/licenses/>.
The GNU General Public License does not permit incorporating your program
into proprietary programs. If your program is a subroutine library, you
may consider it more useful to permit linking proprietary applications with
the library. If this is what you want to do, use the GNU Lesser General
Public License instead of this License. But first, please read
<https://www.gnu.org/licenses/why-not-lgpl.html>.

View File

@@ -0,0 +1,164 @@
# Bluetooth Low Energy (BLE) - Apple Proximity Pairing Message
This document describes how the AirPods BLE "Proximity Pairing Message" is parsed and interpreted in the application. This message is broadcast by Apple devices (such as AirPods) and contains key information about the device's state, battery, and other properties.
## Overview
When scanning for BLE devices, the application looks for manufacturer data with Apple's ID (`0x004C`). If the data starts with `0x07`, it is identified as a Proximity Pairing Message. The message contains various fields, each representing a specific property of the AirPods.
## Proximity Pairing Message Structure
| Byte Index | Field Name | Description | Example Value(s) |
|------------|-------------------------|---------------------------------------------------------|--------------------------|
| 0 | Prefix | Message type (should be `0x07` for proximity pairing) | `0x07` |
| 1 | Length | Length of the message | `0x12` |
| 2 | Pairing Mode | `0x01` = Paired, `0x00` = Pairing mode | `0x01`, `0x00` |
| 3-4 | Device Model | Big-endian: [3]=high, [4]=low | `0x0E20` (AirPods Pro) |
| 5 | Status | Bitfield, see below | `0x62` |
| 6 | Pods Battery Byte | Nibbles for left/right pod battery | `0xA7` |
| 7 | Flags & Case Battery | Upper nibble: case battery, lower: flags | `0xB3` |
| 8 | Lid Indicator | Bits for lid state and open counter | `0x09` |
| 9 | Device Color | Color code | `0x02` |
| 10 | Connection State | Enum, see below | `0x04` |
| 11-26 | Encrypted Payload | 16 bytes, not parsed | |
## Field Details
### Device Model
| Value (hex) | Model Name |
|-------------|--------------------------|
| 0x0220 | AirPods 1st Gen |
| 0x0F20 | AirPods 2nd Gen |
| 0x1320 | AirPods 3rd Gen |
| 0x1920 | AirPods 4th Gen |
| 0x1B20 | AirPods 4th Gen (ANC) |
| 0x0A20 | AirPods Max |
| 0x1F20 | AirPods Max (USB-C) |
| 0x0E20 | AirPods Pro |
| 0x1420 | AirPods Pro 2nd Gen |
| 0x2420 | AirPods Pro 2nd Gen (USB-C) |
### Status Byte (Bitfield)
| Bit | Meaning | Value if Set |
|-----|--------------------------------|-------------|
| 0 | Right Pod In Ear (XOR logic) | true |
| 1 | Right Pod In Ear (XOR logic) | true |
| 2 | Both Pods In Case | true |
| 3 | Left Pod In Ear (XOR logic) | true |
| 4 | One Pod In Case | true |
| 5 | Primary Pod (1=Left, 0=Right) | true/false |
| 6 | This Pod In Case | true |
### Ear Detection Logic
The in-ear detection uses XOR logic based on:
- Whether the right pod is primary (`areValuesFlipped`)
- Whether this pod is in the case (`isThisPodInTheCase`)
```cpp
bool xorFactor = areValuesFlipped ^ deviceInfo.isThisPodInTheCase;
deviceInfo.isLeftPodInEar = xorFactor ? (status & 0x08) != 0 : (status & 0x02) != 0; // Bit 3 or 1
deviceInfo.isRightPodInEar = xorFactor ? (status & 0x02) != 0 : (status & 0x08) != 0; // Bit 1 or 3
```
### Primary Pod
Determined by bit 5 of the status byte:
- `1` = Left pod is primary
- `0` = Right pod is primary
This affects:
1. Battery level interpretation (which nibble corresponds to which pod)
2. Microphone assignment
3. Ear detection logic
### Microphone Status
The active microphone is determined by:
```cpp
deviceInfo.isLeftPodMicrophone = primaryLeft ^ deviceInfo.isThisPodInTheCase;
deviceInfo.isRightPodMicrophone = !primaryLeft ^ deviceInfo.isThisPodInTheCase;
```
### Pods Battery Byte
- Upper nibble: one pod battery (depends on primary)
- Lower nibble: other pod battery
| Value | Meaning |
|-------|----------------|
| 0x0-0x9 | 0-90% (x10) |
| 0xA-0xE | 100% |
| 0xF | Not available|
### Flags & Case Battery Byte
- Upper nibble: case battery (same encoding as pods)
- Lower nibble: flags
#### Flags (Lower Nibble)
| Bit | Meaning |
|-----|--------------------------|
| 0 | Right Pod Charging (XOR) |
| 1 | Left Pod Charging (XOR) |
| 2 | Case Charging |
### Lid Indicator
| Bits | Meaning |
|------|------------------------|
| 0-2 | Lid Open Counter |
| 3 | Lid State (0=Open, 1=Closed) |
### Device Color
| Value | Color |
|-------|-------------|
| 0x00 | White |
| 0x01 | Black |
| 0x02 | Red |
| 0x03 | Blue |
| 0x04 | Pink |
| 0x05 | Gray |
| 0x06 | Silver |
| 0x07 | Gold |
| 0x08 | Rose Gold |
| 0x09 | Space Gray |
| 0x0A | Dark Blue |
| 0x0B | Light Blue |
| 0x0C | Yellow |
| 0x0D+ | Unknown |
### Connection State
| Value | State |
|-------|--------------|
| 0x00 | Disconnected |
| 0x04 | Idle |
| 0x05 | Music |
| 0x06 | Call |
| 0x07 | Ringing |
| 0x09 | Hanging Up |
| 0xFF | Unknown |
## Example Message
| Byte Index | Example Value | Description |
|------------|--------------|----------------------------|
| 0 | 0x07 | Proximity Pairing Message |
| 1 | 0x12 | Length |
| 2 | 0x01 | Paired |
| 3-4 | 0x0E 0x20 | AirPods Pro |
| 5 | 0x62 | Status |
| 6 | 0xA7 | Pods Battery |
| 7 | 0xB3 | Flags & Case Battery |
| 8 | 0x09 | Lid Indicator |
| 9 | 0x02 | Device Color |
| 10 | 0x04 | Connection State (Idle) |
---
For further details, see [`BleManager`](linux/ble/blemanager.cpp) and [`BleScanner`](linux/ble/blescanner.cpp).

260
README.md
View File

@@ -1,123 +1,165 @@
# ALN - AirPods like Normal ![LibrePods Banner](/imgs/banner.png)
*Access AirPods' Apple-exclusive features on linux and android!*
### Check out the packet definitions at [AAP Definitions](/AAP%20Definitions.md)
## Tested device(s) [![XDA Thread](https://img.shields.io/badge/XDA_Forums-Thread-orange)](https://xdaforums.com/t/app-root-for-now-airpodslikenormal-unlock-apple-exclusive-airpods-features-on-android.4707585/)
- AirPods Pro 2 [![GitHub release (latest by date)](https://img.shields.io/github/v/release/kavishdevar/librepods)](https://github.com/kavishdevar/librepods/releases/latest)
[![GitHub all releases](https://img.shields.io/github/downloads/kavishdevar/librepods/total)](https://github.com/kavishdevar/librepods/releases)
Other devices might work too! Features like ear detection and battery should be available for any AirPods! Although the app will show unsupported features/settings! I will not be able test any other devices than the ones I already have (i.e. the AirPods Pro 2). [![GitHub stars](https://img.shields.io/github/stars/kavishdevar/librepods)](https://github.com/kavishdevar/librepods/stargazers)
[![GitHub issues](https://img.shields.io/github/issues/kavishdevar/librepods)](https://github.com/kavishdevar/librepods/issues)
## Implemented Features [![GitHub license](https://img.shields.io/github/license/kavishdevar/librepods)](https://github.com/kavishdevar/librepods/blob/main/LICENSE)
[![GitHub contributors](https://img.shields.io/github/contributors/kavishdevar/librepods)](https://github.com/kavishdevar/librepods/graphs/contributors)
| Feature | Linux | Android |
| --- | --- | --- |
| Ear Detection | ✅ | ✅ |
| Conversational Awareness | ✅ | ✅ |
| Setting Noise Control | ✅ | ✅ |
| Battery Level | ✅ | ✅ |
| Rename AirPods | ❌ | ✅ |
| Adjust Adaptive Audio | ❌ | ✅ |
| Loud Sound Reduction | ❌ | ✅ |
## Linux
Check out the README file in [linux](/linux) folder for more info.
This tray app communicates with a daemon with the help of a UNIX socket. The daemon is responsible for the actual communication with the AirPods. The tray app is just a frontend for the daemon, that does ear-detection, conversational awareness, setting the noise-cancellation mode, and more.
![Tray Battery App](/linux/imgs/tray-icon-hover.png)
![Tray Noise Control Mode Menu](/linux/imgs/tray-icon-menu.png)
## Android
Currently, there's a [bug in the Android Bluetooth stack](https://issuetracker.google.com/issues/371713238) that prevents the app from working `(upvote the issue - click the '+1' icon on the top right corner of IssueTracker)`. This repository provides a workaround for the bug, specifically tested on Android 14 and Android 15 (stock versions).
**This workaround requires root access** to implement and it might not work on other android OEM skins. Try at your own risk!!
### Workaround
#### Step 1: Download the Required Files
- Go to the [Releases](https://github.com/kavishdevar/aln/releases) section.
- Download the required files depending upon your Android version - `bt.sh`, `module.prop`, and `libbluetooth_jni-a14.so` (for android 14) or `libbluetooth_jni-a15.so` (for android 15).
#### Step 2: Set Up the Directory Structure
- Use a file manager with root access (eg. Solid FIle Explorer or MT manager) or a shell (using adb, or a terminal app like Termux) and create a folder structure like this (`upper` and `work` are also folders):
```
/data/local/tmp/overlay:
upper
work
```
- Rename the appropriate file to `libbluetooth_jni.so` and place it in the `upper` folder
```
/data/local/tmp/overlay/upper:
libbluetooth_jni.so
```
- Create a duplicate of the overlay folder inside tmp and name it overlay2.
#### Step 3: Add the Boot Script
- Place the `bt.sh` script in `/data/adb/post-fs-data.d/`.
- This script ensures the fix is applied during system startup.
#### Step 4: Create a Magisk Module
- Create a `btl2capfix` folder in `/data/adb/modules/` and copy the `module.prop`into the folder.
```
/data/adb/modules/btl2capfix:
module.prop
```
- Create `system/lib64` under `btl2capfix` and copy the `libbluetooth_jni.so` into `lib64`
```
/data/adb/modules/btl2capfix/system/lib64:
libbluetooth_jni.so
```
#### Step 5: Verify the Fix
- Reboot your device.
- The Bluetooth bug should now be resolved.
Once the issue is resolved by Google developers or you've addressed it through the above root-based method, download and install the `app-release.apk` from the releases, and you're good to go!
### Features
#### Renaming the Airpods
When you rename the Airpods using the app, you'll need to re-pair it with your phone. Currently, user-level apps cannot directly rename a Bluetooth device. After re-pairing, your phone will display the updated name!
#### Noise Control Modes
- Active Noise Cancellation (ANC): Blocks external sounds using microphones and advanced algorithms for an immersive audio experience; ideal for noisy environments.
- Transparency Mode: Allows external sounds to blend with audio for situational awareness; best for environments where you need to stay alert.
- Off Mode: Disables noise control for a natural listening experience, conserving battery in quiet settings.
- Adaptive Transparency: Dynamically reduces sudden loud noises while maintaining environmental awareness, adjusting seamlessly to fluctuating noise levels.
#### Conversational Awareness
Automatically lowers audio volume and enhances voices when you start speaking, making it easier to engage in conversations without removing your AirPods.
#### Automatic Ear Detection
Recognizes when the AirPods are in your ears to automatically play or pause audio and adjust functionality accordingly.
#### Planned Features
Quick Tile to toggle Conversational Awareness and to switch Noise Control modes, and Battery Widget (App and AndroidSystemIntelligence)/Notification coming soon!!
### Screenshots of the app ## What is LibrePods?
LibrePods unlocks Apple's exclusive AirPods features on non-Apple devices. Get access to noise control modes, adaptive transparency, ear detection, hearing aid, customized transparency mode, battery status, and more - all the premium features you paid for but Apple locked to their ecosystem.
## Device Compatibility
| Status | Device | Features |
| ------ | --------------------- | ---------------------------------------------------------- |
| ✅ | AirPods Pro (2nd Gen) | Fully supported and tested |
| ✅ | AirPods Pro (3rd Gen) | Fully supported (except heartrate monitoring) |
| ⚠️ | Other AirPods models | Basic features (battery status, ear detection) should work |
Most features should work with any AirPods. Currently, I've only got AirPods Pro 2 to test with.
## Key Features
- **Noise Control Modes**: Easily switch between noise control modes without having to reach out to your AirPods to long press
- **Ear Detection**: Controls your music automatically when you put your AirPods in or take them out, and switch to phone speaker when you take them out
- **Battery Status**: Accurate battery levels
- **Head Gestures**: Answer calls just by nodding your head
- **Conversational Awareness**: Volume automatically lowers when you speak
- **Hearing Aid\***
- **Customize Transparency Mode\***
- **Multi-device connectivity\*** (upto 2 devices)
- **Other customizations**:
- Rename your AirPods
- Customize long-press actions
- Few accessibility features
- And more!
See our [pinned issue](https://github.com/kavishdevar/librepods/issues/20) for a complete feature list and roadmap.
## Platform Support
### Linux
The Linux version runs as a system tray app. Connect your AirPods and enjoy:
- Battery monitoring
- Automatic Ear detection
- Conversational Awareness
- Switching Noise Control modes
- Device renaming
> [!NOTE]
> Work in progress, but core functionality is stable and usable.
For installation and detailed info, see the [Linux README](/linux/README.md).
### Android
#### Screenshots
| | | |
| -------------------------------------------------------------------------------------- | ------------------------------------------------- | --------------------------------------------------------------------------- |
| ![Settings 1](/android/imgs/settings-1.png) | ![Settings 2](/android/imgs/settings-2.png) | ![Debug Screen](/android/imgs/debug.png) |
| ![Battery Notification and QS Tile for NC Mode](/android/imgs/notification-and-qs.png) | ![Popup](/android/imgs/popup.png) | ![Head Tracking and Gestures](/android/imgs/head-tracking-and-gestures.png) |
| ![Long Press Configuration](/android/imgs/long-press.png) | ![Widget](/android/imgs/widget.png) | ![Customizations 1](/android/imgs/customizations-1.png) |
| ![Customizations 2](/android/imgs/customizations-2.png) | ![accessibility](/android/imgs/accessibility.png) | ![transparency](/android/imgs/transparency.png) |
| ![hearing-aid](/android/imgs/hearing-aid.png) | ![hearing-test](/android/imgs/hearing-test.png) | ![hearing-aid-adjustments](/android/imgs/hearing-aid-adjustments.png) |
here's a very unprofessional demo video
https://github.com/user-attachments/assets/43911243-0576-4093-8c55-89c1db5ea533
#### Root Requirement
> [!CAUTION]
> **You must have a rooted device to use LibrePods on Android.** This is due to a [bug in the Android Bluetooth stack](https://issuetracker.google.com/issues/371713238). Please upvote the issue by clicking the '+1' icon on the IssueTracker page.
>
> There are **no exceptions** to the root requirement until Google merges the fix.
## Bluetooth DID (Device Identification) Hook
Turns out, if you change the manufacturerid to that of Apple, you get access to several special features!
### Multi-device Connectivity
Upto two devices can be simultaneously connected to AirPods, for audio and control both. Seamless connection switching. The same notification shows up on Apple device when Android takes over the AirPods as if it were an Apple device ("Move to iPhone"). Android also shows a popup when the other device takes over.
### Accessibility Settings and Hearing Aid
Accessibility settings like customizing transparency mode (amplification, balance, tone, conversation boost, and ambient noise reduction), and loud sound reduction can be configured.
The hearing aid feature can now also be used. Currently it can only be used to adjust the settings, not actually take a hearing test because it requires much more precision. It is much better to use an already available audiogram result.
>[!NOTE]
> To enable these features, enable App Settings -> `act as Apple Device`.
> This only works if you use the Xposed method or patch the library yourself. The root module method does not support this feature currently.
#### Installation Methods
##### Method 1: Xposed Module (Recommended)
This method is less intrusive and should be tried first:
1. Install LSPosed, or another Xposed provider on your rooted device
2. Download the LibrePods app from the releases section, and install it.
3. Enable the Xposed module for the bluetooth app in your Xposed manager.
4. Disable unmount modules for the Bluetooth app if enabled.
5. Follow the instructions in the app to set up the module.
6. Open the app and connect your AirPods
##### Method 2: Root Module (Backup Option)
If the Xposed method doesn't work for you:
1. Download the `btl2capfix.zip` module from the releases section
2. Install it using your preferred root manager (KernelSU, Apatch, or Magisk).
3. Disable Unmount modules for the Bluetooth aop if enabled.
4. Reboot your device
5. Connect your AirPods
##### Method 3: Patching it yourself
If you prefer to patch the Bluetooth stack yourself, follow these steps:
1. Look for the library in use by running `lsof | grep libbluetooth`
2. Find the library path (e.g., `/system/lib64/libbluetooth_jni.so`)
3. Find the `l2c_fcr_chk_chan_modes` function in the library
4. Patch the function to always return `1` (true)
5. Repack the library and push it back to the device. You can do this by creating a root module yourself.
6. Reboot your device
If you're unfamiliar with these steps, search for tutorials online or ask in Android rooting communities.
#### A few notes
- Due to recent AirPods' firmware upgrades, you must enable `Off listening mode` to switch to `Off`. This is because in this mode, louds sounds are not reduced!
- If you have take both AirPods out, the app will automatically switch to the phone speaker. But, Android might keep on trying to connect to the AirPods because the phone is still connected to them, just the A2DP profile is not connected. The app tries to disconnect the A2DP profile as soon as it detects that Android has connected again if they're not in the ear.
- When renaming your AirPods through the app, you'll need to re-pair them with your phone for the name change to take effect. This is a limitation of how Bluetooth device naming works on Android.
## Star History
[![Star History Chart](https://api.star-history.com/svg?repos=kavishdevar/librepods&type=Date)](https://star-history.com/#kavishdevar/librepods&Date)
| | | |
|-------------------|-------------------|-------------------|
| ![Settings 1](/android/imgs/settings-1.png) | ![Settings 2](/android/imgs/settings-2.png) | ![Debug Screen](/android/imgs/debug.png) |
| ![Battery Notification](/android/imgs/notification.png) | ![Popup](/android/imgs/popup.png) | ![QuickSetting Tile](/android/imgs/qstile.png) |
# License # License
AirPods like Normal (ALN) - Bringing Apple-only features to Linux and Android for seamless AirPods functionality! LibrePods - AirPods liberated from Apples ecosystem
Copyright (C) 2024 Kavish Devar Copyright (C) 2025 LibrePods contributors
This program is free software: you can redistribute it and/or modify This program is free software: you can redistribute it and/or modify
it under the terms of the GNU General Public License as published by it under the terms of the GNU Affero General Public License as published
the Free Software Foundation, version 3 of the License. by the Free Software Foundation, either version 3 of the License.
This program is distributed in the hope that it will be useful, This program is distributed in the hope that it will be useful,
but WITHOUT ANY WARRANTY; without even the implied warranty of but WITHOUT ANY WARRANTY; without even the implied warranty of
MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
GNU General Public License for more details. GNU Affero General Public License for more details.
You should have received a copy of the GNU General Public License You should have received a copy of the GNU Affero General Public License
along with this program over [here](/LICENSE). If not, see <https://www.gnu.org/licenses/>. along with this program over [here](/LICENSE). If not, see <https://www.gnu.org/licenses/>.
All trademarks, logos, and brand names are the property of their respective owners. Use of them does not imply any affiliation with or endorsement by them. All AirPods images, symbols, and the SF Pro font are the property of Apple Inc.

1
android/.gitignore vendored
View File

@@ -1,3 +1,4 @@
crowdin.yml
*.iml *.iml
.gradle .gradle
/local.properties /local.properties

View File

@@ -2,21 +2,20 @@ plugins {
alias(libs.plugins.android.application) alias(libs.plugins.android.application)
alias(libs.plugins.kotlin.android) alias(libs.plugins.kotlin.android)
alias(libs.plugins.kotlin.compose) alias(libs.plugins.kotlin.compose)
alias(libs.plugins.aboutLibraries)
id("kotlin-parcelize") id("kotlin-parcelize")
} }
android { android {
namespace = "me.kavishdevar.aln" namespace = "me.kavishdevar.librepods"
compileSdk = 35 compileSdk = 36
defaultConfig { defaultConfig {
applicationId = "me.kavishdevar.aln" applicationId = "me.kavishdevar.librepods"
minSdk = 28 minSdk = 28
targetSdk = 35 targetSdk = 36
versionCode = 1 versionCode = 8
versionName = "0.0.2" versionName = "0.2.0-beta.1"
testInstrumentationRunner = "androidx.test.runner.AndroidJUnitRunner"
} }
buildTypes { buildTypes {
@@ -39,6 +38,17 @@ android {
compose = true compose = true
viewBinding = true viewBinding = true
} }
externalNativeBuild {
cmake {
path = file("src/main/cpp/CMakeLists.txt")
version = "3.22.1"
}
}
sourceSets {
getByName("main") {
res.srcDirs("src/main/res", "src/main/res-apple")
}
}
} }
dependencies { dependencies {
@@ -57,11 +67,23 @@ dependencies {
implementation(libs.androidx.constraintlayout) implementation(libs.androidx.constraintlayout)
implementation(libs.haze) implementation(libs.haze)
implementation(libs.haze.materials) implementation(libs.haze.materials)
testImplementation(libs.junit) implementation(libs.androidx.dynamicanimation)
androidTestImplementation(libs.androidx.junit) implementation(libs.androidx.compose.ui)
androidTestImplementation(libs.androidx.espresso.core) debugImplementation(libs.androidx.compose.ui.tooling)
androidTestImplementation(platform(libs.androidx.compose.bom)) implementation(libs.androidx.compose.foundation.layout)
androidTestImplementation(libs.androidx.ui.test.junit4) implementation(libs.aboutlibraries)
debugImplementation(libs.androidx.ui.tooling) implementation(libs.aboutlibraries.compose.m3)
debugImplementation(libs.androidx.ui.test.manifest) // compileOnly(fileTree(mapOf("dir" to "libs", "include" to listOf("*.aar"))))
} // implementation(fileTree(mapOf("dir" to "lib", "include" to listOf("*.aar"))))
compileOnly(files("libs/libxposed-api-100.aar"))
debugImplementation(files("libs/backdrop-debug.aar"))
releaseImplementation(files("libs/backdrop-release.aar"))
}
aboutLibraries {
export{
prettyPrint = true
excludeFields = listOf("generated")
outputFile = file("src/main/res/raw/aboutlibraries.json")
}
}

Binary file not shown.

Binary file not shown.

Binary file not shown.

View File

@@ -1,37 +0,0 @@
{
"version": 3,
"artifactType": {
"type": "APK",
"kind": "Directory"
},
"applicationId": "me.kavishdevar.aln",
"variantName": "release",
"elements": [
{
"type": "SINGLE",
"filters": [],
"attributes": [],
"versionCode": 1,
"versionName": "1.0",
"outputFile": "app-release.apk"
}
],
"elementType": "File",
"baselineProfiles": [
{
"minApi": 28,
"maxApi": 30,
"baselineProfiles": [
"baselineProfiles/1/app-release.dm"
]
},
{
"minApi": 31,
"maxApi": 2147483647,
"baselineProfiles": [
"baselineProfiles/0/app-release.dm"
]
}
],
"minSdkVersionForDexing": 28
}

View File

@@ -1,24 +0,0 @@
package me.kavishdevar.aln
import androidx.test.platform.app.InstrumentationRegistry
import androidx.test.ext.junit.runners.AndroidJUnit4
import org.junit.Test
import org.junit.runner.RunWith
import org.junit.Assert.*
/**
* Instrumented test, which will execute on an Android device.
*
* See [testing documentation](http://d.android.com/tools/testing).
*/
@RunWith(AndroidJUnit4::class)
class ExampleInstrumentedTest {
@Test
fun useAppContext() {
// Context of the app under test.
val appContext = InstrumentationRegistry.getInstrumentation().targetContext
assertEquals("me.kavishdevar.aln", appContext.packageName)
}
}

View File

@@ -2,19 +2,39 @@
<manifest xmlns:android="http://schemas.android.com/apk/res/android" <manifest xmlns:android="http://schemas.android.com/apk/res/android"
xmlns:tools="http://schemas.android.com/tools"> xmlns:tools="http://schemas.android.com/tools">
<uses-feature
android:name="android.hardware.telephony"
android:required="false" />
<uses-permission android:name="android.permission.BLUETOOTH_CONNECT" /> <uses-permission android:name="android.permission.BLUETOOTH_CONNECT" />
<uses-permission android:name="android.permission.FOREGROUND_SERVICE" /> <uses-permission android:name="android.permission.FOREGROUND_SERVICE"
tools:ignore="ForegroundServicesPolicy" />
<uses-permission android:name="android.permission.FOREGROUND_SERVICE_CONNECTED_DEVICE" /> <uses-permission android:name="android.permission.FOREGROUND_SERVICE_CONNECTED_DEVICE" />
<uses-permission android:name="android.permission.INTERACT_ACROSS_USERS"
tools:ignore="ProtectedPermissions" />
<uses-permission android:name="android.permission.BLUETOOTH_ADMIN" />
<uses-permission android:name="android.permission.POST_NOTIFICATIONS" /> <uses-permission android:name="android.permission.POST_NOTIFICATIONS" />
<uses-permission android:name="android.permission.RECEIVE_BOOT_COMPLETED" /> <uses-permission android:name="android.permission.RECEIVE_BOOT_COMPLETED" />
<uses-permission android:name="android.permission.SYSTEM_ALERT_WINDOW" /> <uses-permission android:name="android.permission.SYSTEM_ALERT_WINDOW" />
<uses-permission <uses-permission
android:name="android.permission.BLUETOOTH_PRIVILEGED" android:name="android.permission.BLUETOOTH_PRIVILEGED"
tools:ignore="ProtectedPermissions" /> tools:ignore="ProtectedPermissions" />
<uses-permission
android:name="android.permission.BLUETOOTH_ADMIN"
tools:ignore="ProtectedPermissions" />
<uses-permission android:name="android.permission.BLUETOOTH" /> <uses-permission android:name="android.permission.BLUETOOTH" />
<uses-permission
android:name="android.permission.BLUETOOTH_SCAN"
android:usesPermissionFlags="neverForLocation"
tools:ignore="UnusedAttribute" />
<uses-permission android:name="android.permission.BLUETOOTH_ADVERTISE" />
<uses-permission android:name="android.permission.READ_PHONE_STATE" />
<uses-permission android:name="android.permission.ANSWER_PHONE_CALLS" />
<uses-permission android:name="android.permission.MODIFY_AUDIO_SETTINGS" />
<uses-permission android:name="android.permission.INTERNET" />
<uses-permission android:name="android.permission.WRITE_EXTERNAL_STORAGE"
tools:ignore="ScopedStorage" />
<uses-permission android:name="android.permission.ACCESS_FINE_LOCATION"
android:maxSdkVersion="30" />
<uses-permission android:name="android.permission.ACCESS_COARSE_LOCATION"
android:maxSdkVersion="30" />
<application <application
android:allowBackup="true" android:allowBackup="true"
@@ -25,11 +45,24 @@
android:label="@string/app_name" android:label="@string/app_name"
android:roundIcon="@mipmap/ic_launcher_round" android:roundIcon="@mipmap/ic_launcher_round"
android:supportsRtl="true" android:supportsRtl="true"
android:theme="@style/Theme.ALN" android:theme="@style/Theme.LibrePods"
android:description="@string/app_description"
tools:ignore="UnusedAttribute" tools:ignore="UnusedAttribute"
tools:targetApi="31"> tools:targetApi="31">
<receiver <receiver
android:name=".BatteryWidget" android:name=".widgets.NoiseControlWidget"
android:exported="false">
<intent-filter>
<action android:name="android.appwidget.action.APPWIDGET_UPDATE" />
</intent-filter>
<meta-data
android:name="android.appwidget.provider"
android:resource="@xml/noise_control_widget_info" />
</receiver>
<receiver
android:name=".widgets.BatteryWidget"
android:exported="false"> android:exported="false">
<intent-filter> <intent-filter>
<action android:name="android.appwidget.action.APPWIDGET_UPDATE" /> <action android:name="android.appwidget.action.APPWIDGET_UPDATE" />
@@ -40,34 +73,41 @@
android:resource="@xml/battery_widget_info" /> android:resource="@xml/battery_widget_info" />
</receiver> </receiver>
<activity
android:name=".CustomDevice"
android:exported="true"
android:label="@string/title_activity_custom_device"
android:theme="@style/Theme.ALN">
<intent-filter>
<category android:name="android.intent.category.LAUNCHER" />
</intent-filter>
</activity>
<activity <activity
android:name=".MainActivity" android:name=".MainActivity"
android:exported="true" android:exported="true"
android:theme="@style/Theme.ALN"> android:theme="@style/Theme.LibrePods">
<intent-filter> <intent-filter>
<action android:name="android.intent.action.MAIN" /> <action android:name="android.intent.action.MAIN" />
<category android:name="android.intent.category.LAUNCHER" /> <category android:name="android.intent.category.LAUNCHER" />
</intent-filter> </intent-filter>
<!-- <intent-filter android:autoVerify="true">
<action android:name="android.intent.action.VIEW" />
<category android:name="android.intent.category.DEFAULT" />
<category android:name="android.intent.category.BROWSABLE" />
<data android:scheme="librepods"
android:host="add-magic-keys" />
</intent-filter> -->
</activity> </activity>
<activity
android:name=".QuickSettingsDialogActivity"
android:exported="false"
android:theme="@style/Theme.TransparentDialog"
android:launchMode="singleTask"
android:excludeFromRecents="true"
android:taskAffinity=""
/>
<service <service
android:name=".AirPodsService" android:name=".services.AirPodsService"
android:enabled="true" android:enabled="true"
android:exported="true" android:exported="true"
android:foregroundServiceType="connectedDevice" android:foregroundServiceType="connectedDevice"
android:permission="android.permission.BLUETOOTH_CONNECT" /> android:permission="android.permission.BLUETOOTH_CONNECT" />
<service <service
android:name=".AirPodsQSService" android:name=".services.AirPodsQSService"
android:exported="true" android:exported="true"
android:icon="@drawable/airpods" android:icon="@drawable/airpods"
android:label="ANC Mode" android:label="ANC Mode"
@@ -76,9 +116,19 @@
<action android:name="android.service.quicksettings.action.QS_TILE" /> <action android:name="android.service.quicksettings.action.QS_TILE" />
</intent-filter> </intent-filter>
</service> </service>
<service
android:name=".services.AppListenerService"
android:permission="android.permission.BIND_ACCESSIBILITY_SERVICE"
android:exported="true">
<intent-filter>
<action android:name="android.accessibilityservice.AccessibilityService" />
</intent-filter>
<meta-data
android:name="android.accessibilityservice"
android:resource="@xml/app_listener_service_config" />
</service>
<receiver <receiver
android:name=".BootReceiver" android:name=".receivers.BootReceiver"
android:enabled="true" android:enabled="true"
android:exported="true" android:exported="true"
android:label="@string/app_name"> android:label="@string/app_name">
@@ -87,6 +137,16 @@
<action android:name="android.intent.action.MY_PACKAGE_REPLACED" /> <action android:name="android.intent.action.MY_PACKAGE_REPLACED" />
</intent-filter> </intent-filter>
</receiver> </receiver>
<provider
android:name="androidx.core.content.FileProvider"
android:authorities="${applicationId}.provider"
android:exported="false"
android:grantUriPermissions="true">
<meta-data
android:name="android.support.FILE_PROVIDER_PATHS"
android:resource="@xml/file_paths" />
</provider>
</application> </application>
</manifest> </manifest>

View File

@@ -0,0 +1,12 @@
cmake_minimum_required(VERSION 3.22.1)
project("l2c_fcr_hook")
set(CMAKE_CXX_STANDARD 23)
add_library(${CMAKE_PROJECT_NAME} SHARED
l2c_fcr_hook.cpp
l2c_fcr_hook.h)
target_link_libraries(${CMAKE_PROJECT_NAME}
android
log)

View File

@@ -0,0 +1,491 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
#include <cstdint>
#include <cstring>
#include <dlfcn.h>
#include <android/log.h>
#include <fstream>
#include <string>
#include <sys/system_properties.h>
#include "l2c_fcr_hook.h"
#include <cerrno>
#include <cstdlib>
#define LOG_TAG "AirPodsHook"
#define LOGI(...) __android_log_print(ANDROID_LOG_INFO, LOG_TAG, __VA_ARGS__)
#define LOGE(...) __android_log_print(ANDROID_LOG_ERROR, LOG_TAG, __VA_ARGS__)
static HookFunType hook_func = nullptr;
#define L2CEVT_L2CAP_CONFIG_REQ 4
#define L2CEVT_L2CAP_CONFIG_RSP 15
struct t_l2c_lcb;
typedef struct _BT_HDR {
uint16_t event;
uint16_t len;
uint16_t offset;
uint16_t layer_specific;
uint8_t data[];
} BT_HDR;
typedef struct {
uint8_t mode;
uint8_t tx_win_sz;
uint8_t max_transmit;
uint16_t rtrans_tout;
uint16_t mon_tout;
uint16_t mps;
} tL2CAP_FCR;
// Flow spec structure
typedef struct {
uint8_t qos_present;
uint8_t flow_direction;
uint8_t service_type;
uint32_t token_rate;
uint32_t token_bucket_size;
uint32_t peak_bandwidth;
uint32_t latency;
uint32_t delay_variation;
} FLOW_SPEC;
// Configuration info structure
typedef struct {
uint16_t result;
uint16_t mtu_present;
uint16_t mtu;
uint16_t flush_to_present;
uint16_t flush_to;
uint16_t qos_present;
FLOW_SPEC qos;
uint16_t fcr_present;
tL2CAP_FCR fcr;
uint16_t fcs_present;
uint16_t fcs;
uint16_t ext_flow_spec_present;
FLOW_SPEC ext_flow_spec;
} tL2CAP_CFG_INFO;
// Basic L2CAP link control block
typedef struct {
bool wait_ack;
// Other FCR fields - not needed for our specific hook
} tL2C_FCRB;
// Forward declarations for needed types
struct t_l2c_rcb;
struct t_l2c_lcb;
typedef struct t_l2c_ccb {
struct t_l2c_ccb* p_next_ccb; // Next CCB in the chain
struct t_l2c_ccb* p_prev_ccb; // Previous CCB in the chain
struct t_l2c_lcb* p_lcb; // Link this CCB belongs to
struct t_l2c_rcb* p_rcb; // Registration CB for this Channel
uint16_t local_cid; // Local CID
uint16_t remote_cid; // Remote CID
uint16_t p_lcb_next; // For linking CCBs to an LCB
uint8_t ccb_priority; // Channel priority
uint16_t tx_mps; // MPS for outgoing messages
uint16_t max_rx_mtu; // Max MTU we will receive
// State variables
bool in_use; // True when channel active
uint8_t chnl_state; // Channel state
uint8_t local_id; // Transaction ID for local trans
uint8_t remote_id; // Transaction ID for remote
uint8_t timer_entry; // Timer entry
uint8_t is_flushable; // True if flushable
// Configuration variables
uint16_t our_cfg_bits; // Bitmap of local config bits
uint16_t peer_cfg_bits; // Bitmap of peer config bits
uint16_t config_done; // Configuration bitmask
uint16_t remote_config_rsp_result; // Remote config response result
tL2CAP_CFG_INFO our_cfg; // Our saved configuration options
tL2CAP_CFG_INFO peer_cfg; // Peer's saved configuration options
// Additional control fields
uint8_t remote_credit_count; // Credits sent to peer
tL2C_FCRB fcrb; // FCR info
bool ecoc; // Enhanced Credit-based mode
} tL2C_CCB;
static uint8_t (*original_l2c_fcr_chk_chan_modes)(void* p_ccb) = nullptr;
static void (*original_l2cu_process_our_cfg_req)(tL2C_CCB* p_ccb, tL2CAP_CFG_INFO* p_cfg) = nullptr;
static void (*original_l2c_csm_config)(tL2C_CCB* p_ccb, uint8_t event, void* p_data) = nullptr;
static void (*original_l2cu_send_peer_info_req)(tL2C_LCB* p_lcb, uint16_t info_type) = nullptr;
// Add original pointer for BTA_DmSetLocalDiRecord
static tBTA_STATUS (*original_BTA_DmSetLocalDiRecord)(tSDP_DI_RECORD* p_device_info, uint32_t* p_handle) = nullptr;
uint8_t fake_l2c_fcr_chk_chan_modes(void* p_ccb) {
LOGI("l2c_fcr_chk_chan_modes hooked, returning true.");
return 1;
}
void fake_l2cu_process_our_cfg_req(tL2C_CCB* p_ccb, tL2CAP_CFG_INFO* p_cfg) {
original_l2cu_process_our_cfg_req(p_ccb, p_cfg);
p_ccb->our_cfg.fcr.mode = 0x00;
LOGI("Set FCR mode to Basic Mode in outgoing config request");
}
void fake_l2c_csm_config(tL2C_CCB* p_ccb, uint8_t event, void* p_data) {
// Call the original function first to handle the specific code path where the FCR mode is checked
original_l2c_csm_config(p_ccb, event, p_data);
// Check if this happens during CONFIG_RSP event handling
if (event == L2CEVT_L2CAP_CONFIG_RSP) {
p_ccb->our_cfg.fcr.mode = p_ccb->peer_cfg.fcr.mode;
LOGI("Forced compatibility in l2c_csm_config: set our_mode=%d to match peer_mode=%d",
p_ccb->our_cfg.fcr.mode, p_ccb->peer_cfg.fcr.mode);
}
}
// Replacement function that does nothing
void fake_l2cu_send_peer_info_req(tL2C_LCB* p_lcb, uint16_t info_type) {
LOGI("Intercepted l2cu_send_peer_info_req for info_type 0x%04x - doing nothing", info_type);
// Just return without doing anything
return;
}
// New loader for SDP hook offset (persist.librepods.sdp_offset)
uintptr_t loadSdpOffset() {
const char* property_name = "persist.librepods.sdp_offset";
char value[PROP_VALUE_MAX] = {0};
int len = __system_property_get(property_name, value);
if (len > 0) {
LOGI("Read sdp offset from property: %s", value);
uintptr_t offset;
char* endptr = nullptr;
const char* parse_start = value;
if (value[0] == '0' && (value[1] == 'x' || value[1] == 'X')) {
parse_start = value + 2;
}
errno = 0;
offset = strtoul(parse_start, &endptr, 16);
if (errno == 0 && endptr != parse_start && *endptr == '\0' && offset > 0) {
LOGI("Parsed sdp offset: 0x%x", offset);
return offset;
}
LOGE("Failed to parse sdp offset from property value: %s", value);
}
LOGI("No sdp offset property present - skipping SDP hook");
return 0;
}
// Fake BTA_DmSetLocalDiRecord: set vendor/vendor_id_source then call original
tBTA_STATUS fake_BTA_DmSetLocalDiRecord(tSDP_DI_RECORD* p_device_info, uint32_t* p_handle) {
LOGI("BTA_DmSetLocalDiRecord hooked - forcing vendor fields");
if (p_device_info) {
p_device_info->vendor = 0x004C;
p_device_info->vendor_id_source = 0x0001;
}
LOGI("Set vendor=0x%04x, vendor_id_source=0x%04x", p_device_info->vendor, p_device_info->vendor_id_source);
if (original_BTA_DmSetLocalDiRecord) {
return original_BTA_DmSetLocalDiRecord(p_device_info, p_handle);
}
LOGE("Original BTA_DmSetLocalDiRecord not available");
return BTA_FAILURE;
}
uintptr_t loadHookOffset([[maybe_unused]] const char* package_name) {
const char* property_name = "persist.librepods.hook_offset";
char value[PROP_VALUE_MAX] = {0};
int len = __system_property_get(property_name, value);
if (len > 0) {
LOGI("Read hook offset from property: %s", value);
uintptr_t offset;
char* endptr = nullptr;
const char* parse_start = value;
if (value[0] == '0' && (value[1] == 'x' || value[1] == 'X')) {
parse_start = value + 2;
}
errno = 0;
offset = strtoul(parse_start, &endptr, 16);
if (errno == 0 && endptr != parse_start && *endptr == '\0' && offset > 0) {
LOGI("Parsed offset: 0x%x", offset);
return offset;
}
LOGE("Failed to parse offset from property value: %s", value);
}
LOGI("Using hardcoded fallback offset");
return 0x00a55e30;
}
uintptr_t loadL2cuProcessCfgReqOffset() {
const char* property_name = "persist.librepods.cfg_req_offset";
char value[PROP_VALUE_MAX] = {0};
int len = __system_property_get(property_name, value);
if (len > 0) {
LOGI("Read l2cu_process_our_cfg_req offset from property: %s", value);
uintptr_t offset;
char* endptr = nullptr;
const char* parse_start = value;
if (value[0] == '0' && (value[1] == 'x' || value[1] == 'X')) {
parse_start = value + 2;
}
errno = 0;
offset = strtoul(parse_start, &endptr, 16);
if (errno == 0 && endptr != parse_start && *endptr == '\0' && offset > 0) {
LOGI("Parsed l2cu_process_our_cfg_req offset: 0x%x", offset);
return offset;
}
LOGE("Failed to parse l2cu_process_our_cfg_req offset from property value: %s", value);
}
// Return 0 if not found - we'll skip this hook
return 0;
}
uintptr_t loadL2cCsmConfigOffset() {
const char* property_name = "persist.librepods.csm_config_offset";
char value[PROP_VALUE_MAX] = {0};
int len = __system_property_get(property_name, value);
if (len > 0) {
LOGI("Read l2c_csm_config offset from property: %s", value);
uintptr_t offset;
char* endptr = nullptr;
const char* parse_start = value;
if (value[0] == '0' && (value[1] == 'x' || value[1] == 'X')) {
parse_start = value + 2;
}
errno = 0;
offset = strtoul(parse_start, &endptr, 16);
if (errno == 0 && endptr != parse_start && *endptr == '\0' && offset > 0) {
LOGI("Parsed l2c_csm_config offset: 0x%x", offset);
return offset;
}
LOGE("Failed to parse l2c_csm_config offset from property value: %s", value);
}
// Return 0 if not found - we'll skip this hook
return 0;
}
uintptr_t loadL2cuSendPeerInfoReqOffset() {
const char* property_name = "persist.librepods.peer_info_req_offset";
char value[PROP_VALUE_MAX] = {0};
int len = __system_property_get(property_name, value);
if (len > 0) {
LOGI("Read l2cu_send_peer_info_req offset from property: %s", value);
uintptr_t offset;
char* endptr = nullptr;
const char* parse_start = value;
if (value[0] == '0' && (value[1] == 'x' || value[1] == 'X')) {
parse_start = value + 2;
}
errno = 0;
offset = strtoul(parse_start, &endptr, 16);
if (errno == 0 && endptr != parse_start && *endptr == '\0' && offset > 0) {
LOGI("Parsed l2cu_send_peer_info_req offset: 0x%x", offset);
return offset;
}
LOGE("Failed to parse l2cu_send_peer_info_req offset from property value: %s", value);
}
// Return 0 if not found - we'll skip this hook
return 0;
}
uintptr_t getModuleBase(const char *module_name) {
FILE *fp;
char line[1024];
uintptr_t base_addr = 0;
fp = fopen("/proc/self/maps", "r");
if (!fp) {
LOGE("Failed to open /proc/self/maps");
return 0;
}
while (fgets(line, sizeof(line), fp)) {
if (strstr(line, module_name)) {
char *start_addr_str = line;
char *end_addr_str = strchr(line, '-');
if (end_addr_str) {
*end_addr_str = '\0';
base_addr = strtoull(start_addr_str, nullptr, 16);
break;
}
}
}
fclose(fp);
return base_addr;
}
bool findAndHookFunction(const char *library_name) {
if (!hook_func) {
LOGE("Hook function not initialized");
return false;
}
uintptr_t base_addr = getModuleBase(library_name);
if (!base_addr) {
LOGE("Failed to get base address of %s", library_name);
return false;
}
// Load all offsets from system properties - no hardcoding
uintptr_t l2c_fcr_offset = loadHookOffset(nullptr);
uintptr_t l2cu_process_our_cfg_req_offset = loadL2cuProcessCfgReqOffset();
uintptr_t l2c_csm_config_offset = loadL2cCsmConfigOffset();
uintptr_t l2cu_send_peer_info_req_offset = loadL2cuSendPeerInfoReqOffset();
uintptr_t sdp_offset = loadSdpOffset();
bool success = false;
// Hook l2c_fcr_chk_chan_modes - this is our primary hook
if (l2c_fcr_offset > 0) {
void* target = reinterpret_cast<void*>(base_addr + l2c_fcr_offset);
LOGI("Hooking l2c_fcr_chk_chan_modes at offset: 0x%x, base: %p, target: %p",
l2c_fcr_offset, (void*)base_addr, target);
int result = hook_func(target, (void*)fake_l2c_fcr_chk_chan_modes, (void**)&original_l2c_fcr_chk_chan_modes);
if (result != 0) {
LOGE("Failed to hook l2c_fcr_chk_chan_modes, error: %d", result);
return false;
}
LOGI("Successfully hooked l2c_fcr_chk_chan_modes");
success = true;
} else {
LOGE("No valid offset for l2c_fcr_chk_chan_modes found, cannot proceed");
return false;
}
// Hook l2cu_process_our_cfg_req if offset is available
if (l2cu_process_our_cfg_req_offset > 0) {
void* target = reinterpret_cast<void*>(base_addr + l2cu_process_our_cfg_req_offset);
LOGI("Hooking l2cu_process_our_cfg_req at offset: 0x%x, base: %p, target: %p",
l2cu_process_our_cfg_req_offset, (void*)base_addr, target);
int result = hook_func(target, (void*)fake_l2cu_process_our_cfg_req, (void**)&original_l2cu_process_our_cfg_req);
if (result != 0) {
LOGE("Failed to hook l2cu_process_our_cfg_req, error: %d", result);
// Continue even if this hook fails
} else {
LOGI("Successfully hooked l2cu_process_our_cfg_req");
}
} else {
LOGI("Skipping l2cu_process_our_cfg_req hook as offset is not available");
}
// Hook l2c_csm_config if offset is available
if (l2c_csm_config_offset > 0) {
void* target = reinterpret_cast<void*>(base_addr + l2c_csm_config_offset);
LOGI("Hooking l2c_csm_config at offset: 0x%x, base: %p, target: %p",
l2c_csm_config_offset, (void*)base_addr, target);
int result = hook_func(target, (void*)fake_l2c_csm_config, (void**)&original_l2c_csm_config);
if (result != 0) {
LOGE("Failed to hook l2c_csm_config, error: %d", result);
// Continue even if this hook fails
} else {
LOGI("Successfully hooked l2c_csm_config");
}
} else {
LOGI("Skipping l2c_csm_config hook as offset is not available");
}
// Hook l2cu_send_peer_info_req if offset is available
if (l2cu_send_peer_info_req_offset > 0) {
void* target = reinterpret_cast<void*>(base_addr + l2cu_send_peer_info_req_offset);
LOGI("Hooking l2cu_send_peer_info_req at offset: 0x%x, base: %p, target: %p",
l2cu_send_peer_info_req_offset, (void*)base_addr, target);
int result = hook_func(target, (void*)fake_l2cu_send_peer_info_req, (void**)&original_l2cu_send_peer_info_req);
if (result != 0) {
LOGE("Failed to hook l2cu_send_peer_info_req, error: %d", result);
// Continue even if this hook fails
} else {
LOGI("Successfully hooked l2cu_send_peer_info_req");
}
} else {
LOGI("Skipping l2cu_send_peer_info_req hook as offset is not available");
}
if (sdp_offset > 0) {
void* target = reinterpret_cast<void*>(base_addr + sdp_offset);
LOGI("Hooking BTA_DmSetLocalDiRecord at offset: 0x%x, base: %p, target: %p",
sdp_offset, (void*)base_addr, target);
int result = hook_func(target, (void*)fake_BTA_DmSetLocalDiRecord, (void**)&original_BTA_DmSetLocalDiRecord);
if (result != 0) {
LOGE("Failed to hook BTA_DmSetLocalDiRecord, error: %d", result);
} else {
LOGI("Successfully hooked BTA_DmSetLocalDiRecord (SDP)");
}
} else {
LOGI("Skipping BTA_DmSetLocalDiRecord hook as sdp offset is not available");
}
return success;
}
void on_library_loaded(const char *name, [[maybe_unused]] void *handle) {
if (strstr(name, "libbluetooth_jni.so")) {
LOGI("Detected Bluetooth JNI library: %s", name);
bool hooked = findAndHookFunction("libbluetooth_jni.so");
if (!hooked) {
LOGE("Failed to hook Bluetooth JNI library function");
}
} else if (strstr(name, "libbluetooth_qti.so")) {
LOGI("Detected Bluetooth QTI library: %s", name);
bool hooked = findAndHookFunction("libbluetooth_qti.so");
if (!hooked) {
LOGE("Failed to hook Bluetooth QTI library function");
}
}
}
extern "C" [[gnu::visibility("default")]] [[gnu::used]]
NativeOnModuleLoaded native_init(const NativeAPIEntries* entries) {
LOGI("L2C FCR Hook module initialized");
hook_func = entries->hook_func;
return on_library_loaded;
}

View File

@@ -0,0 +1,50 @@
#pragma once
#include <cstdint>
#include <vector>
typedef int (*HookFunType)(void *func, void *replace, void **backup);
typedef int (*UnhookFunType)(void *func);
typedef void (*NativeOnModuleLoaded)(const char *name, void *handle);
typedef struct {
uint32_t version;
HookFunType hook_func;
UnhookFunType unhook_func;
} NativeAPIEntries;
[[maybe_unused]] typedef NativeOnModuleLoaded (*NativeInit)(const NativeAPIEntries *entries);
typedef struct t_l2c_ccb tL2C_CCB;
typedef struct t_l2c_lcb tL2C_LCB;
uintptr_t loadHookOffset(const char* package_name);
uintptr_t getModuleBase(const char *module_name);
uintptr_t loadL2cuProcessCfgReqOffset();
uintptr_t loadL2cCsmConfigOffset();
uintptr_t loadL2cuSendPeerInfoReqOffset();
bool findAndHookFunction(const char *library_path);
#define SDP_MAX_ATTR_LEN 400
typedef struct t_sdp_di_record {
uint16_t vendor;
uint16_t vendor_id_source;
uint16_t product;
uint16_t version;
bool primary_record;
char client_executable_url[SDP_MAX_ATTR_LEN];
char service_description[SDP_MAX_ATTR_LEN];
char documentation_url[SDP_MAX_ATTR_LEN];
} tSDP_DI_RECORD;
typedef enum : uint8_t {
BTA_SUCCESS = 0, /* Successful operation. */
BTA_FAILURE = 1, /* Generic failure. */
BTA_PENDING = 2, /* API cannot be completed right now */
BTA_BUSY = 3,
BTA_NO_RESOURCES = 4,
BTA_WRONG_MODE = 5,
} tBTA_STATUS;

View File

@@ -1,112 +0,0 @@
package me.kavishdevar.aln
import android.annotation.SuppressLint
import android.content.BroadcastReceiver
import android.content.Context
import android.content.Intent
import android.content.IntentFilter
import android.service.quicksettings.Tile
import android.service.quicksettings.TileService
import android.util.Log
class AirPodsQSService: TileService() {
private val ancModes = listOf(NoiseControlMode.NOISE_CANCELLATION.name, NoiseControlMode.TRANSPARENCY.name, NoiseControlMode.ADAPTIVE.name)
private var currentModeIndex = 2
private lateinit var ancStatusReceiver: BroadcastReceiver
private lateinit var availabilityReceiver: BroadcastReceiver
@SuppressLint("InlinedApi")
override fun onStartListening() {
super.onStartListening()
currentModeIndex = (ServiceManager.getService()?.getANC()?.minus(1)) ?: -1
if (currentModeIndex == -1) {
currentModeIndex = 2
}
if (ServiceManager.getService() == null) {
qsTile.state = Tile.STATE_UNAVAILABLE
qsTile.updateTile()
}
if (ServiceManager.getService()?.isConnected == true) {
qsTile.state = Tile.STATE_ACTIVE
qsTile.updateTile()
}
else {
qsTile.state = Tile.STATE_UNAVAILABLE
qsTile.updateTile()
}
ancStatusReceiver = object : BroadcastReceiver() {
override fun onReceive(context: Context, intent: Intent) {
val ancStatus = intent.getIntExtra("data", 4)
currentModeIndex = if (ancStatus == 2) 0 else if (ancStatus == 3) 1 else if (ancStatus == 4) 2 else 2
updateTile()
}
}
availabilityReceiver = object : BroadcastReceiver() {
override fun onReceive(context: Context, intent: Intent) {
if (intent.action == AirPodsNotifications.AIRPODS_CONNECTED) {
qsTile.state = Tile.STATE_ACTIVE
qsTile.updateTile()
}
else if (intent.action == AirPodsNotifications.AIRPODS_DISCONNECTED) {
qsTile.state = Tile.STATE_UNAVAILABLE
qsTile.updateTile()
}
}
}
registerReceiver(ancStatusReceiver, IntentFilter(AirPodsNotifications.ANC_DATA), RECEIVER_EXPORTED)
qsTile.state = if (ServiceManager.getService()?.isConnected == true) Tile.STATE_ACTIVE else Tile.STATE_UNAVAILABLE
val ancIndex = ServiceManager.getService()?.getANC()
currentModeIndex = if (ancIndex != null) { if (ancIndex == 2) 0 else if (ancIndex == 3) 1 else if (ancIndex == 4) 2 else 2 } else 0
updateTile()
}
override fun onStopListening() {
super.onStopListening()
try {
unregisterReceiver(ancStatusReceiver)
}
catch (
_: IllegalArgumentException
)
{
Log.e("QuickSettingTileService", "Receiver not registered")
}
try {
unregisterReceiver(availabilityReceiver)
}
catch (
_: IllegalArgumentException
)
{
Log.e("QuickSettingTileService", "Receiver not registered")
}
}
override fun onClick() {
super.onClick()
Log.d("QuickSettingTileService", "ANC tile clicked")
currentModeIndex = (currentModeIndex + 1) % ancModes.size
Log.d("QuickSettingTileService", "New mode index: $currentModeIndex, would be set to ${currentModeIndex + 1}")
switchAncMode()
}
private fun updateTile() {
val currentMode = ancModes[currentModeIndex % ancModes.size]
qsTile.label = currentMode.replace("_", " ").lowercase().replaceFirstChar { it.uppercase() }
qsTile.state = Tile.STATE_ACTIVE
qsTile.updateTile()
}
private fun switchAncMode() {
val airPodsService = ServiceManager.getService()
Log.d("QuickSettingTileService", "Setting ANC mode to ${currentModeIndex + 2}")
airPodsService?.setANCMode(currentModeIndex + 2)
Log.d("QuickSettingTileService", "ANC mode set to ${currentModeIndex + 2}")
updateTile()
}
}

View File

@@ -1,736 +0,0 @@
package me.kavishdevar.aln
import android.annotation.SuppressLint
import android.app.Notification
import android.app.NotificationChannel
import android.app.NotificationManager
import android.app.Service
import android.bluetooth.BluetoothDevice
import android.bluetooth.BluetoothManager
import android.bluetooth.BluetoothProfile
import android.bluetooth.BluetoothSocket
import android.content.BroadcastReceiver
import android.content.Context
import android.content.Intent
import android.content.IntentFilter
import android.media.AudioManager
import android.os.Binder
import android.os.Build
import android.os.IBinder
import android.os.ParcelUuid
import android.util.Log
import android.widget.RemoteViews
import androidx.core.app.NotificationCompat
import kotlinx.coroutines.CoroutineScope
import kotlinx.coroutines.Dispatchers
import kotlinx.coroutines.launch
import org.lsposed.hiddenapibypass.HiddenApiBypass
object ServiceManager {
private var service: AirPodsService? = null
@Synchronized
fun getService(): AirPodsService? {
return service
}
@Synchronized
fun setService(service: AirPodsService?) {
this.service = service
}
}
@Suppress("unused")
class AirPodsService: Service() {
inner class LocalBinder : Binder() {
fun getService(): AirPodsService = this@AirPodsService
}
override fun onBind(intent: Intent?): IBinder {
return LocalBinder()
}
var popupShown = false
fun showPopup(service: Service, name: String) {
if (popupShown) {
return
}
val window = Window(service.applicationContext)
window.open(name, batteryNotification)
popupShown = true
}
@Suppress("ClassName")
private object bluetoothReceiver: BroadcastReceiver() {
@SuppressLint("NewApi", "MissingPermission")
override fun onReceive(context: Context?, intent: Intent) {
val bluetoothDevice =
intent.getParcelableExtra("android.bluetooth.device.extra.DEVICE", BluetoothDevice::class.java)
val action = intent.action
val context = context?.applicationContext
val name = context?.getSharedPreferences("settings", MODE_PRIVATE)?.getString("name", bluetoothDevice?.name)
if (bluetoothDevice != null && action != null && !action.isEmpty()) {
Log.d("AirPodsService", "Received bluetooth connection broadcast")
if (BluetoothDevice.ACTION_ACL_CONNECTED == action) {
val uuid = ParcelUuid.fromString("74ec2172-0bad-4d01-8f77-997b2be0722a")
if (bluetoothDevice.uuids.contains(uuid)) {
val intent = Intent(AirPodsNotifications.AIRPODS_CONNECTION_DETECTED)
intent.putExtra("name", name)
intent.putExtra("device", bluetoothDevice)
context?.sendBroadcast(intent)
}
}
// Airpods disconnected, remove notification but leave the scanner going.
if (BluetoothDevice.ACTION_ACL_DISCONNECTED == action
|| BluetoothDevice.ACTION_ACL_DISCONNECT_REQUESTED == action
) {
context?.sendBroadcast(
Intent(AirPodsNotifications.AIRPODS_DISCONNECTED)
)
}
}
}
}
var isConnected = false
var device: BluetoothDevice? = null
private lateinit var earReceiver: BroadcastReceiver
fun startForegroundNotification() {
val notificationChannel = NotificationChannel(
"background_service_status",
"Background Service Status",
NotificationManager.IMPORTANCE_LOW
)
val notificationManager = getSystemService(NotificationManager::class.java)
notificationManager.createNotificationChannel(notificationChannel)
val notification = NotificationCompat.Builder(this, "background_service_status")
.setSmallIcon(R.drawable.airpods)
.setContentTitle("AirPods Service")
.setContentText("Service is running in the background")
.setCategory(Notification.CATEGORY_SERVICE)
.setPriority(NotificationCompat.PRIORITY_LOW)
.build()
try {
startForeground(1, notification)
}
catch (e: Exception) {
e.printStackTrace()
}
}
fun updateNotificationContent(connected: Boolean, airpodsName: String? = null, batteryList: List<Battery>? = null) {
val notificationManager = getSystemService(NotificationManager::class.java)
val textColor = this.getSharedPreferences("settings", MODE_PRIVATE).getLong("textColor", 0)
var updatedNotification: Notification? = null
if (connected) {
val collapsedRemoteViews = RemoteViews(packageName, R.layout.notification)
val expandedRemoteViews = RemoteViews(packageName, R.layout.notification_expanded)
collapsedRemoteViews.setTextColor(R.id.notification_title, textColor.toInt())
collapsedRemoteViews.setTextViewText(R.id.notification_title, "Connected to $airpodsName")
expandedRemoteViews.setTextViewText(
R.id.notification_title,
"Connected to $airpodsName"
)
expandedRemoteViews.setTextViewText(
R.id.left_battery_notification,
batteryList?.find { it.component == BatteryComponent.LEFT }?.let {
if (it.status != BatteryStatus.DISCONNECTED) {
"Left ${if (it.status == BatteryStatus.CHARGING) "⚡" else ""} ${it.level}%"
} else {
""
}
} ?: "")
expandedRemoteViews.setTextViewText(
R.id.right_battery_notification,
batteryList?.find { it.component == BatteryComponent.RIGHT }?.let {
if (it.status != BatteryStatus.DISCONNECTED) {
"Right ${if (it.status == BatteryStatus.CHARGING) "⚡" else ""} ${it.level}%"
} else {
""
}
} ?: "")
expandedRemoteViews.setTextViewText(
R.id.case_battery_notification,
batteryList?.find { it.component == BatteryComponent.CASE }?.let {
if (it.status != BatteryStatus.DISCONNECTED) {
"Case ${if (it.status == BatteryStatus.CHARGING) "⚡" else ""} ${it.level}%"
} else {
""
}
} ?: "")
expandedRemoteViews.setTextColor(R.id.notification_title, textColor.toInt())
expandedRemoteViews.setTextColor(R.id.left_battery_notification, textColor.toInt())
expandedRemoteViews.setTextColor(R.id.right_battery_notification, textColor.toInt())
expandedRemoteViews.setTextColor(R.id.case_battery_notification, textColor.toInt())
updatedNotification = NotificationCompat.Builder(this, "background_service_status")
.setSmallIcon(R.drawable.airpods)
.setStyle(NotificationCompat.DecoratedCustomViewStyle())
.setCustomContentView(collapsedRemoteViews)
.setCustomBigContentView(expandedRemoteViews)
.setPriority(NotificationCompat.PRIORITY_LOW)
.setCategory(Notification.CATEGORY_SERVICE)
.setOngoing(true)
.build()
} else {
updatedNotification = NotificationCompat.Builder(this, "background_service_status")
.setSmallIcon(R.drawable.airpods)
.setContentTitle("AirPods Service")
.setContentText("Service is running in the background!")
.setCategory(Notification.CATEGORY_SERVICE)
.setPriority(NotificationCompat.PRIORITY_LOW)
.build()
}
// Notify the NotificationManager with the same ID
notificationManager.notify(1, updatedNotification)
}
private lateinit var connectionReceiver: BroadcastReceiver
private lateinit var disconnectionReceiver: BroadcastReceiver
@SuppressLint("InlinedApi", "MissingPermission")
override fun onStartCommand(intent: Intent?, flags: Int, startId: Int): Int {
Log.d("AirPodsService", "Service started")
ServiceManager.setService(this)
startForegroundNotification()
registerReceiver(bluetoothReceiver, BluetoothReceiver.buildFilter(), RECEIVER_EXPORTED)
connectionReceiver = object: BroadcastReceiver() {
override fun onReceive(context: Context?, intent: Intent?) {
if (intent?.action == AirPodsNotifications.AIRPODS_CONNECTION_DETECTED) {
val name = this@AirPodsService.getSharedPreferences("settings", MODE_PRIVATE)
.getString("name", device?.name)
Log.d("AirPodsService", "$name connected")
device = intent.getParcelableExtra("device", BluetoothDevice::class.java)!!
showPopup(this@AirPodsService, name.toString())
connectToSocket(device!!)
updateNotificationContent(true, name.toString(), batteryNotification.getBattery())
}
else if (intent?.action == AirPodsNotifications.AIRPODS_DISCONNECTED) {
device = null
isConnected = false
popupShown = false
updateNotificationContent(false)
}
}
}
val intentFilter = IntentFilter().apply {
addAction(AirPodsNotifications.AIRPODS_CONNECTION_DETECTED)
addAction(AirPodsNotifications.AIRPODS_DISCONNECTED)
}
registerReceiver(connectionReceiver, intentFilter, RECEIVER_EXPORTED)
val bluetoothAdapter = getSystemService(BluetoothManager::class.java).adapter
bluetoothAdapter.bondedDevices.forEach { device ->
if (device.uuids.contains(ParcelUuid.fromString("74ec2172-0bad-4d01-8f77-997b2be0722a"))) {
bluetoothAdapter.getProfileProxy(this, object : BluetoothProfile.ServiceListener {
override fun onServiceConnected(profile: Int, proxy: BluetoothProfile) {
if (profile == BluetoothProfile.A2DP) {
val connectedDevices = proxy.connectedDevices
if (connectedDevices.isNotEmpty()) {
connectToSocket(device)
this@AirPodsService.sendBroadcast(
Intent(AirPodsNotifications.AIRPODS_CONNECTED)
)
}
}
bluetoothAdapter.closeProfileProxy(profile, proxy)
}
override fun onServiceDisconnected(profile: Int) { }
}, BluetoothProfile.A2DP)
}
}
return START_STICKY
}
private lateinit var socket: BluetoothSocket
@SuppressLint("MissingPermission", "UnspecifiedRegisterReceiverFlag")
fun connectToSocket(device: BluetoothDevice) {
HiddenApiBypass.addHiddenApiExemptions("Landroid/bluetooth/BluetoothSocket;")
val uuid: ParcelUuid = ParcelUuid.fromString("74ec2172-0bad-4d01-8f77-997b2be0722a")
if (isConnected != true) {
try {
socket = HiddenApiBypass.newInstance(
BluetoothSocket::class.java,
3,
true,
true,
device,
0x1001,
uuid
) as BluetoothSocket
} catch (
e: Exception
) {
e.printStackTrace()
try {
socket = HiddenApiBypass.newInstance(
BluetoothSocket::class.java,
3,
1,
true,
true,
device,
0x1001,
uuid
) as BluetoothSocket
} catch (
e: Exception
) {
e.printStackTrace()
}
}
try {
socket.connect()
this@AirPodsService.device = device
isConnected = true
socket.let { it ->
it.outputStream.write(Enums.HANDSHAKE.value)
it.outputStream.flush()
it.outputStream.write(Enums.SET_SPECIFIC_FEATURES.value)
it.outputStream.flush()
it.outputStream.write(Enums.REQUEST_NOTIFICATIONS.value)
it.outputStream.flush()
sendBroadcast(
Intent(AirPodsNotifications.AIRPODS_CONNECTED)
.putExtra("device", device)
)
CoroutineScope(Dispatchers.IO).launch {
while (socket.isConnected == true) {
socket.let {
val audioManager =
this@AirPodsService.getSystemService(AUDIO_SERVICE) as AudioManager
MediaController.initialize(audioManager)
val buffer = ByteArray(1024)
val bytesRead = it.inputStream.read(buffer)
var data: ByteArray = byteArrayOf()
if (bytesRead > 0) {
data = buffer.copyOfRange(0, bytesRead)
sendBroadcast(Intent(AirPodsNotifications.AIRPODS_DATA).apply {
putExtra("data", buffer.copyOfRange(0, bytesRead))
})
val bytes = buffer.copyOfRange(0, bytesRead)
val formattedHex = bytes.joinToString(" ") { "%02X".format(it) }
Log.d("AirPods Data", "Data received: $formattedHex")
} else if (bytesRead == -1) {
Log.d("AirPods Service", "Socket closed (bytesRead = -1)")
// socket.close()
sendBroadcast(Intent(AirPodsNotifications.AIRPODS_DISCONNECTED))
return@launch
}
var inEar = false
var inEarData = listOf<Boolean>()
if (earDetectionNotification.isEarDetectionData(data)) {
earDetectionNotification.setStatus(data)
sendBroadcast(Intent(AirPodsNotifications.EAR_DETECTION_DATA).apply {
val list = earDetectionNotification.status
val bytes = ByteArray(2)
bytes[0] = list[0]
bytes[1] = list[1]
putExtra("data", bytes)
})
Log.d(
"AirPods Parser",
"Ear Detection: ${earDetectionNotification.status[0]} ${earDetectionNotification.status[1]}"
)
var justEnabledA2dp = false
earReceiver = object : BroadcastReceiver() {
override fun onReceive(context: Context, intent: Intent) {
val data = intent.getByteArrayExtra("data")
if (data != null && earDetectionEnabled) {
inEar =
if (data.find { it == 0x02.toByte() } != null || data.find { it == 0x03.toByte() } != null) {
data[0] == 0x00.toByte() || data[1] == 0x00.toByte()
} else {
data[0] == 0x00.toByte() && data[1] == 0x00.toByte()
}
val newInEarData = listOf(
data[0] == 0x00.toByte(),
data[1] == 0x00.toByte()
)
if (newInEarData.contains(true) && inEarData == listOf(
false,
false
)
) {
connectAudio(this@AirPodsService, device)
justEnabledA2dp = true
val bluetoothAdapter =
this@AirPodsService.getSystemService(
BluetoothManager::class.java
).adapter
bluetoothAdapter.getProfileProxy(
this@AirPodsService,
object : BluetoothProfile.ServiceListener {
override fun onServiceConnected(
profile: Int,
proxy: BluetoothProfile
) {
if (profile == BluetoothProfile.A2DP) {
val connectedDevices =
proxy.connectedDevices
if (connectedDevices.isNotEmpty()) {
MediaController.sendPlay()
}
}
bluetoothAdapter.closeProfileProxy(
profile,
proxy
)
}
override fun onServiceDisconnected(
profile: Int
) {
}
},
BluetoothProfile.A2DP
)
} else if (newInEarData == listOf(false, false)) {
disconnectAudio(this@AirPodsService, device)
}
inEarData = newInEarData
if (inEar == true) {
if (!justEnabledA2dp) {
justEnabledA2dp = false
MediaController.sendPlay()
}
} else {
MediaController.sendPause()
}
}
}
}
val earIntentFilter =
IntentFilter(AirPodsNotifications.EAR_DETECTION_DATA)
if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.TIRAMISU) {
this@AirPodsService.registerReceiver(
earReceiver, earIntentFilter,
RECEIVER_EXPORTED
)
} else {
this@AirPodsService.registerReceiver(
earReceiver,
earIntentFilter
)
}
} else if (ancNotification.isANCData(data)) {
ancNotification.setStatus(data)
sendBroadcast(Intent(AirPodsNotifications.ANC_DATA).apply {
putExtra("data", ancNotification.status)
})
Log.d("AirPods Parser", "ANC: ${ancNotification.status}")
} else if (batteryNotification.isBatteryData(data)) {
batteryNotification.setBattery(data)
sendBroadcast(Intent(AirPodsNotifications.BATTERY_DATA).apply {
putParcelableArrayListExtra(
"data",
ArrayList(batteryNotification.getBattery())
)
})
updateNotificationContent(
true,
this@AirPodsService.getSharedPreferences(
"settings",
MODE_PRIVATE
).getString("name", device.name),
batteryNotification.getBattery()
)
for (battery in batteryNotification.getBattery()) {
Log.d(
"AirPods Parser",
"${battery.getComponentName()}: ${battery.getStatusName()} at ${battery.level}% "
)
}
if (batteryNotification.getBattery()[0].status == 1 && batteryNotification.getBattery()[1].status == 1) {
disconnectAudio(this@AirPodsService, device)
} else {
connectAudio(this@AirPodsService, device)
}
} else if (conversationAwarenessNotification.isConversationalAwarenessData(
data
)
) {
conversationAwarenessNotification.setData(data)
sendBroadcast(Intent(AirPodsNotifications.CA_DATA).apply {
putExtra("data", conversationAwarenessNotification.status)
})
if (conversationAwarenessNotification.status == 1.toByte() || conversationAwarenessNotification.status == 2.toByte()) {
MediaController.startSpeaking()
} else if (conversationAwarenessNotification.status == 8.toByte() || conversationAwarenessNotification.status == 9.toByte()) {
MediaController.stopSpeaking()
}
Log.d(
"AirPods Parser",
"Conversation Awareness: ${conversationAwarenessNotification.status}"
)
} else {
}
}
}
Log.d("AirPods Service", "Socket closed")
isConnected = false
socket.close()
sendBroadcast(Intent(AirPodsNotifications.AIRPODS_DISCONNECTED))
}
}
} catch (e: Exception) {
e.printStackTrace()
Log.d("AirPodsService", "Failed to connect to socket")
}
}
}
fun sendPacket(packet: String) {
val fromHex = packet.split(" ").map { it.toInt(16).toByte() }
socket.outputStream?.write(fromHex.toByteArray())
socket.outputStream?.flush()
}
fun setANCMode(mode: Int) {
when (mode) {
1 -> {
socket.outputStream?.write(Enums.NOISE_CANCELLATION_OFF.value)
}
2 -> {
socket.outputStream?.write(Enums.NOISE_CANCELLATION_ON.value)
}
3 -> {
socket.outputStream?.write(Enums.NOISE_CANCELLATION_TRANSPARENCY.value)
}
4 -> {
socket.outputStream?.write(Enums.NOISE_CANCELLATION_ADAPTIVE.value)
}
}
socket.outputStream?.flush()
}
fun setCAEnabled(enabled: Boolean) {
socket.outputStream?.write(if (enabled) Enums.SET_CONVERSATION_AWARENESS_ON.value else Enums.SET_CONVERSATION_AWARENESS_OFF.value)
socket.outputStream?.flush()
}
fun setOffListeningMode(enabled: Boolean) {
socket.outputStream?.write(byteArrayOf(0x04, 0x00 ,0x04, 0x00, 0x09, 0x00, 0x34, if (enabled) 0x01 else 0x02, 0x00, 0x00, 0x00))
socket.outputStream?.flush()
}
fun setAdaptiveStrength(strength: Int) {
val bytes = byteArrayOf(0x04, 0x00, 0x04, 0x00, 0x09, 0x00, 0x2E, strength.toByte(), 0x00, 0x00, 0x00)
socket.outputStream?.write(bytes)
socket.outputStream?.flush()
}
fun setPressSpeed(speed: Int) {
val bytes = byteArrayOf(0x04, 0x00, 0x04, 0x00, 0x09, 0x00, 0x17, speed.toByte(), 0x00, 0x00, 0x00)
socket.outputStream?.write(bytes)
socket.outputStream?.flush()
}
fun setPressAndHoldDuration(speed: Int) {
val bytes = byteArrayOf(0x04, 0x00, 0x04, 0x00, 0x09, 0x00, 0x18, speed.toByte(), 0x00, 0x00, 0x00)
socket.outputStream?.write(bytes)
socket.outputStream?.flush()
}
fun setNoiseCancellationWithOnePod(enabled: Boolean) {
val bytes = byteArrayOf(0x04, 0x00, 0x04, 0x00, 0x09, 0x00, 0x1B, if (enabled) 0x01 else 0x02, 0x00, 0x00, 0x00)
socket.outputStream?.write(bytes)
socket.outputStream?.flush()
}
fun setVolumeControl(enabled: Boolean) {
val bytes = byteArrayOf(0x04, 0x00, 0x04, 0x00, 0x09, 0x00, 0x25, if (enabled) 0x01 else 0x02, 0x00, 0x00, 0x00)
socket.outputStream?.write(bytes)
socket.outputStream?.flush()
}
fun setVolumeSwipeSpeed(speed: Int) {
val bytes = byteArrayOf(0x04, 0x00, 0x04, 0x00, 0x09, 0x00, 0x23, speed.toByte(), 0x00, 0x00, 0x00)
socket.outputStream?.write(bytes)
socket.outputStream?.flush()
}
fun setToneVolume(volume: Int) {
val bytes = byteArrayOf(0x04, 0x00, 0x04, 0x00, 0x09, 0x00, 0x1F, volume.toByte(), 0x50, 0x00, 0x00)
socket.outputStream?.write(bytes)
socket.outputStream?.flush()
}
val earDetectionNotification = AirPodsNotifications.EarDetection()
val ancNotification = AirPodsNotifications.ANC()
val batteryNotification = AirPodsNotifications.BatteryNotification()
val conversationAwarenessNotification = AirPodsNotifications.ConversationalAwarenessNotification()
var earDetectionEnabled = true
fun setCaseChargingSounds(enabled: Boolean) {
val bytes = byteArrayOf(0x12, 0x3a, 0x00, 0x01, 0x00, 0x08, if (enabled) 0x00 else 0x01)
socket.outputStream?.write(bytes)
socket.outputStream?.flush()
}
fun setEarDetection(enabled: Boolean) {
earDetectionEnabled = enabled
}
fun getBattery(): List<Battery> {
return batteryNotification.getBattery()
}
fun getANC(): Int {
return ancNotification.status
}
fun disconnectAudio(context: Context, device: BluetoothDevice?) {
val bluetoothAdapter = context.getSystemService(BluetoothManager::class.java).adapter
bluetoothAdapter?.getProfileProxy(context, object : BluetoothProfile.ServiceListener {
override fun onServiceConnected(profile: Int, proxy: BluetoothProfile) {
if (profile == BluetoothProfile.A2DP) {
try {
val method = proxy.javaClass.getMethod("disconnect", BluetoothDevice::class.java)
method.invoke(proxy, device)
} catch (e: Exception) {
e.printStackTrace()
} finally {
bluetoothAdapter.closeProfileProxy(BluetoothProfile.A2DP, proxy)
}
}
}
override fun onServiceDisconnected(profile: Int) { }
}, BluetoothProfile.A2DP)
bluetoothAdapter?.getProfileProxy(context, object : BluetoothProfile.ServiceListener {
override fun onServiceConnected(profile: Int, proxy: BluetoothProfile) {
if (profile == BluetoothProfile.HEADSET) {
try {
val method = proxy.javaClass.getMethod("disconnect", BluetoothDevice::class.java)
method.invoke(proxy, device)
} catch (e: Exception) {
e.printStackTrace()
} finally {
bluetoothAdapter.closeProfileProxy(BluetoothProfile.HEADSET, proxy)
}
}
}
override fun onServiceDisconnected(profile: Int) { }
}, BluetoothProfile.HEADSET)
}
fun connectAudio(context: Context, device: BluetoothDevice?) {
val bluetoothAdapter = context.getSystemService(BluetoothManager::class.java).adapter
bluetoothAdapter?.getProfileProxy(context, object : BluetoothProfile.ServiceListener {
override fun onServiceConnected(profile: Int, proxy: BluetoothProfile) {
if (profile == BluetoothProfile.A2DP) {
try {
val method = proxy.javaClass.getMethod("connect", BluetoothDevice::class.java)
method.invoke(proxy, device)
} catch (e: Exception) {
e.printStackTrace()
} finally {
bluetoothAdapter.closeProfileProxy(BluetoothProfile.A2DP, proxy)
}
}
}
override fun onServiceDisconnected(profile: Int) { }
}, BluetoothProfile.A2DP)
bluetoothAdapter?.getProfileProxy(context, object : BluetoothProfile.ServiceListener {
override fun onServiceConnected(profile: Int, proxy: BluetoothProfile) {
if (profile == BluetoothProfile.HEADSET) {
try {
val method = proxy.javaClass.getMethod("connect", BluetoothDevice::class.java)
method.invoke(proxy, device)
} catch (e: Exception) {
e.printStackTrace()
} finally {
bluetoothAdapter.closeProfileProxy(BluetoothProfile.HEADSET, proxy)
}
}
}
override fun onServiceDisconnected(profile: Int) { }
}, BluetoothProfile.HEADSET)
}
fun setName(name: String) {
val nameBytes = name.toByteArray()
val bytes = byteArrayOf(0x04, 0x00, 0x04, 0x00, 0x1a, 0x00, 0x01,
nameBytes.size.toByte(), 0x00) + nameBytes
socket.outputStream?.write(bytes)
socket.outputStream?.flush()
val hex = bytes.joinToString(" ") { "%02X".format(it) }
Log.d("AirPodsService", "setName: $name, sent packet: $hex")
}
fun setPVEnabled(enabled: Boolean) {
var hex = "04 00 04 00 09 00 26 ${if (enabled) "01" else "02"} 00 00 00"
var bytes = hex.split(" ").map { it.toInt(16).toByte() }.toByteArray()
socket.outputStream?.write(bytes)
socket.outputStream?.flush()
hex = "04 00 04 00 17 00 00 00 10 00 12 00 08 E${if (enabled) "6" else "5"} 05 10 02 42 0B 08 50 10 02 1A 05 02 ${if (enabled) "32" else "00"} 00 00 00"
bytes = hex.split(" ").map { it.toInt(16).toByte() }.toByteArray()
socket.outputStream?.write(bytes)
socket.outputStream?.flush()
}
fun setLoudSoundReduction(enabled: Boolean) {
val hex = "52 1B 00 0${if (enabled) "1" else "0"}"
val bytes = hex.split(" ").map { it.toInt(16).toByte() }.toByteArray()
socket.outputStream?.write(bytes)
socket.outputStream?.flush()
}
override fun onDestroy() {
Log.d("AirPodsService", "Service stopped is being destroyed for some reason!")
try {
unregisterReceiver(bluetoothReceiver)
} catch (e: Exception) {
e.printStackTrace()
}
try {
unregisterReceiver(connectionReceiver)
} catch (e: Exception) {
e.printStackTrace()
}
try {
unregisterReceiver(disconnectionReceiver)
} catch (e: Exception) {
e.printStackTrace()
}
try {
unregisterReceiver(earReceiver)
} catch (e: Exception) {
e.printStackTrace()
}
super.onDestroy()
}
}

View File

@@ -1,44 +0,0 @@
package me.kavishdevar.aln
import android.appwidget.AppWidgetManager
import android.appwidget.AppWidgetProvider
import android.content.Context
import android.widget.RemoteViews
/**
* Implementation of App Widget functionality.
*/
class BatteryWidget : AppWidgetProvider() {
override fun onUpdate(
context: Context,
appWidgetManager: AppWidgetManager,
appWidgetIds: IntArray
) {
// There may be multiple widgets active, so update all of them
for (appWidgetId in appWidgetIds) {
updateAppWidget(context, appWidgetManager, appWidgetId)
}
}
override fun onEnabled(context: Context) {
// Enter relevant functionality for when the first widget is created
}
override fun onDisabled(context: Context) {
// Enter relevant functionality for when the last widget is disabled
}
}
internal fun updateAppWidget(
context: Context,
appWidgetManager: AppWidgetManager,
appWidgetId: Int
) {
val widgetText = context.getString(R.string.appwidget_text)
// Construct the RemoteViews object
val views = RemoteViews(context.packageName, R.layout.battery_widget)
views.setTextViewText(R.id.appwidget_text, widgetText)
// Instruct the widget manager to update the widget
appWidgetManager.updateAppWidget(appWidgetId, views)
}

View File

@@ -1,14 +0,0 @@
package me.kavishdevar.aln
import android.content.BroadcastReceiver
import android.content.Context
import android.content.Intent
class BootReceiver: BroadcastReceiver() {
override fun onReceive(context: Context?, intent: Intent?) {
when (intent?.action) {
Intent.ACTION_MY_PACKAGE_REPLACED -> try { context?.startForegroundService(Intent(context, AirPodsService::class.java)) } catch (e: Exception) { e.printStackTrace() }
Intent.ACTION_BOOT_COMPLETED -> try { context?.startForegroundService(Intent(context, AirPodsService::class.java)) } catch (e: Exception) { e.printStackTrace() }
}
}
}

View File

@@ -1,164 +0,0 @@
package me.kavishdevar.aln
import android.annotation.SuppressLint
import android.bluetooth.BluetoothDevice
import android.bluetooth.BluetoothDevice.TRANSPORT_LE
import android.bluetooth.BluetoothGatt
import android.bluetooth.BluetoothGattCallback
import android.bluetooth.BluetoothGattCharacteristic
import android.bluetooth.BluetoothManager
import android.os.Bundle
import android.util.Log
import androidx.activity.ComponentActivity
import androidx.activity.compose.setContent
import androidx.activity.enableEdgeToEdge
import androidx.compose.foundation.layout.Arrangement
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.fillMaxSize
import androidx.compose.foundation.layout.fillMaxWidth
import androidx.compose.foundation.layout.padding
import androidx.compose.material3.Button
import androidx.compose.material3.MaterialTheme
import androidx.compose.material3.Scaffold
import androidx.compose.material3.Text
import androidx.compose.runtime.mutableStateOf
import androidx.compose.runtime.remember
import androidx.compose.ui.Alignment
import androidx.compose.ui.Modifier
import androidx.compose.ui.unit.dp
import me.kavishdevar.aln.ui.theme.ALNTheme
import org.lsposed.hiddenapibypass.HiddenApiBypass
import java.util.UUID
class CustomDevice : ComponentActivity() {
@SuppressLint("MissingPermission", "CoroutineCreationDuringComposition", "NewApi")
override fun onCreate(savedInstanceState: Bundle?) {
super.onCreate(savedInstanceState)
enableEdgeToEdge()
setContent {
ALNTheme {
val connect = remember { mutableStateOf(false) }
Scaffold(
modifier = Modifier.fillMaxSize(),
topBar = {
Column(
modifier = Modifier.fillMaxWidth(),
verticalArrangement = Arrangement.Center,
horizontalAlignment = Alignment.CenterHorizontally
) {
Text("Custom Device", style = MaterialTheme.typography.titleLarge)
}
}
) { innerPadding ->
HiddenApiBypass.addHiddenApiExemptions("Landroid/bluetooth/BluetoothSocket;")
val manager = getSystemService(BLUETOOTH_SERVICE) as BluetoothManager
// val device: BluetoothDevice = manager.adapter.getRemoteDevice("EC:D6:F4:3D:89:B8")
val device: BluetoothDevice = manager.adapter.getRemoteDevice("DE:F4:C6:A3:CD:7A")
// val socket = device.createInsecureL2capChannel(31)
val batteryLevel = remember { mutableStateOf("") }
// socket.outputStream.write(byteArrayOf(0x12,0x3B,0x00,0x02, 0x00))
// socket.outputStream.write(byteArrayOf(0x12, 0x3A, 0x00, 0x01, 0x00, 0x08,0x01))
val gatt = device.connectGatt(this, true, object: BluetoothGattCallback() {
override fun onServicesDiscovered(gatt: BluetoothGatt, status: Int) {
if (status == BluetoothGatt.GATT_SUCCESS) {
// Step 2: Iterate through the services and characteristics
gatt.services.forEach { service ->
Log.d("GATT", "Service UUID: ${service.uuid}")
service.characteristics.forEach { characteristic ->
characteristic.descriptors.forEach { descriptor ->
Log.d("GATT", " Descriptor UUID: ${descriptor.uuid}: ${gatt.readDescriptor(descriptor)}")
}
}
}
}
}
override fun onConnectionStateChange(gatt: BluetoothGatt, status: Int, newState: Int) {
if (newState == BluetoothGatt.STATE_CONNECTED) {
Log.d("GATT", "Connected to GATT server")
gatt.discoverServices() // Discover services after connection
}
}
override fun onCharacteristicWrite(
gatt: BluetoothGatt,
characteristic: BluetoothGattCharacteristic,
status: Int
) {
if (status == BluetoothGatt.GATT_SUCCESS) {
Log.d("BLE", "Write successful for UUID: ${characteristic.uuid}")
} else {
Log.e("BLE", "Write failed for UUID: ${characteristic.uuid}, status: $status")
}
}
}, TRANSPORT_LE, 1)
if (connect.value) {
try {
gatt.connect()
}
catch (e: Exception) {
e.printStackTrace()
}
connect.value = false
}
Column (
modifier = Modifier.padding(innerPadding),
verticalArrangement = Arrangement.spacedBy(16.dp)
)
{
Button(
onClick = { connect.value = true }
)
{
Text("Connect")
}
Button(onClick = {
// val characteristicUuid = "4f860002-943b-49ef-bed4-2f730304427a"
// val value = byteArrayOf(0x01, 0x00, 0x02)
// sendWriteRequest(gatt, characteristicUuid, value)
}) {
Text("batteryLevel.value")
}
}
}
}
}
}
}
@SuppressLint("MissingPermission", "NewApi")
fun sendWriteRequest(
gatt: BluetoothGatt,
characteristicUuid: String,
value: ByteArray
) {
// Retrieve the service containing the characteristic
val service = gatt.services.find { service ->
service.characteristics.any { it.uuid.toString() == characteristicUuid }
}
if (service == null) {
Log.e("GATT", "Service containing characteristic UUID $characteristicUuid not found.")
return
}
// Retrieve the characteristic
val characteristic = service.getCharacteristic(UUID.fromString(characteristicUuid))
if (characteristic == null) {
Log.e("GATT", "Characteristic with UUID $characteristicUuid not found.")
return
}
// Send the write request
val success = gatt.writeCharacteristic(characteristic, value, BluetoothGattCharacteristic.WRITE_TYPE_DEFAULT)
Log.d("GATT", "Write request sent $success to UUID: $characteristicUuid")
}

View File

@@ -1,261 +0,0 @@
@file:OptIn(ExperimentalHazeMaterialsApi::class)
package me.kavishdevar.aln
import android.annotation.SuppressLint
import android.content.BroadcastReceiver
import android.content.ComponentName
import android.content.Context
import android.content.Intent
import android.content.IntentFilter
import android.content.ServiceConnection
import android.os.Build
import android.os.IBinder
import android.util.Log
import androidx.compose.foundation.background
import androidx.compose.foundation.layout.Arrangement
import androidx.compose.foundation.layout.Box
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.ExperimentalLayoutApi
import androidx.compose.foundation.layout.Row
import androidx.compose.foundation.layout.Spacer
import androidx.compose.foundation.layout.fillMaxSize
import androidx.compose.foundation.layout.fillMaxWidth
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.imePadding
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.lazy.LazyColumn
import androidx.compose.foundation.lazy.rememberLazyListState
import androidx.compose.foundation.shape.RoundedCornerShape
import androidx.compose.material.icons.Icons
import androidx.compose.material.icons.automirrored.filled.ArrowBack
import androidx.compose.material.icons.filled.Send
import androidx.compose.material3.ExperimentalMaterial3Api
import androidx.compose.material3.HorizontalDivider
import androidx.compose.material3.Icon
import androidx.compose.material3.IconButton
import androidx.compose.material3.MaterialTheme
import androidx.compose.material3.Scaffold
import androidx.compose.material3.Text
import androidx.compose.material3.TextField
import androidx.compose.material3.TextFieldDefaults
import androidx.compose.material3.TopAppBar
import androidx.compose.material3.TopAppBarDefaults
import androidx.compose.runtime.Composable
import androidx.compose.runtime.LaunchedEffect
import androidx.compose.runtime.mutableStateListOf
import androidx.compose.runtime.mutableStateOf
import androidx.compose.runtime.remember
import androidx.compose.ui.Alignment
import androidx.compose.ui.Modifier
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.graphics.luminance
import androidx.compose.ui.platform.LocalContext
import androidx.compose.ui.text.font.Font
import androidx.compose.ui.text.font.FontFamily
import androidx.compose.ui.text.input.TextFieldValue
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.sp
import androidx.navigation.NavController
import dev.chrisbanes.haze.HazeState
import dev.chrisbanes.haze.haze
import dev.chrisbanes.haze.hazeChild
import dev.chrisbanes.haze.materials.CupertinoMaterials
import dev.chrisbanes.haze.materials.ExperimentalHazeMaterialsApi
@OptIn(ExperimentalMaterial3Api::class, ExperimentalLayoutApi::class)
@SuppressLint("UnusedMaterial3ScaffoldPaddingParameter")
@Composable
fun DebugScreen(navController: NavController) {
val hazeState = remember { HazeState() }
val text = remember { mutableStateListOf<String>("Log Start") }
val context = LocalContext.current
val listState = rememberLazyListState()
Scaffold(
topBar = {
TopAppBar(
title = { Text("Debug") },
navigationIcon = {
IconButton(onClick = {
navController.popBackStack()
}) {
Icon(Icons.AutoMirrored.Filled.ArrowBack, null)
}
},
modifier = Modifier
.hazeChild(
state = hazeState,
style = CupertinoMaterials.thin(),
block = {
alpha = if (listState.firstVisibleItemIndex > 0) {
1f
} else {
0f
}
}
),
colors = TopAppBarDefaults.topAppBarColors(
containerColor = Color.Transparent
)
)
},
containerColor = if (MaterialTheme.colorScheme.surface.luminance() < 0.5) Color(0xFF000000)
else Color(0xFFF2F2F7),
) { paddingValues ->
val receiver = object : BroadcastReceiver() {
override fun onReceive(context: Context, intent: Intent) {
val data = intent.getByteArrayExtra("data")
data?.let {
text.add(">" + it.joinToString(" ") { byte -> "%02X".format(byte) })
}
}
}
LaunchedEffect(context) {
val intentFilter = IntentFilter(AirPodsNotifications.AIRPODS_DATA)
if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.TIRAMISU) {
context.registerReceiver(receiver, intentFilter, Context.RECEIVER_EXPORTED)
}
}
LaunchedEffect(text.size) {
if (text.isNotEmpty()) {
listState.animateScrollToItem(text.size - 1)
}
}
Column(
modifier = Modifier
.fillMaxSize()
.imePadding()
.haze(hazeState)
.padding(top = 0.dp)
) {
LazyColumn(
state = listState,
modifier = Modifier
.fillMaxWidth()
.weight(1f),
content = {
items(text.size) { index ->
val message = text[index]
val isSent = message.startsWith(">")
val backgroundColor =
if (isSent) Color(0xFFE1FFC7) else Color(0xFFD1D1D1)
if (message == "Log Start") {
Spacer(modifier = Modifier.height(115.dp))
}
Box(
modifier = Modifier
.fillMaxWidth()
.padding(8.dp)
.background(backgroundColor, RoundedCornerShape(12.dp))
.padding(12.dp),
) {
Row(
modifier = Modifier.fillMaxWidth(),
verticalAlignment = Alignment.CenterVertically,
horizontalArrangement = Arrangement.SpaceBetween
) {
if (!isSent) {
Text("<", color = Color(0xFF00796B), fontSize = 16.sp)
}
Text(
text = if (isSent) message.substring(1) else message,
fontFamily = FontFamily(Font(R.font.hack)),
color = if (MaterialTheme.colorScheme.surface.luminance() < 0.5) Color(
0xFF000000
)
else Color(0xFF000000),
modifier = Modifier.weight(1f)
)
if (isSent) {
Text(">", color = Color(0xFF00796B), fontSize = 16.sp)
}
}
}
}
}
)
Spacer(modifier = Modifier.height(8.dp))
val airPodsService = remember { mutableStateOf<AirPodsService?>(null) }
val serviceConnection = object : ServiceConnection {
override fun onServiceConnected(name: ComponentName, service: IBinder) {
val binder = service as AirPodsService.LocalBinder
airPodsService.value = binder.getService()
Log.d("AirPodsService", "Service connected")
}
override fun onServiceDisconnected(name: ComponentName) {
airPodsService.value = null
}
}
val intent = Intent(context, AirPodsService::class.java)
context.bindService(intent, serviceConnection, Context.BIND_AUTO_CREATE)
HorizontalDivider()
Row(
modifier = Modifier
.fillMaxWidth()
.background(if (MaterialTheme.colorScheme.surface.luminance() < 0.5) Color(0xFF1C1B20) else Color(0xFFF2F2F7)),
verticalAlignment = Alignment.CenterVertically
) {
val packet = remember { mutableStateOf(TextFieldValue("")) }
TextField(
value = packet.value,
onValueChange = { packet.value = it },
label = { Text("Packet") },
modifier = Modifier
.fillMaxWidth()
.padding(horizontal = 8.dp)
.padding(bottom = 5.dp),
trailingIcon = {
IconButton(
onClick = {
airPodsService.value?.sendPacket(packet.value.text)
text.add(packet.value.text)
packet.value = TextFieldValue("")
}
) {
@Suppress("DEPRECATION")
Icon(Icons.Filled.Send, contentDescription = "Send")
}
},
colors = TextFieldDefaults.colors(
focusedContainerColor = if (MaterialTheme.colorScheme.surface.luminance() < 0.5) Color(0xFF1C1B20) else Color(0xFFF2F2F7),
unfocusedContainerColor = if (MaterialTheme.colorScheme.surface.luminance() < 0.5) Color(0xFF1C1B20) else Color(0xFFF2F2F7),
focusedIndicatorColor = Color.Transparent,
unfocusedIndicatorColor = Color.Transparent,
focusedTextColor = if (MaterialTheme.colorScheme.surface.luminance() < 0.5) Color.White else Color.Black,
unfocusedTextColor = if (MaterialTheme.colorScheme.surface.luminance() < 0.5) Color.White else Color.Black.copy(alpha = 0.6f),
focusedLabelColor = if (MaterialTheme.colorScheme.surface.luminance() < 0.5) Color.White.copy(alpha = 0.6f) else Color.Black,
unfocusedLabelColor = if (MaterialTheme.colorScheme.surface.luminance() < 0.5) Color.White.copy(alpha = 0.6f) else Color.Black.copy(alpha = 0.6f),
),
shape = RoundedCornerShape(12.dp)
)
val airPodsService = remember { mutableStateOf<AirPodsService?>(null) }
val serviceConnection = object : ServiceConnection {
override fun onServiceConnected(name: ComponentName, service: IBinder) {
val binder = service as AirPodsService.LocalBinder
airPodsService.value = binder.getService()
Log.d("AirPodsService", "Service connected")
}
override fun onServiceDisconnected(name: ComponentName) {
airPodsService.value = null
}
}
val intent = Intent(context, AirPodsService::class.java)
context.bindService(intent, serviceConnection, Context.BIND_AUTO_CREATE)
}
}
}
}

View File

@@ -1,187 +0,0 @@
package me.kavishdevar.aln
import android.annotation.SuppressLint
import android.content.BroadcastReceiver
import android.content.ComponentName
import android.content.Context
import android.content.Intent
import android.content.IntentFilter
import android.content.ServiceConnection
import android.os.Bundle
import android.os.IBinder
import android.util.Log
import androidx.activity.ComponentActivity
import androidx.activity.compose.setContent
import androidx.activity.enableEdgeToEdge
import androidx.compose.animation.core.tween
import androidx.compose.animation.slideInHorizontally
import androidx.compose.animation.slideOutHorizontally
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.padding
import androidx.compose.material3.Button
import androidx.compose.material3.ExperimentalMaterial3Api
import androidx.compose.material3.MaterialTheme
import androidx.compose.material3.Text
import androidx.compose.runtime.Composable
import androidx.compose.runtime.mutableStateOf
import androidx.compose.runtime.remember
import androidx.compose.ui.Modifier
import androidx.compose.ui.graphics.toArgb
import androidx.compose.ui.platform.LocalContext
import androidx.compose.ui.unit.dp
import androidx.navigation.compose.NavHost
import androidx.navigation.compose.composable
import androidx.navigation.compose.rememberNavController
import com.google.accompanist.permissions.ExperimentalPermissionsApi
import com.google.accompanist.permissions.rememberMultiplePermissionsState
import me.kavishdevar.aln.ui.theme.ALNTheme
lateinit var serviceConnection: ServiceConnection
lateinit var connectionStatusReceiver: BroadcastReceiver
@ExperimentalMaterial3Api
class MainActivity : ComponentActivity() {
override fun onCreate(savedInstanceState: Bundle?) {
super.onCreate(savedInstanceState)
enableEdgeToEdge()
setContent {
ALNTheme {
getSharedPreferences("settings", MODE_PRIVATE).edit().putLong("textColor",
MaterialTheme.colorScheme.onSurface.toArgb().toLong()).apply()
Main()
startService(Intent(this, AirPodsService::class.java))
}
}
}
override fun onDestroy() {
try {
unbindService(serviceConnection)
Log.d("MainActivity", "Unbound service")
} catch (e: Exception) {
Log.e("MainActivity", "Error while unbinding service: $e")
}
try {
unregisterReceiver(connectionStatusReceiver)
Log.d("MainActivity", "Unregistered receiver")
} catch (e: Exception) {
Log.e("MainActivity", "Error while unregistering receiver: $e")
}
super.onDestroy()
}
override fun onStop() {
try {
unbindService(serviceConnection)
Log.d("MainActivity", "Unbound service")
} catch (e: Exception) {
Log.e("MainActivity", "Error while unbinding service: $e")
}
try {
unregisterReceiver(connectionStatusReceiver)
Log.d("MainActivity", "Unregistered receiver")
} catch (e: Exception) {
Log.e("MainActivity", "Error while unregistering receiver: $e")
}
super.onStop()
}
}
@SuppressLint("MissingPermission", "InlinedApi")
@OptIn(ExperimentalPermissionsApi::class)
@Composable
fun Main() {
val isConnected = remember { mutableStateOf(false) }
val permissionState = rememberMultiplePermissionsState(
permissions = listOf(
"android.permission.BLUETOOTH_CONNECT",
"android.permission.POST_NOTIFICATIONS"
)
)
val airPodsService = remember { mutableStateOf<AirPodsService?>(null) }
if (permissionState.allPermissionsGranted) {
val context = LocalContext.current
val navController = rememberNavController()
connectionStatusReceiver = object : BroadcastReceiver() {
override fun onReceive(context: Context, intent: Intent) {
if (intent.action == AirPodsNotifications.AIRPODS_CONNECTED) {
Log.d("MainActivity", "AirPods Connected intent received")
isConnected.value = true
}
else if (intent.action == AirPodsNotifications.AIRPODS_DISCONNECTED) {
Log.d("MainActivity", "AirPods Disconnected intent received")
isConnected.value = false
}
}
}
val filter = IntentFilter().apply {
addAction(AirPodsNotifications.AIRPODS_CONNECTED)
addAction(AirPodsNotifications.AIRPODS_DISCONNECTED)
addAction(AirPodsNotifications.AIRPODS_CONNECTION_DETECTED)
}
Log.d("MainActivity", "Registering Receiver")
context.registerReceiver(connectionStatusReceiver, filter, Context.RECEIVER_EXPORTED)
Log.d("MainActivity", "Registered Receiver")
NavHost(
navController = navController,
startDestination = "settings",
enterTransition = { slideInHorizontally(initialOffsetX = { it }, animationSpec = tween(300)) },
exitTransition = { slideOutHorizontally(targetOffsetX = { -it }, animationSpec = tween(300)) },
popEnterTransition = { slideInHorizontally(initialOffsetX = { -it }, animationSpec = tween(300)) },
popExitTransition = { slideOutHorizontally(targetOffsetX = { it }, animationSpec = tween(300)) }
) {
composable("settings") {
if (airPodsService.value != null) {
AirPodsSettingsScreen(
dev = airPodsService.value?.device,
service = airPodsService.value!!,
navController = navController,
isConnected = isConnected.value
)
}
}
composable("debug") {
DebugScreen(navController = navController)
}
}
serviceConnection = remember {
object : ServiceConnection {
override fun onServiceConnected(name: ComponentName?, service: IBinder?) {
val binder = service as AirPodsService.LocalBinder
airPodsService.value = binder.getService()
}
override fun onServiceDisconnected(name: ComponentName?) {
airPodsService.value = null
}
}
}
context.bindService(Intent(context, AirPodsService::class.java), serviceConnection, Context.BIND_AUTO_CREATE)
if (airPodsService.value?.isConnected == true) {
isConnected.value = true
}
} else {
// Permission is not granted, request it
Column (
modifier = Modifier.padding(24.dp),
){
val textToShow = if (permissionState.shouldShowRationale) {
// If the user has denied the permission but not permanently, explain why it's needed.
"Please enable Bluetooth and Notification permissions to use the app. The Nearby Devices is required to connect to your AirPods, and the notification is required to show the AirPods battery status."
} else {
// If the user has permanently denied the permission, inform them to enable it in settings.
"Please enable Bluetooth and Notification permissions in the app settings to use the app."
}
Text(textToShow)
Button(onClick = { permissionState.launchMultiplePermissionRequest() }) {
Text("Request permission")
}
}
}
}

View File

@@ -1,55 +0,0 @@
package me.kavishdevar.aln
import android.media.AudioManager
import android.util.Log
import android.view.KeyEvent
object MediaController {
private var initialVolume: Int? = null // Nullable to track the unset state
private lateinit var audioManager: AudioManager // Declare AudioManager
// Initialize the singleton with the AudioManager instance
fun initialize(audioManager: AudioManager) {
this.audioManager = audioManager
}
@Synchronized
fun sendPause() {
if (audioManager.isMusicActive) {
audioManager.dispatchMediaKeyEvent(KeyEvent(KeyEvent.ACTION_DOWN, KeyEvent.KEYCODE_MEDIA_PAUSE))
audioManager.dispatchMediaKeyEvent(KeyEvent(KeyEvent.ACTION_UP, KeyEvent.KEYCODE_MEDIA_PAUSE))
}
}
@Synchronized
fun sendPlay() {
if (!audioManager.isMusicActive) {
audioManager.dispatchMediaKeyEvent(KeyEvent(KeyEvent.ACTION_DOWN, KeyEvent.KEYCODE_MEDIA_PLAY))
audioManager.dispatchMediaKeyEvent(KeyEvent(KeyEvent.ACTION_UP, KeyEvent.KEYCODE_MEDIA_PLAY))
}
}
@Synchronized
fun startSpeaking() {
Log.d("MediaController", "Starting speaking")
if (initialVolume == null) {
initialVolume = audioManager.getStreamVolume(AudioManager.STREAM_MUSIC)
Log.d("MediaController", "Initial Volume Set: $initialVolume")
audioManager.setStreamVolume(
AudioManager.STREAM_MUSIC,
1, // Set to a lower volume when speaking starts
0
)
}
Log.d("MediaController", "Initial Volume: $initialVolume")
}
@Synchronized
fun stopSpeaking() {
Log.d("MediaController", "Stopping speaking, initialVolume: $initialVolume")
initialVolume?.let { volume ->
audioManager.setStreamVolume(AudioManager.STREAM_MUSIC, volume, 0)
initialVolume = null // Reset to null after restoring the volume
}
}
}

View File

@@ -1,463 +0,0 @@
//@file:Suppress("unused")
//
//package me.kavishdevar.aln
//
//import android.annotation.SuppressLint
//import android.app.Notification
//import android.app.NotificationChannel
//import android.app.NotificationManager
//import android.app.Service
//import android.bluetooth.BluetoothDevice
//import android.bluetooth.BluetoothManager
//import android.bluetooth.BluetoothProfile
//import android.bluetooth.BluetoothSocket
//import android.content.BroadcastReceiver
//import android.content.Context
//import android.content.Intent
//import android.content.IntentFilter
//import android.media.AudioManager
//import android.os.Binder
//import android.os.Build
//import android.os.IBinder
//import android.os.ParcelUuid
//import android.util.Log
//import androidx.core.app.NotificationCompat
//import kotlinx.coroutines.CoroutineScope
//import kotlinx.coroutines.Dispatchers
//import kotlinx.coroutines.launch
//import org.lsposed.hiddenapibypass.HiddenApiBypass
//
//object ServiceManager {
// private var service: OldAirPodsService? = null
// @Synchronized
// fun getService(): OldAirPodsService? {
// return service
// }
// @Synchronized
// fun setService(service: OldAirPodsService?) {
// this.service = service
// }
//}
//
//class OldAirPodsService : Service() {
// inner class LocalBinder : Binder() {
// fun getService(): OldAirPodsService = this@OldAirPodsService
// }
//
// override fun onBind(intent: Intent?): IBinder {
// return LocalBinder()
// }
//
// var isConnected: Boolean = false
// private var socket: BluetoothSocket? = null
//
// fun sendPacket(packet: String) {
// val fromHex = packet.split(" ").map { it.toInt(16).toByte() }
// socket?.outputStream?.write(fromHex.toByteArray())
// socket?.outputStream?.flush()
// }
//
// fun setANCMode(mode: Int) {
// when (mode) {
// 1 -> {
// socket?.outputStream?.write(Enums.NOISE_CANCELLATION_OFF.value)
// }
// 2 -> {
// socket?.outputStream?.write(Enums.NOISE_CANCELLATION_ON.value)
// }
// 3 -> {
// socket?.outputStream?.write(Enums.NOISE_CANCELLATION_TRANSPARENCY.value)
// }
// 4 -> {
// socket?.outputStream?.write(Enums.NOISE_CANCELLATION_ADAPTIVE.value)
// }
// }
// socket?.outputStream?.flush()
// }
//
// fun setCAEnabled(enabled: Boolean) {
// socket?.outputStream?.write(if (enabled) Enums.SET_CONVERSATION_AWARENESS_ON.value else Enums.SET_CONVERSATION_AWARENESS_OFF.value)
// }
//
// fun setOffListeningMode(enabled: Boolean) {
// socket?.outputStream?.write(byteArrayOf(0x04, 0x00 ,0x04, 0x00, 0x09, 0x00, 0x34, if (enabled) 0x01 else 0x02, 0x00, 0x00, 0x00))
// }
//
// fun setAdaptiveStrength(strength: Int) {
// val bytes = byteArrayOf(0x04, 0x00, 0x04, 0x00, 0x09, 0x00, 0x2E, strength.toByte(), 0x00, 0x00, 0x00)
// socket?.outputStream?.write(bytes)
// socket?.outputStream?.flush()
// }
//
// fun setPressSpeed(speed: Int) {
// val bytes = byteArrayOf(0x04, 0x00, 0x04, 0x00, 0x09, 0x00, 0x17, speed.toByte(), 0x00, 0x00, 0x00)
// socket?.outputStream?.write(bytes)
// socket?.outputStream?.flush()
// }
//
// fun setPressAndHoldDuration(speed: Int) {
// val bytes = byteArrayOf(0x04, 0x00, 0x04, 0x00, 0x09, 0x00, 0x18, speed.toByte(), 0x00, 0x00, 0x00)
// socket?.outputStream?.write(bytes)
// socket?.outputStream?.flush()
// }
//
// fun setNoiseCancellationWithOnePod(enabled: Boolean) {
// val bytes = byteArrayOf(0x04, 0x00, 0x04, 0x00, 0x09, 0x00, 0x1B, if (enabled) 0x01 else 0x02, 0x00, 0x00, 0x00)
// socket?.outputStream?.write(bytes)
// socket?.outputStream?.flush()
// }
//
// fun setVolumeControl(enabled: Boolean) {
// val bytes = byteArrayOf(0x04, 0x00, 0x04, 0x00, 0x09, 0x00, 0x25, if (enabled) 0x01 else 0x02, 0x00, 0x00, 0x00)
// socket?.outputStream?.write(bytes)
// socket?.outputStream?.flush()
// }
//
// fun setVolumeSwipeSpeed(speed: Int) {
// val bytes = byteArrayOf(0x04, 0x00, 0x04, 0x00, 0x09, 0x00, 0x23, speed.toByte(), 0x00, 0x00, 0x00)
// socket?.outputStream?.write(bytes)
// socket?.outputStream?.flush()
// }
//
// fun setToneVolume(volume: Int) {
// val bytes = byteArrayOf(0x04, 0x00, 0x04, 0x00, 0x09, 0x00, 0x1F, volume.toByte(), 0x50, 0x00, 0x00)
// socket?.outputStream?.write(bytes)
// socket?.outputStream?.flush()
// }
//
// val earDetectionNotification = AirPodsNotifications.EarDetection()
// val ancNotification = AirPodsNotifications.ANC()
// val batteryNotification = AirPodsNotifications.BatteryNotification()
// val conversationAwarenessNotification = AirPodsNotifications.ConversationalAwarenessNotification()
//
// var earDetectionEnabled = true
//
// fun setCaseChargingSounds(enabled: Boolean) {
// val bytes = byteArrayOf(0x12, 0x3a, 0x00, 0x01, 0x00, 0x08, if (enabled) 0x00 else 0x01)
// socket?.outputStream?.write(bytes)
// socket?.outputStream?.flush()
// }
//
// fun setEarDetection(enabled: Boolean) {
// earDetectionEnabled = enabled
// }
//
// fun getBattery(): List<Battery> {
// return batteryNotification.getBattery()
// }
//
// fun getANC(): Int {
// return ancNotification.status
// }
//
// private fun createNotification(): Notification {
// val channelId = "battery"
// val notificationBuilder = NotificationCompat.Builder(this, channelId)
// .setSmallIcon(R.drawable.pro_2_buds)
// .setContentTitle("AirPods Connected")
// .setOngoing(true)
// .setVisibility(NotificationCompat.VISIBILITY_PUBLIC)
//
// val channel =
// NotificationChannel(channelId, "Battery Notification", NotificationManager.IMPORTANCE_LOW)
//
// val notificationManager = getSystemService(NotificationManager::class.java)
// notificationManager.createNotificationChannel(channel)
// return notificationBuilder.build()
// }
//
// fun disconnectAudio(context: Context, device: BluetoothDevice?) {
// val bluetoothAdapter = context.getSystemService(BluetoothManager::class.java).adapter
//
// bluetoothAdapter?.getProfileProxy(context, object : BluetoothProfile.ServiceListener {
// override fun onServiceConnected(profile: Int, proxy: BluetoothProfile) {
// if (profile == BluetoothProfile.A2DP) {
// try {
// val method = proxy.javaClass.getMethod("disconnect", BluetoothDevice::class.java)
// method.invoke(proxy, device)
// } catch (e: Exception) {
// e.printStackTrace()
// } finally {
// bluetoothAdapter.closeProfileProxy(BluetoothProfile.A2DP, proxy)
// }
// }
// }
//
// override fun onServiceDisconnected(profile: Int) { }
// }, BluetoothProfile.A2DP)
//
// bluetoothAdapter?.getProfileProxy(context, object : BluetoothProfile.ServiceListener {
// override fun onServiceConnected(profile: Int, proxy: BluetoothProfile) {
// if (profile == BluetoothProfile.HEADSET) {
// try {
// val method = proxy.javaClass.getMethod("disconnect", BluetoothDevice::class.java)
// method.invoke(proxy, device)
// } catch (e: Exception) {
// e.printStackTrace()
// } finally {
// bluetoothAdapter.closeProfileProxy(BluetoothProfile.HEADSET, proxy)
// }
// }
// }
//
// override fun onServiceDisconnected(profile: Int) { }
// }, BluetoothProfile.HEADSET)
// }
//
// fun connectAudio(context: Context, device: BluetoothDevice?) {
// val bluetoothAdapter = context.getSystemService(BluetoothManager::class.java).adapter
//
// bluetoothAdapter?.getProfileProxy(context, object : BluetoothProfile.ServiceListener {
// override fun onServiceConnected(profile: Int, proxy: BluetoothProfile) {
// if (profile == BluetoothProfile.A2DP) {
// try {
// val method = proxy.javaClass.getMethod("connect", BluetoothDevice::class.java)
// method.invoke(proxy, device)
// } catch (e: Exception) {
// e.printStackTrace()
// } finally {
// bluetoothAdapter.closeProfileProxy(BluetoothProfile.A2DP, proxy)
// }
// }
// }
//
// override fun onServiceDisconnected(profile: Int) { }
// }, BluetoothProfile.A2DP)
//
// bluetoothAdapter?.getProfileProxy(context, object : BluetoothProfile.ServiceListener {
// override fun onServiceConnected(profile: Int, proxy: BluetoothProfile) {
// if (profile == BluetoothProfile.HEADSET) {
// try {
// val method = proxy.javaClass.getMethod("connect", BluetoothDevice::class.java)
// method.invoke(proxy, device)
// } catch (e: Exception) {
// e.printStackTrace()
// } finally {
// bluetoothAdapter.closeProfileProxy(BluetoothProfile.HEADSET, proxy)
// }
// }
// }
//
// override fun onServiceDisconnected(profile: Int) { }
// }, BluetoothProfile.HEADSET)
// }
//
// fun setName(name: String) {
// val nameBytes = name.toByteArray()
// val bytes = byteArrayOf(0x04, 0x00, 0x04, 0x00, 0x1a, 0x00, 0x01,
// nameBytes.size.toByte(), 0x00) + nameBytes
// socket?.outputStream?.write(bytes)
// socket?.outputStream?.flush()
// val hex = bytes.joinToString(" ") { "%02X".format(it) }
// Log.d("OldAirPodsService", "setName: $name, sent packet: $hex")
// }
//
// @SuppressLint("MissingPermission", "InlinedApi")
// override fun onStartCommand(intent: Intent?, flags: Int, startId: Int): Int {
//
// val notification = createNotification()
// startForeground(1, notification)
//
// ServiceManager.setService(this)
//
// if (isConnected) {
// return START_STICKY
// }
// isConnected = true
//
// @Suppress("DEPRECATION") val device = if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.TIRAMISU) intent?.getParcelableExtra("device", BluetoothDevice::class.java) else intent?.getParcelableExtra("device")
//
// HiddenApiBypass.addHiddenApiExemptions("Landroid/bluetooth/BluetoothSocket;")
// val uuid: ParcelUuid = ParcelUuid.fromString("74ec2172-0bad-4d01-8f77-997b2be0722a")
//
// socket = HiddenApiBypass.newInstance(BluetoothSocket::class.java, 3, true, true, device, 0x1001, uuid) as BluetoothSocket?
// try {
// socket?.connect()
// socket?.let { it ->
// it.outputStream.write(Enums.HANDSHAKE.value)
// it.outputStream.write(Enums.SET_SPECIFIC_FEATURES.value)
// it.outputStream.write(Enums.REQUEST_NOTIFICATIONS.value)
// sendBroadcast(Intent(AirPodsNotifications.AIRPODS_CONNECTED))
// it.outputStream.flush()
//
// CoroutineScope(Dispatchers.IO).launch {
// while (socket?.isConnected == true) {
// socket?.let {
// val audioManager = this@OldAirPodsService.getSystemService(AUDIO_SERVICE) as AudioManager
// MediaController.initialize(audioManager)
// val buffer = ByteArray(1024)
// val bytesRead = it.inputStream.read(buffer)
// var data: ByteArray = byteArrayOf()
// if (bytesRead > 0) {
// data = buffer.copyOfRange(0, bytesRead)
// sendBroadcast(Intent(AirPodsNotifications.AIRPODS_DATA).apply {
// putExtra("data", buffer.copyOfRange(0, bytesRead))
// })
// val bytes = buffer.copyOfRange(0, bytesRead)
// val formattedHex = bytes.joinToString(" ") { "%02X".format(it) }
// Log.d("AirPods Data", "Data received: $formattedHex")
// }
// else if (bytesRead == -1) {
// Log.d("AirPods Service", "Socket closed (bytesRead = -1)")
// this@OldAirPodsService.stopForeground(STOP_FOREGROUND_REMOVE)
// socket?.close()
// sendBroadcast(Intent(AirPodsNotifications.AIRPODS_DISCONNECTED))
// return@launch
// }
// var inEar = false
// var inEarData = listOf<Boolean>()
// if (earDetectionNotification.isEarDetectionData(data)) {
// earDetectionNotification.setStatus(data)
// sendBroadcast(Intent(AirPodsNotifications.EAR_DETECTION_DATA).apply {
// val list = earDetectionNotification.status
// val bytes = ByteArray(2)
// bytes[0] = list[0]
// bytes[1] = list[1]
// putExtra("data", bytes)
// })
// Log.d("AirPods Parser", "Ear Detection: ${earDetectionNotification.status[0]} ${earDetectionNotification.status[1]}")
// var justEnabledA2dp = false
// val earReceiver = object : BroadcastReceiver() {
// override fun onReceive(context: Context, intent: Intent) {
// val data = intent.getByteArrayExtra("data")
// if (data != null && earDetectionEnabled) {
// inEar = if (data.find { it == 0x02.toByte() } != null || data.find { it == 0x03.toByte() } != null) {
// data[0] == 0x00.toByte() || data[1] == 0x00.toByte()
// } else {
// data[0] == 0x00.toByte() && data[1] == 0x00.toByte()
// }
//
// val newInEarData = listOf(data[0] == 0x00.toByte(), data[1] == 0x00.toByte())
// if (newInEarData.contains(true) && inEarData == listOf(false, false)) {
// connectAudio(this@OldAirPodsService, device)
// justEnabledA2dp = true
// val bluetoothAdapter = this@OldAirPodsService.getSystemService(BluetoothManager::class.java).adapter
// bluetoothAdapter.getProfileProxy(
// this@OldAirPodsService, object : BluetoothProfile.ServiceListener {
// override fun onServiceConnected(
// profile: Int,
// proxy: BluetoothProfile
// ) {
// if (profile == BluetoothProfile.A2DP) {
// val connectedDevices =
// proxy.connectedDevices
// if (connectedDevices.isNotEmpty()) {
// MediaController.sendPlay()
// }
// }
// bluetoothAdapter.closeProfileProxy(
// profile,
// proxy
// )
// }
//
// override fun onServiceDisconnected(
// profile: Int
// ) {
// }
// }
// ,BluetoothProfile.A2DP
// )
//
// }
// else if (newInEarData == listOf(false, false)){
// disconnectAudio(this@OldAirPodsService, device)
// }
//
// inEarData = newInEarData
//
// if (inEar == true) {
// if (!justEnabledA2dp) {
// justEnabledA2dp = false
// MediaController.sendPlay()
// }
// } else {
// MediaController.sendPause()
// }
// }
// }
// }
//
// val earIntentFilter = IntentFilter(AirPodsNotifications.EAR_DETECTION_DATA)
// this@OldAirPodsService.registerReceiver(earReceiver, earIntentFilter,
// RECEIVER_EXPORTED
// )
// }
// else if (ancNotification.isANCData(data)) {
// ancNotification.setStatus(data)
// sendBroadcast(Intent(AirPodsNotifications.ANC_DATA).apply {
// putExtra("data", ancNotification.status)
// })
// Log.d("AirPods Parser", "ANC: ${ancNotification.status}")
// }
// else if (batteryNotification.isBatteryData(data)) {
// batteryNotification.setBattery(data)
// sendBroadcast(Intent(AirPodsNotifications.BATTERY_DATA).apply {
// putParcelableArrayListExtra("data", ArrayList(batteryNotification.getBattery()))
// })
// for (battery in batteryNotification.getBattery()) {
// Log.d("AirPods Parser", "${battery.getComponentName()}: ${battery.getStatusName()} at ${battery.level}% ")
// }
//// if both are charging, disconnect audio profiles
// if (batteryNotification.getBattery()[0].status == 1 && batteryNotification.getBattery()[1].status == 1) {
// disconnectAudio(this@OldAirPodsService, device)
// }
// else {
// connectAudio(this@OldAirPodsService, device)
// }
//// updatePodsStatus(device!!, batteryNotification.getBattery())
// }
// else if (conversationAwarenessNotification.isConversationalAwarenessData(data)) {
// conversationAwarenessNotification.setData(data)
// sendBroadcast(Intent(AirPodsNotifications.CA_DATA).apply {
// putExtra("data", conversationAwarenessNotification.status)
// })
//
//
// if (conversationAwarenessNotification.status == 1.toByte() || conversationAwarenessNotification.status == 2.toByte()) {
// MediaController.startSpeaking()
// } else if (conversationAwarenessNotification.status == 8.toByte() || conversationAwarenessNotification.status == 9.toByte()) {
// MediaController.stopSpeaking()
// }
//
// Log.d("AirPods Parser", "Conversation Awareness: ${conversationAwarenessNotification.status}")
// }
// else { }
// }
// }
// Log.d("AirPods Service", "Socket closed")
// isConnected = false
// this@OldAirPodsService.stopForeground(STOP_FOREGROUND_REMOVE)
// socket?.close()
// sendBroadcast(Intent(AirPodsNotifications.AIRPODS_DISCONNECTED))
// }
// }
// }
// catch (e: Exception) {
// Log.e("AirPodsSettingsScreen", "Error connecting to device: ${e.message}")
// }
// return START_STICKY
// }
//
// override fun onDestroy() {
// super.onDestroy()
// socket?.close()
// isConnected = false
// ServiceManager.setService(null)
// }
//
// fun setPVEnabled(enabled: Boolean) {
// var hex = "04 00 04 00 09 00 26 ${if (enabled) "01" else "02"} 00 00 00"
// var bytes = hex.split(" ").map { it.toInt(16).toByte() }.toByteArray()
// socket?.outputStream?.write(bytes)
// hex = "04 00 04 00 17 00 00 00 10 00 12 00 08 E${if (enabled) "6" else "5"} 05 10 02 42 0B 08 50 10 02 1A 05 02 ${if (enabled) "32" else "00"} 00 00 00"
// bytes = hex.split(" ").map { it.toInt(16).toByte() }.toByteArray()
// socket?.outputStream?.write(bytes)
// }
//
// fun setLoudSoundReduction(enabled: Boolean) {
// val hex = "52 1B 00 0${if (enabled) "1" else "0"}"
// val bytes = hex.split(" ").map { it.toInt(16).toByte() }.toByteArray()
// socket?.outputStream?.write(bytes)
// }
//}

View File

@@ -1,208 +0,0 @@
@file:Suppress("unused")
package me.kavishdevar.aln
import android.os.Parcelable
import kotlinx.parcelize.Parcelize
enum class Enums(val value: ByteArray) {
NOISE_CANCELLATION(Capabilities.NOISE_CANCELLATION),
CONVERSATION_AWARENESS(Capabilities.CONVERSATION_AWARENESS),
CUSTOMIZABLE_ADAPTIVE_TRANSPARENCY(Capabilities.CUSTOMIZABLE_ADAPTIVE_TRANSPARENCY),
PREFIX(byteArrayOf(0x04, 0x00, 0x04, 0x00)),
SETTINGS(byteArrayOf(0x09, 0x00)),
SUFFIX(byteArrayOf(0x00, 0x00, 0x00)),
NOTIFICATION_FILTER(byteArrayOf(0x0f)),
HANDSHAKE(byteArrayOf(0x00, 0x00, 0x04, 0x00, 0x01, 0x00, 0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00)),
SPECIFIC_FEATURES(byteArrayOf(0x4d)),
SET_SPECIFIC_FEATURES(PREFIX.value + SPECIFIC_FEATURES.value + byteArrayOf(0x00,
0xff.toByte(), 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00)),
REQUEST_NOTIFICATIONS(PREFIX.value + NOTIFICATION_FILTER.value + byteArrayOf(0x00, 0xff.toByte(), 0xff.toByte(), 0xff.toByte(), 0xff.toByte())),
NOISE_CANCELLATION_PREFIX(PREFIX.value + SETTINGS.value + NOISE_CANCELLATION.value),
NOISE_CANCELLATION_OFF(NOISE_CANCELLATION_PREFIX.value + Capabilities.NoiseCancellation.OFF.value + SUFFIX.value),
NOISE_CANCELLATION_ON(NOISE_CANCELLATION_PREFIX.value + Capabilities.NoiseCancellation.ON.value + SUFFIX.value),
NOISE_CANCELLATION_TRANSPARENCY(NOISE_CANCELLATION_PREFIX.value + Capabilities.NoiseCancellation.TRANSPARENCY.value + SUFFIX.value),
NOISE_CANCELLATION_ADAPTIVE(NOISE_CANCELLATION_PREFIX.value + Capabilities.NoiseCancellation.ADAPTIVE.value + SUFFIX.value),
SET_CONVERSATION_AWARENESS_OFF(PREFIX.value + SETTINGS.value + CONVERSATION_AWARENESS.value + Capabilities.ConversationAwareness.OFF.value + SUFFIX.value),
SET_CONVERSATION_AWARENESS_ON(PREFIX.value + SETTINGS.value + CONVERSATION_AWARENESS.value + Capabilities.ConversationAwareness.ON.value + SUFFIX.value),
CONVERSATION_AWARENESS_RECEIVE_PREFIX(PREFIX.value + byteArrayOf(0x4b, 0x00, 0x02, 0x00));
}
object BatteryComponent {
const val LEFT = 4
const val RIGHT = 2
const val CASE = 8
}
object BatteryStatus {
const val CHARGING = 1
const val NOT_CHARGING = 2
const val DISCONNECTED = 4
}
@Parcelize
data class Battery(val component: Int, val level: Int, val status: Int) : Parcelable {
fun getComponentName(): String? {
return when (component) {
BatteryComponent.LEFT -> "LEFT"
BatteryComponent.RIGHT -> "RIGHT"
BatteryComponent.CASE -> "CASE"
else -> null
}
}
fun getStatusName(): String? {
return when (status) {
BatteryStatus.CHARGING -> "CHARGING"
BatteryStatus.NOT_CHARGING -> "NOT_CHARGING"
BatteryStatus.DISCONNECTED -> "DISCONNECTED"
else -> null
}
}
}
enum class NoiseControlMode {
OFF, NOISE_CANCELLATION, TRANSPARENCY, ADAPTIVE
}
class AirPodsNotifications {
companion object {
const val AIRPODS_CONNECTED = "me.kavishdevar.aln.AIRPODS_CONNECTED"
const val AIRPODS_DATA = "me.kavishdevar.aln.AIRPODS_DATA"
const val EAR_DETECTION_DATA = "me.kavishdevar.aln.EAR_DETECTION_DATA"
const val ANC_DATA = "me.kavishdevar.aln.ANC_DATA"
const val BATTERY_DATA = "me.kavishdevar.aln.BATTERY_DATA"
const val CA_DATA = "me.kavishdevar.aln.CA_DATA"
const val AIRPODS_DISCONNECTED = "me.kavishdevar.aln.AIRPODS_DISCONNECTED"
const val AIRPODS_CONNECTION_DETECTED = "me.kavishdevar.aln.AIRPODS_CONNECTION_DETECTED"
}
class EarDetection {
private val notificationBit = Capabilities.EAR_DETECTION
private val notificationPrefix = Enums.PREFIX.value + notificationBit
var status: List<Byte> = listOf(0x01, 0x01)
fun setStatus(data: ByteArray) {
status = listOf(data[6], data[7])
}
fun isEarDetectionData(data: ByteArray): Boolean {
if (data.size != 8) {
return false
}
val prefixHex = notificationPrefix.joinToString("") { "%02x".format(it) }
val dataHex = data.joinToString("") { "%02x".format(it) }
return dataHex.startsWith(prefixHex)
}
}
class ANC {
private val notificationPrefix = Enums.NOISE_CANCELLATION_PREFIX.value
var status: Int = 1
private set
fun isANCData(data: ByteArray): Boolean {
if (data.size != 11) {
return false
}
val prefixHex = notificationPrefix.joinToString("") { "%02x".format(it) }
val dataHex = data.joinToString("") { "%02x".format(it) }
return dataHex.startsWith(prefixHex)
}
fun setStatus(data: ByteArray) {
status = data[7].toInt()
}
val name: String =
when (status) {
1 -> "OFF"
2 -> "ON"
3 -> "TRANSPARENCY"
4 -> "ADAPTIVE"
else -> "UNKNOWN"
}
}
class BatteryNotification {
private var first: Battery = Battery(BatteryComponent.LEFT, 0, BatteryStatus.DISCONNECTED)
private var second: Battery = Battery(BatteryComponent.RIGHT, 0, BatteryStatus.DISCONNECTED)
private var case: Battery = Battery(BatteryComponent.CASE, 0, BatteryStatus.DISCONNECTED)
fun isBatteryData(data: ByteArray): Boolean {
if (data.size != 22) {
return false
}
return data[0] == 0x04.toByte() && data[1] == 0x00.toByte() && data[2] == 0x04.toByte() &&
data[3] == 0x00.toByte() && data[4] == 0x04.toByte() && data[5] == 0x00.toByte()
}
fun setBattery(data: ByteArray) {
first = if (data[10].toInt() == BatteryStatus.DISCONNECTED) {
Battery(first.component, first.level, data[10].toInt())
} else {
Battery(data[7].toInt(), data[9].toInt(), data[10].toInt())
}
second = if (data[15].toInt() == BatteryStatus.DISCONNECTED) {
Battery(second.component, second.level, data[15].toInt())
} else {
Battery(data[12].toInt(), data[14].toInt(), data[15].toInt())
}
case = if (data[20].toInt() == BatteryStatus.DISCONNECTED && case.status != BatteryStatus.DISCONNECTED) {
Battery(case.component, case.level, data[20].toInt())
} else {
Battery(data[17].toInt(), data[19].toInt(), data[20].toInt())
}
}
fun getBattery(): List<Battery> {
val left = if (first.component == BatteryComponent.LEFT) first else second
val right = if (first.component == BatteryComponent.LEFT) second else first
return listOf(left, right, case)
}
}
class ConversationalAwarenessNotification {
private val NOTIFICATION_PREFIX = Enums.CONVERSATION_AWARENESS_RECEIVE_PREFIX.value
var status: Byte = 0
private set
fun isConversationalAwarenessData(data: ByteArray): Boolean {
if (data.size != 10) {
return false
}
val prefixHex = NOTIFICATION_PREFIX.joinToString("") { "%02x".format(it) }
val dataHex = data.joinToString("") { "%02x".format(it) }
return dataHex.startsWith(prefixHex)
}
fun setData(data: ByteArray) {
status = data[9]
}
}
}
class Capabilities {
companion object {
val NOISE_CANCELLATION = byteArrayOf(0x0d)
val CONVERSATION_AWARENESS = byteArrayOf(0x28)
val CUSTOMIZABLE_ADAPTIVE_TRANSPARENCY = byteArrayOf(0x01, 0x02)
val EAR_DETECTION = byteArrayOf(0x06)
}
enum class NoiseCancellation(val value: ByteArray) {
OFF(byteArrayOf(0x01)),
ON(byteArrayOf(0x02)),
TRANSPARENCY(byteArrayOf(0x03)),
ADAPTIVE(byteArrayOf(0x04));
}
enum class ConversationAwareness(val value: ByteArray) {
OFF(byteArrayOf(0x02)),
ON(byteArrayOf(0x01));
}
}

View File

@@ -1,170 +0,0 @@
package me.kavishdevar.aln
import android.animation.Animator
import android.animation.AnimatorListenerAdapter
import android.animation.ObjectAnimator
import android.annotation.SuppressLint
import android.content.Context
import android.graphics.PixelFormat
import android.util.Log
import android.view.Gravity
import android.view.LayoutInflater
import android.view.MotionEvent
import android.view.View
import android.view.WindowManager
import android.view.animation.AccelerateInterpolator
import android.view.animation.DecelerateInterpolator
import android.widget.ImageButton
import android.widget.LinearLayout
import android.widget.TextView
import android.widget.VideoView
import kotlinx.coroutines.CoroutineScope
import kotlinx.coroutines.MainScope
import kotlinx.coroutines.delay
import kotlinx.coroutines.launch
import java.lang.Exception
@SuppressLint("InflateParams", "ClickableViewAccessibility")
class Window (context: Context) {
private val mView: View
@Suppress("DEPRECATION")
@SuppressLint("NewApi")
private val mParams: WindowManager.LayoutParams = WindowManager.LayoutParams().apply {
height = WindowManager.LayoutParams.WRAP_CONTENT
width = WindowManager.LayoutParams.MATCH_PARENT
type = WindowManager.LayoutParams.TYPE_APPLICATION_OVERLAY
format = PixelFormat.TRANSLUCENT
gravity = Gravity.BOTTOM
dimAmount = 0.3f
flags = WindowManager.LayoutParams.FLAG_LAYOUT_NO_LIMITS or
WindowManager.LayoutParams.FLAG_FULLSCREEN or
WindowManager.LayoutParams.FLAG_NOT_FOCUSABLE or
WindowManager.LayoutParams.FLAG_DIM_BEHIND or
WindowManager.LayoutParams.FLAG_WATCH_OUTSIDE_TOUCH
}
private val mWindowManager: WindowManager
init {
val layoutInflater = context.getSystemService(Context.LAYOUT_INFLATER_SERVICE) as LayoutInflater
mView = layoutInflater.inflate(R.layout.popup_window, null)
mParams.x = 0
mParams.y = 0
mParams.gravity = Gravity.BOTTOM
mView.setOnClickListener(View.OnClickListener {
close()
})
mView.findViewById<ImageButton>(R.id.close_button)
.setOnClickListener {
close()
}
val ll = mView.findViewById<LinearLayout>(R.id.linear_layout)
ll.setOnClickListener {
close()
}
@Suppress("DEPRECATION")
mView.systemUiVisibility = View.SYSTEM_UI_FLAG_LAYOUT_STABLE or
View.SYSTEM_UI_FLAG_LAYOUT_HIDE_NAVIGATION or
View.SYSTEM_UI_FLAG_LAYOUT_FULLSCREEN or
View.SYSTEM_UI_FLAG_HIDE_NAVIGATION or
View.SYSTEM_UI_FLAG_FULLSCREEN or
View.SYSTEM_UI_FLAG_IMMERSIVE_STICKY
mView.setOnTouchListener { _, event ->
if (event.action == MotionEvent.ACTION_DOWN) {
val touchY = event.rawY
val popupTop = mView.top
if (touchY < popupTop) {
close()
true
} else {
false
}
} else {
false
}
}
mWindowManager = context.getSystemService(Context.WINDOW_SERVICE) as WindowManager
}
@SuppressLint("InlinedApi", "SetTextI18n")
fun open(name: String = "AirPods Pro", batteryNotification: AirPodsNotifications.BatteryNotification) {
try {
if (mView.windowToken == null) {
if (mView.parent == null) {
// Add the view initially off-screen
mWindowManager.addView(mView, mParams)
mView.findViewById<TextView>(R.id.name).text = name
val vid = mView.findViewById<VideoView>(R.id.video)
vid.setVideoPath("android.resource://me.kavishdevar.aln/" + R.raw.connected)
vid.resolveAdjustedSize(vid.width, vid.height)
vid.start()
vid.setOnCompletionListener {
vid.start()
}
val batteryStatus = batteryNotification.getBattery()
val batteryLeftText = mView.findViewById<TextView>(R.id.left_battery)
val batteryRightText = mView.findViewById<TextView>(R.id.right_battery)
val batteryCaseText = mView.findViewById<TextView>(R.id.case_battery)
batteryLeftText.text = batteryStatus.find { it.component == BatteryComponent.LEFT }?.let {
"\uDBC3\uDC8E ${it.level}%"
} ?: ""
batteryRightText.text = batteryStatus.find { it.component == BatteryComponent.RIGHT }?.let {
"\uDBC3\uDC8D ${it.level}%"
} ?: ""
batteryCaseText.text = batteryStatus.find { it.component == BatteryComponent.CASE }?.let {
"\uDBC3\uDE6C ${it.level}%"
} ?: ""
// Slide-up animation
val displayMetrics = mView.context.resources.displayMetrics
val screenHeight = displayMetrics.heightPixels
mView.translationY = screenHeight.toFloat() // Start below the screen
ObjectAnimator.ofFloat(mView, "translationY", 0f).apply {
duration = 500 // Animation duration in milliseconds
interpolator = DecelerateInterpolator() // Smooth deceleration
start()
}
CoroutineScope(MainScope().coroutineContext).launch {
delay(12000)
close()
}
}
}
} catch (e: Exception) {
Log.d("PopupService", e.toString())
}
}
fun close() {
try {
ObjectAnimator.ofFloat(mView, "translationY", mView.height.toFloat()).apply {
duration = 500 // Animation duration in milliseconds
interpolator = AccelerateInterpolator() // Smooth acceleration
addListener(object : AnimatorListenerAdapter() {
override fun onAnimationEnd(animation: Animator) {
try {
mWindowManager.removeView(mView)
} catch (e: Exception) {
Log.d("PopupService", e.toString())
}
}
})
start()
}
} catch (e: Exception) {
Log.d("PopupService", e.toString())
}
}
}

View File

@@ -1,62 +0,0 @@
package me.kavishdevar.aln
import android.annotation.SuppressLint
import android.bluetooth.BluetoothDevice
import android.content.BroadcastReceiver
import android.content.Context
import android.content.Intent
import android.content.IntentFilter
class BluetoothReceiver : BroadcastReceiver() {
fun onConnect(bluetoothDevice: BluetoothDevice?) {
}
fun onDisconnect(bluetoothDevice: BluetoothDevice?) {
}
@SuppressLint("NewApi")
override fun onReceive(context: Context?, intent: Intent) {
val bluetoothDevice =
intent.getParcelableExtra("android.bluetooth.device.extra.DEVICE", BluetoothDevice::class.java)
val action = intent.action
// Airpods filter
if (bluetoothDevice != null && action != null && !action.isEmpty()) {
// Airpods connected, show notification.
if (BluetoothDevice.ACTION_ACL_CONNECTED == action) {
onConnect(bluetoothDevice)
}
// Airpods disconnected, remove notification but leave the scanner going.
if (BluetoothDevice.ACTION_ACL_DISCONNECTED == action
|| BluetoothDevice.ACTION_ACL_DISCONNECT_REQUESTED == action
) {
onDisconnect(bluetoothDevice)
}
}
}
companion object {
/**
* When the service is created, we register to get as many bluetooth and airpods related events as possible.
* ACL_CONNECTED and ACL_DISCONNECTED should have been enough, but you never know with android these days.
*/
fun buildFilter(): IntentFilter {
val intentFilter = IntentFilter()
intentFilter.addAction("android.bluetooth.device.action.ACL_CONNECTED")
intentFilter.addAction("android.bluetooth.device.action.ACL_DISCONNECTED")
intentFilter.addAction("android.bluetooth.device.action.BOND_STATE_CHANGED")
intentFilter.addAction("android.bluetooth.device.action.NAME_CHANGED")
intentFilter.addAction("android.bluetooth.adapter.action.CONNECTION_STATE_CHANGED")
intentFilter.addAction("android.bluetooth.adapter.action.STATE_CHANGED")
intentFilter.addAction("android.bluetooth.headset.profile.action.CONNECTION_STATE_CHANGED")
intentFilter.addAction("android.bluetooth.headset.action.VENDOR_SPECIFIC_HEADSET_EVENT")
intentFilter.addAction("android.bluetooth.a2dp.profile.action.CONNECTION_STATE_CHANGED")
intentFilter.addAction("android.bluetooth.a2dp.profile.action.PLAYING_STATE_CHANGED")
intentFilter.addCategory("android.bluetooth.headset.intent.category.companyid.76")
return intentFilter
}
}
}

View File

@@ -1,11 +0,0 @@
package me.kavishdevar.aln.ui.theme
import androidx.compose.ui.graphics.Color
val Purple80 = Color(0xFFD0BCFF)
val PurpleGrey80 = Color(0xFFCCC2DC)
val Pink80 = Color(0xFFEFB8C8)
val Purple40 = Color(0xFF6650a4)
val PurpleGrey40 = Color(0xFF625b71)
val Pink40 = Color(0xFF7D5260)

View File

@@ -0,0 +1,808 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
@file:OptIn(ExperimentalEncodingApi::class)
package me.kavishdevar.librepods
import android.annotation.SuppressLint
import android.content.BroadcastReceiver
import android.content.ComponentName
import android.content.Context
import android.content.Context.MODE_PRIVATE
import android.content.Intent
import android.content.ServiceConnection
import android.net.Uri
import android.os.Build
import android.os.Bundle
import android.os.IBinder
import android.provider.Settings
import android.util.Log
import android.widget.Toast
import androidx.activity.ComponentActivity
import androidx.activity.compose.setContent
import androidx.activity.enableEdgeToEdge
import androidx.compose.animation.AnimatedVisibility
import androidx.compose.animation.core.RepeatMode
import androidx.compose.animation.core.animateFloat
import androidx.compose.animation.core.infiniteRepeatable
import androidx.compose.animation.core.rememberInfiniteTransition
import androidx.compose.animation.core.tween
import androidx.compose.animation.fadeIn
import androidx.compose.animation.fadeOut
import androidx.compose.animation.scaleIn
import androidx.compose.animation.scaleOut
import androidx.compose.animation.slideInHorizontally
import androidx.compose.animation.slideOutHorizontally
import androidx.compose.foundation.Canvas
import androidx.compose.foundation.background
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Box
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.Row
import androidx.compose.foundation.layout.Spacer
import androidx.compose.foundation.layout.fillMaxSize
import androidx.compose.foundation.layout.fillMaxWidth
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.layout.size
import androidx.compose.foundation.rememberScrollState
import androidx.compose.foundation.shape.RoundedCornerShape
import androidx.compose.foundation.verticalScroll
import androidx.compose.material.icons.Icons
import androidx.compose.material.icons.filled.Notifications
import androidx.compose.material.icons.filled.Phone
import androidx.compose.material3.Button
import androidx.compose.material3.ButtonDefaults
import androidx.compose.material3.Card
import androidx.compose.material3.CardDefaults
import androidx.compose.material3.ExperimentalMaterial3Api
import androidx.compose.material3.Icon
import androidx.compose.material3.MaterialTheme
import androidx.compose.material3.Text
import androidx.compose.runtime.Composable
import androidx.compose.runtime.LaunchedEffect
import androidx.compose.runtime.getValue
import androidx.compose.runtime.mutableStateOf
import androidx.compose.runtime.remember
import androidx.compose.runtime.setValue
import androidx.compose.ui.Alignment
import androidx.compose.ui.Modifier
import androidx.compose.ui.draw.clip
import androidx.compose.ui.draw.scale
import androidx.compose.ui.geometry.Offset
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.graphics.drawscope.rotate
import androidx.compose.ui.graphics.toArgb
import androidx.compose.ui.graphics.vector.ImageVector
import androidx.compose.ui.platform.LocalContext
import androidx.compose.ui.platform.LocalWindowInfo
import androidx.compose.ui.res.stringResource
import androidx.compose.ui.res.vectorResource
import androidx.compose.ui.text.TextStyle
import androidx.compose.ui.text.font.Font
import androidx.compose.ui.text.font.FontFamily
import androidx.compose.ui.text.font.FontWeight
import androidx.compose.ui.text.style.TextAlign
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.sp
import androidx.core.content.edit
import androidx.core.net.toUri
import androidx.navigation.compose.NavHost
import androidx.navigation.compose.composable
import androidx.navigation.compose.rememberNavController
import com.google.accompanist.permissions.ExperimentalPermissionsApi
import com.google.accompanist.permissions.MultiplePermissionsState
import com.google.accompanist.permissions.isGranted
import com.google.accompanist.permissions.rememberMultiplePermissionsState
import com.kyant.backdrop.backdrops.layerBackdrop
import com.kyant.backdrop.backdrops.rememberLayerBackdrop
import dev.chrisbanes.haze.materials.ExperimentalHazeMaterialsApi
import me.kavishdevar.librepods.composables.StyledIconButton
import me.kavishdevar.librepods.constants.AirPodsNotifications
import me.kavishdevar.librepods.screens.AccessibilitySettingsScreen
import me.kavishdevar.librepods.screens.AdaptiveStrengthScreen
import me.kavishdevar.librepods.screens.AirPodsSettingsScreen
import me.kavishdevar.librepods.screens.AppSettingsScreen
import me.kavishdevar.librepods.screens.CameraControlScreen
import me.kavishdevar.librepods.screens.DebugScreen
import me.kavishdevar.librepods.screens.HeadTrackingScreen
import me.kavishdevar.librepods.screens.HearingAidAdjustmentsScreen
import me.kavishdevar.librepods.screens.HearingAidScreen
import me.kavishdevar.librepods.screens.HearingProtectionScreen
import me.kavishdevar.librepods.screens.LongPress
import me.kavishdevar.librepods.screens.Onboarding
import me.kavishdevar.librepods.screens.OpenSourceLicensesScreen
import me.kavishdevar.librepods.screens.RenameScreen
import me.kavishdevar.librepods.screens.TransparencySettingsScreen
import me.kavishdevar.librepods.screens.TroubleshootingScreen
import me.kavishdevar.librepods.screens.UpdateHearingTestScreen
import me.kavishdevar.librepods.screens.VersionScreen
import me.kavishdevar.librepods.services.AirPodsService
import me.kavishdevar.librepods.ui.theme.LibrePodsTheme
import me.kavishdevar.librepods.utils.RadareOffsetFinder
import kotlin.io.encoding.Base64
import kotlin.io.encoding.ExperimentalEncodingApi
lateinit var serviceConnection: ServiceConnection
lateinit var connectionStatusReceiver: BroadcastReceiver
@ExperimentalMaterial3Api
class MainActivity : ComponentActivity() {
companion object {
init {
System.loadLibrary("l2c_fcr_hook")
}
}
override fun onCreate(savedInstanceState: Bundle?) {
super.onCreate(savedInstanceState)
enableEdgeToEdge()
setContent {
LibrePodsTheme {
getSharedPreferences("settings", MODE_PRIVATE).edit {
putLong(
"textColor",
MaterialTheme.colorScheme.onSurface.toArgb().toLong())}
Main()
}
}
handleIncomingIntent(intent)
}
override fun onDestroy() {
try {
unbindService(serviceConnection)
Log.d("MainActivity", "Unbound service")
} catch (e: Exception) {
Log.e("MainActivity", "Error while unbinding service: $e")
}
try {
unregisterReceiver(connectionStatusReceiver)
Log.d("MainActivity", "Unregistered receiver")
} catch (e: Exception) {
Log.e("MainActivity", "Error while unregistering receiver: $e")
}
sendBroadcast(Intent(AirPodsNotifications.DISCONNECT_RECEIVERS))
super.onDestroy()
}
override fun onStop() {
try {
unbindService(serviceConnection)
Log.d("MainActivity", "Unbound service")
} catch (e: Exception) {
Log.e("MainActivity", "Error while unbinding service: $e")
}
try {
unregisterReceiver(connectionStatusReceiver)
Log.d("MainActivity", "Unregistered receiver")
} catch (e: Exception) {
Log.e("MainActivity", "Error while unregistering receiver: $e")
}
super.onStop()
}
override fun onNewIntent(intent: Intent) {
super.onNewIntent(intent)
setIntent(intent)
handleIncomingIntent(intent)
}
private fun handleIncomingIntent(intent: Intent) {
val data: Uri? = intent.data
if (data != null && data.scheme == "librepods") {
when (data.host) {
"add-magic-keys" -> {
val queryParams = data.queryParameterNames
queryParams.forEach { param ->
val value = data.getQueryParameter(param)
Log.d("LibrePods", "Parameter: $param = $value")
}
handleAddMagicKeys(data)
}
}
}
}
private fun handleAddMagicKeys(uri: Uri) {
val sharedPreferences = getSharedPreferences("settings", MODE_PRIVATE)
val irkHex = uri.getQueryParameter("irk")
val encKeyHex = uri.getQueryParameter("enc_key")
try {
if (irkHex != null && validateHexInput(irkHex)) {
val irkBytes = hexStringToByteArray(irkHex)
val irkBase64 = Base64.encode(irkBytes)
sharedPreferences.edit {putString("IRK", irkBase64)}
}
if (encKeyHex != null && validateHexInput(encKeyHex)) {
val encKeyBytes = hexStringToByteArray(encKeyHex)
val encKeyBase64 = Base64.encode(encKeyBytes)
sharedPreferences.edit { putString("ENC_KEY", encKeyBase64)}
}
Toast.makeText(this, "Magic keys added successfully!", Toast.LENGTH_SHORT).show()
} catch (e: Exception) {
Toast.makeText(this, "Error processing magic keys: ${e.message}", Toast.LENGTH_LONG).show()
}
}
private fun validateHexInput(input: String): Boolean {
val hexPattern = Regex("^[0-9a-fA-F]{32}$")
return hexPattern.matches(input)
}
private fun hexStringToByteArray(hex: String): ByteArray {
val result = ByteArray(16)
for (i in 0 until 16) {
val hexByte = hex.substring(i * 2, i * 2 + 2)
result[i] = hexByte.toInt(16).toByte()
}
return result
}
}
@ExperimentalHazeMaterialsApi
@SuppressLint("MissingPermission", "InlinedApi", "UnspecifiedRegisterReceiverFlag")
@OptIn(ExperimentalPermissionsApi::class)
@Composable
fun Main() {
val isConnected = remember { mutableStateOf(false) }
val isRemotelyConnected = remember { mutableStateOf(false) }
val hookAvailable = RadareOffsetFinder(LocalContext.current).isHookOffsetAvailable()
val context = LocalContext.current
var canDrawOverlays by remember { mutableStateOf(Settings.canDrawOverlays(context)) }
val overlaySkipped = remember { mutableStateOf(context.getSharedPreferences("settings", MODE_PRIVATE).getBoolean("overlay_permission_skipped", false)) }
val bluetoothPermissions = if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.S) {
listOf(
"android.permission.BLUETOOTH_CONNECT",
"android.permission.BLUETOOTH_SCAN",
"android.permission.BLUETOOTH",
"android.permission.BLUETOOTH_ADMIN",
"android.permission.BLUETOOTH_ADVERTISE"
)
} else {
listOf(
"android.permission.BLUETOOTH",
"android.permission.BLUETOOTH_ADMIN",
"android.permission.ACCESS_FINE_LOCATION"
)
}
val otherPermissions = listOf(
"android.permission.POST_NOTIFICATIONS",
"android.permission.READ_PHONE_STATE",
"android.permission.ANSWER_PHONE_CALLS"
)
val allPermissions = bluetoothPermissions + otherPermissions
val permissionState = rememberMultiplePermissionsState(
permissions = allPermissions
)
val airPodsService = remember { mutableStateOf<AirPodsService?>(null) }
LaunchedEffect(Unit) {
canDrawOverlays = Settings.canDrawOverlays(context)
}
if (permissionState.allPermissionsGranted && (canDrawOverlays || overlaySkipped.value)) {
val context = LocalContext.current
val navController = rememberNavController()
Box (
modifier = Modifier
.fillMaxSize()
){
val backButtonBackdrop = rememberLayerBackdrop()
Box (
modifier = Modifier
.fillMaxSize()
.background(if (isSystemInDarkTheme()) Color.Black else Color(0xFFF2F2F7))
.layerBackdrop(backButtonBackdrop)
) {
NavHost(
navController = navController,
startDestination = if (hookAvailable) "settings" else "onboarding",
enterTransition = {
slideInHorizontally(
initialOffsetX = { it },
animationSpec = tween(durationMillis = 300)
) // + fadeIn(animationSpec = tween(durationMillis = 300))
},
exitTransition = {
slideOutHorizontally(
targetOffsetX = { -it/4 },
animationSpec = tween(durationMillis = 300)
) // + fadeOut(animationSpec = tween(durationMillis = 150))
},
popEnterTransition = {
slideInHorizontally(
initialOffsetX = { -it/4 },
animationSpec = tween(durationMillis = 300)
) // + fadeIn(animationSpec = tween(durationMillis = 300))
},
popExitTransition = {
slideOutHorizontally(
targetOffsetX = { it },
animationSpec = tween(durationMillis = 300)
) // + fadeOut(animationSpec = tween(durationMillis = 150))
}
) {
composable("settings") {
if (airPodsService.value != null) {
AirPodsSettingsScreen(
dev = airPodsService.value?.device,
service = airPodsService.value!!,
navController = navController,
isConnected = isConnected.value,
isRemotelyConnected = isRemotelyConnected.value
)
}
}
composable("debug") {
DebugScreen(navController = navController)
}
composable("long_press/{bud}") { navBackStackEntry ->
LongPress(
navController = navController,
name = navBackStackEntry.arguments?.getString("bud")!!
)
}
composable("rename") {
RenameScreen(navController)
}
composable("app_settings") {
AppSettingsScreen(navController)
}
composable("troubleshooting") {
TroubleshootingScreen(navController)
}
composable("head_tracking") {
HeadTrackingScreen(navController)
}
composable("onboarding") {
Onboarding(navController, context)
}
composable("accessibility") {
AccessibilitySettingsScreen(navController)
}
composable("transparency_customization") {
TransparencySettingsScreen(navController)
}
composable("hearing_aid") {
HearingAidScreen(navController)
}
composable("hearing_aid_adjustments") {
HearingAidAdjustmentsScreen(navController)
}
composable("adaptive_strength") {
AdaptiveStrengthScreen(navController)
}
composable("camera_control") {
CameraControlScreen(navController)
}
composable("open_source_licenses") {
OpenSourceLicensesScreen(navController)
}
composable("update_hearing_test") {
UpdateHearingTestScreen(navController)
}
composable("version_info") {
VersionScreen(navController)
}
composable("hearing_protection") {
HearingProtectionScreen(navController)
}
}
}
val showBackButton = remember{ mutableStateOf(false) }
LaunchedEffect(navController) {
navController.addOnDestinationChangedListener { _, destination, _ ->
showBackButton.value = destination.route != "settings" && destination.route != "onboarding"
Log.d("MainActivity", "Navigated to ${destination.route}, showBackButton: ${showBackButton.value}")
}
}
AnimatedVisibility(
visible = showBackButton.value,
enter = fadeIn(animationSpec = tween()) + scaleIn(initialScale = 0f, animationSpec = tween()),
exit = fadeOut(animationSpec = tween()) + scaleOut(targetScale = 0.5f, animationSpec = tween(100)),
modifier = Modifier
.align(Alignment.TopStart)
.padding(
start = 8.dp,
top = (LocalWindowInfo.current.containerSize.width * 0.05f).dp
)
) {
StyledIconButton(
onClick = { navController.popBackStack() },
icon = "􀯶",
darkMode = isSystemInDarkTheme(),
backdrop = backButtonBackdrop
)
}
}
serviceConnection = remember {
object : ServiceConnection {
override fun onServiceConnected(name: ComponentName?, service: IBinder?) {
val binder = service as AirPodsService.LocalBinder
airPodsService.value = binder.getService()
}
override fun onServiceDisconnected(name: ComponentName?) {
airPodsService.value = null
}
}
}
context.bindService(Intent(context, AirPodsService::class.java), serviceConnection, Context.BIND_AUTO_CREATE)
if (airPodsService.value?.isConnectedLocally == true) {
isConnected.value = true
}
} else {
PermissionsScreen(
permissionState = permissionState,
canDrawOverlays = canDrawOverlays,
onOverlaySettingsReturn = { canDrawOverlays = Settings.canDrawOverlays(context) }
)
}
}
@OptIn(ExperimentalPermissionsApi::class, ExperimentalMaterial3Api::class)
@Composable
fun PermissionsScreen(
permissionState: MultiplePermissionsState,
canDrawOverlays: Boolean,
onOverlaySettingsReturn: () -> Unit
) {
val context = LocalContext.current
val isDarkTheme = isSystemInDarkTheme()
val backgroundColor = if (isDarkTheme) Color(0xFF1C1C1E) else Color.White
val textColor = if (isDarkTheme) Color.White else Color.Black
val accentColor = if (isDarkTheme) Color(0xFF007AFF) else Color(0xFF3C6DF5)
val scrollState = rememberScrollState()
val basicPermissionsGranted = permissionState.permissions.all { it.status.isGranted }
val infiniteTransition = rememberInfiniteTransition(label = "pulse")
val pulseScale by infiniteTransition.animateFloat(
initialValue = 1f,
targetValue = 1.05f,
animationSpec = infiniteRepeatable(
animation = tween(1000),
repeatMode = RepeatMode.Reverse
),
label = "pulse scale"
)
Column(
modifier = Modifier
.fillMaxSize()
.background(if (isDarkTheme) Color.Black else Color(0xFFF2F2F7))
.padding(16.dp)
.verticalScroll(scrollState),
horizontalAlignment = Alignment.CenterHorizontally
) {
Box(
modifier = Modifier
.fillMaxWidth()
.height(180.dp),
contentAlignment = Alignment.Center
) {
Text(
text = "\uDBC2\uDEB7",
style = TextStyle(
fontSize = 48.sp,
fontWeight = FontWeight.Bold,
fontFamily = FontFamily(Font(R.font.sf_pro)),
color = textColor,
textAlign = TextAlign.Center
)
)
Canvas(
modifier = Modifier
.size(120.dp)
.scale(pulseScale)
) {
val radius = size.minDimension / 2.2f
val centerX = size.width / 2
val centerY = size.height / 2
rotate(degrees = 45f) {
drawCircle(
color = accentColor.copy(alpha = 0.1f),
radius = radius * 1.3f,
center = Offset(centerX, centerY)
)
drawCircle(
color = accentColor.copy(alpha = 0.2f),
radius = radius * 1.1f,
center = Offset(centerX, centerY)
)
}
}
}
Spacer(modifier = Modifier.height(16.dp))
Text(
text = "Permission Required",
style = TextStyle(
fontSize = 24.sp,
fontWeight = FontWeight.Bold,
fontFamily = FontFamily(Font(R.font.sf_pro)),
color = textColor,
textAlign = TextAlign.Center
),
modifier = Modifier.fillMaxWidth()
)
Spacer(modifier = Modifier.height(8.dp))
Text(
text = stringResource(R.string.permissions_required),
style = TextStyle(
fontSize = 16.sp,
fontWeight = FontWeight.Normal,
fontFamily = FontFamily(Font(R.font.sf_pro)),
color = textColor.copy(alpha = 0.7f),
textAlign = TextAlign.Center
),
modifier = Modifier.fillMaxWidth()
)
Spacer(modifier = Modifier.height(32.dp))
PermissionCard(
title = "Bluetooth Permissions",
description = "Required to communicate with your AirPods",
icon = ImageVector.vectorResource(id = R.drawable.ic_bluetooth),
isGranted = permissionState.permissions.filter {
it.permission.contains("BLUETOOTH")
}.all { it.status.isGranted },
backgroundColor = backgroundColor,
textColor = textColor,
accentColor = accentColor
)
PermissionCard(
title = "Notification Permission",
description = "To show battery status",
icon = Icons.Default.Notifications,
isGranted = permissionState.permissions.find {
it.permission == "android.permission.POST_NOTIFICATIONS"
}?.status?.isGranted == true,
backgroundColor = backgroundColor,
textColor = textColor,
accentColor = accentColor
)
PermissionCard(
title = "Phone Permissions",
description = "For answering calls with Head Gestures",
icon = Icons.Default.Phone,
isGranted = permissionState.permissions.filter {
it.permission.contains("PHONE") || it.permission.contains("CALLS")
}.all { it.status.isGranted },
backgroundColor = backgroundColor,
textColor = textColor,
accentColor = accentColor
)
PermissionCard(
title = "Display Over Other Apps",
description = "For popup animations when AirPods connect",
icon = ImageVector.vectorResource(id = R.drawable.ic_layers),
isGranted = canDrawOverlays,
backgroundColor = backgroundColor,
textColor = textColor,
accentColor = accentColor
)
Spacer(modifier = Modifier.height(24.dp))
Button(
onClick = { permissionState.launchMultiplePermissionRequest() },
modifier = Modifier
.fillMaxWidth()
.height(55.dp),
colors = ButtonDefaults.buttonColors(
containerColor = accentColor
),
shape = RoundedCornerShape(8.dp)
) {
Text(
"Ask for regular permissions",
style = TextStyle(
fontSize = 16.sp,
fontWeight = FontWeight.Medium,
fontFamily = FontFamily(Font(R.font.sf_pro)),
color = Color.White
),
)
}
Spacer(modifier = Modifier.height(12.dp))
Button(
onClick = {
val intent = Intent(
Settings.ACTION_MANAGE_OVERLAY_PERMISSION,
"package:${context.packageName}".toUri()
)
context.startActivity(intent)
onOverlaySettingsReturn()
},
modifier = Modifier
.fillMaxWidth()
.height(55.dp),
colors = ButtonDefaults.buttonColors(
containerColor = if (canDrawOverlays) Color.Gray else accentColor
),
enabled = !canDrawOverlays,
shape = RoundedCornerShape(8.dp)
) {
Text(
if (canDrawOverlays) "Overlay Permission Granted" else "Grant Overlay Permission",
style = TextStyle(
fontSize = 16.sp,
fontWeight = FontWeight.Medium,
fontFamily = FontFamily(Font(R.font.sf_pro)),
color = Color.White
),
)
}
if (!canDrawOverlays && basicPermissionsGranted) {
Spacer(modifier = Modifier.height(12.dp))
Button(
onClick = {
context.getSharedPreferences("settings", MODE_PRIVATE).edit {
putBoolean("overlay_permission_skipped", true)
}
val intent = Intent(context, MainActivity::class.java)
intent.addFlags(Intent.FLAG_ACTIVITY_CLEAR_TOP)
context.startActivity(intent)
},
modifier = Modifier
.fillMaxWidth()
.height(55.dp),
colors = ButtonDefaults.buttonColors(
containerColor = Color(0xFF757575)
),
shape = RoundedCornerShape(8.dp)
) {
Text(
"Continue without overlay",
style = TextStyle(
fontSize = 16.sp,
fontWeight = FontWeight.Medium,
fontFamily = FontFamily(Font(R.font.sf_pro)),
color = Color.White
),
)
}
}
}
}
@Composable
fun PermissionCard(
title: String,
description: String,
icon: ImageVector,
isGranted: Boolean,
backgroundColor: Color,
textColor: Color,
accentColor: Color
) {
Card(
modifier = Modifier
.fillMaxWidth()
.padding(vertical = 6.dp),
colors = CardDefaults.cardColors(
containerColor = backgroundColor
),
shape = RoundedCornerShape(12.dp)
) {
Row(
modifier = Modifier
.fillMaxWidth()
.padding(16.dp),
verticalAlignment = Alignment.CenterVertically
) {
Box(
modifier = Modifier
.size(40.dp)
.clip(RoundedCornerShape(8.dp))
.background(
if (isGranted) accentColor.copy(alpha = 0.15f) else Color.Gray.copy(
alpha = 0.15f
)
),
contentAlignment = Alignment.Center
) {
Icon(
imageVector = icon,
contentDescription = title,
tint = if (isGranted) accentColor else Color.Gray,
modifier = Modifier.size(24.dp)
)
}
Column(
modifier = Modifier
.weight(1f)
.padding(start = 16.dp)
) {
Text(
text = title,
style = TextStyle(
fontSize = 16.sp,
fontWeight = FontWeight.Medium,
fontFamily = FontFamily(Font(R.font.sf_pro)),
color = textColor
)
)
Text(
text = description,
style = TextStyle(
fontSize = 14.sp,
fontWeight = FontWeight.Normal,
fontFamily = FontFamily(Font(R.font.sf_pro)),
color = textColor.copy(alpha = 0.6f)
)
)
}
Box(
modifier = Modifier
.size(24.dp)
.clip(RoundedCornerShape(12.dp))
.background(if (isGranted) Color(0xFF4CAF50) else Color.Gray),
contentAlignment = Alignment.Center
) {
Text(
text = if (isGranted) "" else "!",
style = TextStyle(
fontSize = 14.sp,
fontWeight = FontWeight.Bold,
color = Color.White
)
)
}
}
}
}

View File

@@ -0,0 +1,639 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
@file:OptIn(ExperimentalEncodingApi::class)
package me.kavishdevar.librepods
import android.annotation.SuppressLint
import android.content.BroadcastReceiver
import android.content.ComponentName
import android.content.Context
import android.content.Intent
import android.content.IntentFilter
import android.content.ServiceConnection
import android.media.AudioManager
import android.os.Build
import android.os.Bundle
import android.os.IBinder
import android.util.Log
import android.view.Gravity
import android.view.WindowManager
import androidx.activity.ComponentActivity
import androidx.activity.compose.setContent
import androidx.compose.animation.Crossfade
import androidx.compose.animation.animateContentSize
import androidx.compose.animation.core.Animatable
import androidx.compose.animation.core.FastOutSlowInEasing
import androidx.compose.animation.core.Spring
import androidx.compose.animation.core.animateFloatAsState
import androidx.compose.animation.core.spring
import androidx.compose.animation.core.tween
import androidx.compose.foundation.background
import androidx.compose.foundation.clickable
import androidx.compose.foundation.gestures.detectVerticalDragGestures
import androidx.compose.foundation.interaction.MutableInteractionSource
import androidx.compose.foundation.layout.Arrangement
import androidx.compose.foundation.layout.Box
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.Row
import androidx.compose.foundation.layout.Spacer
import androidx.compose.foundation.layout.fillMaxSize
import androidx.compose.foundation.layout.fillMaxWidth
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.layout.size
import androidx.compose.foundation.layout.width
import androidx.compose.foundation.shape.CircleShape
import androidx.compose.material3.Icon
import androidx.compose.material3.Text
import androidx.compose.runtime.Composable
import androidx.compose.runtime.DisposableEffect
import androidx.compose.runtime.LaunchedEffect
import androidx.compose.runtime.getValue
import androidx.compose.runtime.mutableFloatStateOf
import androidx.compose.runtime.mutableIntStateOf
import androidx.compose.runtime.mutableStateOf
import androidx.compose.runtime.remember
import androidx.compose.runtime.rememberCoroutineScope
import androidx.compose.runtime.setValue
import androidx.compose.ui.Alignment
import androidx.compose.ui.Modifier
import androidx.compose.ui.draw.clip
import androidx.compose.ui.graphics.Brush
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.graphics.graphicsLayer
import androidx.compose.ui.input.pointer.pointerInput
import androidx.compose.ui.platform.LocalContext
import androidx.compose.ui.res.painterResource
import androidx.compose.ui.text.font.FontWeight
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.sp
import kotlinx.coroutines.launch
import me.kavishdevar.librepods.composables.AdaptiveRainbowBrush
import me.kavishdevar.librepods.composables.ControlCenterNoiseControlSegmentedButton
import me.kavishdevar.librepods.composables.IconAreaSize
import me.kavishdevar.librepods.composables.VerticalVolumeSlider
import me.kavishdevar.librepods.constants.AirPodsNotifications
import me.kavishdevar.librepods.constants.NoiseControlMode
import me.kavishdevar.librepods.services.AirPodsService
import me.kavishdevar.librepods.ui.theme.LibrePodsTheme
import me.kavishdevar.librepods.utils.AACPManager
import kotlin.io.encoding.ExperimentalEncodingApi
import kotlin.math.abs
class QuickSettingsDialogActivity : ComponentActivity() {
private var airPodsService: AirPodsService? = null
private var isBound = false
private var isNoiseControlExpandedState by mutableStateOf(false)
private val connection = object : ServiceConnection {
override fun onServiceConnected(className: ComponentName, service: IBinder) {
val binder = service as AirPodsService.LocalBinder
airPodsService = binder.getService()
isBound = true
Log.d("QSActivity", "Service bound")
setContent {
LibrePodsTheme {
DraggableDismissBox(
onDismiss = { finish() },
onlyCollapseWhenClicked = {
if (isNoiseControlExpandedState) {
isNoiseControlExpandedState = false
true
} else {
false
}
}
) {
if (isBound && airPodsService != null) {
NewControlCenterDialogContent(
service = airPodsService,
isNoiseControlExpanded = isNoiseControlExpandedState,
onNoiseControlExpandedChange = { isNoiseControlExpandedState = it }
)
}
}
}
}
}
override fun onServiceDisconnected(arg0: ComponentName) {
isBound = false
airPodsService = null
Log.d("QSActivity", "Service unbound")
finish()
}
}
override fun onCreate(savedInstanceState: Bundle?) {
super.onCreate(savedInstanceState)
window.addFlags(WindowManager.LayoutParams.FLAG_NOT_TOUCH_MODAL)
window.addFlags(WindowManager.LayoutParams.FLAG_WATCH_OUTSIDE_TOUCH)
window.addFlags(WindowManager.LayoutParams.FLAG_BLUR_BEHIND)
window.setGravity(Gravity.BOTTOM)
Intent(this, AirPodsService::class.java).also { intent ->
bindService(intent, connection, BIND_AUTO_CREATE)
}
setContent {
LibrePodsTheme {
DraggableDismissBox(
onDismiss = { finish() },
onlyCollapseWhenClicked = {
if (isNoiseControlExpandedState) {
isNoiseControlExpandedState = false
true
} else {
false
}
}
) {
if (isBound && airPodsService != null) {
NewControlCenterDialogContent(
service = airPodsService,
isNoiseControlExpanded = isNoiseControlExpandedState,
onNoiseControlExpandedChange = { isNoiseControlExpandedState = it }
)
}
}
}
}
}
override fun onDestroy() {
super.onDestroy()
if (isBound) {
unbindService(connection)
isBound = false
}
}
}
@Composable
fun DraggableDismissBox(
onDismiss: () -> Unit,
onlyCollapseWhenClicked: () -> Boolean,
content: @Composable () -> Unit
) {
val coroutineScope = rememberCoroutineScope()
var dragOffset by remember { mutableFloatStateOf(0f) }
var isDragging by remember { mutableStateOf(false) }
val dismissThreshold = 400f
val animatedOffset = remember { Animatable(0f) }
val animatedScale = remember { Animatable(1f) }
val animatedAlpha = remember { Animatable(1f) }
val backgroundAlpha by animateFloatAsState(
targetValue = if (isDragging) {
val dragProgress = (abs(dragOffset) / 800f).coerceIn(0f, 0.8f)
1f - dragProgress
} else 1f,
label = "BackgroundFade"
)
LaunchedEffect(isDragging) {
if (!isDragging) {
if (abs(dragOffset) < dismissThreshold) {
val springSpec = spring(
dampingRatio = Spring.DampingRatioLowBouncy,
stiffness = Spring.StiffnessHigh,
visibilityThreshold = 0.1f
)
launch { animatedOffset.animateTo(0f, springSpec) }
launch { animatedScale.animateTo(1f, springSpec) }
launch { animatedAlpha.animateTo(1f, tween(100)) }
dragOffset = 0f
}
}
}
LaunchedEffect(dragOffset, isDragging) {
if (isDragging) {
val dragProgress = (abs(dragOffset) / 1000f).coerceIn(0f, 0.5f)
animatedOffset.snapTo(dragOffset)
animatedScale.snapTo(1f - dragProgress * 0.3f)
animatedAlpha.snapTo(1f - dragProgress * 0.7f)
}
}
Box(
modifier = Modifier
.fillMaxSize()
.background(Color.Black.copy(alpha = 0.5f * backgroundAlpha))
.pointerInput(Unit) {
detectVerticalDragGestures(
onDragStart = { isDragging = true },
onDragEnd = {
isDragging = false
if (abs(dragOffset) > dismissThreshold) {
coroutineScope.launch {
val direction = if (dragOffset > 0) 1f else -1f
launch {
animatedOffset.animateTo(
direction * 1500f,
tween(350, easing = FastOutSlowInEasing)
)
}
launch { animatedScale.animateTo(0.7f, tween(350)) }
launch { animatedAlpha.animateTo(0f, tween(250)) }
kotlinx.coroutines.delay(350)
onDismiss()
}
}
},
onDragCancel = { isDragging = false },
onVerticalDrag = { change, dragAmount ->
change.consume()
dragOffset += dragAmount
}
)
}
.clickable(
interactionSource = remember { MutableInteractionSource() },
indication = null
) {
onlyCollapseWhenClicked()
},
contentAlignment = Alignment.BottomCenter
) {
Box(
modifier = Modifier
.fillMaxWidth()
.graphicsLayer(
translationY = animatedOffset.value,
scaleX = animatedScale.value,
scaleY = animatedScale.value,
alpha = animatedAlpha.value
),
contentAlignment = Alignment.BottomCenter
) {
content()
}
}
}
@SuppressLint("UnspecifiedRegisterReceiverFlag")
@Composable
fun NewControlCenterDialogContent(
service: AirPodsService?,
isNoiseControlExpanded: Boolean,
onNoiseControlExpandedChange: (Boolean) -> Unit
) {
val context = LocalContext.current
val sharedPreferences = context.getSharedPreferences("settings", Context.MODE_PRIVATE)
val textColor = Color.White
var currentAncMode by remember { mutableStateOf(NoiseControlMode.TRANSPARENCY) }
var isConvAwarenessEnabled by remember { mutableStateOf(false) }
val isOffModeEnabled = remember { sharedPreferences.getBoolean("off_listening_mode", true) }
val availableModes = remember(isOffModeEnabled) {
mutableListOf(
NoiseControlMode.TRANSPARENCY,
NoiseControlMode.ADAPTIVE,
NoiseControlMode.NOISE_CANCELLATION
).apply {
if (isOffModeEnabled) {
add(0, NoiseControlMode.OFF)
}
}
}
val audioManager = context.getSystemService(Context.AUDIO_SERVICE) as AudioManager
val maxVolume = remember { audioManager.getStreamMaxVolume(AudioManager.STREAM_MUSIC) }
var currentVolumeInt by remember { mutableIntStateOf(audioManager.getStreamVolume(AudioManager.STREAM_MUSIC)) }
val animatedVolumeFraction by animateFloatAsState(
targetValue = currentVolumeInt.toFloat() / maxVolume.toFloat(),
animationSpec = spring(
dampingRatio = Spring.DampingRatioLowBouncy,
stiffness = Spring.StiffnessMediumLow
),
label = "VolumeAnimation"
)
var liveDragFraction by remember { mutableFloatStateOf(animatedVolumeFraction) }
var isDraggingVolume by remember { mutableStateOf(false) }
LaunchedEffect(animatedVolumeFraction, isDraggingVolume) {
if (!isDraggingVolume) {
liveDragFraction = animatedVolumeFraction
}
}
DisposableEffect(service, availableModes) {
val ancReceiver = object : BroadcastReceiver() {
override fun onReceive(context: Context, intent: Intent) {
if (intent.action == AirPodsNotifications.ANC_DATA && service != null) {
val newModeOrdinal = intent.getIntExtra("data", NoiseControlMode.TRANSPARENCY.ordinal + 1) - 1
val newMode = NoiseControlMode.entries.getOrElse(newModeOrdinal) { NoiseControlMode.TRANSPARENCY }
if (availableModes.contains(newMode)) {
currentAncMode = newMode
} else if (newMode == NoiseControlMode.OFF && !isOffModeEnabled) {
currentAncMode = NoiseControlMode.TRANSPARENCY
}
Log.d("QSActivity", "ANC Receiver updated mode to: $currentAncMode (available: ${availableModes.joinToString()})")
}
}
}
val filter = IntentFilter(AirPodsNotifications.ANC_DATA)
if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.TIRAMISU) {
context.registerReceiver(ancReceiver, filter, Context.RECEIVER_EXPORTED)
} else {
context.registerReceiver(ancReceiver, filter)
}
service?.let {
val initialModeOrdinal = it.getANC().minus(1)
var initialMode = NoiseControlMode.entries.getOrElse(initialModeOrdinal) { NoiseControlMode.TRANSPARENCY }
if (!availableModes.contains(initialMode)) {
initialMode = NoiseControlMode.TRANSPARENCY
}
currentAncMode = initialMode
isConvAwarenessEnabled = sharedPreferences.getBoolean("conversational_awareness", true)
Log.d("QSActivity", "Initial ANC: $currentAncMode, ConvAware: $isConvAwarenessEnabled")
}
onDispose {
context.unregisterReceiver(ancReceiver)
}
}
DisposableEffect(Unit) {
val volumeReceiver = object : BroadcastReceiver() {
override fun onReceive(context: Context, intent: Intent) {
if (intent.action == "android.media.VOLUME_CHANGED_ACTION") {
val newVolume = audioManager.getStreamVolume(AudioManager.STREAM_MUSIC)
if (newVolume != currentVolumeInt) {
currentVolumeInt = newVolume
Log.d("QSActivity", "Volume Receiver updated volume to: $currentVolumeInt")
}
}
}
}
val filter = IntentFilter("android.media.VOLUME_CHANGED_ACTION")
context.registerReceiver(volumeReceiver, filter)
onDispose {
context.unregisterReceiver(volumeReceiver)
}
}
val deviceName = remember { sharedPreferences.getString("name", "AirPods") ?: "AirPods" }
Column(
modifier = Modifier
.fillMaxSize()
.background(Color.Transparent)
.padding(horizontal = 24.dp)
.pointerInput(Unit) {
awaitPointerEventScope {
while (true) {
awaitPointerEvent()
}
}
},
horizontalAlignment = Alignment.CenterHorizontally,
verticalArrangement = Arrangement.SpaceBetween
) {
if (service != null) {
Spacer(modifier = Modifier.weight(1f))
Column(
modifier = Modifier
.weight(2f)
.fillMaxWidth(),
horizontalAlignment = Alignment.CenterHorizontally,
verticalArrangement = Arrangement.Center
) {
Icon(
painter = painterResource(id = R.drawable.airpods),
contentDescription = "Device Icon",
tint = textColor.copy(alpha = 0.8f),
modifier = Modifier.size(48.dp)
)
Spacer(modifier = Modifier.height(4.dp))
Text(
text = deviceName,
color = textColor,
fontSize = 16.sp,
fontWeight = FontWeight.Medium
)
Spacer(modifier = Modifier.height(32.dp))
VerticalVolumeSlider(
displayFraction = animatedVolumeFraction,
maxVolume = maxVolume,
onVolumeChange = { newVolume ->
currentVolumeInt = newVolume
try {
audioManager.setStreamVolume(AudioManager.STREAM_MUSIC, newVolume, 0)
} catch (e: Exception) { Log.e("QSActivity", "Failed to set volume", e) }
},
initialFraction = animatedVolumeFraction,
onDragStateChange = { dragging -> isDraggingVolume = dragging },
baseSliderHeight = 400.dp,
baseSliderWidth = 145.dp,
baseCornerRadius = 48.dp,
maxStretchFactor = 1.15f,
minCompressionFactor = 0.875f,
stretchSensitivity = 0.3f,
compressionSensitivity = 0.3f,
cornerRadiusChangeFactor = -0.5f,
directionalStretchRatio = 0.75f,
modifier = Modifier
.width(145.dp)
.padding(vertical = 8.dp)
)
}
Spacer(modifier = Modifier.weight(1f))
Box(
modifier = Modifier
.fillMaxWidth()
.padding(bottom = 72.dp)
.animateContentSize(
animationSpec = spring(
dampingRatio = Spring.DampingRatioMediumBouncy,
stiffness = Spring.StiffnessMedium
)
),
contentAlignment = Alignment.Center
) {
Crossfade(
targetState = isNoiseControlExpanded,
animationSpec = tween(durationMillis = 300),
label = "NoiseControlCrossfade"
) { expanded ->
if (expanded) {
ControlCenterNoiseControlSegmentedButton(
availableModes = availableModes,
selectedMode = currentAncMode,
onModeSelected = { newMode ->
service.aacpManager.sendControlCommand(
identifier = AACPManager.Companion.ControlCommandIdentifiers.LISTENING_MODE.value,
value = newMode.ordinal + 1
)
currentAncMode = newMode
},
modifier = Modifier.fillMaxWidth(0.8f)
)
} else {
Row(
modifier = Modifier.fillMaxWidth(0.85f),
horizontalArrangement = Arrangement.SpaceBetween,
verticalAlignment = Alignment.Top
) {
val noiseControlButtonBrush = if (currentAncMode == NoiseControlMode.ADAPTIVE) {
AdaptiveRainbowBrush
} else {
null
}
Column(
horizontalAlignment = Alignment.CenterHorizontally,
verticalArrangement = Arrangement.Center,
modifier = Modifier.weight(1f)
) {
Box(
modifier = Modifier
.size(IconAreaSize)
.clip(CircleShape)
.background(
brush = noiseControlButtonBrush ?:
Brush.linearGradient(colors = listOf(Color(0xFF0A84FF), Color(0xFF0A84FF)))
)
.clickable(
onClick = { onNoiseControlExpandedChange(true) },
indication = null,
interactionSource = remember { MutableInteractionSource() }
),
contentAlignment = Alignment.Center
) {
Icon(
painter = painterResource(id = getModeIconRes(currentAncMode)),
contentDescription = getModeLabel(currentAncMode),
tint = Color.White,
modifier = Modifier.size(32.dp)
)
}
Spacer(modifier = Modifier.height(8.dp))
Text(
text = getModeLabel(currentAncMode),
color = Color.White,
fontSize = 12.sp,
fontWeight = FontWeight.Medium,
textAlign = androidx.compose.ui.text.style.TextAlign.Center
)
}
Spacer(modifier = Modifier.width(24.dp))
Column(
horizontalAlignment = Alignment.CenterHorizontally,
verticalArrangement = Arrangement.Center,
modifier = Modifier.weight(1f)
) {
Box(
modifier = Modifier
.size(IconAreaSize)
.clip(CircleShape)
.background(
Brush.linearGradient(
colors = listOf(
if (isConvAwarenessEnabled) Color(0xFF0A84FF) else Color(0x593C3C3E),
if (isConvAwarenessEnabled) Color(0xFF0A84FF) else Color(0x593C3C3E)
)
)
)
.clickable(
onClick = {
val newState = !isConvAwarenessEnabled
service.aacpManager.sendControlCommand(
identifier = AACPManager.Companion.ControlCommandIdentifiers.CONVERSATION_DETECT_CONFIG.value,
value = newState
)
isConvAwarenessEnabled = newState
},
indication = null,
interactionSource = remember { MutableInteractionSource() }
),
contentAlignment = Alignment.Center
) {
Icon(
painter = painterResource(id = R.drawable.airpods),
contentDescription = "Conversational Awareness",
tint = Color.White,
modifier = Modifier.size(32.dp)
)
}
Spacer(modifier = Modifier.height(8.dp))
Text(
text = "Conversational\nAwareness",
color = Color.White,
fontSize = 12.sp,
fontWeight = FontWeight.Medium,
textAlign = androidx.compose.ui.text.style.TextAlign.Center,
lineHeight = 14.sp
)
}
}
}
}
}
} else {
Spacer(modifier = Modifier.weight(1f))
Box(modifier = Modifier.fillMaxWidth(), contentAlignment = Alignment.Center) {
Text("Loading...", color = textColor)
}
Spacer(modifier = Modifier.weight(1f))
}
}
}
private fun getModeIconRes(mode: NoiseControlMode): Int {
return when (mode) {
NoiseControlMode.OFF -> R.drawable.noise_cancellation
NoiseControlMode.TRANSPARENCY -> R.drawable.transparency
NoiseControlMode.ADAPTIVE -> R.drawable.adaptive
NoiseControlMode.NOISE_CANCELLATION -> R.drawable.noise_cancellation
}
}
private fun getModeLabel(mode: NoiseControlMode): String {
return when (mode) {
NoiseControlMode.OFF -> "Off"
NoiseControlMode.TRANSPARENCY -> "Transparency"
NoiseControlMode.ADAPTIVE -> "Adaptive"
NoiseControlMode.NOISE_CANCELLATION -> "Noise Cancel"
}
}

View File

@@ -0,0 +1,205 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
@file:OptIn(ExperimentalEncodingApi::class)
package me.kavishdevar.librepods.composables
import androidx.compose.foundation.background
import androidx.compose.foundation.clickable
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.interaction.MutableInteractionSource
import androidx.compose.foundation.layout.Arrangement
import androidx.compose.foundation.layout.Box
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.Row
import androidx.compose.foundation.layout.fillMaxWidth
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.shape.RoundedCornerShape
import androidx.compose.material3.HorizontalDivider
import androidx.compose.material3.Text
import androidx.compose.runtime.Composable
import androidx.compose.runtime.mutableStateOf
import androidx.compose.runtime.remember
import androidx.compose.ui.Modifier
import androidx.compose.ui.draw.clip
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.res.stringResource
import androidx.compose.ui.layout.onGloballyPositioned
import androidx.compose.ui.platform.LocalDensity
import androidx.compose.ui.text.TextStyle
import androidx.compose.ui.text.font.Font
import androidx.compose.ui.text.font.FontFamily
import androidx.compose.ui.text.font.FontWeight
import androidx.compose.ui.unit.Dp
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.sp
import androidx.navigation.NavController
import me.kavishdevar.librepods.R
import me.kavishdevar.librepods.composables.NavigationButton
import me.kavishdevar.librepods.services.ServiceManager
import kotlin.io.encoding.ExperimentalEncodingApi
@Composable
fun AboutCard(navController: NavController) {
val isDarkTheme = isSystemInDarkTheme()
val textColor = if (isDarkTheme) Color.White else Color.Black
val service = ServiceManager.getService()
if (service == null) return
val airpodsInstance = service.airpodsInstance
if (airpodsInstance == null) return
val backgroundColor = if (isDarkTheme) Color(0xFF1C1C1E) else Color(0xFFFFFFFF)
Box(
modifier = Modifier
.background(if (isDarkTheme) Color(0xFF000000) else Color(0xFFF2F2F7))
.padding(horizontal = 16.dp, vertical = 4.dp)
){
Text(
text = stringResource(R.string.about),
style = TextStyle(
fontSize = 14.sp,
fontWeight = FontWeight.Bold,
color = textColor.copy(alpha = 0.6f)
)
)
}
val rowHeight = remember { mutableStateOf(0.dp) }
val density = LocalDensity.current
Column(
modifier = Modifier
.clip(RoundedCornerShape(28.dp))
.fillMaxWidth()
.background(backgroundColor, RoundedCornerShape(28.dp))
.padding(top = 2.dp)
) {
Row(
modifier = Modifier
.fillMaxWidth()
.padding(16.dp)
.onGloballyPositioned { coordinates ->
rowHeight.value = with(density) { coordinates.size.height.toDp() }
},
horizontalArrangement = Arrangement.SpaceBetween,
) {
Text(
text = stringResource(R.string.model_name),
style = TextStyle(
fontSize = 16.sp,
color = textColor,
fontFamily = FontFamily(Font(R.font.sf_pro))
)
)
Text(
text = airpodsInstance.model.displayName,
style = TextStyle(
fontSize = 16.sp,
color = if (isDarkTheme) Color.White.copy(alpha = 0.6f) else Color.Black.copy(alpha = 0.8f),
fontFamily = FontFamily(Font(R.font.sf_pro))
)
)
}
HorizontalDivider(
thickness = 1.dp,
color = Color(0x40888888),
modifier = Modifier
.padding(horizontal = 12.dp)
)
Row(
modifier = Modifier
.fillMaxWidth()
.padding(16.dp),
horizontalArrangement = Arrangement.SpaceBetween,
) {
Text(
text = stringResource(R.string.model_name),
style = TextStyle(
fontSize = 16.sp,
color = textColor,
fontFamily = FontFamily(Font(R.font.sf_pro))
)
)
Text(
text = airpodsInstance.actualModelNumber,
style = TextStyle(
fontSize = 16.sp,
color = if (isDarkTheme) Color.White.copy(alpha = 0.6f) else Color.Black.copy(alpha = 0.8f),
fontFamily = FontFamily(Font(R.font.sf_pro))
)
)
}
HorizontalDivider(
thickness = 1.dp,
color = Color(0x40888888),
modifier = Modifier
.padding(horizontal = 12.dp)
)
val serialNumbers = listOf(
airpodsInstance.serialNumber?: "",
"􀀛 ${airpodsInstance.leftSerialNumber}",
"􀀧 ${airpodsInstance.rightSerialNumber}"
)
val serialNumber = remember { mutableStateOf(0) }
Row(
modifier = Modifier
.fillMaxWidth()
.padding(16.dp),
horizontalArrangement = Arrangement.SpaceBetween,
) {
Text(
text = stringResource(R.string.serial_number),
style = TextStyle(
fontSize = 16.sp,
color = textColor,
fontFamily = FontFamily(Font(R.font.sf_pro))
),
)
Text(
text = serialNumbers[serialNumber.value],
style = TextStyle(
fontSize = 16.sp,
color = if (isDarkTheme) Color.White.copy(alpha = 0.6f) else Color.Black.copy(alpha = 0.8f),
fontFamily = FontFamily(Font(R.font.sf_pro))
),
modifier = Modifier
.clickable(
interactionSource = remember { MutableInteractionSource() },
indication = null
) {
serialNumber.value = (serialNumber.value + 1) % serialNumbers.size
}
)
}
HorizontalDivider(
thickness = 1.dp,
color = Color(0x40888888),
modifier = Modifier
.padding(horizontal = 12.dp)
)
NavigationButton(
to = "version_info",
navController = navController,
name = stringResource(R.string.version),
currentState = airpodsInstance.version3,
independent = false,
height = rowHeight.value + 32.dp
)
}
}

View File

@@ -0,0 +1,152 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
@file:OptIn(ExperimentalEncodingApi::class)
package me.kavishdevar.librepods.composables
import androidx.compose.foundation.background
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Box
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.fillMaxWidth
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.shape.RoundedCornerShape
import androidx.compose.material3.HorizontalDivider
import androidx.compose.material3.Text
import androidx.compose.runtime.Composable
import androidx.compose.ui.Modifier
import androidx.compose.ui.draw.clip
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.res.stringResource
import androidx.compose.ui.text.TextStyle
import androidx.compose.ui.text.font.FontWeight
import androidx.compose.ui.tooling.preview.Preview
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.sp
import androidx.navigation.NavController
import androidx.navigation.compose.rememberNavController
import me.kavishdevar.librepods.R
import me.kavishdevar.librepods.services.ServiceManager
import me.kavishdevar.librepods.utils.AACPManager
import me.kavishdevar.librepods.utils.ATTHandles
import me.kavishdevar.librepods.utils.Capability
import kotlin.io.encoding.ExperimentalEncodingApi
@Composable
fun AudioSettings(navController: NavController) {
val isDarkTheme = isSystemInDarkTheme()
val textColor = if (isDarkTheme) Color.White else Color.Black
val service = ServiceManager.getService()
if (service == null) return
val airpodsInstance = service.airpodsInstance
if (airpodsInstance == null) return
if (!airpodsInstance.model.capabilities.contains(Capability.ADAPTIVE_VOLUME) &&
!airpodsInstance.model.capabilities.contains(Capability.CONVERSATION_AWARENESS) &&
!airpodsInstance.model.capabilities.contains(Capability.LOUD_SOUND_REDUCTION) &&
!airpodsInstance.model.capabilities.contains(Capability.ADAPTIVE_AUDIO)
) {
return
}
Box(
modifier = Modifier
.background(if (isDarkTheme) Color(0xFF000000) else Color(0xFFF2F2F7))
.padding(horizontal = 16.dp, vertical = 4.dp)
){
Text(
text = stringResource(R.string.audio),
style = TextStyle(
fontSize = 14.sp,
fontWeight = FontWeight.Bold,
color = textColor.copy(alpha = 0.6f)
)
)
}
val backgroundColor = if (isDarkTheme) Color(0xFF1C1C1E) else Color(0xFFFFFFFF)
Column(
modifier = Modifier
.clip(RoundedCornerShape(28.dp))
.fillMaxWidth()
.background(backgroundColor, RoundedCornerShape(28.dp))
.padding(top = 2.dp)
) {
if (airpodsInstance.model.capabilities.contains(Capability.ADAPTIVE_VOLUME)) {
StyledToggle(
label = stringResource(R.string.personalized_volume),
description = stringResource(R.string.personalized_volume_description),
controlCommandIdentifier = AACPManager.Companion.ControlCommandIdentifiers.ADAPTIVE_VOLUME_CONFIG,
independent = false
)
HorizontalDivider(
thickness = 1.dp,
color = Color(0x40888888),
modifier = Modifier
.padding(horizontal = 12.dp)
)
}
if (airpodsInstance.model.capabilities.contains(Capability.CONVERSATION_AWARENESS)) {
StyledToggle(
label = stringResource(R.string.conversational_awareness),
description = stringResource(R.string.conversational_awareness_description),
controlCommandIdentifier = AACPManager.Companion.ControlCommandIdentifiers.CONVERSATION_DETECT_CONFIG,
independent = false
)
HorizontalDivider(
thickness = 1.dp,
color = Color(0x40888888),
modifier = Modifier
.padding(horizontal = 12.dp)
)
}
if (airpodsInstance.model.capabilities.contains(Capability.LOUD_SOUND_REDUCTION)){
StyledToggle(
label = stringResource(R.string.loud_sound_reduction),
description = stringResource(R.string.loud_sound_reduction_description),
attHandle = ATTHandles.LOUD_SOUND_REDUCTION,
independent = false
)
HorizontalDivider(
thickness = 1.dp,
color = Color(0x40888888),
modifier = Modifier
.padding(horizontal = 12.dp)
)
}
if (airpodsInstance.model.capabilities.contains(Capability.ADAPTIVE_AUDIO)) {
NavigationButton(
to = "adaptive_strength",
name = stringResource(R.string.adaptive_audio),
navController = navController,
independent = false
)
}
}
}
@Preview
@Composable
fun AudioSettingsPreview() {
AudioSettings(rememberNavController())
}

View File

@@ -0,0 +1,128 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.composables
import android.content.res.Configuration
import androidx.compose.animation.core.Animatable
import androidx.compose.animation.core.tween
import androidx.compose.foundation.background
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Box
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.layout.Spacer
import androidx.compose.foundation.layout.size
import androidx.compose.foundation.layout.height
import androidx.compose.material3.CircularProgressIndicator
import androidx.compose.material3.Text
import androidx.compose.runtime.Composable
import androidx.compose.runtime.LaunchedEffect
import androidx.compose.runtime.remember
import androidx.compose.ui.Alignment
import androidx.compose.ui.Modifier
import androidx.compose.ui.draw.scale
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.graphics.StrokeCap
import androidx.compose.ui.text.TextStyle
import androidx.compose.ui.text.font.Font
import androidx.compose.ui.text.font.FontFamily
import androidx.compose.ui.text.style.TextAlign
import androidx.compose.ui.tooling.preview.Preview
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.sp
import me.kavishdevar.librepods.R
@Composable
fun BatteryIndicator(
batteryPercentage: Int,
charging: Boolean = false,
prefix: String = "",
previousCharging: Boolean = false,
) {
val isDarkTheme = isSystemInDarkTheme()
val backgroundColor = if (isDarkTheme) Color.Black else Color(0xFFF2F2F7)
val batteryTextColor = if (isDarkTheme) Color.White else Color.Black
val batteryFillColor = if (batteryPercentage > 25)
if (isDarkTheme) Color(0xFF2ED158) else Color(0xFF35C759)
else if (isDarkTheme) Color(0xFFFC4244) else Color(0xFFfe373C)
val initialScale = if (previousCharging) 1f else 0f
val scaleAnim = remember { Animatable(initialScale) }
val targetScale = if (charging) 1f else 0f
LaunchedEffect(previousCharging, charging) {
scaleAnim.animateTo(targetScale, animationSpec = tween(durationMillis = 250))
}
Column(
modifier = Modifier
.background(backgroundColor), // just for haze to work
horizontalAlignment = Alignment.CenterHorizontally
) {
Box(
modifier = Modifier.padding(bottom = 4.dp),
contentAlignment = Alignment.Center
) {
CircularProgressIndicator(
progress = { batteryPercentage / 100f },
modifier = Modifier.size(40.dp),
color = batteryFillColor,
gapSize = 0.dp,
strokeCap = StrokeCap.Round,
strokeWidth = 4.dp,
trackColor = if (isDarkTheme) Color(0xFF0E0E0F) else Color(0xFFE3E3E8)
)
Text(
text = "\uDBC0\uDEE6",
style = TextStyle(
fontSize = 12.sp,
fontFamily = FontFamily(Font(R.font.sf_pro)),
color = batteryFillColor,
textAlign = TextAlign.Center
),
modifier = Modifier.scale(scaleAnim.value)
)
}
Spacer(modifier = Modifier.height(4.dp))
Text(
text = "$prefix $batteryPercentage%",
color = batteryTextColor,
style = TextStyle(
fontSize = 16.sp,
fontFamily = FontFamily(Font(R.font.sf_pro)),
textAlign = TextAlign.Center
),
)
}
}
@Preview(uiMode = Configuration.UI_MODE_NIGHT_YES)
@Composable
fun BatteryIndicatorPreview() {
val bg = if (isSystemInDarkTheme()) Color.Black else Color(0xFFF2F2F7)
Box(
modifier = Modifier.background(bg)
) {
BatteryIndicator(batteryPercentage = 24, charging = true, prefix = "\uDBC6\uDCE5", previousCharging = false)
}
}

View File

@@ -0,0 +1,235 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
@file:OptIn(ExperimentalEncodingApi::class)
package me.kavishdevar.librepods.composables
import android.content.BroadcastReceiver
import android.content.Context
import android.content.Intent
import android.content.IntentFilter
import android.content.res.Configuration
import android.os.Build
import android.util.Log
import androidx.compose.foundation.Image
import androidx.compose.foundation.background
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Arrangement
import androidx.compose.foundation.layout.Box
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.Row
import androidx.compose.foundation.layout.Spacer
import androidx.compose.foundation.layout.fillMaxWidth
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.layout.width
import androidx.compose.runtime.Composable
import androidx.compose.runtime.LaunchedEffect
import androidx.compose.runtime.mutableStateOf
import androidx.compose.runtime.remember
import androidx.compose.ui.Alignment
import androidx.compose.ui.Modifier
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.graphics.ImageBitmap
import androidx.compose.ui.platform.LocalContext
import androidx.compose.ui.res.imageResource
import androidx.compose.ui.res.stringResource
import androidx.compose.ui.tooling.preview.Preview
import androidx.compose.ui.unit.dp
import me.kavishdevar.librepods.R
import me.kavishdevar.librepods.constants.AirPodsNotifications
import me.kavishdevar.librepods.constants.Battery
import me.kavishdevar.librepods.constants.BatteryComponent
import me.kavishdevar.librepods.constants.BatteryStatus
import me.kavishdevar.librepods.services.AirPodsService
import kotlin.io.encoding.ExperimentalEncodingApi
@Composable
fun BatteryView(service: AirPodsService, preview: Boolean = false) {
val batteryStatus = remember { mutableStateOf<List<Battery>>(listOf()) }
val previousBatteryStatus = remember { mutableStateOf<List<Battery>>(listOf()) }
@Suppress("DEPRECATION") val batteryReceiver = remember {
object : BroadcastReceiver() {
override fun onReceive(context: Context, intent: Intent) {
if (intent.action == AirPodsNotifications.BATTERY_DATA) {
batteryStatus.value =
if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.TIRAMISU) {
intent.getParcelableArrayListExtra("data", Battery::class.java)
} else {
intent.getParcelableArrayListExtra("data")
}?.toList() ?: listOf()
}
else if (intent.action == AirPodsNotifications.DISCONNECT_RECEIVERS) {
try {
context.unregisterReceiver(this)
}
catch (_: IllegalArgumentException) {
Log.wtf("BatteryReceiver", "Receiver already unregistered")
}
}
}
}
}
val context = LocalContext.current
LaunchedEffect(context) {
val batteryIntentFilter = IntentFilter()
.apply {
addAction(AirPodsNotifications.BATTERY_DATA)
addAction(AirPodsNotifications.DISCONNECT_RECEIVERS)
}
if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.TIRAMISU) {
context.registerReceiver(
batteryReceiver,
batteryIntentFilter,
Context.RECEIVER_EXPORTED
)
}
}
previousBatteryStatus.value = batteryStatus.value
batteryStatus.value = service.getBattery()
if (preview) {
batteryStatus.value = listOf(
Battery(BatteryComponent.LEFT, 100, BatteryStatus.NOT_CHARGING),
Battery(BatteryComponent.RIGHT, 94, BatteryStatus.CHARGING),
Battery(BatteryComponent.CASE, 40, BatteryStatus.CHARGING)
)
previousBatteryStatus.value = batteryStatus.value
}
val left = batteryStatus.value.find { it.component == BatteryComponent.LEFT }
val right = batteryStatus.value.find { it.component == BatteryComponent.RIGHT }
val case = batteryStatus.value.find { it.component == BatteryComponent.CASE }
val leftLevel = left?.level ?: 0
val rightLevel = right?.level ?: 0
val caseLevel = case?.level ?: 0
val leftCharging = left?.status == BatteryStatus.CHARGING
val rightCharging = right?.status == BatteryStatus.CHARGING
val caseCharging = case?.status == BatteryStatus.CHARGING
val prevLeft = previousBatteryStatus.value.find { it.component == BatteryComponent.LEFT }
val prevRight = previousBatteryStatus.value.find { it.component == BatteryComponent.RIGHT }
val prevCase = previousBatteryStatus.value.find { it.component == BatteryComponent.CASE }
val prevLeftCharging = prevLeft?.status == BatteryStatus.CHARGING
val prevRightCharging = prevRight?.status == BatteryStatus.CHARGING
val prevCaseCharging = prevCase?.status == BatteryStatus.CHARGING
val singleDisplayed = remember { mutableStateOf(false) }
val airpodsInstance = service.airpodsInstance
if (airpodsInstance == null) {
return
}
val budsRes = airpodsInstance.model.budsRes
val caseRes = airpodsInstance.model.caseRes
Row {
Column (
modifier = Modifier
.fillMaxWidth(0.5f),
horizontalAlignment = Alignment.CenterHorizontally
) {
Image (
bitmap = ImageBitmap.imageResource(budsRes),
contentDescription = stringResource(R.string.buds),
modifier = Modifier
.fillMaxWidth()
.padding(8.dp)
)
if (
leftCharging == rightCharging &&
(leftLevel - rightLevel) in -3..3
)
{
BatteryIndicator(
leftLevel.coerceAtMost(rightLevel),
leftCharging,
previousCharging = (prevLeftCharging && prevRightCharging)
)
singleDisplayed.value = true
}
else {
singleDisplayed.value = false
Row (
modifier = Modifier
.fillMaxWidth(),
horizontalArrangement = Arrangement.Center
) {
if (leftLevel > 0 || left?.status != BatteryStatus.DISCONNECTED) {
BatteryIndicator(
leftLevel,
leftCharging,
"\uDBC6\uDCE5",
previousCharging = prevLeftCharging
)
}
if (leftLevel > 0 && rightLevel > 0)
{
Spacer(modifier = Modifier.width(16.dp))
}
if (rightLevel > 0 || right?.status != BatteryStatus.DISCONNECTED)
{
BatteryIndicator(
rightLevel,
rightCharging,
"\uDBC6\uDCE8",
previousCharging = prevRightCharging
)
}
}
}
}
Column (
modifier = Modifier
.fillMaxWidth(),
horizontalAlignment = Alignment.CenterHorizontally
) {
Image(
bitmap = ImageBitmap.imageResource(caseRes),
contentDescription = stringResource(R.string.case_alt),
modifier = Modifier
.fillMaxWidth()
.padding(8.dp)
)
if (caseLevel > 0 || case?.status != BatteryStatus.DISCONNECTED) {
BatteryIndicator(
caseLevel,
caseCharging,
prefix = if (!singleDisplayed.value) "\uDBC3\uDE6C" else "",
previousCharging = prevCaseCharging
)
}
}
}
}
@Preview(uiMode = Configuration.UI_MODE_NIGHT_YES)
@Composable
fun BatteryViewPreview() {
val bg = if (isSystemInDarkTheme()) Color.Black else Color(0xFFF2F2F7)
Box(
modifier = Modifier.background(bg)
) {
BatteryView(AirPodsService(), preview = true)
}
}

View File

@@ -0,0 +1,470 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
@file:OptIn(ExperimentalEncodingApi::class)
package me.kavishdevar.librepods.composables
import android.util.Log
import androidx.compose.foundation.background
import androidx.compose.foundation.gestures.detectDragGesturesAfterLongPress
import androidx.compose.foundation.gestures.detectTapGestures
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Arrangement
import androidx.compose.foundation.layout.Box
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.Row
import androidx.compose.foundation.layout.fillMaxWidth
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.shape.RoundedCornerShape
import androidx.compose.material3.HorizontalDivider
import androidx.compose.material3.Text
import androidx.compose.runtime.Composable
import androidx.compose.runtime.DisposableEffect
import androidx.compose.runtime.LaunchedEffect
import androidx.compose.runtime.getValue
import androidx.compose.runtime.mutableLongStateOf
import androidx.compose.runtime.mutableStateOf
import androidx.compose.runtime.remember
import androidx.compose.runtime.setValue
import androidx.compose.ui.Alignment
import androidx.compose.ui.Modifier
import androidx.compose.ui.geometry.Offset
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.input.pointer.pointerInput
import androidx.compose.ui.layout.onGloballyPositioned
import androidx.compose.ui.layout.positionInParent
import androidx.compose.ui.platform.LocalDensity
import androidx.compose.ui.res.stringResource
import androidx.compose.ui.text.TextStyle
import androidx.compose.ui.text.font.Font
import androidx.compose.ui.text.font.FontFamily
import androidx.compose.ui.text.font.FontWeight
import androidx.compose.ui.tooling.preview.Preview
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.sp
import dev.chrisbanes.haze.HazeState
import dev.chrisbanes.haze.materials.ExperimentalHazeMaterialsApi
import me.kavishdevar.librepods.R
import me.kavishdevar.librepods.services.ServiceManager
import me.kavishdevar.librepods.utils.AACPManager
import kotlin.io.encoding.ExperimentalEncodingApi
@ExperimentalHazeMaterialsApi
@Composable
fun CallControlSettings(hazeState: HazeState) {
val isDarkTheme = isSystemInDarkTheme()
val textColor = if (isDarkTheme) Color.White else Color.Black
val backgroundColor = if (isDarkTheme) Color(0xFF1C1C1E) else Color(0xFFFFFFFF)
Box(
modifier = Modifier
.background(if (isDarkTheme) Color(0xFF000000) else Color(0xFFF2F2F7))
.padding(horizontal = 16.dp, vertical = 4.dp)
){
Text(
text = stringResource(R.string.call_controls),
style = TextStyle(
fontSize = 14.sp,
fontWeight = FontWeight.Bold,
color = textColor.copy(alpha = 0.6f)
)
)
}
Column(
modifier = Modifier
.fillMaxWidth()
.background(backgroundColor, RoundedCornerShape(28.dp))
.padding(top = 2.dp)
) {
val service = ServiceManager.getService()!!
val callControlEnabledValue = service.aacpManager.controlCommandStatusList.find {
it.identifier == AACPManager.Companion.ControlCommandIdentifiers.CALL_MANAGEMENT_CONFIG
}?.value ?: byteArrayOf(0x00, 0x03)
val pressOnceText = stringResource(R.string.press_once)
val pressTwiceText = stringResource(R.string.press_twice)
var flipped by remember {
mutableStateOf(
callControlEnabledValue.contentEquals(
byteArrayOf(
0x00,
0x02
)
)
)
}
var singlePressAction by remember { mutableStateOf(if (flipped) pressTwiceText else pressOnceText) }
var doublePressAction by remember { mutableStateOf(if (flipped) pressOnceText else pressTwiceText) }
var showSinglePressDropdown by remember { mutableStateOf(false) }
var touchOffsetSingle by remember { mutableStateOf<Offset?>(null) }
var boxPositionSingle by remember { mutableStateOf(Offset.Zero) }
var lastDismissTimeSingle by remember { mutableLongStateOf(0L) }
var parentHoveredIndexSingle by remember { mutableStateOf<Int?>(null) }
var parentDragActiveSingle by remember { mutableStateOf(false) }
var showDoublePressDropdown by remember { mutableStateOf(false) }
var touchOffsetDouble by remember { mutableStateOf<Offset?>(null) }
var boxPositionDouble by remember { mutableStateOf(Offset.Zero) }
var lastDismissTimeDouble by remember { mutableLongStateOf(0L) }
var parentHoveredIndexDouble by remember { mutableStateOf<Int?>(null) }
var parentDragActiveDouble by remember { mutableStateOf(false) }
LaunchedEffect(Unit) {
val listener = object : AACPManager.ControlCommandListener {
override fun onControlCommandReceived(controlCommand: AACPManager.ControlCommand) {
if (AACPManager.Companion.ControlCommandIdentifiers.fromByte(controlCommand.identifier) ==
AACPManager.Companion.ControlCommandIdentifiers.CALL_MANAGEMENT_CONFIG
) {
val newFlipped = controlCommand.value.contentEquals(byteArrayOf(0x00, 0x02))
flipped = newFlipped
singlePressAction = if (newFlipped) pressTwiceText else pressOnceText
doublePressAction = if (newFlipped) pressOnceText else pressTwiceText
Log.d(
"CallControlSettings",
"Control command received, flipped: $newFlipped"
)
}
}
}
service.aacpManager.registerControlCommandListener(
AACPManager.Companion.ControlCommandIdentifiers.CALL_MANAGEMENT_CONFIG,
listener
)
}
DisposableEffect(Unit) {
onDispose {
service.aacpManager.controlCommandListeners[AACPManager.Companion.ControlCommandIdentifiers.CALL_MANAGEMENT_CONFIG]?.clear()
}
}
LaunchedEffect(flipped) {
Log.d("CallControlSettings", "Call control flipped: $flipped")
}
val density = LocalDensity.current
val itemHeightPx = with(density) { 48.dp.toPx() }
Column(
modifier = Modifier
.fillMaxWidth()
) {
Row(
modifier = Modifier
.fillMaxWidth()
.padding(horizontal = 16.dp)
.height(58.dp),
horizontalArrangement = Arrangement.SpaceBetween,
verticalAlignment = Alignment.CenterVertically
) {
Text(
text = stringResource(R.string.answer_call),
fontSize = 16.sp,
color = textColor,
modifier = Modifier.padding(bottom = 4.dp)
)
Text(
text = stringResource(R.string.press_once),
fontSize = 16.sp,
color = textColor.copy(alpha = 0.6f)
)
}
HorizontalDivider(
thickness = 1.dp,
color = Color(0x40888888),
modifier = Modifier
.padding(horizontal = 12.dp)
)
Row(
modifier = Modifier
.fillMaxWidth()
.padding(horizontal = 16.dp)
.height(58.dp)
.pointerInput(Unit) {
detectTapGestures { offset ->
val now = System.currentTimeMillis()
if (showSinglePressDropdown) {
showSinglePressDropdown = false
lastDismissTimeSingle = now
} else {
if (now - lastDismissTimeSingle > 250L) {
touchOffsetSingle = offset
showSinglePressDropdown = true
}
}
}
}
.pointerInput(Unit) {
detectDragGesturesAfterLongPress(
onDragStart = { offset ->
val now = System.currentTimeMillis()
touchOffsetSingle = offset
if (!showSinglePressDropdown && now - lastDismissTimeSingle > 250L) {
showSinglePressDropdown = true
}
lastDismissTimeSingle = now
parentDragActiveSingle = true
parentHoveredIndexSingle = 0
},
onDrag = { change, _ ->
val current = change.position
val touch = touchOffsetSingle ?: current
val posInPopupY = current.y - touch.y
val idx = (posInPopupY / itemHeightPx).toInt()
parentHoveredIndexSingle = idx
},
onDragEnd = {
parentDragActiveSingle = false
parentHoveredIndexSingle?.let { idx ->
val options = listOf(pressOnceText, pressTwiceText)
if (idx in options.indices) {
val option = options[idx]
singlePressAction = option
doublePressAction =
if (option == pressOnceText) pressTwiceText else pressOnceText
showSinglePressDropdown = false
lastDismissTimeSingle = System.currentTimeMillis()
val bytes = if (option == pressOnceText) byteArrayOf(
0x00,
0x03
) else byteArrayOf(0x00, 0x02)
service.aacpManager.sendControlCommand(0x24, bytes)
}
}
parentHoveredIndexSingle = null
},
onDragCancel = {
parentDragActiveSingle = false
parentHoveredIndexSingle = null
}
)
},
horizontalArrangement = Arrangement.SpaceBetween,
verticalAlignment = Alignment.CenterVertically
) {
Text(
text = stringResource(R.string.mute_unmute),
fontSize = 16.sp,
color = textColor,
modifier = Modifier.padding(bottom = 4.dp)
)
Box(
modifier = Modifier.onGloballyPositioned { coordinates ->
boxPositionSingle = coordinates.positionInParent()
}
) {
Row(
verticalAlignment = Alignment.CenterVertically
) {
Text(
text = singlePressAction,
style = TextStyle(
fontSize = 16.sp,
color = textColor.copy(alpha = 0.8f),
fontFamily = FontFamily(Font(R.font.sf_pro))
)
)
Text(
text = "􀆏",
style = TextStyle(
fontSize = 16.sp,
color = textColor.copy(alpha = 0.6f),
fontFamily = FontFamily(Font(R.font.sf_pro))
),
modifier = Modifier
.padding(start = 6.dp)
)
}
StyledDropdown(
expanded = showSinglePressDropdown,
onDismissRequest = {
showSinglePressDropdown = false
lastDismissTimeSingle = System.currentTimeMillis()
},
options = listOf(pressOnceText, pressTwiceText),
selectedOption = singlePressAction,
touchOffset = touchOffsetSingle,
boxPosition = boxPositionSingle,
externalHoveredIndex = parentHoveredIndexSingle,
externalDragActive = parentDragActiveSingle,
onOptionSelected = { option ->
singlePressAction = option
doublePressAction =
if (option == pressOnceText) pressTwiceText else pressOnceText
showSinglePressDropdown = false
val bytes = if (option == pressOnceText) byteArrayOf(
0x00,
0x03
) else byteArrayOf(0x00, 0x02)
service.aacpManager.sendControlCommand(0x24, bytes)
},
hazeState = hazeState
)
}
}
HorizontalDivider(
thickness = 1.dp,
color = Color(0x40888888),
modifier = Modifier
.padding(horizontal = 12.dp)
)
Row(
modifier = Modifier
.fillMaxWidth()
.padding(horizontal = 16.dp)
.height(58.dp)
.pointerInput(Unit) {
detectTapGestures { offset ->
val now = System.currentTimeMillis()
if (showDoublePressDropdown) {
showDoublePressDropdown = false
lastDismissTimeDouble = now
} else {
if (now - lastDismissTimeDouble > 250L) {
touchOffsetDouble = offset
showDoublePressDropdown = true
}
}
}
}
.pointerInput(Unit) {
detectDragGesturesAfterLongPress(
onDragStart = { offset ->
val now = System.currentTimeMillis()
touchOffsetDouble = offset
if (!showDoublePressDropdown && now - lastDismissTimeDouble > 250L) {
showDoublePressDropdown = true
}
lastDismissTimeDouble = now
parentDragActiveDouble = true
parentHoveredIndexDouble = 0
},
onDrag = { change, _ ->
val current = change.position
val touch = touchOffsetDouble ?: current
val posInPopupY = current.y - touch.y
val idx = (posInPopupY / itemHeightPx).toInt()
parentHoveredIndexDouble = idx
},
onDragEnd = {
parentDragActiveDouble = false
parentHoveredIndexDouble?.let { idx ->
val options = listOf(pressOnceText, pressTwiceText)
if (idx in options.indices) {
val option = options[idx]
doublePressAction = option
singlePressAction =
if (option == pressOnceText) pressTwiceText else pressOnceText
showDoublePressDropdown = false
lastDismissTimeDouble = System.currentTimeMillis()
val bytes = if (option == pressOnceText) byteArrayOf(
0x00,
0x02
) else byteArrayOf(0x00, 0x03)
service.aacpManager.sendControlCommand(0x24, bytes)
}
}
parentHoveredIndexDouble = null
},
onDragCancel = {
parentDragActiveDouble = false
parentHoveredIndexDouble = null
}
)
},
horizontalArrangement = Arrangement.SpaceBetween,
verticalAlignment = Alignment.CenterVertically
) {
Text(
text = stringResource(R.string.hang_up),
fontSize = 16.sp,
color = textColor,
modifier = Modifier.padding(bottom = 4.dp)
)
Box(
modifier = Modifier.onGloballyPositioned { coordinates ->
boxPositionDouble = coordinates.positionInParent()
}
) {
Row(
verticalAlignment = Alignment.CenterVertically
) {
Text(
text = doublePressAction,
style = TextStyle(
fontSize = 16.sp,
color = textColor.copy(alpha = 0.8f),
fontFamily = FontFamily(Font(R.font.sf_pro))
)
)
Text(
text = "􀆏",
style = TextStyle(
fontSize = 16.sp,
color = textColor.copy(alpha = 0.6f),
fontFamily = FontFamily(Font(R.font.sf_pro))
),
modifier = Modifier
.padding(start = 6.dp)
)
}
StyledDropdown(
expanded = showDoublePressDropdown,
onDismissRequest = {
showDoublePressDropdown = false
lastDismissTimeDouble = System.currentTimeMillis()
},
options = listOf(pressOnceText, pressTwiceText),
selectedOption = doublePressAction,
touchOffset = touchOffsetDouble,
boxPosition = boxPositionDouble,
externalHoveredIndex = parentHoveredIndexDouble,
externalDragActive = parentDragActiveDouble,
onOptionSelected = { option ->
doublePressAction = option
singlePressAction =
if (option == pressOnceText) pressTwiceText else pressOnceText
showDoublePressDropdown = false
val bytes = if (option == pressOnceText) byteArrayOf(
0x00,
0x02
) else byteArrayOf(0x00, 0x03)
service.aacpManager.sendControlCommand(0x24, bytes)
},
hazeState = hazeState
)
}
}
}
}
}
@ExperimentalHazeMaterialsApi
@Preview
@Composable
fun CallControlSettingsPreview() {
CallControlSettings(HazeState())
}

View File

@@ -0,0 +1,217 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.composables
import androidx.compose.foundation.background
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Arrangement
import androidx.compose.foundation.layout.Box
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.Row
import androidx.compose.foundation.layout.fillMaxHeight
import androidx.compose.foundation.layout.fillMaxWidth
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.layout.requiredWidthIn
import androidx.compose.foundation.layout.width
import androidx.compose.foundation.shape.RoundedCornerShape
import androidx.compose.material3.HorizontalDivider
import androidx.compose.material3.Text
import androidx.compose.runtime.Composable
import androidx.compose.runtime.MutableState
import androidx.compose.runtime.getValue
import androidx.compose.runtime.mutableStateOf
import androidx.compose.runtime.remember
import androidx.compose.runtime.setValue
import androidx.compose.ui.Alignment
import androidx.compose.ui.Modifier
import androidx.compose.ui.draw.clip
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.input.pointer.PointerEventType
import androidx.compose.ui.input.pointer.pointerInput
import androidx.compose.ui.text.TextStyle
import androidx.compose.ui.text.font.Font
import androidx.compose.ui.text.font.FontFamily
import androidx.compose.ui.text.font.FontWeight
import androidx.compose.ui.text.style.TextAlign
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.sp
import androidx.compose.ui.window.Dialog
import dev.chrisbanes.haze.HazeState
import dev.chrisbanes.haze.hazeEffect
import dev.chrisbanes.haze.materials.CupertinoMaterials
import dev.chrisbanes.haze.materials.ExperimentalHazeMaterialsApi
import me.kavishdevar.librepods.R
@ExperimentalHazeMaterialsApi
@Composable
fun ConfirmationDialog(
showDialog: MutableState<Boolean>,
title: String,
message: String,
confirmText: String = "Enable",
dismissText: String = "Cancel",
onConfirm: () -> Unit,
onDismiss: () -> Unit = { showDialog.value = false },
hazeState: HazeState,
) {
val isDarkTheme = isSystemInDarkTheme()
val textColor = if (isDarkTheme) Color.White else Color.Black
val accentColor = if (isDarkTheme) Color(0xFF007AFF) else Color(0xFF3C6DF5)
if (showDialog.value) {
Dialog(onDismissRequest = { showDialog.value = false }) {
Box(
modifier = Modifier
// .fillMaxWidth(0.75f)
.requiredWidthIn(min = 200.dp, max = 360.dp)
.background(Color.Transparent, RoundedCornerShape(14.dp))
.clip(RoundedCornerShape(14.dp))
.hazeEffect(
hazeState,
style = CupertinoMaterials.regular(
containerColor = if (isDarkTheme) Color(0xFF1C1C1E).copy(alpha = 0.95f) else Color.White.copy(alpha = 0.95f)
)
)
) {
Column(horizontalAlignment = Alignment.CenterHorizontally) {
androidx.compose.foundation.layout.Spacer(modifier = Modifier.height(24.dp))
Text(
title,
style = TextStyle(
fontSize = 16.sp,
fontWeight = FontWeight.Bold,
color = textColor,
fontFamily = FontFamily(Font(R.font.sf_pro))
),
textAlign = TextAlign.Center,
modifier = Modifier.padding(horizontal = 16.dp)
)
androidx.compose.foundation.layout.Spacer(modifier = Modifier.height(12.dp))
Text(
message,
style = TextStyle(
fontSize = 14.sp,
color = textColor.copy(alpha = 0.8f),
fontFamily = FontFamily(Font(R.font.sf_pro))
),
textAlign = TextAlign.Center,
modifier = Modifier.padding(horizontal = 16.dp)
)
androidx.compose.foundation.layout.Spacer(modifier = Modifier.height(16.dp))
HorizontalDivider(
thickness = 1.dp,
color = Color(0x40888888),
modifier = Modifier.fillMaxWidth()
)
var leftPressed by remember { mutableStateOf(false) }
var rightPressed by remember { mutableStateOf(false) }
val pressedColor = if (isDarkTheme) Color(0x40888888) else Color(0x40D9D9D9)
Row(
modifier = Modifier
.fillMaxWidth()
.height(48.dp)
.pointerInput(Unit) {
awaitPointerEventScope {
while (true) {
val event = awaitPointerEvent()
val position = event.changes.first().position
val width = size.width.toFloat()
val height = size.height.toFloat()
val isWithinBounds = position.y >= 0 && position.y <= height
val isLeft = position.x < width / 2
event.changes.first().consume()
when (event.type) {
PointerEventType.Press -> {
if (isWithinBounds) {
leftPressed = isLeft
rightPressed = !isLeft
} else {
leftPressed = false
rightPressed = false
}
}
PointerEventType.Move -> {
if (isWithinBounds) {
leftPressed = isLeft
rightPressed = !isLeft
} else {
leftPressed = false
rightPressed = false
}
}
PointerEventType.Release -> {
if (isWithinBounds) {
if (leftPressed) {
onDismiss()
} else if (rightPressed) {
onConfirm()
}
}
leftPressed = false
rightPressed = false
}
}
}
}
},
horizontalArrangement = Arrangement.Start,
verticalAlignment = Alignment.CenterVertically
) {
Box(
modifier = Modifier
.weight(1f)
.fillMaxHeight()
.background(if (leftPressed) pressedColor else Color.Transparent),
contentAlignment = Alignment.Center
) {
Text(
text = dismissText,
style = TextStyle(
color = accentColor,
fontFamily = FontFamily(Font(R.font.sf_pro))
)
)
}
Box(
modifier = Modifier
.width(1.dp)
.fillMaxHeight()
.background(Color(0x40888888))
)
Box(
modifier = Modifier
.weight(1f)
.fillMaxHeight()
.background(if (rightPressed) pressedColor else Color.Transparent),
contentAlignment = Alignment.Center
) {
Text(
text = confirmText,
style = TextStyle(
color = accentColor,
fontFamily = FontFamily(Font(R.font.sf_pro))
)
)
}
}
}
}
}
}
}

View File

@@ -0,0 +1,82 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
@file:OptIn(ExperimentalEncodingApi::class)
package me.kavishdevar.librepods.composables
import android.content.Context.MODE_PRIVATE
import androidx.compose.foundation.background
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.fillMaxWidth
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.shape.RoundedCornerShape
import androidx.compose.material3.HorizontalDivider
import androidx.compose.runtime.Composable
import androidx.compose.ui.Modifier
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.platform.LocalContext
import androidx.compose.ui.res.stringResource
import androidx.compose.ui.tooling.preview.Preview
import androidx.compose.ui.unit.dp
import me.kavishdevar.librepods.R
import me.kavishdevar.librepods.utils.AACPManager
import kotlin.io.encoding.ExperimentalEncodingApi
@Composable
fun ConnectionSettings() {
val isDarkTheme = isSystemInDarkTheme()
val backgroundColor = if (isDarkTheme) Color(0xFF1C1C1E) else Color(0xFFFFFFFF)
Column(
modifier = Modifier
.fillMaxWidth()
.background(backgroundColor, RoundedCornerShape(28.dp))
.padding(top = 2.dp)
) {
StyledToggle(
label = stringResource(R.string.ear_detection),
controlCommandIdentifier = AACPManager.Companion.ControlCommandIdentifiers.EAR_DETECTION_CONFIG,
sharedPreferenceKey = "automatic_ear_detection",
sharedPreferences = LocalContext.current.getSharedPreferences("settings", MODE_PRIVATE),
independent = false
)
HorizontalDivider(
thickness = 1.dp,
color = Color(0x40888888),
modifier = Modifier
.padding(horizontal = 12.dp)
)
StyledToggle(
label = stringResource(R.string.automatically_connect),
description = stringResource(R.string.automatically_connect_description),
controlCommandIdentifier = AACPManager.Companion.ControlCommandIdentifiers.AUTOMATIC_CONNECTION_CONFIG,
sharedPreferenceKey = "automatic_connection_ctrl_cmd",
sharedPreferences = LocalContext.current.getSharedPreferences("settings", MODE_PRIVATE),
independent = false
)
}
}
@Preview
@Composable
fun ConnectionSettingsPreview() {
ConnectionSettings()
}

View File

@@ -0,0 +1,106 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods Contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
@file:Suppress("unused")
package me.kavishdevar.librepods.composables
import androidx.compose.animation.animateColorAsState
import androidx.compose.foundation.background
import androidx.compose.foundation.clickable
import androidx.compose.foundation.interaction.MutableInteractionSource
import androidx.compose.foundation.layout.Arrangement
import androidx.compose.foundation.layout.Box
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.Spacer
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.size
import androidx.compose.foundation.shape.CircleShape
import androidx.compose.material3.Icon
import androidx.compose.material3.Text
import androidx.compose.runtime.Composable
import androidx.compose.runtime.getValue
import androidx.compose.runtime.remember
import androidx.compose.ui.Alignment
import androidx.compose.ui.Modifier
import androidx.compose.ui.draw.clip
import androidx.compose.ui.graphics.Brush
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.graphics.painter.Painter
import androidx.compose.ui.text.font.FontWeight
import androidx.compose.ui.text.style.TextAlign
import androidx.compose.ui.unit.Dp
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.sp
private val SelectedColorBlue = Color(0xFF0A84FF)
private val UnselectedColor = Color(0x593C3C3E)
private val TextColor = Color.White
private val IconTint = Color.White
@Composable
fun ControlCenterButton(
label: String,
icon: Painter,
onClick: () -> Unit,
modifier: Modifier = Modifier,
iconAreaSize: Dp,
isSelected: Boolean,
backgroundBrush: Brush? = null
) {
val targetBackgroundColor = if (isSelected) SelectedColorBlue else UnselectedColor
val backgroundColor by animateColorAsState(
targetValue = targetBackgroundColor,
label = "ButtonBackground"
)
Column(
modifier = modifier,
horizontalAlignment = Alignment.CenterHorizontally,
verticalArrangement = Arrangement.Center
) {
Box(
modifier = Modifier
.size(iconAreaSize)
.clip(CircleShape)
.background(backgroundBrush ?: Brush.linearGradient(colors=listOf(backgroundColor, backgroundColor)))
.clickable(
onClick = onClick,
indication = null,
interactionSource = remember { MutableInteractionSource() }
),
contentAlignment = Alignment.Center
) {
Icon(
painter = icon,
contentDescription = null,
tint = IconTint,
modifier = Modifier.size(32.dp)
)
}
Spacer(modifier = Modifier.height(8.dp))
Text(
text = label,
color = TextColor,
fontSize = 12.sp,
fontWeight = FontWeight.Medium,
textAlign = TextAlign.Center,
maxLines = 2
)
}
}

View File

@@ -0,0 +1,242 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods Contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.composables
import androidx.compose.animation.core.Spring
import androidx.compose.animation.core.animateDpAsState
import androidx.compose.animation.core.spring
import androidx.compose.foundation.background
import androidx.compose.foundation.clickable
import androidx.compose.foundation.interaction.MutableInteractionSource
import androidx.compose.foundation.layout.Arrangement
import androidx.compose.foundation.layout.Box
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.Row
import androidx.compose.foundation.layout.Spacer
import androidx.compose.foundation.layout.fillMaxWidth
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.offset
import androidx.compose.foundation.layout.size
import androidx.compose.foundation.layout.width
import androidx.compose.foundation.shape.CircleShape
import androidx.compose.material3.Icon
import androidx.compose.material3.Text
import androidx.compose.runtime.Composable
import androidx.compose.runtime.getValue
import androidx.compose.runtime.mutableFloatStateOf
import androidx.compose.runtime.remember
import androidx.compose.runtime.setValue
import androidx.compose.ui.Alignment
import androidx.compose.ui.Modifier
import androidx.compose.ui.draw.clip
import androidx.compose.ui.graphics.Brush
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.layout.onSizeChanged
import androidx.compose.ui.platform.LocalDensity
import androidx.compose.ui.res.painterResource
import androidx.compose.ui.text.font.FontWeight
import androidx.compose.ui.text.style.TextAlign
import androidx.compose.ui.unit.Dp
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.sp
import me.kavishdevar.librepods.R
import me.kavishdevar.librepods.constants.NoiseControlMode
private val ContainerColor = Color(0x593C3C3E)
private val SelectedIndicatorColorGray = Color(0xFF6C6C6E)
private val SelectedIndicatorColorBlue = Color(0xFF0A84FF)
private val TextColor = Color.White
private val IconTintUnselected = Color.White
private val IconTintSelected = Color.White
internal val AdaptiveRainbowBrush = Brush.sweepGradient(
colors = listOf(
Color(0xFFB03A2F), Color(0xFFB07A2F), Color(0xFFB0A22F), Color(0xFF6AB02F),
Color(0xFF2FAAB0), Color(0xFF2F5EB0), Color(0xFF7D2FB0), Color(0xFFB02F7D),
Color(0xFFB03A2F)
)
)
internal val IconAreaSize = 72.dp
private val IconSize = 42.dp
private val IconRowHeight = IconAreaSize + 12.dp
private val TextRowHeight = 24.dp
private val TextSize = 12.sp
@Composable
fun ControlCenterNoiseControlSegmentedButton(
modifier: Modifier = Modifier,
availableModes: List<NoiseControlMode>,
selectedMode: NoiseControlMode,
onModeSelected: (NoiseControlMode) -> Unit
) {
val selectedIndex = availableModes.indexOf(selectedMode).coerceAtLeast(0)
val density = LocalDensity.current
var iconRowWidthPx by remember { mutableFloatStateOf(0f) }
val itemCount = availableModes.size
val itemSlotWidthPx = remember(iconRowWidthPx, itemCount) {
if (itemCount > 0 && iconRowWidthPx > 0) {
iconRowWidthPx / itemCount
} else {
0f
}
}
val itemSlotWidthDp = remember(itemSlotWidthPx) { with(density) { itemSlotWidthPx.toDp() } }
val iconAreaSizePx = remember { with(density) { IconAreaSize.toPx() } }
val targetIndicatorStartPx = remember(selectedIndex, itemSlotWidthPx, iconAreaSizePx) {
if (itemSlotWidthPx > 0) {
val slotCenterPx = (selectedIndex + 0.5f) * itemSlotWidthPx
slotCenterPx - (iconAreaSizePx / 2f)
} else {
0f
}
}
val indicatorOffset: Dp by animateDpAsState(
targetValue = with(density) { targetIndicatorStartPx.toDp() },
animationSpec = spring(
dampingRatio = Spring.DampingRatioLowBouncy,
stiffness = Spring.StiffnessMedium
),
label = "IndicatorOffset"
)
val indicatorBackground = remember(selectedMode) {
when (selectedMode) {
NoiseControlMode.ADAPTIVE -> AdaptiveRainbowBrush
NoiseControlMode.OFF -> Brush.linearGradient(colors=listOf(SelectedIndicatorColorGray, SelectedIndicatorColorGray))
NoiseControlMode.TRANSPARENCY,
NoiseControlMode.NOISE_CANCELLATION -> Brush.linearGradient(colors=listOf(SelectedIndicatorColorBlue, SelectedIndicatorColorBlue))
}
}
Column(
modifier = modifier,
horizontalAlignment = Alignment.CenterHorizontally
) {
Box(
modifier = Modifier
.fillMaxWidth()
.height(IconRowHeight)
.clip(CircleShape)
.background(ContainerColor)
.onSizeChanged { iconRowWidthPx = it.width.toFloat() },
contentAlignment = Alignment.Center
) {
Box(
Modifier
.align(Alignment.CenterStart)
.offset(x = indicatorOffset)
.size(IconAreaSize)
.clip(CircleShape)
.background(indicatorBackground)
)
Row(
modifier = Modifier.fillMaxWidth().align(Alignment.Center),
verticalAlignment = Alignment.CenterVertically,
horizontalArrangement = Arrangement.SpaceAround
) {
availableModes.forEach { mode ->
val isSelected = selectedMode == mode
NoiseControlIconItem(
modifier = Modifier.size(IconAreaSize),
mode = mode,
isSelected = isSelected,
onClick = { onModeSelected(mode) }
)
}
}
}
Spacer(modifier = Modifier.height(4.dp))
Row(
modifier = Modifier
.fillMaxWidth()
.height(TextRowHeight),
horizontalArrangement = Arrangement.SpaceAround,
verticalAlignment = Alignment.CenterVertically
) {
availableModes.forEach { mode ->
val isSelected = selectedMode == mode
Text(
text = getModeLabel(mode),
color = TextColor,
fontSize = TextSize,
fontWeight = if (isSelected) FontWeight.SemiBold else FontWeight.Normal,
textAlign = TextAlign.Center,
modifier = Modifier.width(itemSlotWidthDp.coerceAtLeast(1.dp))
)
}
}
}
}
@Composable
private fun NoiseControlIconItem(
modifier: Modifier = Modifier,
mode: NoiseControlMode,
isSelected: Boolean,
onClick: () -> Unit
) {
val iconRes = remember(mode) { getModeIconRes(mode) }
val tint = IconTintUnselected
Box(
modifier = modifier
.clip(CircleShape)
.clickable(
onClick = onClick,
indication = null,
interactionSource = remember { MutableInteractionSource() }
),
contentAlignment = Alignment.Center
) {
Icon(
painter = painterResource(id = iconRes),
contentDescription = getModeLabel(mode),
tint = if (isSelected && mode == NoiseControlMode.ADAPTIVE) IconTintSelected else tint,
modifier = Modifier.size(IconSize)
)
}
}
private fun getModeIconRes(mode: NoiseControlMode): Int {
return when (mode) {
NoiseControlMode.OFF -> R.drawable.noise_cancellation
NoiseControlMode.TRANSPARENCY -> R.drawable.transparency
NoiseControlMode.ADAPTIVE -> R.drawable.adaptive
NoiseControlMode.NOISE_CANCELLATION -> R.drawable.noise_cancellation
}
}
private fun getModeLabel(mode: NoiseControlMode): String {
return when (mode) {
NoiseControlMode.OFF -> "Off"
NoiseControlMode.TRANSPARENCY -> "Transparency"
NoiseControlMode.ADAPTIVE -> "Adaptive"
NoiseControlMode.NOISE_CANCELLATION -> "Noise Cancellation"
}
}

View File

@@ -0,0 +1,109 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
@file:OptIn(ExperimentalEncodingApi::class)
package me.kavishdevar.librepods.composables
import androidx.compose.foundation.background
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Box
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.fillMaxWidth
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.shape.RoundedCornerShape
import androidx.compose.material3.HorizontalDivider
import androidx.compose.material3.Text
import androidx.compose.runtime.Composable
import androidx.compose.ui.Modifier
import androidx.compose.ui.draw.clip
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.res.stringResource
import androidx.compose.ui.text.TextStyle
import androidx.compose.ui.text.font.FontWeight
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.sp
import androidx.navigation.NavController
import me.kavishdevar.librepods.R
import me.kavishdevar.librepods.composables.NavigationButton
import me.kavishdevar.librepods.services.ServiceManager
import me.kavishdevar.librepods.utils.Capability
import kotlin.io.encoding.ExperimentalEncodingApi
@Composable
fun HearingHealthSettings(navController: NavController) {
val service = ServiceManager.getService()
if (service == null) return
val airpodsInstance = service.airpodsInstance
if (airpodsInstance == null) return
if (airpodsInstance.model.capabilities.contains(Capability.HEARING_AID)) {
val isDarkTheme = isSystemInDarkTheme()
val textColor = if (isDarkTheme) Color.White else Color.Black
val backgroundColor = if (isDarkTheme) Color(0xFF1C1C1E) else Color(0xFFFFFFFF)
if (airpodsInstance.model.capabilities.contains(Capability.PPE)) {
Box(
modifier = Modifier
.background(if (isDarkTheme) Color(0xFF000000) else Color(0xFFF2F2F7))
.padding(horizontal = 16.dp, vertical = 4.dp)
){
Text(
text = stringResource(R.string.hearing_health),
style = TextStyle(
fontSize = 14.sp,
fontWeight = FontWeight.Bold,
color = textColor.copy(alpha = 0.6f)
)
)
}
Column(
modifier = Modifier
.clip(RoundedCornerShape(28.dp))
.fillMaxWidth()
.background(backgroundColor, RoundedCornerShape(28.dp))
.padding(top = 2.dp)
) {
NavigationButton(
to = "hearing_protection",
name = stringResource(R.string.hearing_protection),
navController = navController,
independent = false
)
HorizontalDivider(
thickness = 1.dp,
color = Color(0x40888888),
modifier = Modifier
.padding(horizontal = 12.dp)
)
NavigationButton(
to = "hearing_aid",
name = stringResource(R.string.hearing_aid),
navController = navController,
independent = false
)
}
} else {
NavigationButton(
to = "hearing_aid",
name = stringResource(R.string.hearing_aid),
navController = navController
)
}
}
}

View File

@@ -0,0 +1,297 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
@file:OptIn(ExperimentalEncodingApi::class)
package me.kavishdevar.librepods.composables
import android.util.Log
import androidx.compose.foundation.background
import androidx.compose.foundation.gestures.detectDragGesturesAfterLongPress
import androidx.compose.foundation.gestures.detectTapGestures
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Arrangement
import androidx.compose.foundation.layout.Box
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.Row
import androidx.compose.foundation.layout.fillMaxWidth
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.shape.RoundedCornerShape
import androidx.compose.material3.Text
import androidx.compose.runtime.Composable
import androidx.compose.runtime.DisposableEffect
import androidx.compose.runtime.LaunchedEffect
import androidx.compose.runtime.getValue
import androidx.compose.runtime.mutableLongStateOf
import androidx.compose.runtime.mutableStateOf
import androidx.compose.runtime.remember
import androidx.compose.runtime.setValue
import androidx.compose.ui.Alignment
import androidx.compose.ui.Modifier
import androidx.compose.ui.geometry.Offset
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.input.pointer.pointerInput
import androidx.compose.ui.layout.onGloballyPositioned
import androidx.compose.ui.layout.positionInParent
import androidx.compose.ui.platform.LocalDensity
import androidx.compose.ui.res.stringResource
import androidx.compose.ui.text.TextStyle
import androidx.compose.ui.text.font.Font
import androidx.compose.ui.text.font.FontFamily
import androidx.compose.ui.tooling.preview.Preview
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.sp
import dev.chrisbanes.haze.HazeState
import dev.chrisbanes.haze.materials.ExperimentalHazeMaterialsApi
import me.kavishdevar.librepods.R
import me.kavishdevar.librepods.services.ServiceManager
import me.kavishdevar.librepods.utils.AACPManager
import kotlin.io.encoding.ExperimentalEncodingApi
@ExperimentalHazeMaterialsApi
@Composable
fun MicrophoneSettings(hazeState: HazeState) {
val isDarkTheme = isSystemInDarkTheme()
val textColor = if (isDarkTheme) Color.White else Color.Black
val backgroundColor = if (isDarkTheme) Color(0xFF1C1C1E) else Color(0xFFFFFFFF)
Column(
modifier = Modifier
.fillMaxWidth()
.background(backgroundColor, RoundedCornerShape(28.dp))
.padding(top = 2.dp)
) {
val service = ServiceManager.getService()!!
val micModeValue = service.aacpManager.controlCommandStatusList.find {
it.identifier == AACPManager.Companion.ControlCommandIdentifiers.MIC_MODE
}?.value?.get(0) ?: 0x00.toByte()
var selectedMode by remember {
mutableStateOf(
when (micModeValue) {
0x00.toByte() -> "Automatic"
0x01.toByte() -> "Always Right"
0x02.toByte() -> "Always Left"
else -> "Automatic"
}
)
}
var showDropdown by remember { mutableStateOf(false) }
var touchOffset by remember { mutableStateOf<Offset?>(null) }
var boxPosition by remember { mutableStateOf(Offset.Zero) }
var lastDismissTime by remember { mutableLongStateOf(0L) }
val reopenThresholdMs = 250L
val listener = object : AACPManager.ControlCommandListener {
override fun onControlCommandReceived(controlCommand: AACPManager.ControlCommand) {
if (AACPManager.Companion.ControlCommandIdentifiers.fromByte(controlCommand.identifier) ==
AACPManager.Companion.ControlCommandIdentifiers.MIC_MODE
) {
selectedMode = when (controlCommand.value[0]) {
0x00.toByte() -> "Automatic"
0x01.toByte() -> "Always Right"
0x02.toByte() -> "Always Left"
else -> "Automatic"
}
Log.d("MicrophoneSettings", "Microphone mode received: $selectedMode")
}
}
}
LaunchedEffect(Unit) {
service.aacpManager.registerControlCommandListener(
AACPManager.Companion.ControlCommandIdentifiers.MIC_MODE,
listener
)
}
DisposableEffect(Unit) {
onDispose {
service.aacpManager.unregisterControlCommandListener(
AACPManager.Companion.ControlCommandIdentifiers.MIC_MODE,
listener
)
}
}
val density = LocalDensity.current
val itemHeightPx = with(density) { 48.dp.toPx() }
var parentHoveredIndex by remember { mutableStateOf<Int?>(null) }
var parentDragActive by remember { mutableStateOf(false) }
val microphoneAutomaticText = stringResource(R.string.microphone_automatic)
val microphoneAlwaysRightText = stringResource(R.string.microphone_always_right)
val microphoneAlwaysLeftText = stringResource(R.string.microphone_always_left)
Row(
modifier = Modifier
.fillMaxWidth()
.padding(horizontal = 16.dp)
.height(58.dp)
.pointerInput(Unit) {
detectTapGestures { offset ->
val now = System.currentTimeMillis()
if (showDropdown) {
showDropdown = false
lastDismissTime = now
} else {
if (now - lastDismissTime > reopenThresholdMs) {
touchOffset = offset
showDropdown = true
}
}
}
}
.pointerInput(Unit) {
detectDragGesturesAfterLongPress(
onDragStart = { offset ->
val now = System.currentTimeMillis()
touchOffset = offset
if (!showDropdown && now - lastDismissTime > reopenThresholdMs) {
showDropdown = true
}
lastDismissTime = now
parentDragActive = true
parentHoveredIndex = 0
},
onDrag = { change, _ ->
val current = change.position
val touch = touchOffset ?: current
val posInPopupY = current.y - touch.y
val idx = (posInPopupY / itemHeightPx).toInt()
parentHoveredIndex = idx
},
onDragEnd = {
parentDragActive = false
parentHoveredIndex?.let { idx ->
val options = listOf(
microphoneAutomaticText,
microphoneAlwaysRightText,
microphoneAlwaysLeftText
)
if (idx in options.indices) {
val option = options[idx]
selectedMode = option
showDropdown = false
lastDismissTime = System.currentTimeMillis()
val byteValue = when (option) {
options[0] -> 0x00
options[1] -> 0x01
options[2] -> 0x02
else -> 0x00
}
service.aacpManager.sendControlCommand(
AACPManager.Companion.ControlCommandIdentifiers.MIC_MODE.value,
byteArrayOf(byteValue.toByte())
)
}
}
parentHoveredIndex = null
},
onDragCancel = {
parentDragActive = false
parentHoveredIndex = null
}
)
},
horizontalArrangement = Arrangement.SpaceBetween,
verticalAlignment = Alignment.CenterVertically
) {
Text(
text = stringResource(R.string.microphone_mode),
style = TextStyle(
fontSize = 16.sp,
color = textColor,
fontFamily = FontFamily(Font(R.font.sf_pro))
),
modifier = Modifier.padding(bottom = 4.dp)
)
Box(
modifier = Modifier.onGloballyPositioned { coordinates ->
boxPosition = coordinates.positionInParent()
}
) {
Row(
verticalAlignment = Alignment.CenterVertically
) {
Text(
text = selectedMode,
style = TextStyle(
fontSize = 16.sp,
color = textColor.copy(alpha = 0.8f),
fontFamily = FontFamily(Font(R.font.sf_pro))
)
)
Text(
text = "􀆏",
style = TextStyle(
fontSize = 16.sp,
color = textColor.copy(alpha = 0.6f),
fontFamily = FontFamily(Font(R.font.sf_pro))
),
modifier = Modifier
.padding(start = 6.dp)
)
}
val microphoneAutomaticText = stringResource(R.string.microphone_automatic)
val microphoneAlwaysRightText = stringResource(R.string.microphone_always_right)
val microphoneAlwaysLeftText = stringResource(R.string.microphone_always_left)
StyledDropdown(
expanded = showDropdown,
onDismissRequest = {
showDropdown = false
lastDismissTime = System.currentTimeMillis()
},
options = listOf(
microphoneAutomaticText,
microphoneAlwaysRightText,
microphoneAlwaysLeftText
),
selectedOption = selectedMode,
touchOffset = touchOffset,
boxPosition = boxPosition,
externalHoveredIndex = parentHoveredIndex,
externalDragActive = parentDragActive,
onOptionSelected = { option ->
selectedMode = option
showDropdown = false
val byteValue = when (option) {
microphoneAutomaticText -> 0x00
microphoneAlwaysRightText -> 0x01
microphoneAlwaysLeftText -> 0x02
else -> 0x00
}
service.aacpManager.sendControlCommand(
AACPManager.Companion.ControlCommandIdentifiers.MIC_MODE.value,
byteArrayOf(byteValue.toByte())
)
},
hazeState = hazeState
)
}
}
}
}
@ExperimentalHazeMaterialsApi
@Preview
@Composable
fun MicrophoneSettingsPreview() {
MicrophoneSettings(HazeState())
}

View File

@@ -0,0 +1,160 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.composables
import androidx.compose.animation.animateColorAsState
import androidx.compose.animation.core.tween
import androidx.compose.foundation.background
import androidx.compose.foundation.gestures.detectTapGestures
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Box
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.Row
import androidx.compose.foundation.layout.Spacer
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.shape.RoundedCornerShape
import androidx.compose.material3.Text
import androidx.compose.runtime.Composable
import androidx.compose.runtime.getValue
import androidx.compose.runtime.mutableStateOf
import androidx.compose.runtime.remember
import androidx.compose.runtime.setValue
import androidx.compose.ui.Alignment
import androidx.compose.ui.Modifier
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.input.pointer.pointerInput
import androidx.compose.ui.platform.LocalContext
import androidx.compose.ui.text.TextStyle
import androidx.compose.ui.text.font.Font
import androidx.compose.ui.text.font.FontFamily
import androidx.compose.ui.text.font.FontWeight
import androidx.compose.ui.tooling.preview.Preview
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.Dp
import androidx.compose.ui.unit.sp
import androidx.navigation.NavController
import me.kavishdevar.librepods.R
@Composable
fun NavigationButton(
to: String,
name: String,
navController: NavController, onClick: (() -> Unit)? = null,
independent: Boolean = true,
title: String? = null,
description: String? = null,
currentState: String? = null,
height: Dp = 58.dp,
) {
val isDarkTheme = isSystemInDarkTheme()
var backgroundColor by remember { mutableStateOf(if (isDarkTheme) Color(0xFF1C1C1E) else Color(0xFFFFFFFF)) }
val animatedBackgroundColor by animateColorAsState(targetValue = backgroundColor, animationSpec = tween(durationMillis = 500))
Column {
if (title != null) {
Box(
modifier = Modifier
.background(if (isDarkTheme) Color(0xFF000000) else Color(0xFFF2F2F7))
.padding(start = 16.dp, end = 16.dp, top = 8.dp, bottom = 4.dp)
){
Text(
text = title,
style = TextStyle(
fontSize = 14.sp,
fontWeight = FontWeight.Bold,
color = if (isDarkTheme) Color.White.copy(alpha = 0.6f) else Color.Black.copy(alpha = 0.6f),
)
)
}
}
Row(
modifier = Modifier
.background(animatedBackgroundColor, RoundedCornerShape(if (independent) 28.dp else 0.dp))
.height(height)
.pointerInput(Unit) {
detectTapGestures(
onPress = {
backgroundColor = if (isDarkTheme) Color(0x40888888) else Color(0x40D9D9D9)
tryAwaitRelease()
backgroundColor = if (isDarkTheme) Color(0xFF1C1C1E) else Color(0xFFFFFFFF)
},
onTap = {
if (onClick != null) onClick() else navController.navigate(to)
}
)
}
.padding(horizontal = 16.dp),
verticalAlignment = Alignment.CenterVertically,
) {
Text(
text = name,
style = TextStyle(
fontSize = 16.sp,
fontFamily = FontFamily(Font(R.font.sf_pro)),
color = if (isDarkTheme) Color.White else Color.Black,
)
)
Spacer(modifier = Modifier.weight(1f))
if (currentState != null) {
Text(
text = currentState,
style = TextStyle(
fontSize = 16.sp,
fontFamily = FontFamily(Font(R.font.sf_pro)),
color = if (isDarkTheme) Color.White.copy(alpha = 0.6f) else Color.Black.copy(alpha = 0.8f),
)
)
}
Text(
text = "􀯻",
style = TextStyle(
fontSize = 16.sp,
fontFamily = FontFamily(Font(R.font.sf_pro)),
color = if (isDarkTheme) Color.White.copy(alpha = 0.6f) else Color.Black.copy(alpha = 0.6f)
),
modifier = Modifier
.padding(start = if (currentState != null) 6.dp else 0.dp)
)
}
if (description != null) {
Box(
modifier = Modifier
.background(if (isDarkTheme) Color(0xFF000000) else Color(0xFFF2F2F7)) // because blur effect doesn't work for some reason
.padding(horizontal = 16.dp, vertical = 4.dp),
) {
Text(
text = description,
style = TextStyle(
fontSize = 12.sp,
fontWeight = FontWeight.Light,
color = if (isDarkTheme) Color.White.copy(alpha = 0.6f) else Color.Black.copy(alpha = 0.6f),
fontFamily = FontFamily(Font(R.font.sf_pro))
),
// modifier = Modifier.padding(horizontal = 16.dp)
)
}
}
}
}
@Preview
@Composable
fun NavigationButtonPreview() {
NavigationButton("to", "Name", NavController(LocalContext.current))
}

View File

@@ -0,0 +1,77 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.composables
import androidx.compose.foundation.clickable
import androidx.compose.foundation.interaction.MutableInteractionSource
import androidx.compose.foundation.layout.Arrangement
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.fillMaxHeight
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.layout.size
import androidx.compose.material3.Icon
import androidx.compose.runtime.Composable
import androidx.compose.runtime.remember
import androidx.compose.ui.Alignment
import androidx.compose.ui.Modifier
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.graphics.ImageBitmap
import androidx.compose.ui.res.imageResource
import androidx.compose.ui.tooling.preview.Preview
import androidx.compose.ui.unit.dp
import me.kavishdevar.librepods.R
@Composable
fun NoiseControlButton(
icon: ImageBitmap,
onClick: () -> Unit,
textColor: Color,
modifier: Modifier = Modifier,
usePadding: Boolean = true
) {
Column(
modifier = modifier
.fillMaxHeight()
.then(if (usePadding) Modifier.padding(horizontal = 4.dp, vertical = 4.dp) else Modifier)
.clickable(
onClick = onClick,
indication = null,
interactionSource = remember { MutableInteractionSource() }
),
horizontalAlignment = Alignment.CenterHorizontally,
verticalArrangement = Arrangement.Center
) {
Icon(
bitmap = icon,
contentDescription = null,
tint = textColor,
modifier = Modifier.size(40.dp)
)
}
}
@Preview
@Composable
fun NoiseControlButtonPreview() {
NoiseControlButton(
icon = ImageBitmap.imageResource(R.drawable.noise_cancellation),
onClick = {},
textColor = Color.White,
)
}

View File

@@ -0,0 +1,444 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
@file:OptIn(ExperimentalEncodingApi::class)
package me.kavishdevar.librepods.composables
import android.annotation.SuppressLint
import android.content.BroadcastReceiver
import android.content.Context
import android.content.Intent
import android.content.IntentFilter
import android.os.Build
import androidx.compose.animation.core.AnimationSpec
import androidx.compose.animation.core.Spring
import androidx.compose.animation.core.SpringSpec
import androidx.compose.animation.core.animateFloatAsState
import androidx.compose.foundation.background
import androidx.compose.foundation.gestures.Orientation
import androidx.compose.foundation.gestures.draggable
import androidx.compose.foundation.gestures.rememberDraggableState
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Box
import androidx.compose.foundation.layout.BoxWithConstraints
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.Row
import androidx.compose.foundation.layout.fillMaxHeight
import androidx.compose.foundation.layout.fillMaxSize
import androidx.compose.foundation.layout.fillMaxWidth
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.offset
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.layout.width
import androidx.compose.foundation.shape.RoundedCornerShape
import androidx.compose.material3.MaterialTheme
import androidx.compose.material3.Text
import androidx.compose.material3.VerticalDivider
import androidx.compose.runtime.Composable
import androidx.compose.runtime.getValue
import androidx.compose.runtime.mutableFloatStateOf
import androidx.compose.runtime.mutableStateOf
import androidx.compose.runtime.remember
import androidx.compose.runtime.setValue
import androidx.compose.ui.Modifier
import androidx.compose.ui.draw.alpha
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.graphics.ImageBitmap
import androidx.compose.ui.platform.LocalContext
import androidx.compose.ui.platform.LocalDensity
import androidx.compose.ui.res.imageResource
import androidx.compose.ui.res.stringResource
import androidx.compose.ui.text.TextStyle
import androidx.compose.ui.text.font.FontWeight
import androidx.compose.ui.text.style.TextAlign
import androidx.compose.ui.tooling.preview.Preview
import androidx.compose.ui.unit.IntOffset
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.sp
import androidx.compose.ui.zIndex
import me.kavishdevar.librepods.R
import me.kavishdevar.librepods.constants.AirPodsNotifications
import me.kavishdevar.librepods.constants.NoiseControlMode
import me.kavishdevar.librepods.services.AirPodsService
import me.kavishdevar.librepods.utils.AACPManager
import kotlin.io.encoding.ExperimentalEncodingApi
import kotlin.math.roundToInt
@SuppressLint("UnspecifiedRegisterReceiverFlag", "UnusedBoxWithConstraintsScope")
@Composable
fun NoiseControlSettings(
service: AirPodsService,
) {
val context = LocalContext.current
val offListeningModeConfigValue = service.aacpManager.controlCommandStatusList.find {
it.identifier == AACPManager.Companion.ControlCommandIdentifiers.ALLOW_OFF_OPTION
}?.value?.takeIf { it.isNotEmpty() }?.get(0) == 1.toByte()
val offListeningMode = remember { mutableStateOf(offListeningModeConfigValue) }
val offListeningModeListener = object: AACPManager.ControlCommandListener {
override fun onControlCommandReceived(controlCommand: AACPManager.ControlCommand) {
offListeningMode.value = controlCommand.value[0] == 1.toByte()
}
}
service.aacpManager.registerControlCommandListener(
AACPManager.Companion.ControlCommandIdentifiers.ALLOW_OFF_OPTION,
offListeningModeListener
)
val isDarkTheme = isSystemInDarkTheme()
val backgroundColor = if (isDarkTheme) Color(0xFF1C1C1E) else Color(0xFFE3E3E8)
val textColor = if (isDarkTheme) Color.White else Color.Black
val textColorSelected = if (isDarkTheme) Color.White else Color.Black
val selectedBackground = if (isDarkTheme) Color(0xBF5C5A5F) else Color(0xFFFFFFFF)
val noiseControlMode = remember { mutableStateOf(NoiseControlMode.OFF) }
val d1a = remember { mutableFloatStateOf(0f) }
val d2a = remember { mutableFloatStateOf(0f) }
val d3a = remember { mutableFloatStateOf(0f) }
fun onModeSelected(mode: NoiseControlMode, received: Boolean = false) {
val previousMode = noiseControlMode.value
val targetMode = if (!offListeningMode.value && mode == NoiseControlMode.OFF) {
NoiseControlMode.TRANSPARENCY
} else {
mode
}
noiseControlMode.value = targetMode
if (!received && targetMode != previousMode) {
service.aacpManager.sendControlCommand(identifier = AACPManager.Companion.ControlCommandIdentifiers.LISTENING_MODE.value, value = targetMode.ordinal + 1)
}
when (noiseControlMode.value) {
NoiseControlMode.NOISE_CANCELLATION -> {
d1a.floatValue = 1f
d2a.floatValue = 1f
d3a.floatValue = 0f
}
NoiseControlMode.OFF -> {
d1a.floatValue = 0f
d2a.floatValue = 1f
d3a.floatValue = 1f
}
NoiseControlMode.ADAPTIVE -> {
d1a.floatValue = 1f
d2a.floatValue = 0f
d3a.floatValue = 0f
}
NoiseControlMode.TRANSPARENCY -> {
d1a.floatValue = 0f
d2a.floatValue = 0f
d3a.floatValue = 1f
}
}
}
val noiseControlReceiver = remember {
object : BroadcastReceiver() {
override fun onReceive(context: Context, intent: Intent) {
if (intent.action == AirPodsNotifications.ANC_DATA) {
noiseControlMode.value = NoiseControlMode.entries.toTypedArray()[intent.getIntExtra("data", 3) - 1]
onModeSelected(noiseControlMode.value, true)
} else if (intent.action == AirPodsNotifications.DISCONNECT_RECEIVERS) {
try {
context.unregisterReceiver(this)
} catch (e: IllegalArgumentException) {
e.printStackTrace()
}
}
}
}
}
val noiseControlIntentFilter = IntentFilter().apply {
addAction(AirPodsNotifications.ANC_DATA)
addAction(AirPodsNotifications.DISCONNECT_RECEIVERS)
}
if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.TIRAMISU) {
context.registerReceiver(noiseControlReceiver, noiseControlIntentFilter, Context.RECEIVER_EXPORTED)
} else {
context.registerReceiver(noiseControlReceiver, noiseControlIntentFilter)
}
Box(
modifier = Modifier
.background(if (isDarkTheme) Color(0xFF000000) else Color(0xFFF2F2F7))
.padding(horizontal = 16.dp, vertical = 4.dp)
){
Text(
text = stringResource(R.string.noise_control),
style = TextStyle(
fontSize = 14.sp,
fontWeight = FontWeight.Bold,
color = textColor.copy(alpha = 0.6f),
)
)
}
@Suppress("COMPOSE_APPLIER_CALL_MISMATCH")
BoxWithConstraints(
modifier = Modifier
.fillMaxWidth()
.padding(vertical = 8.dp)
) {
val density = LocalDensity.current
val buttonCount = if (offListeningMode.value) 4 else 3
val buttonWidth = maxWidth / buttonCount
val isDragging = remember { mutableStateOf(false) }
var dragOffset by remember {
mutableFloatStateOf(
with(density) {
when(noiseControlMode.value) {
NoiseControlMode.OFF -> if (offListeningMode.value) 0f else buttonWidth.toPx()
NoiseControlMode.TRANSPARENCY -> if (offListeningMode.value) buttonWidth.toPx() else 0f
NoiseControlMode.ADAPTIVE -> if (offListeningMode.value) (buttonWidth * 2).toPx() else buttonWidth.toPx()
NoiseControlMode.NOISE_CANCELLATION -> if (offListeningMode.value) (buttonWidth * 3).toPx() else (buttonWidth * 2).toPx()
}
}
)
}
val animationSpec: AnimationSpec<Float> = SpringSpec(
dampingRatio = Spring.DampingRatioLowBouncy,
stiffness = Spring.StiffnessMediumLow,
visibilityThreshold = 0.01f
)
val targetOffset = buttonWidth * when(noiseControlMode.value) {
NoiseControlMode.OFF -> if (offListeningMode.value) 0 else 1
NoiseControlMode.TRANSPARENCY -> if (offListeningMode.value) 1 else 0
NoiseControlMode.ADAPTIVE -> if (offListeningMode.value) 2 else 1
NoiseControlMode.NOISE_CANCELLATION -> if (offListeningMode.value) 3 else 2
}
val animatedOffset by animateFloatAsState(
targetValue = with(density) {
if (isDragging.value) dragOffset else targetOffset.toPx()
},
animationSpec = animationSpec,
label = "selector"
)
Column(
modifier = Modifier.fillMaxWidth()
) {
Box(
modifier = Modifier
.fillMaxWidth()
.height(60.dp)
.background(backgroundColor, RoundedCornerShape(28.dp))
) {
Row(
modifier = Modifier.fillMaxWidth()
) {
if (offListeningMode.value) {
NoiseControlButton(
icon = ImageBitmap.imageResource(R.drawable.noise_cancellation),
onClick = { onModeSelected(NoiseControlMode.OFF) },
textColor = if (noiseControlMode.value == NoiseControlMode.OFF) textColorSelected else textColor,
modifier = Modifier.weight(1f),
usePadding = false
)
VerticalDivider(
thickness = 1.dp,
modifier = Modifier
.padding(vertical = 10.dp)
.alpha(d1a.floatValue),
color = MaterialTheme.colorScheme.onSurface.copy(alpha = 0.12f)
)
}
NoiseControlButton(
icon = ImageBitmap.imageResource(R.drawable.transparency),
onClick = { onModeSelected(NoiseControlMode.TRANSPARENCY) },
textColor = if (noiseControlMode.value == NoiseControlMode.TRANSPARENCY) textColorSelected else textColor,
modifier = Modifier.weight(1f),
usePadding = false
)
VerticalDivider(
thickness = 1.dp,
modifier = Modifier
.padding(vertical = 10.dp)
.alpha(d2a.floatValue),
color = MaterialTheme.colorScheme.onSurface.copy(alpha = 0.12f)
)
NoiseControlButton(
icon = ImageBitmap.imageResource(R.drawable.adaptive),
onClick = { onModeSelected(NoiseControlMode.ADAPTIVE) },
textColor = if (noiseControlMode.value == NoiseControlMode.ADAPTIVE) textColorSelected else textColor,
modifier = Modifier.weight(1f),
usePadding = false
)
VerticalDivider(
thickness = 1.dp,
modifier = Modifier
.padding(vertical = 10.dp)
.alpha(d3a.floatValue),
color = MaterialTheme.colorScheme.onSurface.copy(alpha = 0.12f)
)
NoiseControlButton(
icon = ImageBitmap.imageResource(R.drawable.noise_cancellation),
onClick = { onModeSelected(NoiseControlMode.NOISE_CANCELLATION) },
textColor = if (noiseControlMode.value == NoiseControlMode.NOISE_CANCELLATION) textColorSelected else textColor,
modifier = Modifier.weight(1f),
usePadding = false
)
}
Box(
modifier = Modifier
.width(buttonWidth)
.fillMaxHeight()
.offset { IntOffset(animatedOffset.roundToInt(), 0) }
.zIndex(0f)
.draggable(
orientation = Orientation.Horizontal,
state = rememberDraggableState { delta ->
dragOffset = (dragOffset + delta).coerceIn(
0f,
with(density) { (buttonWidth * (buttonCount - 1)).toPx() }
)
},
onDragStarted = { isDragging.value = true },
onDragStopped = {
isDragging.value = false
val position = dragOffset / with(density) { buttonWidth.toPx() }
val newIndex = position.roundToInt()
val newMode = when(newIndex) {
0 -> if (offListeningMode.value) NoiseControlMode.OFF else NoiseControlMode.TRANSPARENCY
1 -> if (offListeningMode.value) NoiseControlMode.TRANSPARENCY else NoiseControlMode.ADAPTIVE
2 -> if (offListeningMode.value) NoiseControlMode.ADAPTIVE else NoiseControlMode.NOISE_CANCELLATION
3 -> NoiseControlMode.NOISE_CANCELLATION
else -> noiseControlMode.value // Keep current if index is invalid
}
// Call onModeSelected which now handles service call but not callback
onModeSelected(newMode)
}
)
) {
Box(
modifier = Modifier
.fillMaxSize()
.padding(3.dp)
.background(selectedBackground, RoundedCornerShape(26.dp))
)
}
Row(
modifier = Modifier
.fillMaxWidth()
.zIndex(1f)
) {
if (offListeningMode.value) {
NoiseControlButton(
icon = ImageBitmap.imageResource(R.drawable.noise_cancellation),
onClick = { onModeSelected(NoiseControlMode.OFF) },
textColor = if (noiseControlMode.value == NoiseControlMode.OFF) textColorSelected else textColor,
modifier = Modifier.weight(1f),
usePadding = false
)
VerticalDivider(
thickness = 1.dp,
modifier = Modifier
.padding(vertical = 10.dp)
.alpha(d1a.floatValue),
color = MaterialTheme.colorScheme.onSurface.copy(alpha = 0.12f)
)
}
NoiseControlButton(
icon = ImageBitmap.imageResource(R.drawable.transparency),
onClick = { onModeSelected(NoiseControlMode.TRANSPARENCY) },
textColor = if (noiseControlMode.value == NoiseControlMode.TRANSPARENCY) textColorSelected else textColor,
modifier = Modifier.weight(1f),
usePadding = false
)
VerticalDivider(
thickness = 1.dp,
modifier = Modifier
.padding(vertical = 10.dp)
.alpha(d2a.floatValue),
color = MaterialTheme.colorScheme.onSurface.copy(alpha = 0.12f)
)
NoiseControlButton(
icon = ImageBitmap.imageResource(R.drawable.adaptive),
onClick = { onModeSelected(NoiseControlMode.ADAPTIVE) },
textColor = if (noiseControlMode.value == NoiseControlMode.ADAPTIVE) textColorSelected else textColor,
modifier = Modifier.weight(1f),
usePadding = false
)
VerticalDivider(
thickness = 1.dp,
modifier = Modifier
.padding(vertical = 10.dp)
.alpha(d3a.floatValue),
color = MaterialTheme.colorScheme.onSurface.copy(alpha = 0.12f)
)
NoiseControlButton(
icon = ImageBitmap.imageResource(R.drawable.noise_cancellation),
onClick = { onModeSelected(NoiseControlMode.NOISE_CANCELLATION) },
textColor = if (noiseControlMode.value == NoiseControlMode.NOISE_CANCELLATION) textColorSelected else textColor,
modifier = Modifier.weight(1f),
usePadding = false
)
}
}
Row(
modifier = Modifier
.fillMaxWidth()
.padding(top = 4.dp)
) {
if (offListeningMode.value) {
Text(
text = stringResource(R.string.off),
style = TextStyle(fontSize = 12.sp, color = textColor),
textAlign = TextAlign.Center,
modifier = Modifier.weight(1f)
)
}
Text(
text = stringResource(R.string.transparency),
style = TextStyle(fontSize = 12.sp, color = textColor),
textAlign = TextAlign.Center,
modifier = Modifier.weight(1f)
)
Text(
text = stringResource(R.string.adaptive),
style = TextStyle(fontSize = 12.sp, color = textColor),
textAlign = TextAlign.Center,
modifier = Modifier.weight(1f)
)
Text(
text = stringResource(R.string.noise_cancellation),
style = TextStyle(fontSize = 12.sp, color = textColor),
textAlign = TextAlign.Center,
modifier = Modifier.weight(1f)
)
}
}
}
}
@Preview
@Composable
fun NoiseControlSettingsPreview() {
NoiseControlSettings(AirPodsService())
}

View File

@@ -0,0 +1,122 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.composables
import android.content.Context
import android.content.res.Configuration
import androidx.compose.foundation.background
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Box
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.Spacer
import androidx.compose.foundation.layout.fillMaxWidth
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.shape.RoundedCornerShape
import androidx.compose.material3.HorizontalDivider
import androidx.compose.material3.Text
import androidx.compose.runtime.Composable
import androidx.compose.ui.Modifier
import androidx.compose.ui.draw.clip
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.platform.LocalContext
import androidx.compose.ui.res.stringResource
import androidx.compose.ui.text.TextStyle
import androidx.compose.ui.text.font.Font
import androidx.compose.ui.text.font.FontFamily
import androidx.compose.ui.text.font.FontWeight
import androidx.compose.ui.tooling.preview.Preview
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.sp
import androidx.navigation.NavController
import me.kavishdevar.librepods.R
import me.kavishdevar.librepods.constants.StemAction
@Composable
fun PressAndHoldSettings(navController: NavController) {
val isDarkTheme = isSystemInDarkTheme()
val textColor = if (isDarkTheme) Color.White else Color.Black
val dividerColor = Color(0x40888888)
val context = LocalContext.current
val sharedPreferences = context.getSharedPreferences("settings", Context.MODE_PRIVATE)
val leftAction = sharedPreferences.getString("left_long_press_action", StemAction.CYCLE_NOISE_CONTROL_MODES.name)
val rightAction = sharedPreferences.getString("right_long_press_action", StemAction.CYCLE_NOISE_CONTROL_MODES.name)
val leftActionText = when (StemAction.valueOf(leftAction ?: StemAction.CYCLE_NOISE_CONTROL_MODES.name)) {
StemAction.CYCLE_NOISE_CONTROL_MODES -> stringResource(R.string.noise_control)
StemAction.DIGITAL_ASSISTANT -> "Digital Assistant"
else -> "INVALID!!"
}
val rightActionText = when (StemAction.valueOf(rightAction ?: StemAction.CYCLE_NOISE_CONTROL_MODES.name)) {
StemAction.CYCLE_NOISE_CONTROL_MODES -> stringResource(R.string.noise_control)
StemAction.DIGITAL_ASSISTANT -> "Digital Assistant"
else -> "INVALID!!"
}
Box(
modifier = Modifier
.background(if (isDarkTheme) Color(0xFF000000) else Color(0xFFF2F2F7))
.padding(horizontal = 16.dp, vertical = 4.dp)
){
Text(
text = stringResource(R.string.press_and_hold_airpods),
style = TextStyle(
fontSize = 14.sp,
fontWeight = FontWeight.Bold,
color = textColor.copy(alpha = 0.6f),
fontFamily = FontFamily(Font(R.font.sf_pro))
)
)
}
Column(
modifier = Modifier
.fillMaxWidth()
.background(if (isDarkTheme) Color(0xFF1C1C1E) else Color(0xFFFFFFFF), RoundedCornerShape(28.dp))
.clip(RoundedCornerShape(28.dp))
) {
NavigationButton(
to = "long_press/Left",
name = stringResource(R.string.left),
navController = navController,
independent = false,
currentState = leftActionText,
)
HorizontalDivider(
thickness = 1.dp,
color = dividerColor,
modifier = Modifier
.padding(horizontal = 16.dp)
)
NavigationButton(
to = "long_press/Right",
name = stringResource(R.string.right),
navController = navController,
independent = false,
currentState = rightActionText,
)
}
}
@Preview(uiMode = Configuration.UI_MODE_NIGHT_YES)
@Composable
fun PressAndHoldSettingsPreview() {
PressAndHoldSettings(navController = NavController(LocalContext.current))
}

View File

@@ -0,0 +1,284 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.composables
import android.graphics.RuntimeShader
import android.os.Build
import androidx.compose.animation.core.Animatable
import androidx.compose.animation.core.VectorConverter
import androidx.compose.animation.core.VisibilityThreshold
import androidx.compose.animation.core.spring
import androidx.compose.foundation.clickable
import androidx.compose.foundation.gestures.detectTapGestures
import androidx.compose.foundation.layout.Arrangement
import androidx.compose.foundation.layout.Row
import androidx.compose.foundation.layout.RowScope
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.shape.RoundedCornerShape
import androidx.compose.runtime.Composable
import androidx.compose.runtime.getValue
import androidx.compose.runtime.mutableStateOf
import androidx.compose.runtime.remember
import androidx.compose.runtime.rememberCoroutineScope
import androidx.compose.runtime.setValue
import androidx.compose.ui.Alignment
import androidx.compose.ui.Modifier
import androidx.compose.ui.geometry.Offset
import androidx.compose.ui.graphics.BlendMode
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.graphics.ShaderBrush
import androidx.compose.ui.graphics.isSpecified
import androidx.compose.ui.graphics.toArgb
import androidx.compose.ui.input.pointer.pointerInput
import androidx.compose.ui.semantics.Role
import androidx.compose.ui.unit.dp
import androidx.compose.ui.util.fastCoerceAtMost
import androidx.compose.ui.util.fastCoerceIn
import androidx.compose.ui.util.lerp
import com.kyant.backdrop.Backdrop
import com.kyant.backdrop.drawBackdrop
import com.kyant.backdrop.effects.blur
import com.kyant.backdrop.effects.refraction
import com.kyant.backdrop.effects.vibrancy
import com.kyant.backdrop.highlight.Highlight
import kotlinx.coroutines.launch
import me.kavishdevar.librepods.utils.inspectDragGestures
import kotlin.math.abs
import kotlin.math.atan2
import kotlin.math.cos
import kotlin.math.sin
import kotlin.math.tanh
@Composable
fun StyledButton(
onClick: () -> Unit,
backdrop: Backdrop,
modifier: Modifier = Modifier,
isInteractive: Boolean = true,
tint: Color = Color.Unspecified,
surfaceColor: Color = Color.Unspecified,
maxScale: Float = 0.1f,
content: @Composable RowScope.() -> Unit,
) {
val animationScope = rememberCoroutineScope()
val progressAnimation = remember { Animatable(0f) }
var pressStartPosition by remember { mutableStateOf(Offset.Zero) }
val offsetAnimation = remember { Animatable(Offset.Zero, Offset.VectorConverter) }
var isPressed by remember { mutableStateOf(false) }
val interactiveHighlightShader = remember {
if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.TIRAMISU) {
RuntimeShader(
"""
uniform float2 size;
layout(color) uniform half4 color;
uniform float radius;
uniform float2 offset;
half4 main(float2 coord) {
float2 center = offset;
float dist = distance(coord, center);
float intensity = smoothstep(radius, radius * 0.5, dist);
return color * intensity;
}"""
)
} else {
null
}
}
Row(
modifier
.then(
if (!isInteractive) {
Modifier.drawBackdrop(
backdrop = backdrop,
shape = { RoundedCornerShape(28f.dp) },
effects = {
blur(16f.dp.toPx())
},
layerBlock = null,
onDrawSurface = {
if (tint.isSpecified) {
drawRect(tint, blendMode = BlendMode.Hue)
drawRect(tint.copy(alpha = 0.75f))
} else {
drawRect(Color.White.copy(0.1f))
}
if (surfaceColor.isSpecified) {
val color = if (!isInteractive && isPressed) {
Color(
red = surfaceColor.red * 0.5f,
green = surfaceColor.green * 0.5f,
blue = surfaceColor.blue * 0.5f,
alpha = surfaceColor.alpha
)
} else {
surfaceColor
}
drawRect(color)
}
},
onDrawFront = null,
highlight = { Highlight.Ambient.copy(alpha = 0f) }
)
} else {
Modifier.drawBackdrop(
backdrop = backdrop,
shape = { RoundedCornerShape(28f.dp) },
effects = {
vibrancy()
blur(2f.dp.toPx())
refraction(12f.dp.toPx(), 24f.dp.toPx())
},
layerBlock = {
val width = size.width
val height = size.height
val progress = progressAnimation.value
val scale = lerp(1f, 1f + maxScale, progress)
val maxOffset = size.minDimension
val initialDerivative = 0.05f
val offset = offsetAnimation.value
translationX = maxOffset * tanh(initialDerivative * offset.x / maxOffset)
translationY = maxOffset * tanh(initialDerivative * offset.y / maxOffset)
val maxDragScale = 0.1f
val offsetAngle = atan2(offset.y, offset.x)
scaleX =
scale +
maxDragScale * abs(cos(offsetAngle) * offset.x / size.maxDimension) *
(width / height).fastCoerceAtMost(1f)
scaleY =
scale +
maxDragScale * abs(sin(offsetAngle) * offset.y / size.maxDimension) *
(height / width).fastCoerceAtMost(1f)
},
onDrawSurface = {
if (tint.isSpecified) {
drawRect(tint, blendMode = BlendMode.Hue)
drawRect(tint.copy(alpha = 0.75f))
} else {
drawRect(Color.White.copy(0.1f))
}
if (surfaceColor.isSpecified) {
val color = if (!isInteractive && isPressed) {
Color(
red = surfaceColor.red * 0.5f,
green = surfaceColor.green * 0.5f,
blue = surfaceColor.blue * 0.5f,
alpha = surfaceColor.alpha
)
} else {
surfaceColor
}
drawRect(color)
}
},
onDrawFront = {
val progress = progressAnimation.value.fastCoerceIn(0f, 1f)
if (progress > 0f) {
if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.TIRAMISU && interactiveHighlightShader != null) {
drawRect(
Color.White.copy(0.1f * progress),
blendMode = BlendMode.Plus
)
interactiveHighlightShader.apply {
val offset = pressStartPosition + offsetAnimation.value
setFloatUniform("size", size.width, size.height)
setColorUniform("color", Color.White.copy(0.15f * progress).toArgb())
setFloatUniform("radius", size.maxDimension)
setFloatUniform(
"offset",
offset.x.fastCoerceIn(0f, size.width),
offset.y.fastCoerceIn(0f, size.height)
)
}
drawRect(
ShaderBrush(interactiveHighlightShader),
blendMode = BlendMode.Plus
)
} else {
drawRect(
Color.White.copy(0.25f * progress),
blendMode = BlendMode.Plus
)
}
}
}
)
}
)
.clickable(
interactionSource = null,
indication = null,
role = Role.Button,
onClick = onClick
)
.then(
if (isInteractive) {
Modifier.pointerInput(animationScope) {
val progressAnimationSpec = spring(0.5f, 300f, 0.001f)
val offsetAnimationSpec = spring(1f, 300f, Offset.VisibilityThreshold)
val onDragStop: () -> Unit = {
animationScope.launch {
launch { progressAnimation.animateTo(0f, progressAnimationSpec) }
launch { offsetAnimation.animateTo(Offset.Zero, offsetAnimationSpec) }
}
}
inspectDragGestures(
onDragStart = { down ->
pressStartPosition = down.position
animationScope.launch {
launch { progressAnimation.animateTo(1f, progressAnimationSpec) }
launch { offsetAnimation.snapTo(Offset.Zero) }
}
},
onDragEnd = { onDragStop() },
onDragCancel = onDragStop
) { _, dragAmount ->
animationScope.launch {
offsetAnimation.snapTo(offsetAnimation.value + dragAmount)
}
}
}
} else {
Modifier.pointerInput(Unit) {
detectTapGestures(
onPress = {
isPressed = true
tryAwaitRelease()
isPressed = false
},
onTap = {
onClick()
}
)
}
}
)
.height(48f.dp)
.padding(horizontal = 16f.dp),
horizontalArrangement = Arrangement.spacedBy(8f.dp, Alignment.CenterHorizontally),
verticalAlignment = Alignment.CenterVertically,
content = content
)
}

View File

@@ -0,0 +1,244 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.composables
import android.annotation.SuppressLint
import androidx.compose.animation.AnimatedVisibility
import androidx.compose.animation.fadeIn
import androidx.compose.animation.fadeOut
import androidx.compose.animation.slideInVertically
import androidx.compose.animation.slideOutVertically
import androidx.compose.foundation.background
import androidx.compose.foundation.clickable
import androidx.compose.foundation.gestures.detectDragGestures
import androidx.compose.foundation.interaction.MutableInteractionSource
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Arrangement
import androidx.compose.foundation.layout.Box
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.Row
import androidx.compose.foundation.layout.fillMaxWidth
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.layout.width
import androidx.compose.foundation.shape.RoundedCornerShape
import androidx.compose.material3.Card
import androidx.compose.material3.CardDefaults
import androidx.compose.material3.Checkbox
import androidx.compose.material3.CheckboxDefaults
import androidx.compose.material3.HorizontalDivider
import androidx.compose.material3.Text
import androidx.compose.runtime.Composable
import androidx.compose.runtime.LaunchedEffect
import androidx.compose.runtime.getValue
import androidx.compose.runtime.mutableStateOf
import androidx.compose.runtime.remember
import androidx.compose.runtime.setValue
import androidx.compose.ui.Alignment
import androidx.compose.ui.Modifier
import androidx.compose.ui.draw.clip
import androidx.compose.ui.geometry.Offset
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.input.pointer.pointerInput
import androidx.compose.ui.layout.onGloballyPositioned
import androidx.compose.ui.text.TextStyle
import androidx.compose.ui.text.font.Font
import androidx.compose.ui.text.font.FontFamily
import androidx.compose.ui.unit.IntOffset
import androidx.compose.ui.unit.IntSize
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.sp
import androidx.compose.ui.window.Popup
import dev.chrisbanes.haze.HazeEffectScope
import dev.chrisbanes.haze.HazeState
import dev.chrisbanes.haze.HazeTint
import dev.chrisbanes.haze.hazeEffect
import dev.chrisbanes.haze.materials.CupertinoMaterials
import dev.chrisbanes.haze.materials.ExperimentalHazeMaterialsApi
import me.kavishdevar.librepods.R
@ExperimentalHazeMaterialsApi
@Composable
fun StyledDropdown(
expanded: Boolean,
onDismissRequest: () -> Unit,
options: List<String>,
selectedOption: String,
touchOffset: Offset?,
boxPosition: Offset,
onOptionSelected: (String) -> Unit,
externalHoveredIndex: Int? = null,
externalDragActive: Boolean = false,
hazeState: HazeState,
@SuppressLint("ModifierParameter") modifier: Modifier = Modifier
) {
if (expanded) {
val relativeOffset = touchOffset?.let { it - boxPosition } ?: Offset.Zero
Popup(
offset = IntOffset(relativeOffset.x.toInt(), relativeOffset.y.toInt()),
onDismissRequest = onDismissRequest
) {
AnimatedVisibility(
visible = true,
enter = slideInVertically(initialOffsetY = { -it }) + fadeIn(),
exit = slideOutVertically(targetOffsetY = { -it }) + fadeOut()
) {
Card(
modifier = modifier
.padding(8.dp)
.width(300.dp)
.background(Color.Transparent)
.clip(RoundedCornerShape(8.dp)),
elevation = CardDefaults.cardElevation(defaultElevation = 4.dp)
) {
var hoveredIndex by remember { mutableStateOf<Int?>(null) }
val itemHeight = 48.dp
var popupSize by remember { mutableStateOf(IntSize(0, 0)) }
var lastDragPosition by remember { mutableStateOf<Offset?>(null) }
LaunchedEffect(externalHoveredIndex, externalDragActive) {
if (externalDragActive) {
hoveredIndex = externalHoveredIndex
}
}
Column(
modifier = Modifier
.onGloballyPositioned { coordinates ->
popupSize = coordinates.size
}
.pointerInput(popupSize) {
detectDragGestures(
onDragStart = { offset ->
hoveredIndex = (offset.y / itemHeight.toPx()).toInt()
lastDragPosition = offset
},
onDrag = { change, _ ->
val y = change.position.y
hoveredIndex = (y / itemHeight.toPx()).toInt()
lastDragPosition = change.position
},
onDragEnd = {
val pos = lastDragPosition
val withinBounds = pos != null &&
pos.x >= 0f && pos.y >= 0f &&
pos.x <= popupSize.width.toFloat() && pos.y <= popupSize.height.toFloat()
if (withinBounds) {
hoveredIndex?.let { idx ->
if (idx in options.indices) {
onOptionSelected(options[idx])
}
}
onDismissRequest()
} else {
hoveredIndex = null
}
}
)
}
) {
options.forEachIndexed { index, text ->
val isHovered =
if (externalDragActive && externalHoveredIndex != null) {
index == externalHoveredIndex
} else {
index == hoveredIndex
}
val isSystemInDarkTheme = isSystemInDarkTheme()
Box(
modifier = Modifier
.fillMaxWidth()
.height(itemHeight)
.background(
Color.Transparent
)
.clickable(
interactionSource = remember { MutableInteractionSource() },
indication = null
) {
onOptionSelected(text)
onDismissRequest()
}
.hazeEffect(
state = hazeState,
style = CupertinoMaterials.regular(),
block = fun HazeEffectScope.() {
alpha = 1f
backgroundColor = if (isSystemInDarkTheme) {
Color(0xB02C2C2E)
} else {
Color(0xB0FFFFFF)
}
tints = if (isHovered) listOf(
HazeTint(
color = if (isSystemInDarkTheme) Color(0x338A8A8A) else Color(0x40D9D9D9)
)
) else listOf()
})
.padding(horizontal = 12.dp),
contentAlignment = Alignment.CenterStart
) {
Row(
modifier = Modifier.fillMaxWidth(),
horizontalArrangement = Arrangement.SpaceBetween,
verticalAlignment = Alignment.CenterVertically
) {
Text(
text,
style = TextStyle(
fontSize = 16.sp,
color = if (isSystemInDarkTheme()) Color.White else Color.Black.copy(alpha = 0.75f),
fontFamily = FontFamily(Font(R.font.sf_pro))
)
)
Checkbox(
checked = text == selectedOption,
onCheckedChange = { onOptionSelected(text) },
colors = CheckboxDefaults.colors().copy(
checkedCheckmarkColor = Color(0xFF007AFF),
uncheckedCheckmarkColor = Color.Transparent,
checkedBoxColor = Color.Transparent,
uncheckedBoxColor = Color.Transparent,
checkedBorderColor = Color.Transparent,
uncheckedBorderColor = Color.Transparent,
disabledBorderColor = Color.Transparent,
disabledCheckedBoxColor = Color.Transparent,
disabledUncheckedBoxColor = Color.Transparent,
disabledUncheckedBorderColor = Color.Transparent
)
)
}
}
if (index != options.lastIndex) {
HorizontalDivider(
thickness = 1.dp,
color = Color(0x40888888),
modifier = Modifier.padding(start = 12.dp, end = 0.dp)
)
}
}
}
}
}
}
}
}

View File

@@ -0,0 +1,260 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.composables
import android.graphics.RuntimeShader
import android.os.Build
import androidx.compose.animation.core.Animatable
import androidx.compose.animation.core.VectorConverter
import androidx.compose.animation.core.VisibilityThreshold
import androidx.compose.animation.core.spring
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.layout.size
import androidx.compose.foundation.shape.RoundedCornerShape
import androidx.compose.material3.Text
import androidx.compose.material3.TextButton
import androidx.compose.runtime.Composable
import androidx.compose.runtime.getValue
import androidx.compose.runtime.mutableStateOf
import androidx.compose.runtime.remember
import androidx.compose.runtime.rememberCoroutineScope
import androidx.compose.runtime.setValue
import androidx.compose.ui.Modifier
import androidx.compose.ui.geometry.Offset
import androidx.compose.ui.graphics.BlendMode
import androidx.compose.ui.graphics.BlurEffect
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.graphics.ShaderBrush
import androidx.compose.ui.graphics.TileMode
import androidx.compose.ui.graphics.drawOutline
import androidx.compose.ui.graphics.drawscope.translate
import androidx.compose.ui.graphics.isSpecified
import androidx.compose.ui.graphics.layer.CompositingStrategy
import androidx.compose.ui.graphics.layer.drawLayer
import androidx.compose.ui.graphics.rememberGraphicsLayer
import androidx.compose.ui.graphics.toArgb
import androidx.compose.ui.input.pointer.pointerInput
import androidx.compose.ui.text.TextStyle
import androidx.compose.ui.text.font.Font
import androidx.compose.ui.text.font.FontFamily
import androidx.compose.ui.text.font.FontWeight
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.sp
import androidx.compose.ui.util.fastCoerceAtMost
import androidx.compose.ui.util.fastCoerceIn
import androidx.compose.ui.util.lerp
import com.kyant.backdrop.backdrops.LayerBackdrop
import com.kyant.backdrop.backdrops.rememberLayerBackdrop
import com.kyant.backdrop.drawBackdrop
import com.kyant.backdrop.effects.blur
import com.kyant.backdrop.effects.refractionWithDispersion
import com.kyant.backdrop.highlight.Highlight
import com.kyant.backdrop.shadow.Shadow
import kotlinx.coroutines.launch
import me.kavishdevar.librepods.R
import me.kavishdevar.librepods.utils.inspectDragGestures
import kotlin.math.abs
import kotlin.math.atan2
import kotlin.math.cos
import kotlin.math.sin
import kotlin.math.tanh
@Composable
fun StyledIconButton(
onClick: () -> Unit,
icon: String,
darkMode: Boolean,
tint: Color = Color.Unspecified,
backdrop: LayerBackdrop = rememberLayerBackdrop(),
modifier: Modifier = Modifier,
) {
val animationScope = rememberCoroutineScope()
val progressAnimationSpec = spring(0.5f, 300f, 0.001f)
val offsetAnimationSpec = spring(1f, 300f, Offset.VisibilityThreshold)
val progressAnimation = remember { Animatable(0f) }
val offsetAnimation = remember { Animatable(Offset.Zero, Offset.VectorConverter) }
var pressStartPosition by remember { mutableStateOf(Offset.Zero) }
val innerShadowLayer = rememberGraphicsLayer().apply {
compositingStrategy = CompositingStrategy.Offscreen
}
val interactiveHighlightShader = remember {
if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.TIRAMISU) {
RuntimeShader(
"""
uniform float2 size;
layout(color) uniform half4 color;
uniform float radius;
uniform float2 offset;
half4 main(float2 coord) {
float2 center = offset;
float dist = distance(coord, center);
float intensity = smoothstep(radius, radius * 0.5, dist);
return color * intensity;
}"""
)
} else {
null
}
}
val isDarkTheme = isSystemInDarkTheme()
TextButton(
onClick = onClick,
shape = RoundedCornerShape(56.dp),
modifier = modifier
.padding(horizontal = 12.dp)
.drawBackdrop(
backdrop = backdrop,
shape = { RoundedCornerShape(56.dp) },
highlight = { Highlight.Ambient.copy(alpha = if (isDarkTheme) 1f else 0f) },
shadow = {
Shadow(
radius = 12f.dp,
color = Color.Black.copy(if (isDarkTheme) 0.08f else 0.2f)
)
},
layerBlock = {
val width = size.width
val height = size.height
val progress = progressAnimation.value
val scale = lerp(1f, 1.5f, progress)
val maxOffset = size.minDimension
val initialDerivative = 0.05f
val offset = offsetAnimation.value
translationX = maxOffset * tanh(initialDerivative * offset.x / maxOffset)
translationY = maxOffset * tanh(initialDerivative * offset.y / maxOffset)
val maxDragScale = 0.1f
val offsetAngle = atan2(offset.y, offset.x)
scaleX =
scale +
maxDragScale * abs(cos(offsetAngle) * offset.x / size.maxDimension) *
(width / height).fastCoerceAtMost(1f)
scaleY =
scale +
maxDragScale * abs(sin(offsetAngle) * offset.y / size.maxDimension) *
(height / width).fastCoerceAtMost(1f)
},
onDrawSurface = {
val progress = progressAnimation.value.coerceIn(0f, 1f)
val shape = RoundedCornerShape(56.dp)
val outline = shape.createOutline(size, layoutDirection, this)
val innerShadowOffset = 4f.dp.toPx()
val innerShadowBlurRadius = 4f.dp.toPx()
innerShadowLayer.alpha = progress
innerShadowLayer.renderEffect =
BlurEffect(
innerShadowBlurRadius,
innerShadowBlurRadius,
TileMode.Decal
)
innerShadowLayer.record {
drawOutline(outline, Color.Black.copy(0.2f))
translate(0f, innerShadowOffset) {
drawOutline(
outline,
Color.Transparent,
blendMode = BlendMode.Clear
)
}
}
drawLayer(innerShadowLayer)
drawRect(
(if (isDarkTheme) Color(0xFFAFAFAF) else Color.White).copy(progress.coerceIn(0.15f, 0.35f))
)
},
onDrawFront = {
val progress = progressAnimation.value.fastCoerceIn(0f, 1f)
if (progress > 0f) {
if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.TIRAMISU && interactiveHighlightShader != null) {
drawRect(
Color.White.copy(0.1f * progress),
blendMode = BlendMode.Plus
)
interactiveHighlightShader.apply {
val offset = pressStartPosition + offsetAnimation.value
setFloatUniform("size", size.width, size.height)
setColorUniform("color", Color.White.copy(0.15f * progress).toArgb())
setFloatUniform("radius", size.maxDimension)
setFloatUniform(
"offset",
offset.x.fastCoerceIn(0f, size.width),
offset.y.fastCoerceIn(0f, size.height)
)
}
drawRect(
ShaderBrush(interactiveHighlightShader),
blendMode = BlendMode.Plus
)
} else {
drawRect(
Color.White.copy(0.25f * progress),
blendMode = BlendMode.Plus
)
}
}
},
effects = {
refractionWithDispersion(6f.dp.toPx(), size.height / 2f)
// blur(24f, TileMode.Decal)
},
)
.pointerInput(animationScope) {
val onDragStop: () -> Unit = {
animationScope.launch {
launch { progressAnimation.animateTo(0f, progressAnimationSpec) }
launch { offsetAnimation.animateTo(Offset.Zero, offsetAnimationSpec) }
}
}
inspectDragGestures(
onDragStart = { down ->
pressStartPosition = down.position
animationScope.launch {
launch { progressAnimation.animateTo(1f, progressAnimationSpec) }
launch { offsetAnimation.snapTo(Offset.Zero) }
}
},
onDragEnd = { onDragStop() },
onDragCancel = onDragStop
) { _, dragAmount ->
animationScope.launch {
offsetAnimation.snapTo(offsetAnimation.value + dragAmount)
}
}
}
.size(48.dp),
) {
Text(
text = icon,
style = TextStyle(
fontSize = 16.sp,
fontWeight = FontWeight.Normal,
color = if (tint.isSpecified) tint else if (darkMode) Color.White else Color.Black,
fontFamily = FontFamily(Font(R.font.sf_pro))
)
)
}
}

View File

@@ -0,0 +1,168 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.composables
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Box
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.Row
import androidx.compose.foundation.layout.Spacer
import androidx.compose.foundation.layout.fillMaxSize
import androidx.compose.foundation.layout.fillMaxWidth
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.shape.RoundedCornerShape
import androidx.compose.material3.Scaffold
import androidx.compose.material3.SnackbarHost
import androidx.compose.material3.SnackbarHostState
import androidx.compose.material3.Text
import androidx.compose.runtime.Composable
import androidx.compose.runtime.remember
import androidx.compose.ui.Alignment
import androidx.compose.ui.Modifier
import androidx.compose.ui.draw.clip
import androidx.compose.ui.draw.shadow
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.platform.LocalLayoutDirection
import androidx.compose.ui.text.TextStyle
import androidx.compose.ui.text.font.Font
import androidx.compose.ui.text.font.FontFamily
import androidx.compose.ui.text.font.FontWeight
import androidx.compose.ui.text.style.TextAlign
import androidx.compose.ui.unit.Dp
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.sp
import androidx.compose.ui.zIndex
import androidx.navigation.NavController
import com.kyant.backdrop.backdrops.LayerBackdrop
import com.kyant.backdrop.backdrops.layerBackdrop
import com.kyant.backdrop.backdrops.rememberLayerBackdrop
import dev.chrisbanes.haze.HazeProgressive
import dev.chrisbanes.haze.HazeState
import dev.chrisbanes.haze.HazeTint
import dev.chrisbanes.haze.hazeEffect
import dev.chrisbanes.haze.materials.ExperimentalHazeMaterialsApi
import dev.chrisbanes.haze.rememberHazeState
import me.kavishdevar.librepods.R
@ExperimentalHazeMaterialsApi
@Composable
fun StyledScaffold(
title: String,
actionButtons: List<@Composable (backdrop: LayerBackdrop) -> Unit> = emptyList(),
snackbarHostState: SnackbarHostState = remember { SnackbarHostState() },
content: @Composable (spacerValue: Dp, hazeState: HazeState) -> Unit
) {
val isDarkTheme = isSystemInDarkTheme()
val hazeState = rememberHazeState(blurEnabled = true)
Scaffold(
containerColor = if (isDarkTheme) Color(0xFF000000) else Color(0xFFF2F2F7),
snackbarHost = { SnackbarHost(snackbarHostState) },
modifier = Modifier
.then(if (!isDarkTheme) Modifier.shadow(elevation = 36.dp, shape = RoundedCornerShape(52.dp), ambientColor = Color.Black, spotColor = Color.Black) else Modifier)
.clip(RoundedCornerShape(52.dp))
) { paddingValues ->
val topPadding = paddingValues.calculateTopPadding()
val bottomPadding = paddingValues.calculateBottomPadding()
val startPadding = paddingValues.calculateLeftPadding(LocalLayoutDirection.current)
val endPadding = paddingValues.calculateRightPadding(LocalLayoutDirection.current)
Box(
modifier = Modifier
.fillMaxSize()
.padding(start = startPadding, end = endPadding, bottom = bottomPadding)
) {
val backdrop = rememberLayerBackdrop()
Box(
modifier = Modifier
.zIndex(2f)
.height(64.dp + topPadding)
.fillMaxWidth()
.layerBackdrop(backdrop)
.hazeEffect(state = hazeState) {
tints = listOf(HazeTint(color = if (isDarkTheme) Color.Black else Color.White))
progressive = HazeProgressive.verticalGradient(startIntensity = 1f, endIntensity = 0f)
}
) {
Column(modifier = Modifier.fillMaxSize()) {
Spacer(modifier = Modifier.height(topPadding + 12.dp))
Text(
text = title,
style = TextStyle(
fontSize = 20.sp,
fontWeight = FontWeight.Medium,
color = if (isDarkTheme) Color.White else Color.Black,
fontFamily = FontFamily(Font(R.font.sf_pro))
),
modifier = Modifier.fillMaxWidth(),
textAlign = TextAlign.Center
)
}
}
Row(
modifier = Modifier
.zIndex(3f)
.padding(top = topPadding, end = 8.dp)
.align(Alignment.TopEnd)
) {
actionButtons.forEach { actionButton ->
actionButton(backdrop)
}
}
content(topPadding + 64.dp, hazeState)
}
}
}
@ExperimentalHazeMaterialsApi
@Composable
fun StyledScaffold(
title: String,
actionButtons: List<@Composable (backdrop: LayerBackdrop) -> Unit> = emptyList(),
snackbarHostState: SnackbarHostState = remember { SnackbarHostState() },
content: @Composable () -> Unit
) {
StyledScaffold(
title = title,
actionButtons = actionButtons,
snackbarHostState = snackbarHostState,
) { _, _ ->
content()
}
}
@ExperimentalHazeMaterialsApi
@Composable
fun StyledScaffold(
title: String,
actionButtons: List<@Composable (backdrop: LayerBackdrop) -> Unit> = emptyList(),
snackbarHostState: SnackbarHostState = remember { SnackbarHostState() },
content: @Composable (spacerValue: Dp) -> Unit
) {
StyledScaffold(
title = title,
actionButtons = actionButtons,
snackbarHostState = snackbarHostState,
) { spacerValue, _ ->
content(spacerValue)
}
}

View File

@@ -0,0 +1,184 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.composables
import androidx.compose.animation.animateColorAsState
import androidx.compose.animation.core.animateFloatAsState
import androidx.compose.animation.core.tween
import androidx.compose.foundation.background
import androidx.compose.foundation.gestures.detectTapGestures
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Arrangement
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.Row
import androidx.compose.foundation.layout.fillMaxWidth
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.layout.wrapContentWidth
import androidx.compose.foundation.shape.RoundedCornerShape
import androidx.compose.material3.HorizontalDivider
import androidx.compose.material3.Icon
import androidx.compose.material3.Text
import androidx.compose.runtime.Composable
import androidx.compose.runtime.getValue
import androidx.compose.runtime.mutableStateOf
import androidx.compose.runtime.remember
import androidx.compose.runtime.setValue
import androidx.compose.ui.Alignment
import androidx.compose.ui.Modifier
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.input.pointer.pointerInput
import androidx.compose.ui.res.painterResource
import androidx.compose.ui.text.TextStyle
import androidx.compose.ui.text.font.Font
import androidx.compose.ui.text.font.FontFamily
import androidx.compose.ui.text.font.FontWeight
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.sp
import me.kavishdevar.librepods.R
data class SelectItem(
val name: String,
val description: String? = null,
val iconRes: Int? = null,
val selected: Boolean,
val onClick: () -> Unit,
val enabled: Boolean = true
)
data class SelectItem2(
val name: String,
val description: String? = null,
val iconRes: Int? = null,
val selected: () -> Boolean,
val onClick: () -> Unit,
val enabled: Boolean = true
)
@Composable
fun StyledSelectList(
items: List<SelectItem>,
modifier: Modifier = Modifier
) {
val isDarkTheme = isSystemInDarkTheme()
val backgroundColor = if (isDarkTheme) Color(0xFF1C1C1E) else Color(0xFFFFFFFF)
val textColor = if (isDarkTheme) Color.White else Color.Black
Column(
modifier = modifier
.fillMaxWidth()
.background(backgroundColor, RoundedCornerShape(28.dp)),
horizontalAlignment = Alignment.CenterHorizontally
) {
val visibleItems = items.filter { it.enabled }
visibleItems.forEachIndexed { index, item ->
val isFirst = index == 0
val isLast = index == visibleItems.size - 1
val hasIcon = item.iconRes != null
val shape = when {
isFirst -> RoundedCornerShape(topStart = 28.dp, topEnd = 28.dp)
isLast -> RoundedCornerShape(bottomStart = 28.dp, bottomEnd = 28.dp)
else -> RoundedCornerShape(0.dp)
}
var itemBackgroundColor by remember { mutableStateOf(backgroundColor) }
val animatedBackgroundColor by animateColorAsState(targetValue = itemBackgroundColor, animationSpec = tween(durationMillis = 500))
Row(
modifier = Modifier
.height(if (hasIcon) 72.dp else 55.dp)
.background(animatedBackgroundColor, shape)
.pointerInput(Unit) {
detectTapGestures(
onPress = {
itemBackgroundColor = if (isDarkTheme) Color(0x40888888) else Color(0x40D9D9D9)
tryAwaitRelease()
itemBackgroundColor = backgroundColor
item.onClick()
}
)
}
.padding(horizontal = 16.dp),
verticalAlignment = Alignment.CenterVertically,
horizontalArrangement = Arrangement.SpaceBetween
) {
if (hasIcon) {
Icon(
painter = painterResource(item.iconRes!!),
contentDescription = "Icon",
tint = Color(0xFF007AFF),
modifier = Modifier
.height(48.dp)
.wrapContentWidth()
)
}
Column(
modifier = Modifier
.weight(1f)
.padding(vertical = 2.dp)
.padding(start = if (hasIcon) 8.dp else 4.dp)
) {
Text(
item.name,
fontSize = 16.sp,
color = textColor,
fontFamily = FontFamily(Font(R.font.sf_pro)),
)
item.description?.let {
Text(
it,
fontSize = 14.sp,
color = textColor.copy(alpha = 0.6f),
fontFamily = FontFamily(Font(R.font.sf_pro)),
)
}
}
val floatAnimateState by animateFloatAsState(
targetValue = if (item.selected) 1f else 0f,
animationSpec = tween(durationMillis = 300)
)
Text(
text = "􀆅",
style = TextStyle(
fontSize = 20.sp,
fontFamily = FontFamily(Font(R.font.sf_pro)),
color = Color(0xFF007AFF).copy(alpha = floatAnimateState),
),
modifier = Modifier.padding(end = 4.dp)
)
}
if (!isLast) {
if (hasIcon) {
HorizontalDivider(
thickness = 1.dp,
color = Color(0x40888888),
modifier = Modifier.padding(start = 72.dp, end = 20.dp)
)
} else {
HorizontalDivider(
thickness = 1.dp,
color = Color(0x40888888),
modifier = Modifier.padding(start = 20.dp, end = 20.dp)
)
}
}
}
}
}

View File

@@ -0,0 +1,587 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.composables
import android.content.res.Configuration
import android.util.Log
import androidx.compose.animation.core.Animatable
import androidx.compose.animation.core.FiniteAnimationSpec
import androidx.compose.animation.core.spring
import androidx.compose.foundation.background
import androidx.compose.foundation.gestures.Orientation
import androidx.compose.foundation.gestures.draggable
import androidx.compose.foundation.gestures.rememberDraggableState
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Arrangement
import androidx.compose.foundation.layout.Box
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.Row
import androidx.compose.foundation.layout.Spacer
import androidx.compose.foundation.layout.fillMaxSize
import androidx.compose.foundation.layout.fillMaxWidth
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.heightIn
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.layout.size
import androidx.compose.foundation.shape.CircleShape
import androidx.compose.foundation.shape.RoundedCornerShape
import androidx.compose.material3.Text
import androidx.compose.runtime.Composable
import androidx.compose.runtime.MutableFloatState
import androidx.compose.runtime.derivedStateOf
import androidx.compose.runtime.getValue
import androidx.compose.runtime.mutableFloatStateOf
import androidx.compose.runtime.mutableStateOf
import androidx.compose.runtime.remember
import androidx.compose.runtime.rememberCoroutineScope
import androidx.compose.runtime.setValue
import androidx.compose.ui.Alignment
import androidx.compose.ui.Modifier
import androidx.compose.ui.draw.clip
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.graphics.graphicsLayer
import androidx.compose.ui.input.pointer.pointerInput
import androidx.compose.ui.input.pointer.util.VelocityTracker
import androidx.compose.ui.input.pointer.util.addPointerInputChange
import androidx.compose.ui.layout.layout
import androidx.compose.ui.layout.onGloballyPositioned
import androidx.compose.ui.layout.onSizeChanged
import androidx.compose.ui.layout.positionInParent
import androidx.compose.ui.platform.LocalDensity
import androidx.compose.ui.text.TextStyle
import androidx.compose.ui.text.font.Font
import androidx.compose.ui.text.font.FontFamily
import androidx.compose.ui.text.font.FontWeight
import androidx.compose.ui.tooling.preview.Preview
import androidx.compose.ui.unit.Velocity
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.sp
import androidx.compose.ui.util.fastCoerceIn
import androidx.compose.ui.util.fastRoundToInt
import androidx.compose.ui.util.lerp
import com.kyant.backdrop.Backdrop
import com.kyant.backdrop.backdrops.layerBackdrop
import com.kyant.backdrop.backdrops.rememberCombinedBackdrop
import com.kyant.backdrop.backdrops.rememberLayerBackdrop
import com.kyant.backdrop.drawBackdrop
import com.kyant.backdrop.effects.blur
import com.kyant.backdrop.effects.refractionWithDispersion
import com.kyant.backdrop.highlight.Highlight
import com.kyant.backdrop.shadow.InnerShadow
import com.kyant.backdrop.shadow.Shadow
import kotlinx.coroutines.CoroutineScope
import kotlinx.coroutines.launch
import me.kavishdevar.librepods.R
import me.kavishdevar.librepods.utils.inspectDragGestures
import kotlin.math.abs
import kotlin.math.roundToInt
@Composable
fun rememberMomentumAnimation(
maxScale: Float,
progressAnimationSpec: FiniteAnimationSpec<Float> =
spring(1f, 1000f, 0.01f),
velocityAnimationSpec: FiniteAnimationSpec<Float> =
spring(0.5f, 250f, 5f),
scaleXAnimationSpec: FiniteAnimationSpec<Float> =
spring(0.4f, 400f, 0.01f),
scaleYAnimationSpec: FiniteAnimationSpec<Float> =
spring(0.6f, 400f, 0.01f)
): MomentumAnimation {
val animationScope = rememberCoroutineScope()
return remember(
maxScale,
animationScope,
progressAnimationSpec,
velocityAnimationSpec,
scaleXAnimationSpec,
scaleYAnimationSpec
) {
MomentumAnimation(
maxScale = maxScale,
animationScope = animationScope,
progressAnimationSpec = progressAnimationSpec,
velocityAnimationSpec = velocityAnimationSpec,
scaleXAnimationSpec = scaleXAnimationSpec,
scaleYAnimationSpec = scaleYAnimationSpec
)
}
}
class MomentumAnimation(
val maxScale: Float,
private val animationScope: CoroutineScope,
private val progressAnimationSpec: FiniteAnimationSpec<Float>,
private val velocityAnimationSpec: FiniteAnimationSpec<Float>,
private val scaleXAnimationSpec: FiniteAnimationSpec<Float>,
private val scaleYAnimationSpec: FiniteAnimationSpec<Float>
) {
private val velocityTracker = VelocityTracker()
private val progressAnimation = Animatable(0f)
private val velocityAnimation = Animatable(0f)
private val scaleXAnimation = Animatable(1f)
private val scaleYAnimation = Animatable(1f)
val progress: Float get() = progressAnimation.value
val velocity: Float get() = velocityAnimation.value
val scaleX: Float get() = scaleXAnimation.value
val scaleY: Float get() = scaleYAnimation.value
var isDragging: Boolean by mutableStateOf(false)
private set
val modifier: Modifier = Modifier.pointerInput(Unit) {
inspectDragGestures(
onDragStart = {
isDragging = true
velocityTracker.resetTracking()
startPressingAnimation()
},
onDragEnd = { change ->
isDragging = false
val velocity = velocityTracker.calculateVelocity()
updateVelocity(velocity)
velocityTracker.addPointerInputChange(change)
velocityTracker.resetTracking()
endPressingAnimation()
settleVelocity()
},
onDragCancel = {
isDragging = false
velocityTracker.resetTracking()
endPressingAnimation()
settleVelocity()
}
) { change, _ ->
isDragging = true
velocityTracker.addPointerInputChange(change)
val velocity = velocityTracker.calculateVelocity()
updateVelocity(velocity)
}
}
private fun updateVelocity(velocity: Velocity) {
animationScope.launch { velocityAnimation.animateTo(velocity.x, velocityAnimationSpec) }
}
private fun settleVelocity() {
animationScope.launch { velocityAnimation.animateTo(0f, velocityAnimationSpec) }
}
fun startPressingAnimation() {
animationScope.launch {
launch { progressAnimation.animateTo(1f, progressAnimationSpec) }
launch { scaleXAnimation.animateTo(maxScale, scaleXAnimationSpec) }
launch { scaleYAnimation.animateTo(maxScale, scaleYAnimationSpec) }
}
}
fun endPressingAnimation() {
animationScope.launch {
launch { progressAnimation.animateTo(0f, progressAnimationSpec) }
launch { scaleXAnimation.animateTo(1f, scaleXAnimationSpec) }
launch { scaleYAnimation.animateTo(1f, scaleYAnimationSpec) }
}
}
}
@Composable
fun StyledSlider(
label: String? = null,
mutableFloatState: MutableFloatState,
onValueChange: (Float) -> Unit,
valueRange: ClosedFloatingPointRange<Float>,
backdrop: Backdrop = rememberLayerBackdrop(),
snapPoints: List<Float> = emptyList(),
snapThreshold: Float = 0.05f,
startIcon: String? = null,
endIcon: String? = null,
startLabel: String? = null,
endLabel: String? = null,
independent: Boolean = false,
description: String? = null
) {
val backgroundColor = if (isSystemInDarkTheme()) Color(0xFF1C1C1E) else Color(0xFFFFFFFF)
val isLightTheme = !isSystemInDarkTheme()
val accentColor =
if (isLightTheme) Color(0xFF0088FF)
else Color(0xFF0091FF)
val trackColor =
if (isLightTheme) Color(0xFF787878).copy(0.2f)
else Color(0xFF787880).copy(0.36f)
val labelTextColor = if (isLightTheme) Color.Black else Color.White
val fraction by remember {
derivedStateOf {
((mutableFloatState.floatValue - valueRange.start) / (valueRange.endInclusive - valueRange.start))
.fastCoerceIn(0f, 1f)
}
}
val sliderBackdrop = rememberLayerBackdrop()
val trackWidthState = remember { mutableFloatStateOf(0f) }
val trackPositionState = remember { mutableFloatStateOf(0f) }
val startIconWidthState = remember { mutableFloatStateOf(0f) }
val endIconWidthState = remember { mutableFloatStateOf(0f) }
val density = LocalDensity.current
val momentumAnimation = rememberMomentumAnimation(maxScale = 1.5f)
val content = @Composable {
Box(
Modifier
.fillMaxWidth(if (startIcon == null && endIcon == null) 0.95f else 1f)
) {
Box(
Modifier
.padding(vertical = 4.dp)
.layerBackdrop(sliderBackdrop)
.fillMaxWidth()
) {
Column(
modifier = Modifier
.fillMaxWidth(1f)
.padding(vertical = 12.dp),
horizontalAlignment = Alignment.CenterHorizontally,
) {
if (startLabel != null || endLabel != null) {
Row(
modifier = Modifier
.fillMaxWidth()
.padding(horizontal = 8.dp),
horizontalArrangement = Arrangement.SpaceBetween
) {
Text(
text = startLabel ?: "",
style = TextStyle(
fontSize = 16.sp,
fontWeight = FontWeight.Normal,
color = labelTextColor,
fontFamily = FontFamily(Font(R.font.sf_pro))
)
)
Text(
text = endLabel ?: "",
style = TextStyle(
fontSize = 16.sp,
fontWeight = FontWeight.Normal,
color = labelTextColor,
fontFamily = FontFamily(Font(R.font.sf_pro))
)
)
}
Spacer(modifier = Modifier.height(12.dp))
}
Column(
modifier = Modifier
.fillMaxWidth()
.padding(vertical = 4.dp)
.then(if (startIcon == null && endIcon == null) Modifier.padding(horizontal = 8.dp) else Modifier),
) {
Row(
verticalAlignment = Alignment.CenterVertically,
horizontalArrangement = Arrangement.spacedBy(0.dp)
) {
if (startIcon != null) {
Text(
text = startIcon,
style = TextStyle(
fontSize = 18.sp,
fontWeight = FontWeight.Normal,
color = accentColor,
fontFamily = FontFamily(Font(R.font.sf_pro))
),
modifier = Modifier
.padding(horizontal = 12.dp)
.onGloballyPositioned {
startIconWidthState.floatValue = it.size.width.toFloat()
}
)
}
Box(
Modifier
.weight(1f)
.onSizeChanged { trackWidthState.floatValue = it.width.toFloat() }
.onGloballyPositioned {
trackPositionState.floatValue =
it.positionInParent().y + it.size.height / 2f
}
) {
Box(
Modifier
.clip(RoundedCornerShape(28.dp))
.background(trackColor)
.height(6f.dp)
.fillMaxWidth()
)
Box(
Modifier
.clip(RoundedCornerShape(28.dp))
.background(accentColor)
.height(6f.dp)
.layout { measurable, constraints ->
val placeable = measurable.measure(constraints)
val fraction = fraction
val width =
(fraction * constraints.maxWidth).fastRoundToInt()
layout(width, placeable.height) {
placeable.place(0, 0)
}
}
)
}
if (endIcon != null) {
Text(
text = endIcon,
style = TextStyle(
fontSize = 18.sp,
fontWeight = FontWeight.Normal,
color = accentColor,
fontFamily = FontFamily(Font(R.font.sf_pro))
),
modifier = Modifier
.padding(horizontal = 12.dp)
.onGloballyPositioned {
endIconWidthState.floatValue = it.size.width.toFloat()
}
)
}
}
if (snapPoints.isNotEmpty() && startLabel != null && endLabel != null) Spacer(modifier = Modifier.height(4.dp))
Row(
modifier = Modifier
.fillMaxWidth(),
horizontalArrangement = Arrangement.Center
) {
if (snapPoints.isNotEmpty()) {
val trackWidth = if (startIcon != null && endIcon != null) trackWidthState.floatValue - with(density) { 6.dp.toPx() } * 2 else trackWidthState.floatValue- with(density) { 22.dp.toPx() }
val startOffset =
if (startIcon != null) startIconWidthState.floatValue + with(
density
) { 34.dp.toPx() } else with(density) { 14.dp.toPx() }
Box(
Modifier
.fillMaxWidth()
) {
snapPoints.forEach { point ->
val pointFraction =
((point - valueRange.start) / (valueRange.endInclusive - valueRange.start))
.fastCoerceIn(0f, 1f)
Box(
Modifier
.graphicsLayer {
translationX =
startOffset + pointFraction * trackWidth - 4.dp.toPx()
}
.size(2.dp)
.background(
trackColor,
CircleShape
)
)
}
}
}
}
}
}
}
Box(
Modifier
.graphicsLayer {
// val startOffset =
// if (startIcon != null) startIconWidthState.floatValue + with(density) { 24.dp.toPx() } else with(density) { 12.dp.toPx() }
// translationX =
// startOffset + fraction * trackWidthState.floatValue - size.width / 2f
val startOffset =
if (startIcon != null)
startIconWidthState.floatValue + with(density) { 24.dp.toPx() }
else
with(density) { 8.dp.toPx() }
translationX =
(startOffset + fraction * trackWidthState.floatValue - size.width / 2f)
.fastCoerceIn(
startOffset - size.width / 4f,
startOffset + trackWidthState.floatValue - size.width * 3f / 4f
)
translationY = if (startLabel != null || endLabel != null) trackPositionState.floatValue + with(density) { 26.dp.toPx() } + size.height / 2f else trackPositionState.floatValue + with(density) { 8.dp.toPx() }
}
.draggable(
rememberDraggableState { delta ->
val trackWidth = trackWidthState.floatValue
if (trackWidth > 0f) {
val targetFraction = fraction + delta / trackWidth
val targetValue =
lerp(valueRange.start, valueRange.endInclusive, targetFraction)
.fastCoerceIn(valueRange.start, valueRange.endInclusive)
val snappedValue = if (snapPoints.isNotEmpty()) snapIfClose(
targetValue,
snapPoints,
snapThreshold
) else targetValue
onValueChange(snappedValue)
}
},
Orientation.Horizontal,
startDragImmediately = true,
onDragStarted = {
// Remove this block as momentumAnimation handles pressing
},
onDragStopped = {
// Remove this block as momentumAnimation handles pressing
onValueChange((mutableFloatState.floatValue * 100).roundToInt() / 100f)
}
)
.then(momentumAnimation.modifier)
.drawBackdrop(
rememberCombinedBackdrop(backdrop, sliderBackdrop),
{ RoundedCornerShape(28.dp) },
highlight = {
val progress = momentumAnimation.progress
Highlight.Ambient.copy(alpha = progress)
},
shadow = {
Shadow(
radius = 4f.dp,
color = Color.Black.copy(0.05f)
)
},
innerShadow = {
val progress = momentumAnimation.progress
InnerShadow(
radius = 4f.dp * progress,
alpha = progress
)
},
layerBlock = {
scaleX = momentumAnimation.scaleX
scaleY = momentumAnimation.scaleY
val velocity = momentumAnimation.velocity / 5000f
scaleX /= 1f - (velocity * 0.75f).fastCoerceIn(-0.15f, 0.15f)
scaleY *= 1f - (velocity * 0.25f).fastCoerceIn(-0.15f, 0.15f)
},
onDrawSurface = {
val progress = momentumAnimation.progress
drawRect(Color.White.copy(alpha = 1f - progress))
},
effects = {
val progress = momentumAnimation.progress
blur(8f.dp.toPx() * (1f - progress))
refractionWithDispersion(
height = 6f.dp.toPx() * progress,
amount = size.height / 2f * progress
)
}
)
.size(40f.dp, 24f.dp)
)
}
}
if (independent) {
Column (
modifier = Modifier
.fillMaxWidth(),
verticalArrangement = Arrangement.spacedBy(2.dp)
) {
if (label != null) {
Text(
text = label,
style = TextStyle(
fontSize = 14.sp,
fontWeight = FontWeight.Bold,
color = labelTextColor.copy(alpha = 0.6f),
fontFamily = FontFamily(Font(R.font.sf_pro))
),
modifier = Modifier.padding(horizontal = 18.dp, vertical = 4.dp)
)
}
Box(
modifier = Modifier
.fillMaxWidth()
.background(backgroundColor, RoundedCornerShape(28.dp))
.padding(horizontal = 8.dp, vertical = 0.dp)
.heightIn(min = 58.dp),
contentAlignment = Alignment.Center
) {
content()
}
if (description != null) {
Text(
text = description,
style = TextStyle(
fontSize = 12.sp,
fontWeight = FontWeight.Light,
color = (if (isSystemInDarkTheme()) Color.White else Color.Black).copy(alpha = 0.6f),
fontFamily = FontFamily(Font(R.font.sf_pro))
),
modifier = Modifier
.padding(horizontal = 18.dp, vertical = 4.dp)
)
}
}
} else {
if (label != null) Log.w("StyledSlider", "Label is ignored when independent is false")
if (description != null) Log.w("StyledSlider", "Description is ignored when independent is false")
content()
}
}
private fun snapIfClose(value: Float, points: List<Float>, threshold: Float = 0.05f): Float {
val nearest = points.minByOrNull { abs(it - value) } ?: value
return if (abs(nearest - value) <= threshold) nearest else value
}
@Preview(uiMode = Configuration.UI_MODE_NIGHT_YES)
@Composable
fun StyledSliderPreview() {
val a = remember { mutableFloatStateOf(0.5f) }
Box(
Modifier
.background(if (isSystemInDarkTheme()) Color(0xFF000000) else Color(0xFFF0F0F0))
.padding(16.dp)
.fillMaxSize()
) {
Box (
Modifier.align(Alignment.Center)
)
{
StyledSlider(
mutableFloatState = a,
onValueChange = {
a.floatValue = it
},
valueRange = 0f..2f,
snapPoints = listOf(1f),
snapThreshold = 0.1f,
independent = true,
startIcon = "A",
endIcon = "B",
)
}
}
}

View File

@@ -0,0 +1,301 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.composables
import android.content.res.Configuration
import androidx.compose.animation.Animatable
import androidx.compose.animation.core.Animatable
import androidx.compose.animation.core.FastOutSlowInEasing
import androidx.compose.animation.core.spring
import androidx.compose.animation.core.tween
import androidx.compose.foundation.background
import androidx.compose.foundation.gestures.Orientation
import androidx.compose.foundation.gestures.draggable
import androidx.compose.foundation.gestures.rememberDraggableState
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Box
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.layout.width
import androidx.compose.foundation.shape.RoundedCornerShape
import androidx.compose.runtime.Composable
import androidx.compose.runtime.LaunchedEffect
import androidx.compose.runtime.derivedStateOf
import androidx.compose.runtime.getValue
import androidx.compose.runtime.mutableFloatStateOf
import androidx.compose.runtime.mutableStateOf
import androidx.compose.runtime.remember
import androidx.compose.runtime.rememberCoroutineScope
import androidx.compose.ui.Alignment
import androidx.compose.ui.Modifier
import androidx.compose.ui.draw.clip
import androidx.compose.ui.graphics.BlendMode
import androidx.compose.ui.graphics.BlurEffect
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.graphics.Paint
import androidx.compose.ui.graphics.TileMode
import androidx.compose.ui.graphics.drawOutline
import androidx.compose.ui.graphics.drawscope.drawIntoCanvas
import androidx.compose.ui.graphics.drawscope.scale
import androidx.compose.ui.graphics.drawscope.translate
import androidx.compose.ui.graphics.graphicsLayer
import androidx.compose.ui.graphics.layer.CompositingStrategy
import androidx.compose.ui.graphics.layer.drawLayer
import androidx.compose.ui.graphics.rememberGraphicsLayer
import androidx.compose.ui.layout.onSizeChanged
import androidx.compose.ui.platform.LocalDensity
import androidx.compose.ui.tooling.preview.Preview
import androidx.compose.ui.unit.dp
import androidx.compose.ui.util.fastCoerceIn
import androidx.compose.ui.util.lerp
import com.kyant.backdrop.backdrops.layerBackdrop
import com.kyant.backdrop.backdrops.rememberCombinedBackdrop
import com.kyant.backdrop.backdrops.rememberLayerBackdrop
import com.kyant.backdrop.drawBackdrop
import com.kyant.backdrop.effects.refractionWithDispersion
import com.kyant.backdrop.highlight.Highlight
import com.kyant.backdrop.shadow.Shadow
import kotlinx.coroutines.coroutineScope
import kotlinx.coroutines.launch
@Composable
fun StyledSwitch(
checked: Boolean,
onCheckedChange: (Boolean) -> Unit,
enabled: Boolean = true,
) {
val isDarkTheme = isSystemInDarkTheme()
val onColor = if (enabled) Color(0xFF34C759) else if (isDarkTheme) Color(0xFF5B5B5E) else Color(0xFFD1D1D6)
val offColor = if (enabled) if (isDarkTheme) Color(0xFF5B5B5E) else Color(0xFFD1D1D6) else if (isDarkTheme) Color(0xFF5B5B5E) else Color(0xFFD1D1D6)
val trackWidth = 64.dp
val trackHeight = 28.dp
val thumbHeight = 24.dp
val thumbWidth = 39.dp
val backdrop = rememberLayerBackdrop()
val switchBackdrop = rememberLayerBackdrop()
val fraction by remember {
derivedStateOf { if (checked) 1f else 0f }
}
val animatedFraction = remember { Animatable(fraction) }
val trackWidthPx = remember { mutableFloatStateOf(0f) }
val density = LocalDensity.current
val animationScope = rememberCoroutineScope()
val progressAnimationSpec = spring(0.5f, 300f, 0.001f)
val colorAnimationSpec = tween<Color>(200, easing = FastOutSlowInEasing)
val progressAnimation = remember { Animatable(0f) }
val innerShadowLayer = rememberGraphicsLayer().apply {
compositingStrategy = CompositingStrategy.Offscreen
}
val animatedTrackColor = remember { Animatable(if (checked) onColor else offColor) }
val totalDrag = remember { mutableFloatStateOf(0f) }
val tapThreshold = 10f
val isFirstComposition = remember { mutableStateOf(true) }
LaunchedEffect(checked) {
if (!isFirstComposition.value) {
coroutineScope {
launch {
val targetColor = if (checked) onColor else offColor
animatedTrackColor.animateTo(targetColor, colorAnimationSpec)
}
launch {
val targetFrac = if (checked) 1f else 0f
animatedFraction.animateTo(targetFrac, progressAnimationSpec)
}
if (progressAnimation.value > 0f) return@coroutineScope
launch {
progressAnimation.animateTo(1f, tween(175, easing = FastOutSlowInEasing))
progressAnimation.animateTo(0f, tween(175, easing = FastOutSlowInEasing))
}
}
}
isFirstComposition.value = false
}
Box(
modifier = Modifier
.width(trackWidth)
.height(trackHeight),
contentAlignment = Alignment.CenterStart
) {
Box(
modifier = Modifier
.layerBackdrop(switchBackdrop)
.clip(RoundedCornerShape(trackHeight / 2))
.background(animatedTrackColor.value)
.width(trackWidth)
.height(trackHeight)
.onSizeChanged { trackWidthPx.floatValue = it.width.toFloat() }
)
Box(
modifier = Modifier
.padding(horizontal = 2.dp)
.graphicsLayer {
translationX = animatedFraction.value * (trackWidthPx.floatValue - with(density) { thumbWidth.toPx() + 4.dp.toPx() })
}
.then(if (enabled) Modifier.draggable(
rememberDraggableState { delta ->
if (trackWidthPx.floatValue > 0f) {
val newFraction = (animatedFraction.value + delta / trackWidthPx.floatValue).fastCoerceIn(-0.3f, 1.3f)
animationScope.launch {
animatedFraction.snapTo(newFraction)
}
totalDrag.floatValue += kotlin.math.abs(delta)
val newChecked = newFraction >= 0.5f
if (newChecked != checked) {
onCheckedChange(newChecked)
}
}
},
Orientation.Horizontal,
startDragImmediately = true,
onDragStarted = {
totalDrag.floatValue = 0f
animationScope.launch {
progressAnimation.animateTo(1f, progressAnimationSpec)
}
},
onDragStopped = {
animationScope.launch {
if (totalDrag.floatValue < tapThreshold) {
val newChecked = !checked
onCheckedChange(newChecked)
val snappedFraction = if (newChecked) 1f else 0f
coroutineScope {
launch { progressAnimation.animateTo(0f, progressAnimationSpec) }
launch { animatedFraction.animateTo(snappedFraction, progressAnimationSpec) }
}
} else {
val snappedFraction = if (animatedFraction.value >= 0.5f) 1f else 0f
onCheckedChange(snappedFraction >= 0.5f)
coroutineScope {
launch { progressAnimation.animateTo(0f, progressAnimationSpec) }
launch { animatedFraction.animateTo(snappedFraction, progressAnimationSpec) }
}
}
}
}
) else Modifier)
.drawBackdrop(
rememberCombinedBackdrop(backdrop, switchBackdrop),
{ RoundedCornerShape(thumbHeight / 2) },
highlight = {
val progress = progressAnimation.value
Highlight.Ambient.copy(
alpha = progress
)
},
shadow = {
Shadow(
radius = 4f.dp,
color = Color.Black.copy(0.05f)
)
},
layerBlock = {
val progress = progressAnimation.value
val scale = lerp(1f, 1.5f, progress)
scaleX = scale
scaleY = scale
},
onDrawBackdrop = { drawScope ->
drawIntoCanvas { canvas ->
canvas.save()
canvas.drawRect(
left = 0f,
top = 0f,
right = size.width,
bottom = size.height,
paint = Paint().apply {
color = if (isDarkTheme) Color(0xFF1C1C1E) else Color(0xFFF2F2F7)
}
)
scale(0.7f) {
drawScope()
}
}
},
onDrawSurface = {
val progress = progressAnimation.value.fastCoerceIn(0f, 1f)
val shape = RoundedCornerShape(thumbHeight / 2)
val outline = shape.createOutline(size, layoutDirection, this)
val innerShadowOffset = 4f.dp.toPx()
val innerShadowBlurRadius = 4f.dp.toPx()
innerShadowLayer.alpha = progress
innerShadowLayer.renderEffect =
BlurEffect(
innerShadowBlurRadius,
innerShadowBlurRadius,
TileMode.Decal
)
innerShadowLayer.record {
drawOutline(outline, Color.Black.copy(0.2f))
translate(0f, innerShadowOffset) {
drawOutline(
outline,
Color.Transparent,
blendMode = BlendMode.Clear
)
}
}
drawLayer(innerShadowLayer)
drawRect(Color.White.copy(1f - progress))
},
effects = {
refractionWithDispersion(6f.dp.toPx(), size.height / 2f)
}
)
.width(thumbWidth)
.height(thumbHeight)
)
}
}
@Preview(uiMode = Configuration.UI_MODE_NIGHT_NO)
@Composable
fun StyledSwitchPreview() {
val isDarkTheme = isSystemInDarkTheme()
val backgroundColor = if (isDarkTheme) Color(0xFF1C1C1E) else Color(0xFFF2F2F7)
Box(
modifier = Modifier
.background(backgroundColor)
.width(100.dp)
.height(150.dp),
contentAlignment = Alignment.Center
) {
val checked = remember { mutableStateOf(true) }
StyledSwitch(
checked = checked.value,
onCheckedChange = {
checked.value = it
},
enabled = true,
)
// LaunchedEffect(Unit) {
// delay(1000)
// checked.value = false
// delay(1000)
// checked.value = true
// }
}
}

View File

@@ -0,0 +1,682 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
@file:OptIn(ExperimentalEncodingApi::class)
package me.kavishdevar.librepods.composables
import android.content.SharedPreferences
import android.util.Log
import androidx.compose.animation.animateColorAsState
import androidx.compose.animation.core.tween
import androidx.compose.foundation.background
import androidx.compose.foundation.clickable
import androidx.compose.foundation.gestures.detectTapGestures
import androidx.compose.foundation.interaction.MutableInteractionSource
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Box
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.Row
import androidx.compose.foundation.layout.Spacer
import androidx.compose.foundation.layout.fillMaxWidth
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.shape.RoundedCornerShape
import androidx.compose.material3.Text
import androidx.compose.runtime.Composable
import androidx.compose.runtime.DisposableEffect
import androidx.compose.runtime.LaunchedEffect
import androidx.compose.runtime.MutableState
import androidx.compose.runtime.getValue
import androidx.compose.runtime.mutableStateOf
import androidx.compose.runtime.remember
import androidx.compose.runtime.setValue
import androidx.compose.ui.Alignment
import androidx.compose.ui.Modifier
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.input.pointer.pointerInput
import androidx.compose.ui.platform.LocalContext
import androidx.compose.ui.text.TextStyle
import androidx.compose.ui.text.font.Font
import androidx.compose.ui.text.font.FontFamily
import androidx.compose.ui.text.font.FontWeight
import androidx.compose.ui.tooling.preview.Preview
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.sp
import androidx.core.content.edit
import me.kavishdevar.librepods.R
import me.kavishdevar.librepods.services.ServiceManager
import me.kavishdevar.librepods.utils.AACPManager
import me.kavishdevar.librepods.utils.ATTHandles
import kotlin.io.encoding.ExperimentalEncodingApi
@Composable
fun StyledToggle(
title: String? = null,
label: String,
description: String? = null,
checkedState: MutableState<Boolean> = remember { mutableStateOf(false) } ,
sharedPreferenceKey: String? = null,
sharedPreferences: SharedPreferences? = null,
independent: Boolean = true,
enabled: Boolean = true,
onCheckedChange: ((Boolean) -> Unit)? = null,
) {
val isDarkTheme = isSystemInDarkTheme()
val textColor = if (isDarkTheme) Color.White else Color.Black
var checked by checkedState
var backgroundColor by remember { mutableStateOf(if (isDarkTheme) Color(0xFF1C1C1E) else Color(0xFFFFFFFF)) }
val animatedBackgroundColor by animateColorAsState(targetValue = backgroundColor, animationSpec = tween(durationMillis = 500))
if (sharedPreferenceKey != null && sharedPreferences != null) {
checked = sharedPreferences.getBoolean(sharedPreferenceKey, checked)
}
fun cb() {
if (sharedPreferences != null) {
if (sharedPreferenceKey == null) {
Log.e("StyledToggle", "SharedPreferenceKey is null but SharedPreferences is provided.")
return
}
sharedPreferences.edit { putBoolean(sharedPreferenceKey, checked) }
}
onCheckedChange?.invoke(checked)
}
if (independent) {
Column(modifier = Modifier.padding(vertical = 8.dp)) {
if (title != null) {
Text(
text = title,
style = TextStyle(
fontSize = 14.sp,
fontWeight = FontWeight.Bold,
color = textColor.copy(alpha = 0.6f)
),
modifier = Modifier.padding(start = 16.dp, end = 16.dp, top = 8.dp, bottom = 4.dp)
)
}
Box(
modifier = Modifier
.background(animatedBackgroundColor, RoundedCornerShape(28.dp))
.padding(4.dp)
.pointerInput(Unit) {
detectTapGestures(
onPress = {
backgroundColor =
if (isDarkTheme) Color(0x40888888) else Color(0x40D9D9D9)
tryAwaitRelease()
backgroundColor =
if (isDarkTheme) Color(0xFF1C1C1E) else Color(0xFFFFFFFF)
},
onTap = {
if (enabled) {
checked = !checked
cb()
}
}
)
}
) {
Row(
modifier = Modifier
.fillMaxWidth()
.height(55.dp)
.padding(horizontal = 12.dp),
verticalAlignment = Alignment.CenterVertically
) {
Text(
text = label,
modifier = Modifier.weight(1f),
style = TextStyle(
fontSize = 16.sp,
fontFamily = FontFamily(Font(R.font.sf_pro)),
fontWeight = FontWeight.Normal,
color = textColor
)
)
StyledSwitch(
checked = checked,
enabled = enabled,
onCheckedChange = {
if (enabled) {
checked = it
cb()
}
}
)
}
}
if (description != null) {
Spacer(modifier = Modifier.height(8.dp))
Box(
modifier = Modifier
.padding(horizontal = 16.dp)
.background(if (isDarkTheme) Color(0xFF000000) else Color(0xFFF2F2F7))
) {
Text(
text = description,
style = TextStyle(
fontSize = 12.sp,
fontWeight = FontWeight.Light,
color = textColor.copy(alpha = 0.6f),
fontFamily = FontFamily(Font(R.font.sf_pro))
)
)
}
}
}
} else {
val isPressed = remember { mutableStateOf(false) }
Row(
modifier = Modifier
.fillMaxWidth()
.background(
shape = RoundedCornerShape(28.dp),
color = if (isPressed.value) Color(0xFFE0E0E0) else Color.Transparent
)
.padding(16.dp)
.pointerInput(Unit) {
detectTapGestures(
onPress = {
isPressed.value = true
tryAwaitRelease()
isPressed.value = false
}
)
}
.clickable(
indication = null,
interactionSource = remember { MutableInteractionSource() }
) {
if (enabled) {
checked = !checked
cb()
}
},
verticalAlignment = Alignment.CenterVertically
) {
Column(
modifier = Modifier
.weight(1f)
.padding(end = 4.dp)
) {
Text(
text = label,
style = TextStyle(
fontSize = 16.sp,
fontFamily = FontFamily(Font(R.font.sf_pro)),
fontWeight = FontWeight.Normal,
color = textColor
)
)
Spacer(modifier = Modifier.height(4.dp))
if (description != null) {
Text(
text = description,
style = TextStyle(
fontSize = 12.sp,
color = textColor.copy(0.6f),
fontFamily = FontFamily(Font(R.font.sf_pro)),
)
)
}
}
StyledSwitch(
checked = checked,
enabled = enabled,
onCheckedChange = {
if (enabled) {
checked = it
cb()
}
}
)
}
}
}
@Composable
fun StyledToggle(
title: String? = null,
label: String,
description: String? = null,
controlCommandIdentifier: AACPManager.Companion.ControlCommandIdentifiers,
independent: Boolean = true,
enabled: Boolean = true,
sharedPreferenceKey: String? = null,
sharedPreferences: SharedPreferences? = null,
onCheckedChange: ((Boolean) -> Unit)? = null,
) {
val service = ServiceManager.getService() ?: return
val isDarkTheme = isSystemInDarkTheme()
val textColor = if (isDarkTheme) Color.White else Color.Black
val checkedValue = service.aacpManager.controlCommandStatusList.find {
it.identifier == controlCommandIdentifier
}?.value?.takeIf { it.isNotEmpty() }?.get(0)
var checked by remember { mutableStateOf(checkedValue == 1.toByte()) }
var backgroundColor by remember { mutableStateOf(if (isDarkTheme) Color(0xFF1C1C1E) else Color(0xFFFFFFFF)) }
val animatedBackgroundColor by animateColorAsState(targetValue = backgroundColor, animationSpec = tween(durationMillis = 500))
if (sharedPreferenceKey != null && sharedPreferences != null) {
checked = sharedPreferences.getBoolean(sharedPreferenceKey, checked)
}
fun cb() {
service.aacpManager.sendControlCommand(identifier = controlCommandIdentifier.value, value = checked)
if (sharedPreferences != null) {
if (sharedPreferenceKey == null) {
Log.e("StyledToggle", "SharedPreferenceKey is null but SharedPreferences is provided.")
return
}
sharedPreferences.edit { putBoolean(sharedPreferenceKey, checked) }
}
onCheckedChange?.invoke(checked)
}
val listener = remember {
object : AACPManager.ControlCommandListener {
override fun onControlCommandReceived(controlCommand: AACPManager.ControlCommand) {
if (controlCommand.identifier == controlCommandIdentifier.value) {
Log.d("StyledToggle", "Received control command for $label: ${controlCommand.value}")
checked = controlCommand.value.takeIf { it.isNotEmpty() }?.get(0) == 1.toByte()
}
}
}
}
LaunchedEffect(Unit) {
service.aacpManager.registerControlCommandListener(controlCommandIdentifier, listener)
}
DisposableEffect(Unit) {
onDispose {
service.aacpManager.unregisterControlCommandListener(controlCommandIdentifier, listener)
}
}
if (independent) {
Column(modifier = Modifier.padding(vertical = 8.dp)) {
if (title != null) {
Text(
text = title,
style = TextStyle(
fontSize = 14.sp,
fontWeight = FontWeight.Bold,
color = textColor.copy(alpha = 0.6f)
),
modifier = Modifier.padding(start = 16.dp, end = 16.dp, top = 8.dp, bottom = 4.dp)
)
}
Box(
modifier = Modifier
.background(animatedBackgroundColor, RoundedCornerShape(28.dp))
.padding(4.dp)
.pointerInput(Unit) {
detectTapGestures(
onPress = {
backgroundColor =
if (isDarkTheme) Color(0x40888888) else Color(0x40D9D9D9)
tryAwaitRelease()
backgroundColor =
if (isDarkTheme) Color(0xFF1C1C1E) else Color(0xFFFFFFFF)
},
onTap = {
if (enabled) {
checked = !checked
cb()
}
}
)
}
) {
Row(
modifier = Modifier
.fillMaxWidth()
.height(55.dp)
.padding(horizontal = 12.dp),
verticalAlignment = Alignment.CenterVertically
) {
Text(
text = label,
modifier = Modifier.weight(1f),
style = TextStyle(
fontSize = 16.sp,
fontFamily = FontFamily(Font(R.font.sf_pro)),
fontWeight = FontWeight.Normal,
color = textColor
)
)
StyledSwitch(
checked = checked,
enabled = enabled,
onCheckedChange = {
if (enabled) {
checked = it
cb()
}
}
)
}
}
if (description != null) {
Spacer(modifier = Modifier.height(8.dp))
Box(
modifier = Modifier
.padding(horizontal = 16.dp)
.background(if (isDarkTheme) Color(0xFF000000) else Color(0xFFF2F2F7))
) {
Text(
text = description,
style = TextStyle(
fontSize = 12.sp,
fontWeight = FontWeight.Light,
color = textColor.copy(alpha = 0.6f),
fontFamily = FontFamily(Font(R.font.sf_pro))
)
)
}
}
}
} else {
val isPressed = remember { mutableStateOf(false) }
Row(
modifier = Modifier
.fillMaxWidth()
.background(
shape = RoundedCornerShape(28.dp),
color = if (isPressed.value) Color(0xFFE0E0E0) else Color.Transparent
)
.padding(16.dp)
.pointerInput(Unit) {
detectTapGestures(
onPress = {
isPressed.value = true
tryAwaitRelease()
isPressed.value = false
}
)
}
.clickable(
indication = null,
interactionSource = remember { MutableInteractionSource() }
) {
if (enabled) {
checked = !checked
cb()
}
},
verticalAlignment = Alignment.CenterVertically
) {
Column(
modifier = Modifier
.weight(1f)
.padding(end = 4.dp)
) {
Text(
text = label,
style = TextStyle(
fontSize = 16.sp,
fontFamily = FontFamily(Font(R.font.sf_pro)),
fontWeight = FontWeight.Normal,
color = textColor
)
)
Spacer(modifier = Modifier.height(4.dp))
if (description != null) {
Text(
text = description,
style = TextStyle(
fontSize = 12.sp,
color = textColor.copy(0.6f),
fontFamily = FontFamily(Font(R.font.sf_pro)),
)
)
}
}
StyledSwitch(
checked = checked,
enabled = enabled,
onCheckedChange = {
if (enabled) {
checked = it
cb()
}
}
)
}
}
}
@Composable
fun StyledToggle(
title: String? = null,
label: String,
description: String? = null,
attHandle: ATTHandles,
independent: Boolean = true,
enabled: Boolean = true,
sharedPreferenceKey: String? = null,
sharedPreferences: SharedPreferences? = null,
onCheckedChange: ((Boolean) -> Unit)? = null,
) {
val attManager = ServiceManager.getService()?.attManager ?: return
val isDarkTheme = isSystemInDarkTheme()
val textColor = if (isDarkTheme) Color.White else Color.Black
val checkedValue = attManager.read(attHandle).getOrNull(0)?.toInt()
var checked by remember { mutableStateOf(checkedValue !=0) }
var backgroundColor by remember { mutableStateOf(if (isDarkTheme) Color(0xFF1C1C1E) else Color(0xFFFFFFFF)) }
val animatedBackgroundColor by animateColorAsState(targetValue = backgroundColor, animationSpec = tween(durationMillis = 500))
attManager.enableNotifications(attHandle)
if (sharedPreferenceKey != null && sharedPreferences != null) {
checked = sharedPreferences.getBoolean(sharedPreferenceKey, checked)
}
fun cb() {
if (sharedPreferences != null) {
if (sharedPreferenceKey == null) {
Log.e("StyledToggle", "SharedPreferenceKey is null but SharedPreferences is provided.")
return
}
sharedPreferences.edit { putBoolean(sharedPreferenceKey, checked) }
}
onCheckedChange?.invoke(checked)
}
LaunchedEffect(checked) {
if (attManager.socket?.isConnected != true) return@LaunchedEffect
attManager.write(attHandle, if (checked) byteArrayOf(1) else byteArrayOf(0))
}
val listener = remember {
object : (ByteArray) -> Unit {
override fun invoke(value: ByteArray) {
if (value.isNotEmpty()) {
checked = value[0].toInt() != 0
Log.d("StyledToggle", "Updated from notification for $label: enabled=$checked")
} else {
Log.w("StyledToggle", "Empty value in notification for $label")
}
}
}
}
LaunchedEffect(Unit) {
attManager.registerListener(attHandle, listener)
}
DisposableEffect(Unit) {
onDispose {
attManager.unregisterListener(attHandle, listener)
}
}
if (independent) {
Column(modifier = Modifier.padding(vertical = 8.dp)) {
if (title != null) {
Text(
text = title,
style = TextStyle(
fontSize = 14.sp,
fontWeight = FontWeight.Bold,
color = textColor.copy(alpha = 0.6f)
),
modifier = Modifier.padding(start = 16.dp, end = 16.dp, top = 8.dp, bottom = 4.dp)
)
}
Box(
modifier = Modifier
.background(animatedBackgroundColor, RoundedCornerShape(28.dp))
.padding(4.dp)
.pointerInput(Unit) {
detectTapGestures(
onPress = {
backgroundColor =
if (isDarkTheme) Color(0x40888888) else Color(0x40D9D9D9)
tryAwaitRelease()
backgroundColor =
if (isDarkTheme) Color(0xFF1C1C1E) else Color(0xFFFFFFFF)
},
onTap = {
if (enabled) {
checked = !checked
cb()
}
}
)
}
) {
Row(
modifier = Modifier
.fillMaxWidth()
.height(55.dp)
.padding(horizontal = 12.dp),
verticalAlignment = Alignment.CenterVertically
) {
Text(
text = label,
modifier = Modifier.weight(1f),
style = TextStyle(
fontSize = 16.sp,
fontFamily = FontFamily(Font(R.font.sf_pro)),
fontWeight = FontWeight.Normal,
color = textColor
)
)
StyledSwitch(
checked = checked,
enabled = enabled,
onCheckedChange = {
if (enabled) {
checked = it
cb()
}
}
)
}
}
if (description != null) {
Spacer(modifier = Modifier.height(8.dp))
Box(
modifier = Modifier
.padding(horizontal = 16.dp)
.background(if (isDarkTheme) Color(0xFF000000) else Color(0xFFF2F2F7))
) {
Text(
text = description,
style = TextStyle(
fontSize = 12.sp,
fontWeight = FontWeight.Light,
color = textColor.copy(alpha = 0.6f),
fontFamily = FontFamily(Font(R.font.sf_pro))
)
)
}
}
}
} else {
val isPressed = remember { mutableStateOf(false) }
Row(
modifier = Modifier
.fillMaxWidth()
.background(
shape = RoundedCornerShape(28.dp),
color = if (isPressed.value) Color(0xFFE0E0E0) else Color.Transparent
)
.padding(16.dp)
.pointerInput(Unit) {
detectTapGestures(
onPress = {
isPressed.value = true
tryAwaitRelease()
isPressed.value = false
}
)
}
.clickable(
indication = null,
interactionSource = remember { MutableInteractionSource() }
) {
if (enabled) {
checked = !checked
cb()
}
},
verticalAlignment = Alignment.CenterVertically
) {
Column(
modifier = Modifier
.weight(1f)
.padding(end = 4.dp)
) {
Text(
text = label,
fontSize = 16.sp,
color = textColor
)
Spacer(modifier = Modifier.height(4.dp))
if (description != null) {
Text(
text = description,
fontSize = 12.sp,
color = textColor.copy(0.6f),
lineHeight = 14.sp,
)
}
}
StyledSwitch(
checked = checked,
enabled = enabled,
onCheckedChange = {
if (enabled) {
checked = it
cb()
}
}
)
}
}
}
@Preview
@Composable
fun StyledTogglePreview() {
val context = LocalContext.current
val sharedPrefs = context.getSharedPreferences("preview", 0)
StyledToggle(
label = "Example Toggle",
description = "This is an example description for the styled toggle.",
sharedPreferences = sharedPrefs
)
}

View File

@@ -0,0 +1,190 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods Contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.composables
import androidx.compose.animation.core.Spring
import androidx.compose.animation.core.animateFloatAsState
import androidx.compose.animation.core.spring
import androidx.compose.foundation.background
import androidx.compose.foundation.gestures.Orientation
import androidx.compose.foundation.gestures.detectTapGestures
import androidx.compose.foundation.gestures.draggable
import androidx.compose.foundation.gestures.rememberDraggableState
import androidx.compose.foundation.layout.Box
import androidx.compose.foundation.layout.fillMaxHeight
import androidx.compose.foundation.layout.fillMaxWidth
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.offset
import androidx.compose.foundation.layout.width
import androidx.compose.foundation.shape.RoundedCornerShape
import androidx.compose.runtime.Composable
import androidx.compose.runtime.getValue
import androidx.compose.runtime.mutableFloatStateOf
import androidx.compose.runtime.mutableStateOf
import androidx.compose.runtime.remember
import androidx.compose.runtime.setValue
import androidx.compose.ui.Alignment
import androidx.compose.ui.Modifier
import androidx.compose.ui.draw.clip
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.input.pointer.pointerInput
import androidx.compose.ui.platform.LocalDensity
import androidx.compose.ui.unit.Dp
import androidx.compose.ui.unit.dp
import kotlin.math.abs
import kotlin.math.max
import kotlin.math.min
import kotlin.math.roundToInt
import kotlin.math.sign
@Composable
fun VerticalVolumeSlider(
displayFraction: Float,
maxVolume: Int,
onVolumeChange: (Int) -> Unit,
initialFraction: Float,
onDragStateChange: (Boolean) -> Unit,
modifier: Modifier = Modifier,
baseSliderHeight: Dp = 400.dp,
baseSliderWidth: Dp = 145.dp,
baseCornerRadius: Dp = 45.dp,
maxStretchFactor: Float = 1.15f,
minCompressionFactor: Float = 0.875f,
stretchSensitivity: Float = 1.0f,
compressionSensitivity: Float = 1.0f,
cornerRadiusChangeFactor: Float = 0.2f,
directionalStretchRatio: Float = 0.75f
) {
val trackColor = Color(0x593C3C3E)
val progressColor = Color.White
var dragFraction by remember { mutableFloatStateOf(initialFraction) }
var isDragging by remember { mutableStateOf(false) }
var rawDragPosition by remember { mutableFloatStateOf(initialFraction) }
var overscrollAmount by remember { mutableFloatStateOf(0f) }
val baseHeightPx = with(LocalDensity.current) { baseSliderHeight.toPx() }
val animatedProgress by animateFloatAsState(
targetValue = dragFraction.coerceIn(0f, 1f),
animationSpec = spring(
dampingRatio = Spring.DampingRatioLowBouncy,
stiffness = Spring.StiffnessMedium
),
label = "ProgressAnimation"
)
val animatedOverscroll by animateFloatAsState(
targetValue = overscrollAmount,
animationSpec = spring(
dampingRatio = Spring.DampingRatioMediumBouncy,
stiffness = Spring.StiffnessMediumLow
),
label = "OverscrollAnimation"
)
val maxOverscrollEffect = (maxStretchFactor - 1f).coerceAtLeast(0f)
val stretchMultiplier = stretchSensitivity
val compressionMultiplier = compressionSensitivity
val overscrollDirection = sign(animatedOverscroll)
val totalStretchAmount = (min(maxOverscrollEffect, abs(animatedOverscroll) * stretchMultiplier) * baseSliderHeight.value).dp
val offsetY = if (abs(animatedOverscroll) > 0.001f) {
val asymmetricOffset = totalStretchAmount * (directionalStretchRatio - 0.5f)
(-overscrollDirection * asymmetricOffset.value).dp
} else {
0.dp
}
val heightStretch = baseSliderHeight + totalStretchAmount
val widthCompression = baseSliderWidth * max(
minCompressionFactor,
1f - min(1f - minCompressionFactor, abs(animatedOverscroll) * compressionMultiplier)
)
val dynamicCornerRadius = baseCornerRadius * (1f - min(cornerRadiusChangeFactor, abs(animatedOverscroll) * cornerRadiusChangeFactor * 2f))
Box(
modifier = modifier,
contentAlignment = Alignment.Center
) {
Box(
modifier = Modifier
.height(heightStretch)
.width(widthCompression)
.offset(y = offsetY)
.clip(RoundedCornerShape(dynamicCornerRadius))
.background(trackColor)
.pointerInput(Unit) {
detectTapGestures { offset ->
val newFraction = 1f - (offset.y / size.height).coerceIn(0f, 1f)
dragFraction = newFraction
rawDragPosition = newFraction
overscrollAmount = 0f
val newVolume = (newFraction * maxVolume).roundToInt()
onVolumeChange(newVolume)
}
}
.draggable(
orientation = Orientation.Vertical,
state = rememberDraggableState { delta ->
rawDragPosition -= (delta / baseHeightPx)
dragFraction = rawDragPosition.coerceIn(0f, 1f)
overscrollAmount = when {
rawDragPosition > 1f -> min(1.0f, (rawDragPosition - 1f) * 2.0f)
rawDragPosition < 0f -> max(-1.0f, rawDragPosition * 2.0f)
else -> 0f
}
val newVolume = (dragFraction * maxVolume).roundToInt()
onVolumeChange(newVolume)
},
onDragStarted = {
isDragging = true
dragFraction = displayFraction
rawDragPosition = displayFraction
overscrollAmount = 0f
onDragStateChange(true)
},
onDragStopped = {
isDragging = false
overscrollAmount = 0f
rawDragPosition = dragFraction
onDragStateChange(false)
}
),
contentAlignment = Alignment.BottomCenter
) {
Box(
modifier = Modifier
.fillMaxWidth()
.fillMaxHeight(animatedProgress)
.background(progressColor)
)
}
}
}

View File

@@ -0,0 +1,265 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.constants
import android.os.Parcelable
import android.util.Log
import kotlinx.parcelize.Parcelize
enum class Enums(val value: ByteArray) {
NOISE_CANCELLATION(Capabilities.NOISE_CANCELLATION),
PREFIX(byteArrayOf(0x04, 0x00, 0x04, 0x00)),
SETTINGS(byteArrayOf(0x09, 0x00)),
NOISE_CANCELLATION_PREFIX(PREFIX.value + SETTINGS.value + NOISE_CANCELLATION.value),
CONVERSATION_AWARENESS_RECEIVE_PREFIX(PREFIX.value + byteArrayOf(0x4b, 0x00, 0x02, 0x00)),
}
object BatteryComponent {
const val LEFT = 4
const val RIGHT = 2
const val CASE = 8
}
object BatteryStatus {
const val CHARGING = 1
const val NOT_CHARGING = 2
const val DISCONNECTED = 4
}
@Parcelize
data class Battery(val component: Int, val level: Int, val status: Int) : Parcelable {
fun getComponentName(): String? {
return when (component) {
BatteryComponent.LEFT -> "LEFT"
BatteryComponent.RIGHT -> "RIGHT"
BatteryComponent.CASE -> "CASE"
else -> null
}
}
fun getStatusName(): String? {
return when (status) {
BatteryStatus.CHARGING -> "CHARGING"
BatteryStatus.NOT_CHARGING -> "NOT_CHARGING"
BatteryStatus.DISCONNECTED -> "DISCONNECTED"
else -> null
}
}
}
enum class NoiseControlMode {
OFF, NOISE_CANCELLATION, TRANSPARENCY, ADAPTIVE
}
class AirPodsNotifications {
companion object {
const val AIRPODS_CONNECTED = "me.kavishdevar.librepods.AIRPODS_CONNECTED"
const val AIRPODS_DATA = "me.kavishdevar.librepods.AIRPODS_DATA"
const val EAR_DETECTION_DATA = "me.kavishdevar.librepods.EAR_DETECTION_DATA"
const val ANC_DATA = "me.kavishdevar.librepods.ANC_DATA"
const val BATTERY_DATA = "me.kavishdevar.librepods.BATTERY_DATA"
const val CA_DATA = "me.kavishdevar.librepods.CA_DATA"
const val AIRPODS_DISCONNECTED = "me.kavishdevar.librepods.AIRPODS_DISCONNECTED"
const val AIRPODS_CONNECTION_DETECTED = "me.kavishdevar.librepods.AIRPODS_CONNECTION_DETECTED"
const val DISCONNECT_RECEIVERS = "me.kavishdevar.librepods.DISCONNECT_RECEIVERS"
}
class EarDetection {
private val notificationBit = Capabilities.EAR_DETECTION
private val notificationPrefix = Enums.PREFIX.value + notificationBit
var status: List<Byte> = listOf(0x01, 0x01)
fun setStatus(data: ByteArray) {
status = listOf(data[6], data[7])
}
fun isEarDetectionData(data: ByteArray): Boolean {
if (data.size != 8) {
return false
}
val prefixHex = notificationPrefix.joinToString("") { "%02x".format(it) }
val dataHex = data.joinToString("") { "%02x".format(it) }
return dataHex.startsWith(prefixHex)
}
}
class ANC {
private val notificationPrefix = Enums.NOISE_CANCELLATION_PREFIX.value
var status: Int = 1
private set
fun isANCData(data: ByteArray): Boolean {
if (data.size != 11) {
return false
}
val prefixHex = notificationPrefix.joinToString("") { "%02x".format(it) }
val dataHex = data.joinToString("") { "%02x".format(it) }
return dataHex.startsWith(prefixHex)
}
fun setStatus(data: ByteArray) {
when (data.size) {
// if the whole packet is given
11 -> {
status = data[7].toInt()
}
// if only the data is given
1 -> {
status = data[0].toInt()
}
// if the value of control command is given
4 -> {
status = data[0].toInt()
}
else -> {
Log.d("ANC", "Invalid ANC data size: ${data.size}")
}
}
}
val name: String =
when (status) {
1 -> "OFF"
2 -> "ON"
3 -> "TRANSPARENCY"
4 -> "ADAPTIVE"
else -> "UNKNOWN"
}
}
class BatteryNotification {
private var first: Battery = Battery(BatteryComponent.LEFT, 0, BatteryStatus.DISCONNECTED)
private var second: Battery = Battery(BatteryComponent.RIGHT, 0, BatteryStatus.DISCONNECTED)
private var case: Battery = Battery(BatteryComponent.CASE, 0, BatteryStatus.DISCONNECTED)
fun isBatteryData(data: ByteArray): Boolean {
if (data.joinToString("") { "%02x".format(it) }.startsWith("040004000400")) {
Log.d("BatteryNotification", "Battery data starts with 040004000400. Most likely is a battery packet.")
} else {
return false
}
if (data.size != 22) {
Log.d("BatteryNotification", "Battery data size is not 22, probably being used with Airpods with fewer or more battery count.")
return false
}
Log.d("BatteryNotification", data.joinToString("") { "%02x".format(it) }.startsWith("040004000400").toString())
return data.joinToString("") { "%02x".format(it) }.startsWith("040004000400")
}
fun setBatteryDirect(
leftLevel: Int,
leftCharging: Boolean,
rightLevel: Int,
rightCharging: Boolean,
caseLevel: Int,
caseCharging: Boolean
) {
first = Battery(BatteryComponent.LEFT, leftLevel, if (leftCharging) BatteryStatus.CHARGING else BatteryStatus.NOT_CHARGING)
second = Battery(BatteryComponent.RIGHT, rightLevel, if (rightCharging) BatteryStatus.CHARGING else BatteryStatus.NOT_CHARGING)
case = Battery(BatteryComponent.CASE, caseLevel, if (caseCharging) BatteryStatus.CHARGING else BatteryStatus.NOT_CHARGING)
}
fun setBattery(data: ByteArray) {
if (data.size != 22) {
return
}
// first = if (data[10].toInt() == BatteryStatus.DISCONNECTED) {
// Battery(first.component, first.level, data[10].toInt())
// } else {
// Battery(data[7].toInt(), data[9].toInt(), data[10].toInt())
// }
// second = if (data[15].toInt() == BatteryStatus.DISCONNECTED) {
// Battery(second.component, second.level, data[15].toInt())
// } else {
// Battery(data[12].toInt(), data[14].toInt(), data[15].toInt())
// }
// case = if (data[20].toInt() == BatteryStatus.DISCONNECTED && case.status != BatteryStatus.DISCONNECTED) {
// Battery(case.component, case.level, data[20].toInt())
// } else {
// Battery(data[17].toInt(), data[19].toInt(), data[20].toInt())
// }
// sometimes it shows battery as -1%, just skip all that and set it normally
first = Battery(
data[7].toInt(), data[9].toInt(), data[10].toInt()
)
second = Battery(
data[12].toInt(), data[14].toInt(), data[15].toInt()
)
case = Battery(
data[17].toInt(), data[19].toInt(), data[20].toInt()
)
}
fun getBattery(): List<Battery> {
val left = if (first.component == BatteryComponent.LEFT) first else second
val right = if (first.component == BatteryComponent.LEFT) second else first
return listOf(left, right, case)
}
}
class ConversationalAwarenessNotification {
@Suppress("PrivatePropertyName")
private val NOTIFICATION_PREFIX = Enums.CONVERSATION_AWARENESS_RECEIVE_PREFIX.value
var status: Byte = 0
private set
fun isConversationalAwarenessData(data: ByteArray): Boolean {
if (data.size != 10) {
return false
}
val prefixHex = NOTIFICATION_PREFIX.joinToString("") { "%02x".format(it) }
val dataHex = data.joinToString("") { "%02x".format(it) }
return dataHex.startsWith(prefixHex)
}
fun setData(data: ByteArray) {
status = data[9]
}
}
}
class Capabilities {
companion object {
val NOISE_CANCELLATION = byteArrayOf(0x0d)
val EAR_DETECTION = byteArrayOf(0x06)
}
}
fun isHeadTrackingData(data: ByteArray): Boolean {
if (data.size <= 60) return false
val prefixPattern = byteArrayOf(
0x04, 0x00, 0x04, 0x00, 0x17, 0x00, 0x00, 0x00,
0x10, 0x00
)
for (i in prefixPattern.indices) {
if (data[i] != prefixPattern[i]) return false
}
if (data[10] != 0x44.toByte() && data[10] != 0x45.toByte()) return false
if (data[11] != 0x00.toByte()) return false
return true
}

View File

@@ -0,0 +1,40 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.constants
import me.kavishdevar.librepods.utils.AACPManager
enum class StemAction {
PLAY_PAUSE,
PREVIOUS_TRACK,
NEXT_TRACK,
DIGITAL_ASSISTANT,
CYCLE_NOISE_CONTROL_MODES;
companion object {
fun fromString(action: String): StemAction? {
return entries.find { it.name == action }
}
val defaultActions: Map<AACPManager.Companion.StemPressType, StemAction> = mapOf(
AACPManager.Companion.StemPressType.SINGLE_PRESS to PLAY_PAUSE,
AACPManager.Companion.StemPressType.DOUBLE_PRESS to NEXT_TRACK,
AACPManager.Companion.StemPressType.TRIPLE_PRESS to PREVIOUS_TRACK,
AACPManager.Companion.StemPressType.LONG_PRESS to CYCLE_NOISE_CONTROL_MODES,
)
}
}

View File

@@ -0,0 +1,46 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
@file:OptIn(ExperimentalEncodingApi::class)
package me.kavishdevar.librepods.receivers
import android.content.BroadcastReceiver
import android.content.Context
import android.content.Intent
import kotlin.io.encoding.ExperimentalEncodingApi
import me.kavishdevar.librepods.services.AirPodsService
class BootReceiver: BroadcastReceiver() {
override fun onReceive(context: Context?, intent: Intent?) {
when (intent?.action) {
Intent.ACTION_MY_PACKAGE_REPLACED -> try { context?.startForegroundService(
Intent(
context,
AirPodsService::class.java
)
) } catch (e: Exception) { e.printStackTrace() }
Intent.ACTION_BOOT_COMPLETED -> try { context?.startForegroundService(
Intent(
context,
AirPodsService::class.java
)
) } catch (e: Exception) { e.printStackTrace() }
}
}
}

View File

@@ -0,0 +1,840 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.screens
import android.annotation.SuppressLint
import android.util.Log
import androidx.compose.foundation.background
import androidx.compose.foundation.gestures.detectDragGesturesAfterLongPress
import androidx.compose.foundation.gestures.detectTapGestures
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Arrangement
import androidx.compose.foundation.layout.Box
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.Row
import androidx.compose.foundation.layout.Spacer
import androidx.compose.foundation.layout.fillMaxSize
import androidx.compose.foundation.layout.fillMaxWidth
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.rememberScrollState
import androidx.compose.foundation.shape.RoundedCornerShape
import androidx.compose.foundation.verticalScroll
import androidx.compose.material3.ExperimentalMaterial3Api
import androidx.compose.material3.Text
import androidx.compose.runtime.Composable
import androidx.compose.runtime.DisposableEffect
import androidx.compose.runtime.LaunchedEffect
import androidx.compose.runtime.getValue
import androidx.compose.runtime.mutableFloatStateOf
import androidx.compose.runtime.mutableLongStateOf
import androidx.compose.runtime.mutableStateOf
import androidx.compose.runtime.remember
import androidx.compose.runtime.setValue
import androidx.compose.ui.Alignment
import androidx.compose.ui.Modifier
import androidx.compose.ui.draw.clip
import androidx.compose.ui.geometry.Offset
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.input.pointer.pointerInput
import androidx.compose.ui.layout.onGloballyPositioned
import androidx.compose.ui.layout.positionInParent
import androidx.compose.ui.platform.LocalDensity
import androidx.compose.ui.res.stringResource
import androidx.compose.ui.text.TextStyle
import androidx.compose.ui.text.font.Font
import androidx.compose.ui.text.font.FontFamily
import androidx.compose.ui.text.font.FontWeight
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.sp
import androidx.navigation.NavController
import com.kyant.backdrop.backdrops.layerBackdrop
import com.kyant.backdrop.backdrops.rememberLayerBackdrop
import dev.chrisbanes.haze.HazeState
import dev.chrisbanes.haze.hazeSource
import dev.chrisbanes.haze.materials.ExperimentalHazeMaterialsApi
import kotlinx.coroutines.CoroutineScope
import kotlinx.coroutines.Dispatchers
import kotlinx.coroutines.Job
import kotlinx.coroutines.delay
import kotlinx.coroutines.launch
import me.kavishdevar.librepods.R
import me.kavishdevar.librepods.composables.NavigationButton
import me.kavishdevar.librepods.composables.StyledDropdown
import me.kavishdevar.librepods.composables.StyledScaffold
import me.kavishdevar.librepods.composables.StyledSlider
import me.kavishdevar.librepods.composables.StyledToggle
import me.kavishdevar.librepods.services.ServiceManager
import me.kavishdevar.librepods.utils.AACPManager
import me.kavishdevar.librepods.utils.ATTHandles
import me.kavishdevar.librepods.utils.Capability
import me.kavishdevar.librepods.utils.RadareOffsetFinder
import kotlin.io.encoding.ExperimentalEncodingApi
private var phoneMediaDebounceJob: Job? = null
private var toneVolumeDebounceJob: Job? = null
private const val TAG = "AccessibilitySettings"
@SuppressLint("DefaultLocale")
@ExperimentalHazeMaterialsApi
@OptIn(ExperimentalMaterial3Api::class, ExperimentalEncodingApi::class)
@Composable
fun AccessibilitySettingsScreen(navController: NavController) {
val isDarkTheme = isSystemInDarkTheme()
val textColor = if (isDarkTheme) Color.White else Color.Black
val aacpManager = remember { ServiceManager.getService()?.aacpManager }
val isSdpOffsetAvailable =
remember { mutableStateOf(RadareOffsetFinder.isSdpOffsetAvailable()) }
val trackColor = if (isDarkTheme) Color(0xFFB3B3B3) else Color(0xFF929491)
val activeTrackColor = if (isDarkTheme) Color(0xFF007AFF) else Color(0xFF3C6DF5)
val thumbColor = if (isDarkTheme) Color(0xFFFFFFFF) else Color(0xFFFFFFFF)
val capabilities = remember { ServiceManager.getService()?.airpodsInstance?.model?.capabilities ?: emptySet<Capability>() }
val hearingAidEnabled = remember { mutableStateOf(
aacpManager?.controlCommandStatusList?.find { it.identifier == AACPManager.Companion.ControlCommandIdentifiers.HEARING_AID }?.value?.getOrNull(1) == 0x01.toByte() &&
aacpManager.controlCommandStatusList.find { it.identifier == AACPManager.Companion.ControlCommandIdentifiers.HEARING_ASSIST_CONFIG }?.value?.getOrNull(0) == 0x01.toByte()
) }
val hearingAidListener = remember {
object : AACPManager.ControlCommandListener {
override fun onControlCommandReceived(controlCommand: AACPManager.ControlCommand) {
if (controlCommand.identifier == AACPManager.Companion.ControlCommandIdentifiers.HEARING_AID.value ||
controlCommand.identifier == AACPManager.Companion.ControlCommandIdentifiers.HEARING_ASSIST_CONFIG.value) {
val aidStatus = aacpManager?.controlCommandStatusList?.find { it.identifier == AACPManager.Companion.ControlCommandIdentifiers.HEARING_AID }
val assistStatus = aacpManager?.controlCommandStatusList?.find { it.identifier == AACPManager.Companion.ControlCommandIdentifiers.HEARING_ASSIST_CONFIG }
hearingAidEnabled.value = (aidStatus?.value?.getOrNull(1) == 0x01.toByte()) && (assistStatus?.value?.getOrNull(0) == 0x01.toByte())
}
}
}
}
LaunchedEffect(Unit) {
aacpManager?.registerControlCommandListener(AACPManager.Companion.ControlCommandIdentifiers.HEARING_AID, hearingAidListener)
aacpManager?.registerControlCommandListener(AACPManager.Companion.ControlCommandIdentifiers.HEARING_ASSIST_CONFIG, hearingAidListener)
}
DisposableEffect(Unit) {
onDispose {
aacpManager?.unregisterControlCommandListener(AACPManager.Companion.ControlCommandIdentifiers.HEARING_AID, hearingAidListener)
aacpManager?.unregisterControlCommandListener(AACPManager.Companion.ControlCommandIdentifiers.HEARING_ASSIST_CONFIG, hearingAidListener)
}
}
val backdrop = rememberLayerBackdrop()
StyledScaffold(
title = stringResource(R.string.accessibility)
) { spacerHeight, hazeState ->
Column(
modifier = Modifier
.fillMaxSize()
.hazeSource(hazeState)
.layerBackdrop(backdrop)
.verticalScroll(rememberScrollState())
.padding(horizontal = 16.dp),
verticalArrangement = Arrangement.spacedBy(16.dp)
) {
Spacer(modifier = Modifier.height(spacerHeight))
val backgroundColor = if (isDarkTheme) Color(0xFF1C1C1E) else Color(0xFFFFFFFF)
val phoneMediaEQ = remember { mutableStateOf(FloatArray(8) { 0.5f }) }
val phoneEQEnabled = remember { mutableStateOf(false) }
val mediaEQEnabled = remember { mutableStateOf(false) }
val pressSpeedOptions = mapOf(
0.toByte() to "Default",
1.toByte() to "Slower",
2.toByte() to "Slowest"
)
val selectedPressSpeedValue =
aacpManager?.controlCommandStatusList?.find { it.identifier == AACPManager.Companion.ControlCommandIdentifiers.DOUBLE_CLICK_INTERVAL }?.value?.takeIf { it.isNotEmpty() }
?.get(0)
var selectedPressSpeed by remember {
mutableStateOf(
pressSpeedOptions[selectedPressSpeedValue] ?: pressSpeedOptions[0]
)
}
val selectedPressSpeedListener = object : AACPManager.ControlCommandListener {
override fun onControlCommandReceived(controlCommand: AACPManager.ControlCommand) {
if (controlCommand.identifier == AACPManager.Companion.ControlCommandIdentifiers.DOUBLE_CLICK_INTERVAL.value) {
val newValue = controlCommand.value.takeIf { it.isNotEmpty() }?.get(0)
selectedPressSpeed = pressSpeedOptions[newValue] ?: pressSpeedOptions[0]
}
}
}
LaunchedEffect(Unit) {
aacpManager?.registerControlCommandListener(
AACPManager.Companion.ControlCommandIdentifiers.DOUBLE_CLICK_INTERVAL,
selectedPressSpeedListener
)
}
DisposableEffect(Unit) {
onDispose {
aacpManager?.unregisterControlCommandListener(
AACPManager.Companion.ControlCommandIdentifiers.DOUBLE_CLICK_INTERVAL,
selectedPressSpeedListener
)
}
}
val pressAndHoldDurationOptions = mapOf(
0.toByte() to "Default",
1.toByte() to "Slower",
2.toByte() to "Slowest"
)
val selectedPressAndHoldDurationValue =
aacpManager?.controlCommandStatusList?.find { it.identifier == AACPManager.Companion.ControlCommandIdentifiers.CLICK_HOLD_INTERVAL }?.value?.takeIf { it.isNotEmpty() }
?.get(0)
var selectedPressAndHoldDuration by remember {
mutableStateOf(
pressAndHoldDurationOptions[selectedPressAndHoldDurationValue]
?: pressAndHoldDurationOptions[0]
)
}
val selectedPressAndHoldDurationListener = object : AACPManager.ControlCommandListener {
override fun onControlCommandReceived(controlCommand: AACPManager.ControlCommand) {
if (controlCommand.identifier == AACPManager.Companion.ControlCommandIdentifiers.CLICK_HOLD_INTERVAL.value) {
val newValue = controlCommand.value.takeIf { it.isNotEmpty() }?.get(0)
selectedPressAndHoldDuration =
pressAndHoldDurationOptions[newValue] ?: pressAndHoldDurationOptions[0]
}
}
}
LaunchedEffect(Unit) {
aacpManager?.registerControlCommandListener(
AACPManager.Companion.ControlCommandIdentifiers.CLICK_HOLD_INTERVAL,
selectedPressAndHoldDurationListener
)
}
DisposableEffect(Unit) {
onDispose {
aacpManager?.unregisterControlCommandListener(
AACPManager.Companion.ControlCommandIdentifiers.CLICK_HOLD_INTERVAL,
selectedPressAndHoldDurationListener
)
}
}
val volumeSwipeSpeedOptions = mapOf(
1.toByte() to "Default",
2.toByte() to "Longer",
3.toByte() to "Longest"
)
val selectedVolumeSwipeSpeedValue =
aacpManager?.controlCommandStatusList?.find { it.identifier == AACPManager.Companion.ControlCommandIdentifiers.VOLUME_SWIPE_INTERVAL }?.value?.takeIf { it.isNotEmpty() }
?.get(0)
var selectedVolumeSwipeSpeed by remember {
mutableStateOf(
volumeSwipeSpeedOptions[selectedVolumeSwipeSpeedValue]
?: volumeSwipeSpeedOptions[1]
)
}
val selectedVolumeSwipeSpeedListener = object : AACPManager.ControlCommandListener {
override fun onControlCommandReceived(controlCommand: AACPManager.ControlCommand) {
if (controlCommand.identifier == AACPManager.Companion.ControlCommandIdentifiers.VOLUME_SWIPE_INTERVAL.value) {
val newValue = controlCommand.value.takeIf { it.isNotEmpty() }?.get(0)
selectedVolumeSwipeSpeed =
volumeSwipeSpeedOptions[newValue] ?: volumeSwipeSpeedOptions[1]
}
}
}
LaunchedEffect(Unit) {
aacpManager?.registerControlCommandListener(
AACPManager.Companion.ControlCommandIdentifiers.VOLUME_SWIPE_INTERVAL,
selectedVolumeSwipeSpeedListener
)
}
DisposableEffect(Unit) {
onDispose {
aacpManager?.unregisterControlCommandListener(
AACPManager.Companion.ControlCommandIdentifiers.VOLUME_SWIPE_INTERVAL,
selectedVolumeSwipeSpeedListener
)
}
}
LaunchedEffect(phoneMediaEQ.value, phoneEQEnabled.value, mediaEQEnabled.value) {
phoneMediaDebounceJob?.cancel()
phoneMediaDebounceJob = CoroutineScope(Dispatchers.IO).launch {
delay(150)
val manager = ServiceManager.getService()?.aacpManager
if (manager == null) {
Log.w(TAG, "Cannot write EQ: AACPManager not available")
return@launch
}
try {
val phoneByte = if (phoneEQEnabled.value) 0x01.toByte() else 0x02.toByte()
val mediaByte = if (mediaEQEnabled.value) 0x01.toByte() else 0x02.toByte()
Log.d(
TAG,
"Sending phone/media EQ (phoneEnabled=${phoneEQEnabled.value}, mediaEnabled=${mediaEQEnabled.value})"
)
manager.sendPhoneMediaEQ(phoneMediaEQ.value, phoneByte, mediaByte)
} catch (e: Exception) {
Log.w(TAG, "Error sending phone/media EQ: ${e.message}")
}
}
}
val toneVolumeValue = remember { mutableFloatStateOf(
aacpManager?.controlCommandStatusList?.find {
it.identifier == AACPManager.Companion.ControlCommandIdentifiers.CHIME_VOLUME
}?.value?.takeIf { it.isNotEmpty() }?.get(0)?.toFloat() ?: 75f
) }
LaunchedEffect(toneVolumeValue.floatValue) {
toneVolumeDebounceJob?.cancel()
toneVolumeDebounceJob = CoroutineScope(Dispatchers.IO).launch {
delay(150)
val manager = ServiceManager.getService()?.aacpManager
if (manager == null) {
Log.w(TAG, "Cannot write tone volume: AACPManager not available")
return@launch
}
try {
manager.sendControlCommand(
identifier = AACPManager.Companion.ControlCommandIdentifiers.CHIME_VOLUME.value,
value = byteArrayOf(toneVolumeValue.floatValue.toInt().toByte(), 0x50.toByte())
)
} catch (e: Exception) {
Log.w(TAG, "Error sending tone volume: ${e.message}")
}
}
}
DropdownMenuComponent(
label = stringResource(R.string.press_speed),
description = stringResource(R.string.press_speed_description),
options = pressSpeedOptions.values.toList(),
selectedOption = selectedPressSpeed?: "Default",
onOptionSelected = { newValue ->
selectedPressSpeed = newValue
aacpManager?.sendControlCommand(
identifier = AACPManager.Companion.ControlCommandIdentifiers.DOUBLE_CLICK_INTERVAL.value,
value = pressSpeedOptions.filterValues { it == newValue }.keys.firstOrNull()
?: 0.toByte()
)
},
textColor = textColor,
hazeState = hazeState,
independent = true
)
DropdownMenuComponent(
label = stringResource(R.string.press_and_hold_duration),
description = stringResource(R.string.press_and_hold_duration_description),
options = pressAndHoldDurationOptions.values.toList(),
selectedOption = selectedPressAndHoldDuration?: "Default",
onOptionSelected = { newValue ->
selectedPressAndHoldDuration = newValue
aacpManager?.sendControlCommand(
identifier = AACPManager.Companion.ControlCommandIdentifiers.CLICK_HOLD_INTERVAL.value,
value = pressAndHoldDurationOptions.filterValues { it == newValue }.keys.firstOrNull()
?: 0.toByte()
)
},
textColor = textColor,
hazeState = hazeState,
independent = true
)
StyledToggle(
title = stringResource(R.string.noise_control),
label = stringResource(R.string.noise_cancellation_single_airpod),
description = stringResource(R.string.noise_cancellation_single_airpod_description),
controlCommandIdentifier = AACPManager.Companion.ControlCommandIdentifiers.ONE_BUD_ANC_MODE,
independent = true,
)
if (capabilities.contains(Capability.LOUD_SOUND_REDUCTION)) {
StyledToggle(
label = stringResource(R.string.loud_sound_reduction),
description = stringResource(R.string.loud_sound_reduction_description),
attHandle = ATTHandles.LOUD_SOUND_REDUCTION
)
}
if (!hearingAidEnabled.value&& isSdpOffsetAvailable.value) {
NavigationButton(
to = "transparency_customization",
name = stringResource(R.string.customize_transparency_mode),
navController = navController
)
}
StyledSlider(
label = stringResource(R.string.tone_volume),
description = stringResource(R.string.tone_volume_description),
mutableFloatState = toneVolumeValue,
onValueChange = {
toneVolumeValue.floatValue = it
},
valueRange = 0f..100f,
snapPoints = listOf(75f),
startIcon = "\uDBC0\uDEA1",
endIcon = "\uDBC0\uDEA9",
independent = true
)
if (capabilities.contains(Capability.SWIPE_FOR_VOLUME)) {
StyledToggle(
label = stringResource(R.string.volume_control),
description = stringResource(R.string.volume_control_description),
controlCommandIdentifier = AACPManager.Companion.ControlCommandIdentifiers.VOLUME_SWIPE_MODE,
)
DropdownMenuComponent(
label = stringResource(R.string.volume_swipe_speed),
description = stringResource(R.string.volume_swipe_speed_description),
options = volumeSwipeSpeedOptions.values.toList(),
selectedOption = selectedVolumeSwipeSpeed?: "Default",
onOptionSelected = { newValue ->
selectedVolumeSwipeSpeed = newValue
aacpManager?.sendControlCommand(
identifier = AACPManager.Companion.ControlCommandIdentifiers.VOLUME_SWIPE_INTERVAL.value,
value = volumeSwipeSpeedOptions.filterValues { it == newValue }.keys.firstOrNull()
?: 1.toByte()
)
},
textColor = textColor,
hazeState = hazeState,
independent = true
)
}
if (!hearingAidEnabled.value&& isSdpOffsetAvailable.value) {
// Text(
// text = stringResource(R.string.apply_eq_to),
// style = TextStyle(
// fontSize = 14.sp,
// fontWeight = FontWeight.Bold,
// color = textColor.copy(alpha = 0.6f),
// fontFamily = FontFamily(Font(R.font.sf_pro))
// ),
// modifier = Modifier.padding(8.dp, bottom = 0.dp)
// )
// Column(
// modifier = Modifier
// .fillMaxWidth()
// .background(backgroundColor, RoundedCornerShape(28.dp))
// .padding(vertical = 0.dp)
// ) {
// val darkModeLocal = isSystemInDarkTheme()
//
// val phoneShape = RoundedCornerShape(topStart = 28.dp, topEnd = 28.dp)
// var phoneBackgroundColor by remember {
// mutableStateOf(
// if (darkModeLocal) Color(
// 0xFF1C1C1E
// ) else Color(0xFFFFFFFF)
// )
// }
// val phoneAnimatedBackgroundColor by animateColorAsState(
// targetValue = phoneBackgroundColor,
// animationSpec = tween(durationMillis = 500)
// )
//
// Row(
// modifier = Modifier
// .height(48.dp)
// .fillMaxWidth()
// .background(phoneAnimatedBackgroundColor, phoneShape)
// .pointerInput(Unit) {
// detectTapGestures(
// onPress = {
// phoneBackgroundColor =
// if (darkModeLocal) Color(0x40888888) else Color(0x40D9D9D9)
// tryAwaitRelease()
// phoneBackgroundColor =
// if (darkModeLocal) Color(0xFF1C1C1E) else Color(0xFFFFFFFF)
// phoneEQEnabled.value = !phoneEQEnabled.value
// }
// )
// }
// .padding(horizontal = 16.dp),
// verticalAlignment = Alignment.CenterVertically
// ) {
// Text(
// stringResource(R.string.phone),
// fontSize = 16.sp,
// color = textColor,
// fontFamily = FontFamily(Font(R.font.sf_pro)),
// modifier = Modifier.weight(1f)
// )
// Checkbox(
// checked = phoneEQEnabled.value,
// onCheckedChange = { phoneEQEnabled.value = it },
// colors = CheckboxDefaults.colors().copy(
// checkedCheckmarkColor = Color(0xFF007AFF),
// uncheckedCheckmarkColor = Color.Transparent,
// checkedBoxColor = Color.Transparent,
// uncheckedBoxColor = Color.Transparent,
// checkedBorderColor = Color.Transparent,
// uncheckedBorderColor = Color.Transparent
// ),
// modifier = Modifier
// .height(24.dp)
// .scale(1.5f)
// )
// }
//
// HorizontalDivider(
// thickness = 1.dp,
// color = Color(0x40888888)
// )
//
// val mediaShape = RoundedCornerShape(bottomStart = 28.dp, bottomEnd = 28.dp)
// var mediaBackgroundColor by remember {
// mutableStateOf(
// if (darkModeLocal) Color(
// 0xFF1C1C1E
// ) else Color(0xFFFFFFFF)
// )
// }
// val mediaAnimatedBackgroundColor by animateColorAsState(
// targetValue = mediaBackgroundColor,
// animationSpec = tween(durationMillis = 500)
// )
//
// Row(
// modifier = Modifier
// .height(48.dp)
// .fillMaxWidth()
// .background(mediaAnimatedBackgroundColor, mediaShape)
// .pointerInput(Unit) {
// detectTapGestures(
// onPress = {
// mediaBackgroundColor =
// if (darkModeLocal) Color(0x40888888) else Color(0x40D9D9D9)
// tryAwaitRelease()
// mediaBackgroundColor =
// if (darkModeLocal) Color(0xFF1C1C1E) else Color(0xFFFFFFFF)
// mediaEQEnabled.value = !mediaEQEnabled.value
// }
// )
// }
// .padding(horizontal = 16.dp),
// verticalAlignment = Alignment.CenterVertically
// ) {
// Text(
// stringResource(R.string.media),
// fontSize = 16.sp,
// color = textColor,
// fontFamily = FontFamily(Font(R.font.sf_pro)),
// modifier = Modifier.weight(1f)
// )
// Checkbox(
// checked = mediaEQEnabled.value,
// onCheckedChange = { mediaEQEnabled.value = it },
// colors = CheckboxDefaults.colors().copy(
// checkedCheckmarkColor = Color(0xFF007AFF),
// uncheckedCheckmarkColor = Color.Transparent,
// checkedBoxColor = Color.Transparent,
// uncheckedBoxColor = Color.Transparent,
// checkedBorderColor = Color.Transparent,
// uncheckedBorderColor = Color.Transparent
// ),
// modifier = Modifier
// .height(24.dp)
// .scale(1.5f)
// )
// }
// }
// EQ Settings. Don't seem to have an effect?
// Column(
// modifier = Modifier
// .fillMaxWidth()
// .background(backgroundColor, RoundedCornerShape(28.dp))
// .padding(12.dp),
// horizontalAlignment = Alignment.CenterHorizontally
// ) {
// for (i in 0 until 8) {
// val eqPhoneValue =
// remember(phoneMediaEQ.value[i]) { mutableFloatStateOf(phoneMediaEQ.value[i]) }
// Row(
// horizontalArrangement = Arrangement.SpaceBetween,
// verticalAlignment = Alignment.CenterVertically,
// modifier = Modifier
// .fillMaxWidth()
// .height(38.dp)
// ) {
// Text(
// text = String.format("%.2f", eqPhoneValue.floatValue),
// fontSize = 12.sp,
// color = textColor,
// modifier = Modifier.padding(bottom = 4.dp)
// )
// Slider(
// value = eqPhoneValue.floatValue,
// onValueChange = { newVal ->
// eqPhoneValue.floatValue = newVal
// val newEQ = phoneMediaEQ.value.copyOf()
// newEQ[i] = eqPhoneValue.floatValue
// phoneMediaEQ.value = newEQ
// },
// valueRange = 0f..100f,
// modifier = Modifier
// .fillMaxWidth(0.9f)
// .height(36.dp),
// colors = SliderDefaults.colors(
// thumbColor = thumbColor,
// activeTrackColor = activeTrackColor,
// inactiveTrackColor = trackColor
// ),
// thumb = {
// Box(
// modifier = Modifier
// .size(24.dp)
// .shadow(4.dp, CircleShape)
// .background(thumbColor, CircleShape)
// )
// },
// track = {
// Box(
// modifier = Modifier
// .fillMaxWidth()
// .height(12.dp),
// contentAlignment = Alignment.CenterStart
// )
// {
// Box(
// modifier = Modifier
// .fillMaxWidth()
// .height(4.dp)
// .background(trackColor, RoundedCornerShape(4.dp))
// )
// Box(
// modifier = Modifier
// .fillMaxWidth(eqPhoneValue.floatValue / 100f)
// .height(4.dp)
// .background(activeTrackColor, RoundedCornerShape(4.dp))
// )
// }
// }
// )
// Text(
// text = stringResource(R.string.band_label, i + 1),
// fontSize = 12.sp,
// color = textColor,
// modifier = Modifier.padding(top = 4.dp)
// )
// }
// }
// }
}
}
}
}
@ExperimentalHazeMaterialsApi
@Composable
private fun DropdownMenuComponent(
label: String,
options: List<String>,
selectedOption: String,
onOptionSelected: (String) -> Unit,
textColor: Color,
hazeState: HazeState,
description: String? = null,
independent: Boolean = true
) {
val density = LocalDensity.current
val itemHeightPx = with(density) { 48.dp.toPx() }
var expanded by remember { mutableStateOf(false) }
var touchOffset by remember { mutableStateOf<Offset?>(null) }
var boxPosition by remember { mutableStateOf(Offset.Zero) }
var lastDismissTime by remember { mutableLongStateOf(0L) }
var parentHoveredIndex by remember { mutableStateOf<Int?>(null) }
var parentDragActive by remember { mutableStateOf(false) }
Column(modifier = Modifier.fillMaxWidth()){
Column(
modifier = Modifier
.fillMaxWidth()
.then(
if (independent) {
if (description != null) {
Modifier.padding(top = 8.dp, bottom = 4.dp)
} else {
Modifier.padding(vertical = 8.dp)
}
} else Modifier
)
.background(
if (independent) (if (isSystemInDarkTheme()) Color(0xFF1C1C1E) else Color(0xFFFFFFFF)) else Color.Transparent,
if (independent) RoundedCornerShape(28.dp) else RoundedCornerShape(0.dp)
)
then(
if (independent) Modifier.padding(horizontal = 4.dp) else Modifier
)
.clip(if (independent) RoundedCornerShape(28.dp) else RoundedCornerShape(0.dp))
){
Row(
modifier = Modifier
.fillMaxWidth()
.padding(start = 12.dp, end = 12.dp)
.height(58.dp)
.pointerInput(Unit) {
detectTapGestures { offset ->
val now = System.currentTimeMillis()
if (expanded) {
expanded = false
lastDismissTime = now
} else {
if (now - lastDismissTime > 250L) {
touchOffset = offset
expanded = true
}
}
}
}
.pointerInput(Unit) {
detectDragGesturesAfterLongPress(
onDragStart = { offset ->
val now = System.currentTimeMillis()
touchOffset = offset
if (!expanded && now - lastDismissTime > 250L) {
expanded = true
}
lastDismissTime = now
parentDragActive = true
parentHoveredIndex = 0
},
onDrag = { change, _ ->
val current = change.position
val touch = touchOffset ?: current
val posInPopupY = current.y - touch.y
val idx = (posInPopupY / itemHeightPx).toInt()
parentHoveredIndex = idx
},
onDragEnd = {
parentDragActive = false
parentHoveredIndex?.let { idx ->
if (idx in options.indices) {
onOptionSelected(options[idx])
expanded = false
lastDismissTime = System.currentTimeMillis()
}
}
parentHoveredIndex = null
},
onDragCancel = {
parentDragActive = false
parentHoveredIndex = null
}
)
},
horizontalArrangement = Arrangement.SpaceBetween,
verticalAlignment = Alignment.CenterVertically
) {
Column(
modifier = Modifier.weight(1f)
){
Text(
text = label,
fontSize = 16.sp,
color = textColor,
modifier = Modifier.padding(bottom = 4.dp)
)
if (!independent && description != null){
Text(
text = description,
style = TextStyle(
fontSize = 12.sp,
fontWeight = FontWeight.Light,
color = textColor.copy(alpha = 0.6f),
fontFamily = FontFamily(Font(R.font.sf_pro))
),
modifier = Modifier.padding(16.dp, top = 0.dp, bottom = 2.dp)
)
}
}
Box(
modifier = Modifier.onGloballyPositioned { coordinates ->
boxPosition = coordinates.positionInParent()
}
) {
Row(
verticalAlignment = Alignment.CenterVertically
) {
Text(
text = selectedOption,
style = TextStyle(
fontSize = 16.sp,
color = textColor.copy(alpha = 0.8f),
fontFamily = FontFamily(Font(R.font.sf_pro))
)
)
Text(
text = "􀆏",
style = TextStyle(
fontSize = 16.sp,
color = textColor.copy(alpha = 0.6f),
fontFamily = FontFamily(Font(R.font.sf_pro))
),
modifier = Modifier
.padding(start = 6.dp)
)
}
StyledDropdown(
expanded = expanded,
onDismissRequest = {
expanded = false
lastDismissTime = System.currentTimeMillis()
},
options = options,
selectedOption = selectedOption,
touchOffset = touchOffset,
boxPosition = boxPosition,
externalHoveredIndex = parentHoveredIndex,
externalDragActive = parentDragActive,
onOptionSelected = { option ->
onOptionSelected(option)
expanded = false
},
hazeState = hazeState
)
}
}
}
if (independent && description != null){
Box(
modifier = Modifier
.fillMaxWidth()
.padding(horizontal = 16.dp)
.background(if (isSystemInDarkTheme()) Color(0xFF000000) else Color(0xFFF2F2F7))
){
Text(
text = description,
style = TextStyle(
fontSize = 12.sp,
fontWeight = FontWeight.Light,
color = (if (isSystemInDarkTheme()) Color.White else Color.Black).copy(alpha = 0.6f),
fontFamily = FontFamily(Font(R.font.sf_pro))
)
)
}
}
}
}

View File

@@ -0,0 +1,135 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.screens
import android.annotation.SuppressLint
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Arrangement
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.Spacer
import androidx.compose.foundation.layout.fillMaxSize
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.padding
import androidx.compose.material3.ExperimentalMaterial3Api
import androidx.compose.runtime.Composable
import androidx.compose.runtime.DisposableEffect
import androidx.compose.runtime.LaunchedEffect
import androidx.compose.runtime.mutableFloatStateOf
import androidx.compose.runtime.remember
import androidx.compose.ui.Modifier
import androidx.compose.ui.res.stringResource
import androidx.compose.ui.unit.dp
import androidx.navigation.NavController
import com.kyant.backdrop.backdrops.layerBackdrop
import com.kyant.backdrop.backdrops.rememberLayerBackdrop
import dev.chrisbanes.haze.materials.ExperimentalHazeMaterialsApi
import kotlinx.coroutines.CoroutineScope
import kotlinx.coroutines.Dispatchers
import kotlinx.coroutines.Job
import kotlinx.coroutines.delay
import kotlinx.coroutines.launch
import me.kavishdevar.librepods.R
import me.kavishdevar.librepods.composables.StyledIconButton
import me.kavishdevar.librepods.composables.StyledScaffold
import me.kavishdevar.librepods.composables.StyledSlider
import me.kavishdevar.librepods.services.ServiceManager
import me.kavishdevar.librepods.utils.AACPManager
import kotlin.io.encoding.ExperimentalEncodingApi
private var debounceJob: Job? = null
@SuppressLint("DefaultLocale")
@ExperimentalHazeMaterialsApi
@OptIn(ExperimentalMaterial3Api::class, ExperimentalEncodingApi::class)
@Composable
fun AdaptiveStrengthScreen(navController: NavController) {
val isDarkTheme = isSystemInDarkTheme()
val sliderValue = remember { mutableFloatStateOf(0f) }
val service = ServiceManager.getService()!!
LaunchedEffect(sliderValue) {
val sliderValueFromAACP = service.aacpManager.controlCommandStatusList.find {
it.identifier == AACPManager.Companion.ControlCommandIdentifiers.AUTO_ANC_STRENGTH
}?.value?.takeIf { it.isNotEmpty() }?.get(0)
sliderValueFromAACP?.toFloat()?.let { sliderValue.floatValue = (100 - it) }
}
val listener = remember {
object : AACPManager.ControlCommandListener {
override fun onControlCommandReceived(controlCommand: AACPManager.ControlCommand) {
if (controlCommand.identifier == AACPManager.Companion.ControlCommandIdentifiers.AUTO_ANC_STRENGTH.value) {
controlCommand.value.takeIf { it.isNotEmpty() }?.get(0)?.toFloat()?.let {
sliderValue.floatValue = (100 - it)
}
}
}
}
}
DisposableEffect(Unit) {
service.aacpManager.registerControlCommandListener(
AACPManager.Companion.ControlCommandIdentifiers.AUTO_ANC_STRENGTH,
listener
)
onDispose {
service.aacpManager.unregisterControlCommandListener(
AACPManager.Companion.ControlCommandIdentifiers.AUTO_ANC_STRENGTH,
listener
)
}
}
val backdrop = rememberLayerBackdrop()
StyledScaffold(
title = stringResource(R.string.customize_adaptive_audio)
) { spacerHeight ->
Column(
modifier = Modifier
.fillMaxSize()
.layerBackdrop(backdrop)
.padding(horizontal = 16.dp),
verticalArrangement = Arrangement.spacedBy(16.dp)
) {
Spacer(modifier = Modifier.height(spacerHeight))
StyledSlider(
label = stringResource(R.string.customize_adaptive_audio),
mutableFloatState = sliderValue,
onValueChange = {
sliderValue.floatValue = it
debounceJob?.cancel()
debounceJob = CoroutineScope(Dispatchers.Default).launch {
delay(300)
service.aacpManager.sendControlCommand(
AACPManager.Companion.ControlCommandIdentifiers.AUTO_ANC_STRENGTH.value,
(100 - it).toInt()
)
}
},
valueRange = 0f..100f,
snapPoints = listOf(0f, 50f, 100f),
startIcon = "􀊥",
endIcon = "􀊩",
independent = true,
description = stringResource(R.string.adaptive_audio_description)
)
}
}
}

View File

@@ -0,0 +1,451 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
@file:OptIn(ExperimentalEncodingApi::class)
package me.kavishdevar.librepods.screens
import android.annotation.SuppressLint
import android.bluetooth.BluetoothDevice
import android.content.BroadcastReceiver
import android.content.Context
import android.content.Context.MODE_PRIVATE
import android.content.Context.RECEIVER_EXPORTED
import android.content.Intent
import android.content.IntentFilter
import android.content.SharedPreferences
import android.os.Build
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Arrangement
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.Spacer
import androidx.compose.foundation.layout.fillMaxSize
import androidx.compose.foundation.layout.fillMaxWidth
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.lazy.LazyColumn
import androidx.compose.foundation.shape.RoundedCornerShape
import androidx.compose.material3.ExperimentalMaterial3Api
import androidx.compose.material3.SnackbarHostState
import androidx.compose.material3.Text
import androidx.compose.runtime.Composable
import androidx.compose.runtime.DisposableEffect
import androidx.compose.runtime.LaunchedEffect
import androidx.compose.runtime.getValue
import androidx.compose.runtime.mutableStateOf
import androidx.compose.runtime.remember
import androidx.compose.runtime.rememberCoroutineScope
import androidx.compose.runtime.setValue
import androidx.compose.ui.Alignment
import androidx.compose.ui.Modifier
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.platform.LocalContext
import androidx.compose.ui.res.stringResource
import androidx.compose.ui.text.TextStyle
import androidx.compose.ui.text.font.Font
import androidx.compose.ui.text.font.FontFamily
import androidx.compose.ui.text.font.FontWeight
import androidx.compose.ui.text.input.TextFieldValue
import androidx.compose.ui.text.style.TextAlign
import androidx.compose.ui.tooling.preview.Preview
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.sp
import androidx.core.content.edit
import androidx.core.net.toUri
import androidx.navigation.NavController
import androidx.navigation.compose.rememberNavController
import com.kyant.backdrop.backdrops.rememberLayerBackdrop
import com.kyant.backdrop.drawBackdrop
import com.kyant.backdrop.highlight.Highlight
import dev.chrisbanes.haze.HazeState
import dev.chrisbanes.haze.hazeSource
import dev.chrisbanes.haze.materials.ExperimentalHazeMaterialsApi
import kotlinx.coroutines.launch
import me.kavishdevar.librepods.R
import me.kavishdevar.librepods.composables.AboutCard
import me.kavishdevar.librepods.composables.AudioSettings
import me.kavishdevar.librepods.composables.BatteryView
import me.kavishdevar.librepods.composables.CallControlSettings
import me.kavishdevar.librepods.composables.ConfirmationDialog
import me.kavishdevar.librepods.composables.ConnectionSettings
import me.kavishdevar.librepods.composables.HearingHealthSettings
import me.kavishdevar.librepods.composables.MicrophoneSettings
import me.kavishdevar.librepods.composables.NavigationButton
import me.kavishdevar.librepods.composables.NoiseControlSettings
import me.kavishdevar.librepods.composables.PressAndHoldSettings
import me.kavishdevar.librepods.composables.StyledButton
import me.kavishdevar.librepods.composables.StyledIconButton
import me.kavishdevar.librepods.composables.StyledScaffold
import me.kavishdevar.librepods.composables.StyledToggle
import me.kavishdevar.librepods.constants.AirPodsNotifications
import me.kavishdevar.librepods.services.AirPodsService
import me.kavishdevar.librepods.ui.theme.LibrePodsTheme
import me.kavishdevar.librepods.utils.AACPManager
import me.kavishdevar.librepods.utils.Capability
import me.kavishdevar.librepods.utils.RadareOffsetFinder
import kotlin.io.encoding.ExperimentalEncodingApi
@OptIn(ExperimentalMaterial3Api::class, ExperimentalHazeMaterialsApi::class)
@SuppressLint("MissingPermission", "UnspecifiedRegisterReceiverFlag")
@Composable
fun AirPodsSettingsScreen(dev: BluetoothDevice?, service: AirPodsService,
navController: NavController, isConnected: Boolean, isRemotelyConnected: Boolean) {
var isLocallyConnected by remember { mutableStateOf(isConnected) }
var isRemotelyConnected by remember { mutableStateOf(isRemotelyConnected) }
val sharedPreferences = LocalContext.current.getSharedPreferences("settings", MODE_PRIVATE)
var device by remember { mutableStateOf(dev) }
var deviceName by remember {
mutableStateOf(
TextFieldValue(
sharedPreferences.getString("name", device?.name ?: "AirPods Pro").toString()
)
)
}
LaunchedEffect(service) {
isLocallyConnected = service.isConnectedLocally
}
val nameChangeListener = remember {
SharedPreferences.OnSharedPreferenceChangeListener { _, key ->
if (key == "name") {
deviceName = TextFieldValue(sharedPreferences.getString("name", "AirPods Pro").toString())
}
}
}
DisposableEffect(Unit) {
sharedPreferences.registerOnSharedPreferenceChangeListener(nameChangeListener)
onDispose {
sharedPreferences.unregisterOnSharedPreferenceChangeListener(nameChangeListener)
}
}
val snackbarHostState = remember { SnackbarHostState() }
val coroutineScope = rememberCoroutineScope()
fun handleRemoteConnection(connected: Boolean) {
isRemotelyConnected = connected
}
val context = LocalContext.current
val connectionReceiver = remember {
object : BroadcastReceiver() {
override fun onReceive(context: Context?, intent: Intent?) {
when (intent?.action) {
"me.kavishdevar.librepods.AIRPODS_CONNECTED_REMOTELY" -> {
coroutineScope.launch {
handleRemoteConnection(true)
}
}
"me.kavishdevar.librepods.AIRPODS_DISCONNECTED_REMOTELY" -> {
coroutineScope.launch {
handleRemoteConnection(false)
}
}
AirPodsNotifications.AIRPODS_CONNECTED -> {
coroutineScope.launch {
isLocallyConnected = true
}
}
AirPodsNotifications.AIRPODS_DISCONNECTED -> {
coroutineScope.launch {
isLocallyConnected = false
}
}
AirPodsNotifications.DISCONNECT_RECEIVERS -> {
try {
context?.unregisterReceiver(this)
} catch (e: IllegalArgumentException) {
e.printStackTrace()
}
}
}
}
}
}
DisposableEffect(Unit) {
val filter = IntentFilter().apply {
addAction("me.kavishdevar.librepods.AIRPODS_CONNECTED_REMOTELY")
addAction("me.kavishdevar.librepods.AIRPODS_DISCONNECTED_REMOTELY")
addAction(AirPodsNotifications.AIRPODS_CONNECTED)
addAction(AirPodsNotifications.AIRPODS_DISCONNECTED)
addAction(AirPodsNotifications.DISCONNECT_RECEIVERS)
}
if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.TIRAMISU) {
context.registerReceiver(connectionReceiver, filter, RECEIVER_EXPORTED)
} else {
context.registerReceiver(connectionReceiver, filter)
}
onDispose {
try {
context.unregisterReceiver(connectionReceiver)
} catch (e: Exception) {
e.printStackTrace()
}
}
}
LaunchedEffect(service) {
service.let {
it.sendBroadcast(Intent(AirPodsNotifications.BATTERY_DATA).apply {
putParcelableArrayListExtra("data", ArrayList(it.getBattery()))
})
it.sendBroadcast(Intent(AirPodsNotifications.ANC_DATA).apply {
putExtra("data", it.getANC())
})
}
}
val darkMode = isSystemInDarkTheme()
val hazeStateS = remember { mutableStateOf(HazeState()) }
val showDialog = remember { mutableStateOf(!sharedPreferences.getBoolean("donationDialogShown", false)) }
StyledScaffold(
title = deviceName.text,
actionButtons = listOf(
{scaffoldBackdrop ->
StyledIconButton(
onClick = { navController.navigate("app_settings") },
icon = "􀍟",
darkMode = darkMode,
backdrop = scaffoldBackdrop
)
}
),
snackbarHostState = snackbarHostState
) { spacerHeight, hazeState ->
hazeStateS.value = hazeState
if (isLocallyConnected || isRemotelyConnected) {
val instance = service.airpodsInstance
if (instance == null) {
Text("Error: AirPods instance is null")
return@StyledScaffold
}
val capabilities = instance.model.capabilities
LazyColumn(
modifier = Modifier
.fillMaxSize()
.hazeSource(hazeState)
.padding(horizontal = 16.dp)
) {
item(key = "spacer_top") { Spacer(modifier = Modifier.height(spacerHeight)) }
item(key = "battery") {
BatteryView(service = service)
}
item(key = "spacer_battery") { Spacer(modifier = Modifier.height(32.dp)) }
item(key = "name") {
NavigationButton(
to = "rename",
name = stringResource(R.string.name),
currentState = deviceName.text,
navController = navController,
independent = true
)
}
val actAsAppleDeviceHookEnabled = RadareOffsetFinder.isSdpOffsetAvailable()
if (actAsAppleDeviceHookEnabled) {
item(key = "spacer_hearing_health") { Spacer(modifier = Modifier.height(32.dp)) }
item(key = "hearing_health") {
HearingHealthSettings(navController = navController)
}
}
if (capabilities.contains(Capability.LISTENING_MODE)) {
item(key = "spacer_noise") { Spacer(modifier = Modifier.height(16.dp)) }
item(key = "noise_control") { NoiseControlSettings(service = service) }
}
if (capabilities.contains(Capability.STEM_CONFIG)) {
item(key = "spacer_press_hold") { Spacer(modifier = Modifier.height(16.dp)) }
item(key = "press_hold") { PressAndHoldSettings(navController = navController) }
}
item(key = "spacer_call") { Spacer(modifier = Modifier.height(16.dp)) }
item(key = "call_control") { CallControlSettings(hazeState = hazeState) }
if (capabilities.contains(Capability.STEM_CONFIG)) {
item(key = "spacer_camera") { Spacer(modifier = Modifier.height(16.dp)) }
item(key = "camera_control") { NavigationButton(to = "camera_control", name = stringResource(R.string.camera_remote), description = stringResource(R.string.camera_control_description), title = stringResource(R.string.camera_control), navController = navController) }
}
item(key = "spacer_audio") { Spacer(modifier = Modifier.height(16.dp)) }
item(key = "audio") { AudioSettings(navController = navController) }
item(key = "spacer_connection") { Spacer(modifier = Modifier.height(16.dp)) }
item(key = "connection") { ConnectionSettings() }
item(key = "spacer_microphone") { Spacer(modifier = Modifier.height(16.dp)) }
item(key = "microphone") { MicrophoneSettings(hazeState) }
if (capabilities.contains(Capability.SLEEP_DETECTION)) {
item(key = "spacer_sleep") { Spacer(modifier = Modifier.height(16.dp)) }
item(key = "sleep_detection") {
StyledToggle(
label = stringResource(R.string.sleep_detection),
controlCommandIdentifier = AACPManager.Companion.ControlCommandIdentifiers.SLEEP_DETECTION_CONFIG
)
}
}
if (capabilities.contains(Capability.HEAD_GESTURES)) {
item(key = "spacer_head_tracking") { Spacer(modifier = Modifier.height(16.dp)) }
item(key = "head_tracking") { NavigationButton(to = "head_tracking", name = stringResource(R.string.head_gestures), navController = navController, currentState = if (sharedPreferences.getBoolean("head_gestures", false)) stringResource(R.string.on) else stringResource(R.string.off)) }
}
item(key = "spacer_accessibility") { Spacer(modifier = Modifier.height(16.dp)) }
item(key = "accessibility") { NavigationButton(to = "accessibility", name = stringResource(R.string.accessibility), navController = navController) }
if (capabilities.contains(Capability.LOUD_SOUND_REDUCTION)){
item(key = "spacer_off_listening") { Spacer(modifier = Modifier.height(16.dp)) }
item(key = "off_listening") {
StyledToggle(
label = stringResource(R.string.off_listening_mode),
controlCommandIdentifier = AACPManager.Companion.ControlCommandIdentifiers.ALLOW_OFF_OPTION,
description = stringResource(R.string.off_listening_mode_description)
)
}
}
item(key = "spacer_about") { Spacer(modifier = Modifier.height(32.dp)) }
item(key = "about") { AboutCard(navController = navController) }
item(key = "spacer_debug") { Spacer(modifier = Modifier.height(16.dp)) }
item(key = "debug") { NavigationButton("debug", "Debug", navController) }
item(key = "spacer_bottom") { Spacer(Modifier.height(24.dp)) }
}
}
else {
val backdrop = rememberLayerBackdrop()
Column(
modifier = Modifier
.fillMaxSize()
.drawBackdrop(
backdrop = rememberLayerBackdrop(),
exportedBackdrop = backdrop,
shape = { RoundedCornerShape(0.dp) },
highlight = {
Highlight.Ambient.copy(alpha = 0f)
}
)
.hazeSource(hazeState)
.padding(horizontal = 8.dp),
horizontalAlignment = Alignment.CenterHorizontally,
verticalArrangement = Arrangement.Center
) {
Text(
text = stringResource(R.string.airpods_not_connected),
style = TextStyle(
fontSize = 24.sp,
fontWeight = FontWeight.Medium,
color = if (isSystemInDarkTheme()) Color.White else Color.Black,
fontFamily = FontFamily(Font(R.font.sf_pro))
),
textAlign = TextAlign.Center,
modifier = Modifier.fillMaxWidth()
)
Spacer(Modifier.height(24.dp))
Text(
text = stringResource(R.string.airpods_not_connected_description),
style = TextStyle(
fontSize = 16.sp,
fontWeight = FontWeight.Light,
color = if (isSystemInDarkTheme()) Color.White else Color.Black,
fontFamily = FontFamily(Font(R.font.sf_pro))
),
textAlign = TextAlign.Center,
modifier = Modifier.fillMaxWidth()
)
Spacer(Modifier.height(32.dp))
StyledButton(
onClick = { navController.navigate("troubleshooting") },
backdrop = backdrop,
modifier = Modifier
.fillMaxWidth(0.9f)
) {
Text(
text = "Troubleshoot Connection",
style = TextStyle(
fontSize = 16.sp,
fontWeight = FontWeight.Medium,
fontFamily = FontFamily(Font(R.font.sf_pro)),
color = if (isSystemInDarkTheme()) Color.White else Color.Black
)
)
}
Spacer(Modifier.height(16.dp))
StyledButton(
onClick = {
service.reconnectFromSavedMac()
},
backdrop = backdrop,
modifier = Modifier
.fillMaxWidth(0.9f)
) {
Text(
text = stringResource(R.string.reconnect_to_last_device),
style = TextStyle(
fontSize = 16.sp,
fontWeight = FontWeight.Medium,
fontFamily = FontFamily(Font(R.font.sf_pro)),
color = if (isSystemInDarkTheme()) Color.White else Color.Black
)
)
}
}
}
}
ConfirmationDialog(
showDialog = showDialog,
title = stringResource(R.string.support_librepods),
message = stringResource(R.string.support_dialog_description),
confirmText = stringResource(R.string.support_me) + " \uDBC0\uDEB5",
dismissText = stringResource(R.string.never_show_again),
onConfirm = {
val browserIntent = Intent(
Intent.ACTION_VIEW,
"https://github.com/sponsors/kavishdevar".toUri()
)
context.startActivity(browserIntent)
sharedPreferences.edit { putBoolean("donationDialogShown", true) }
},
onDismiss = {
sharedPreferences.edit { putBoolean("donationDialogShown", true) }
},
hazeState = hazeStateS.value,
)
}
@Preview
@Composable
fun AirPodsSettingsScreenPreview() {
Column (
modifier = Modifier.height(2000.dp)
) {
LibrePodsTheme (
darkTheme = true
) {
AirPodsSettingsScreen(dev = null, service = AirPodsService(), navController = rememberNavController(), isConnected = true, isRemotelyConnected = false)
}
}
}

View File

@@ -0,0 +1,981 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.screens
import android.content.Context
import android.widget.Toast
import androidx.activity.compose.BackHandler
import androidx.compose.foundation.background
import androidx.compose.foundation.clickable
import androidx.compose.foundation.interaction.MutableInteractionSource
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Arrangement
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.Row
import androidx.compose.foundation.layout.Spacer
import androidx.compose.foundation.layout.fillMaxSize
import androidx.compose.foundation.layout.fillMaxWidth
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.layout.size
import androidx.compose.foundation.layout.width
import androidx.compose.foundation.rememberScrollState
import androidx.compose.foundation.shape.RoundedCornerShape
import androidx.compose.foundation.text.KeyboardOptions
import androidx.compose.foundation.verticalScroll
import androidx.compose.material.icons.Icons
import androidx.compose.material.icons.filled.Refresh
import androidx.compose.material3.AlertDialog
import androidx.compose.material3.Button
import androidx.compose.material3.ButtonDefaults
import androidx.compose.material3.ExperimentalMaterial3Api
import androidx.compose.material3.HorizontalDivider
import androidx.compose.material3.Icon
import androidx.compose.material3.MaterialTheme
import androidx.compose.material3.OutlinedTextField
import androidx.compose.material3.OutlinedTextFieldDefaults
import androidx.compose.material3.Text
import androidx.compose.material3.TextButton
import androidx.compose.runtime.Composable
import androidx.compose.runtime.LaunchedEffect
import androidx.compose.runtime.mutableFloatStateOf
import androidx.compose.runtime.mutableStateOf
import androidx.compose.runtime.remember
import androidx.compose.runtime.rememberCoroutineScope
import androidx.compose.ui.Alignment
import androidx.compose.ui.Modifier
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.platform.LocalContext
import androidx.compose.ui.res.stringResource
import androidx.compose.ui.text.TextStyle
import androidx.compose.ui.text.font.Font
import androidx.compose.ui.text.font.FontFamily
import androidx.compose.ui.text.font.FontWeight
import androidx.compose.ui.text.input.KeyboardCapitalization
import androidx.compose.ui.text.input.KeyboardType
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.sp
import androidx.core.content.edit
import androidx.navigation.NavController
import com.kyant.backdrop.backdrops.layerBackdrop
import com.kyant.backdrop.backdrops.rememberLayerBackdrop
import dev.chrisbanes.haze.hazeSource
import dev.chrisbanes.haze.materials.ExperimentalHazeMaterialsApi
import kotlinx.coroutines.launch
import me.kavishdevar.librepods.R
import me.kavishdevar.librepods.composables.NavigationButton
import me.kavishdevar.librepods.composables.StyledScaffold
import me.kavishdevar.librepods.composables.StyledSlider
import me.kavishdevar.librepods.composables.StyledToggle
import me.kavishdevar.librepods.utils.AACPManager
import me.kavishdevar.librepods.utils.RadareOffsetFinder
import kotlin.io.encoding.Base64
import kotlin.io.encoding.ExperimentalEncodingApi
import kotlin.math.roundToInt
@OptIn(ExperimentalMaterial3Api::class, ExperimentalHazeMaterialsApi::class, ExperimentalEncodingApi::class)
@Composable
fun AppSettingsScreen(navController: NavController) {
val sharedPreferences = LocalContext.current.getSharedPreferences("settings", Context.MODE_PRIVATE)
val isDarkTheme = isSystemInDarkTheme()
val context = LocalContext.current
val coroutineScope = rememberCoroutineScope()
val scrollState = rememberScrollState()
val showResetDialog = remember { mutableStateOf(false) }
val showIrkDialog = remember { mutableStateOf(false) }
val showEncKeyDialog = remember { mutableStateOf(false) }
val showCameraDialog = remember { mutableStateOf(false) }
val irkValue = remember { mutableStateOf("") }
val encKeyValue = remember { mutableStateOf("") }
val cameraPackageValue = remember { mutableStateOf("") }
val irkError = remember { mutableStateOf<String?>(null) }
val encKeyError = remember { mutableStateOf<String?>(null) }
val cameraPackageError = remember { mutableStateOf<String?>(null) }
LaunchedEffect(Unit) {
val savedIrk = sharedPreferences.getString(AACPManager.Companion.ProximityKeyType.IRK.name, null)
val savedEncKey = sharedPreferences.getString(AACPManager.Companion.ProximityKeyType.ENC_KEY.name, null)
val savedCameraPackage = sharedPreferences.getString("custom_camera_package", null)
if (savedIrk != null) {
try {
val decoded = Base64.decode(savedIrk)
irkValue.value = decoded.joinToString("") { "%02x".format(it) }
} catch (e: Exception) {
irkValue.value = ""
e.printStackTrace()
}
}
if (savedEncKey != null) {
try {
val decoded = Base64.decode(savedEncKey)
encKeyValue.value = decoded.joinToString("") { "%02x".format(it) }
} catch (e: Exception) {
encKeyValue.value = ""
e.printStackTrace()
}
}
if (savedCameraPackage != null) {
cameraPackageValue.value = savedCameraPackage
}
}
val showPhoneBatteryInWidget = remember {
mutableStateOf(sharedPreferences.getBoolean("show_phone_battery_in_widget", true))
}
val conversationalAwarenessPauseMusicEnabled = remember {
mutableStateOf(sharedPreferences.getBoolean("conversational_awareness_pause_music", false))
}
val relativeConversationalAwarenessVolumeEnabled = remember {
mutableStateOf(sharedPreferences.getBoolean("relative_conversational_awareness_volume", true))
}
val openDialogForControlling = remember {
mutableStateOf(sharedPreferences.getString("qs_click_behavior", "dialog") == "dialog")
}
val disconnectWhenNotWearing = remember {
mutableStateOf(sharedPreferences.getBoolean("disconnect_when_not_wearing", false))
}
val takeoverWhenDisconnected = remember {
mutableStateOf(sharedPreferences.getBoolean("takeover_when_disconnected", true))
}
val takeoverWhenIdle = remember {
mutableStateOf(sharedPreferences.getBoolean("takeover_when_idle", true))
}
val takeoverWhenMusic = remember {
mutableStateOf(sharedPreferences.getBoolean("takeover_when_music", false))
}
val takeoverWhenCall = remember {
mutableStateOf(sharedPreferences.getBoolean("takeover_when_call", true))
}
val takeoverWhenRingingCall = remember {
mutableStateOf(sharedPreferences.getBoolean("takeover_when_ringing_call", true))
}
val takeoverWhenMediaStart = remember {
mutableStateOf(sharedPreferences.getBoolean("takeover_when_media_start", true))
}
val useAlternateHeadTrackingPackets = remember {
mutableStateOf(sharedPreferences.getBoolean("use_alternate_head_tracking_packets", false))
}
fun validateHexInput(input: String): Boolean {
val hexPattern = Regex("^[0-9a-fA-F]{32}$")
return hexPattern.matches(input)
}
val isProcessingSdp = remember { mutableStateOf(false) }
val actAsAppleDevice = remember { mutableStateOf(false) }
BackHandler(enabled = isProcessingSdp.value) {}
val backdrop = rememberLayerBackdrop()
StyledScaffold(
title = stringResource(R.string.app_settings)
) { spacerHeight, hazeState ->
Column(
modifier = Modifier
.fillMaxSize()
.layerBackdrop(backdrop)
.hazeSource(state = hazeState)
.verticalScroll(scrollState)
.padding(horizontal = 16.dp)
) {
Spacer(modifier = Modifier.height(spacerHeight))
val isDarkTheme = isSystemInDarkTheme()
val backgroundColor = if (isDarkTheme) Color(0xFF1C1C1E) else Color(0xFFFFFFFF)
val textColor = if (isDarkTheme) Color.White else Color.Black
StyledToggle(
title = stringResource(R.string.widget),
label = stringResource(R.string.show_phone_battery_in_widget),
description = stringResource(R.string.show_phone_battery_in_widget_description),
checkedState = showPhoneBatteryInWidget,
sharedPreferenceKey = "show_phone_battery_in_widget",
sharedPreferences = sharedPreferences,
)
Text(
text = stringResource(R.string.conversational_awareness),
style = TextStyle(
fontSize = 14.sp,
fontWeight = FontWeight.Bold,
color = textColor.copy(alpha = 0.6f),
fontFamily = FontFamily(Font(R.font.sf_pro))
),
modifier = Modifier.padding(16.dp, bottom = 2.dp, top = 24.dp)
)
Spacer(modifier = Modifier.height(2.dp))
Column (
modifier = Modifier
.fillMaxWidth()
.background(
backgroundColor,
RoundedCornerShape(28.dp)
)
.padding(vertical = 4.dp)
) {
fun updateConversationalAwarenessPauseMusic(enabled: Boolean) {
conversationalAwarenessPauseMusicEnabled.value = enabled
sharedPreferences.edit { putBoolean("conversational_awareness_pause_music", enabled)}
}
fun updateRelativeConversationalAwarenessVolume(enabled: Boolean) {
relativeConversationalAwarenessVolumeEnabled.value = enabled
sharedPreferences.edit { putBoolean("relative_conversational_awareness_volume", enabled)}
}
StyledToggle(
label = stringResource(R.string.conversational_awareness_pause_music),
description = stringResource(R.string.conversational_awareness_pause_music_description),
checkedState = conversationalAwarenessPauseMusicEnabled,
onCheckedChange = { updateConversationalAwarenessPauseMusic(it) },
independent = false
)
HorizontalDivider(
thickness = 1.dp,
color = Color(0x40888888),
modifier = Modifier
.padding(horizontal = 12.dp)
)
StyledToggle(
label = stringResource(R.string.relative_conversational_awareness_volume),
description = stringResource(R.string.relative_conversational_awareness_volume_description),
checkedState = relativeConversationalAwarenessVolumeEnabled,
onCheckedChange = { updateRelativeConversationalAwarenessVolume(it) },
independent = false
)
}
Spacer(modifier = Modifier.height(16.dp))
val conversationalAwarenessVolume = remember { mutableFloatStateOf(sharedPreferences.getInt("conversational_awareness_volume", 43).toFloat()) }
LaunchedEffect(conversationalAwarenessVolume.floatValue) {
sharedPreferences.edit { putInt("conversational_awareness_volume", conversationalAwarenessVolume.floatValue.roundToInt()) }
}
StyledSlider(
label = stringResource(R.string.conversational_awareness_volume),
mutableFloatState = conversationalAwarenessVolume,
valueRange = 10f..85f,
startLabel = "10%",
endLabel = "85%",
onValueChange = { newValue -> conversationalAwarenessVolume.floatValue = newValue },
independent = true
)
Spacer(modifier = Modifier.height(16.dp))
NavigationButton(
to = "",
title = stringResource(R.string.camera_control),
name = stringResource(R.string.set_custom_camera_package),
navController = navController,
onClick = { showCameraDialog.value = true },
independent = true,
description = stringResource(R.string.camera_control_app_description)
)
Spacer(modifier = Modifier.height(16.dp))
StyledToggle(
title = stringResource(R.string.quick_settings_tile),
label = stringResource(R.string.open_dialog_for_controlling),
description = stringResource(R.string.open_dialog_for_controlling_description),
checkedState = openDialogForControlling,
onCheckedChange = {
openDialogForControlling.value = it
sharedPreferences.edit { putString("qs_click_behavior", if (it) "dialog" else "activity") }
},
)
Spacer(modifier = Modifier.height(16.dp))
StyledToggle(
title = stringResource(R.string.ear_detection),
label = stringResource(R.string.disconnect_when_not_wearing),
description = stringResource(R.string.disconnect_when_not_wearing_description),
checkedState = disconnectWhenNotWearing,
sharedPreferenceKey = "disconnect_when_not_wearing",
sharedPreferences = sharedPreferences,
)
Text(
text = stringResource(R.string.takeover_airpods_state),
style = TextStyle(
fontSize = 14.sp,
fontWeight = FontWeight.Bold,
color = textColor.copy(alpha = 0.6f),
fontFamily = FontFamily(Font(R.font.sf_pro))
),
modifier = Modifier.padding(16.dp, bottom = 2.dp, top = 24.dp)
)
Spacer(modifier = Modifier.height(4.dp))
Column(
modifier = Modifier
.fillMaxWidth()
.background(
backgroundColor,
RoundedCornerShape(28.dp)
)
.padding(vertical = 4.dp)
) {
StyledToggle(
label = stringResource(R.string.takeover_disconnected),
description = stringResource(R.string.takeover_disconnected_desc),
checkedState = takeoverWhenDisconnected,
onCheckedChange = {
takeoverWhenDisconnected.value = it
sharedPreferences.edit { putBoolean("takeover_when_disconnected", it)}
},
independent = false
)
HorizontalDivider(
thickness = 1.dp,
color = Color(0x40888888),
modifier = Modifier
.padding(horizontal = 12.dp)
)
StyledToggle(
label = stringResource(R.string.takeover_idle),
description = stringResource(R.string.takeover_idle_desc),
checkedState = takeoverWhenIdle,
onCheckedChange = {
takeoverWhenIdle.value = it
sharedPreferences.edit { putBoolean("takeover_when_idle", it)}
},
independent = false
)
HorizontalDivider(
thickness = 1.dp,
color = Color(0x40888888),
modifier = Modifier
.padding(horizontal = 12.dp)
)
StyledToggle(
label = stringResource(R.string.takeover_music),
description = stringResource(R.string.takeover_music_desc),
checkedState = takeoverWhenMusic,
onCheckedChange = {
takeoverWhenMusic.value = it
sharedPreferences.edit { putBoolean("takeover_when_music", it)}
},
independent = false
)
HorizontalDivider(
thickness = 1.dp,
color = Color(0x40888888),
modifier = Modifier
.padding(horizontal = 12.dp)
)
StyledToggle(
label = stringResource(R.string.takeover_call),
description = stringResource(R.string.takeover_call_desc),
checkedState = takeoverWhenCall,
onCheckedChange = {
takeoverWhenCall.value = it
sharedPreferences.edit { putBoolean("takeover_when_call", it)}
},
independent = false
)
}
Spacer(modifier = Modifier.height(16.dp))
Text(
text = stringResource(R.string.takeover_phone_state),
style = TextStyle(
fontSize = 14.sp,
fontWeight = FontWeight.Bold,
color = textColor.copy(alpha = 0.6f),
fontFamily = FontFamily(Font(R.font.sf_pro))
),
modifier = Modifier.padding(horizontal = 16.dp)
)
Spacer(modifier = Modifier.height(4.dp))
Column(
modifier = Modifier
.fillMaxWidth()
.background(
backgroundColor,
RoundedCornerShape(28.dp)
)
.padding(vertical = 4.dp)
){
StyledToggle(
label = stringResource(R.string.takeover_ringing_call),
description = stringResource(R.string.takeover_ringing_call_desc),
checkedState = takeoverWhenRingingCall,
onCheckedChange = {
takeoverWhenRingingCall.value = it
sharedPreferences.edit { putBoolean("takeover_when_ringing_call", it)}
},
independent = false
)
HorizontalDivider(
thickness = 1.dp,
color = Color(0x40888888),
modifier = Modifier
.padding(horizontal = 12.dp)
)
StyledToggle(
label = stringResource(R.string.takeover_media_start),
description = stringResource(R.string.takeover_media_start_desc),
checkedState = takeoverWhenMediaStart,
onCheckedChange = {
takeoverWhenMediaStart.value = it
sharedPreferences.edit { putBoolean("takeover_when_media_start", it)}
},
independent = false
)
}
Text(
text = stringResource(R.string.advanced_options),
style = TextStyle(
fontSize = 14.sp,
fontWeight = FontWeight.Bold,
color = textColor.copy(alpha = 0.6f),
fontFamily = FontFamily(Font(R.font.sf_pro))
),
modifier = Modifier.padding(16.dp, bottom = 2.dp, top = 24.dp)
)
Spacer(modifier = Modifier.height(2.dp))
Column(
modifier = Modifier
.fillMaxWidth()
.background(
backgroundColor,
RoundedCornerShape(28.dp)
)
.padding(horizontal = 16.dp, vertical = 4.dp)
) {
Row(
modifier = Modifier
.fillMaxWidth()
.clickable (
onClick = { showIrkDialog.value = true },
indication = null,
interactionSource = remember { MutableInteractionSource() }
),
verticalAlignment = Alignment.CenterVertically
) {
Column(
modifier = Modifier
.weight(1f)
.padding(vertical = 8.dp)
.padding(end = 4.dp)
) {
Text(
text = stringResource(R.string.set_identity_resolving_key),
fontSize = 16.sp,
color = textColor
)
Spacer(modifier = Modifier.height(4.dp))
Text(
text = stringResource(R.string.set_identity_resolving_key_description),
fontSize = 14.sp,
color = textColor.copy(0.6f),
lineHeight = 16.sp,
)
}
}
HorizontalDivider(
thickness = 1.dp,
color = Color(0x40888888),
)
Row(
modifier = Modifier
.fillMaxWidth()
.clickable (
onClick = { showEncKeyDialog.value = true },
indication = null,
interactionSource = remember { MutableInteractionSource() }
),
verticalAlignment = Alignment.CenterVertically
) {
Column(
modifier = Modifier
.weight(1f)
.padding(vertical = 8.dp)
.padding(end = 4.dp)
) {
Text(
text = stringResource(R.string.set_encryption_key),
fontSize = 16.sp,
color = textColor
)
Spacer(modifier = Modifier.height(4.dp))
Text(
text = stringResource(R.string.set_encryption_key_description),
fontSize = 14.sp,
color = textColor.copy(0.6f),
lineHeight = 16.sp,
)
}
}
}
Spacer(modifier = Modifier.height(16.dp))
StyledToggle(
label = stringResource(R.string.use_alternate_head_tracking_packets),
description = stringResource(R.string.use_alternate_head_tracking_packets_description),
checkedState = useAlternateHeadTrackingPackets,
onCheckedChange = {
useAlternateHeadTrackingPackets.value = it
sharedPreferences.edit { putBoolean("use_alternate_head_tracking_packets", it)}
},
independent = true
)
Spacer(modifier = Modifier.height(16.dp))
NavigationButton(
to = "troubleshooting",
name = stringResource(R.string.troubleshooting),
navController = navController,
independent = true,
description = stringResource(R.string.troubleshooting_description)
)
LaunchedEffect(Unit) {
actAsAppleDevice.value = RadareOffsetFinder.isSdpOffsetAvailable()
}
val restartBluetoothText = stringResource(R.string.found_offset_restart_bluetooth)
StyledToggle(
label = stringResource(R.string.act_as_an_apple_device),
description = stringResource(R.string.act_as_an_apple_device_description),
checkedState = actAsAppleDevice,
onCheckedChange = {
actAsAppleDevice.value = it
isProcessingSdp.value = true
coroutineScope.launch {
if (it) {
val radareOffsetFinder = RadareOffsetFinder(context)
val success = radareOffsetFinder.findSdpOffset()
if (success) {
Toast.makeText(context, restartBluetoothText, Toast.LENGTH_LONG).show()
}
} else {
RadareOffsetFinder.clearSdpOffset()
}
isProcessingSdp.value = false
}
},
independent = true,
enabled = !isProcessingSdp.value
)
Spacer(modifier = Modifier.height(16.dp))
Button(
onClick = { showResetDialog.value = true },
modifier = Modifier
.fillMaxWidth()
.height(50.dp),
colors = ButtonDefaults.buttonColors(
containerColor = MaterialTheme.colorScheme.errorContainer
),
shape = RoundedCornerShape(28.dp)
) {
Row(
verticalAlignment = Alignment.CenterVertically,
horizontalArrangement = Arrangement.Center
) {
Icon(
imageVector = Icons.Default.Refresh,
contentDescription = "Reset",
tint = MaterialTheme.colorScheme.onErrorContainer,
modifier = Modifier.size(18.dp)
)
Spacer(modifier = Modifier.width(8.dp))
Text(
text = stringResource(R.string.reset_hook_offset),
color = MaterialTheme.colorScheme.onErrorContainer,
style = TextStyle(
fontSize = 16.sp,
fontWeight = FontWeight.Medium,
fontFamily = FontFamily(Font(R.font.sf_pro))
)
)
}
}
Spacer(modifier = Modifier.height(16.dp))
NavigationButton(
to = "open_source_licenses",
name = stringResource(R.string.open_source_licenses),
navController = navController,
independent = true
)
Spacer(modifier = Modifier.height(32.dp))
if (showResetDialog.value) {
AlertDialog(
onDismissRequest = { showResetDialog.value = false },
title = {
Text(
"Reset Hook Offset",
fontFamily = FontFamily(Font(R.font.sf_pro)),
fontWeight = FontWeight.Medium
)
},
text = {
Text(
stringResource(R.string.reset_hook_offset_description),
fontFamily = FontFamily(Font(R.font.sf_pro))
)
},
confirmButton = {
val successText = stringResource(R.string.hook_offset_reset_success)
val failureText = stringResource(R.string.hook_offset_reset_failure)
TextButton(
onClick = {
if (RadareOffsetFinder.clearHookOffsets()) {
Toast.makeText(
context,
successText,
Toast.LENGTH_LONG
).show()
navController.navigate("onboarding") {
popUpTo("settings") { inclusive = true }
}
} else {
Toast.makeText(
context,
failureText,
Toast.LENGTH_SHORT
).show()
}
showResetDialog.value = false
},
colors = ButtonDefaults.textButtonColors(
contentColor = MaterialTheme.colorScheme.error
)
) {
Text(
stringResource(R.string.reset),
fontFamily = FontFamily(Font(R.font.sf_pro)),
fontWeight = FontWeight.Medium
)
}
},
dismissButton = {
TextButton(
onClick = { showResetDialog.value = false }
) {
Text(
"Cancel",
fontFamily = FontFamily(Font(R.font.sf_pro)),
fontWeight = FontWeight.Medium
)
}
}
)
}
if (showIrkDialog.value) {
AlertDialog(
onDismissRequest = { showIrkDialog.value = false },
title = {
Text(
stringResource(R.string.set_identity_resolving_key),
fontFamily = FontFamily(Font(R.font.sf_pro)),
fontWeight = FontWeight.Medium
)
},
text = {
Column {
Text(
stringResource(R.string.enter_irk_hex),
fontFamily = FontFamily(Font(R.font.sf_pro)),
modifier = Modifier.padding(bottom = 8.dp)
)
OutlinedTextField(
value = irkValue.value,
onValueChange = {
irkValue.value = it.lowercase().filter { char -> char.isDigit() || char in 'a'..'f' }
irkError.value = null
},
modifier = Modifier.fillMaxWidth(),
isError = irkError.value != null,
keyboardOptions = KeyboardOptions(
keyboardType = KeyboardType.Ascii,
capitalization = KeyboardCapitalization.None
),
colors = OutlinedTextFieldDefaults.colors(
focusedBorderColor = if (isDarkTheme) Color(0xFF007AFF) else Color(0xFF3C6DF5),
unfocusedBorderColor = if (isDarkTheme) Color.Gray else Color.LightGray
),
supportingText = {
if (irkError.value != null) {
Text(stringResource(R.string.must_be_32_hex_chars), color = MaterialTheme.colorScheme.error)
}
},
label = { Text(stringResource(R.string.irk_hex_value)) }
)
}
},
confirmButton = {
val successText = stringResource(R.string.irk_set_success)
val errorText = stringResource(R.string.error_converting_hex)
TextButton(
onClick = {
if (!validateHexInput(irkValue.value)) {
irkError.value = "Must be exactly 32 hex characters"
return@TextButton
}
try {
val hexBytes = ByteArray(16)
for (i in 0 until 16) {
val hexByte = irkValue.value.substring(i * 2, i * 2 + 2)
hexBytes[i] = hexByte.toInt(16).toByte()
}
val base64Value = Base64.encode(hexBytes)
sharedPreferences.edit { putString(AACPManager.Companion.ProximityKeyType.IRK.name, base64Value)}
Toast.makeText(context, successText, Toast.LENGTH_SHORT).show()
showIrkDialog.value = false
} catch (e: Exception) {
irkError.value = errorText + " " + (e.message ?: "Unknown error")
}
}
) {
Text(
"Save",
fontFamily = FontFamily(Font(R.font.sf_pro)),
fontWeight = FontWeight.Medium
)
}
},
dismissButton = {
TextButton(
onClick = { showIrkDialog.value = false }
) {
Text(
"Cancel",
fontFamily = FontFamily(Font(R.font.sf_pro)),
fontWeight = FontWeight.Medium
)
}
}
)
}
if (showEncKeyDialog.value) {
AlertDialog(
onDismissRequest = { showEncKeyDialog.value = false },
title = {
Text(
stringResource(R.string.set_encryption_key),
fontFamily = FontFamily(Font(R.font.sf_pro)),
fontWeight = FontWeight.Medium
)
},
text = {
Column {
Text(
stringResource(R.string.enter_enc_key_hex),
fontFamily = FontFamily(Font(R.font.sf_pro)),
modifier = Modifier.padding(bottom = 8.dp)
)
OutlinedTextField(
value = encKeyValue.value,
onValueChange = {
encKeyValue.value = it.lowercase().filter { char -> char.isDigit() || char in 'a'..'f' }
encKeyError.value = null
},
modifier = Modifier.fillMaxWidth(),
isError = encKeyError.value != null,
keyboardOptions = KeyboardOptions(
keyboardType = KeyboardType.Ascii,
capitalization = KeyboardCapitalization.None
),
colors = OutlinedTextFieldDefaults.colors(
focusedBorderColor = if (isDarkTheme) Color(0xFF007AFF) else Color(0xFF3C6DF5),
unfocusedBorderColor = if (isDarkTheme) Color.Gray else Color.LightGray
),
supportingText = {
if (encKeyError.value != null) {
Text(stringResource(R.string.must_be_32_hex_chars), color = MaterialTheme.colorScheme.error)
}
},
label = { Text(stringResource(R.string.enc_key_hex_value)) }
)
}
},
confirmButton = {
val successText = stringResource(R.string.encryption_key_set_success)
val errorText = stringResource(R.string.error_converting_hex)
TextButton(
onClick = {
if (!validateHexInput(encKeyValue.value)) {
encKeyError.value = "Must be exactly 32 hex characters"
return@TextButton
}
try {
val hexBytes = ByteArray(16)
for (i in 0 until 16) {
val hexByte = encKeyValue.value.substring(i * 2, i * 2 + 2)
hexBytes[i] = hexByte.toInt(16).toByte()
}
val base64Value = Base64.encode(hexBytes)
sharedPreferences.edit { putString(AACPManager.Companion.ProximityKeyType.ENC_KEY.name, base64Value)}
Toast.makeText(context, successText, Toast.LENGTH_SHORT).show()
showEncKeyDialog.value = false
} catch (e: Exception) {
encKeyError.value = errorText + " " + (e.message ?: "Unknown error")
}
}
) {
Text(
"Save",
fontFamily = FontFamily(Font(R.font.sf_pro)),
fontWeight = FontWeight.Medium
)
}
},
dismissButton = {
TextButton(
onClick = { showEncKeyDialog.value = false }
) {
Text(
"Cancel",
fontFamily = FontFamily(Font(R.font.sf_pro)),
fontWeight = FontWeight.Medium
)
}
}
)
}
if (showCameraDialog.value) {
AlertDialog(
onDismissRequest = { showCameraDialog.value = false },
title = {
Text(
stringResource(R.string.set_custom_camera_package),
fontFamily = FontFamily(Font(R.font.sf_pro)),
fontWeight = FontWeight.Medium
)
},
text = {
Column {
Text(
stringResource(R.string.enter_custom_camera_package),
fontFamily = FontFamily(Font(R.font.sf_pro)),
modifier = Modifier.padding(bottom = 8.dp)
)
OutlinedTextField(
value = cameraPackageValue.value,
onValueChange = {
cameraPackageValue.value = it
cameraPackageError.value = null
},
modifier = Modifier.fillMaxWidth(),
isError = cameraPackageError.value != null,
keyboardOptions = KeyboardOptions(
keyboardType = KeyboardType.Ascii,
capitalization = KeyboardCapitalization.None
),
colors = OutlinedTextFieldDefaults.colors(
focusedBorderColor = if (isDarkTheme) Color(0xFF007AFF) else Color(0xFF3C6DF5),
unfocusedBorderColor = if (isDarkTheme) Color.Gray else Color.LightGray
),
supportingText = {
if (cameraPackageError.value != null) {
Text(cameraPackageError.value!!, color = MaterialTheme.colorScheme.error)
}
},
label = { Text(stringResource(R.string.custom_camera_package)) }
)
}
},
confirmButton = {
val successText = stringResource(R.string.custom_camera_package_set_success)
TextButton(
onClick = {
if (cameraPackageValue.value.isBlank()) {
sharedPreferences.edit { remove("custom_camera_package") }
Toast.makeText(context, successText, Toast.LENGTH_SHORT).show()
showCameraDialog.value = false
return@TextButton
}
sharedPreferences.edit { putString("custom_camera_package", cameraPackageValue.value) }
Toast.makeText(context, successText, Toast.LENGTH_SHORT).show()
showCameraDialog.value = false
}
) {
Text(
"Save",
fontFamily = FontFamily(Font(R.font.sf_pro)),
fontWeight = FontWeight.Medium
)
}
},
dismissButton = {
TextButton(
onClick = { showCameraDialog.value = false }
) {
Text(
"Cancel",
fontFamily = FontFamily(Font(R.font.sf_pro)),
fontWeight = FontWeight.Medium
)
}
}
)
}
}
}
}

View File

@@ -0,0 +1,146 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.screens
import android.annotation.SuppressLint
import android.content.ComponentName
import android.content.Context
import android.content.Intent
import android.provider.Settings
import android.view.accessibility.AccessibilityManager
import android.accessibilityservice.AccessibilityServiceInfo
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Arrangement
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.Spacer
import androidx.compose.foundation.layout.fillMaxSize
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.padding
import androidx.compose.material3.ExperimentalMaterial3Api
import androidx.compose.runtime.Composable
import androidx.compose.runtime.DisposableEffect
import androidx.compose.runtime.LaunchedEffect
import androidx.compose.runtime.mutableFloatStateOf
import androidx.compose.runtime.getValue
import androidx.compose.runtime.mutableStateOf
import androidx.compose.runtime.remember
import androidx.compose.runtime.setValue
import androidx.compose.ui.Modifier
import androidx.compose.ui.platform.LocalContext
import androidx.compose.ui.res.stringResource
import androidx.compose.ui.unit.dp
import androidx.navigation.NavController
import androidx.core.content.edit
import com.kyant.backdrop.backdrops.layerBackdrop
import com.kyant.backdrop.backdrops.rememberLayerBackdrop
import dev.chrisbanes.haze.materials.ExperimentalHazeMaterialsApi
import kotlinx.coroutines.CoroutineScope
import kotlinx.coroutines.Dispatchers
import kotlinx.coroutines.Job
import kotlinx.coroutines.delay
import kotlinx.coroutines.launch
import me.kavishdevar.librepods.R
import me.kavishdevar.librepods.composables.SelectItem
import me.kavishdevar.librepods.composables.StyledIconButton
import me.kavishdevar.librepods.composables.StyledScaffold
import me.kavishdevar.librepods.composables.StyledSelectList
import me.kavishdevar.librepods.composables.StyledSlider
import me.kavishdevar.librepods.services.ServiceManager
import me.kavishdevar.librepods.services.AppListenerService
import me.kavishdevar.librepods.utils.AACPManager
import me.kavishdevar.librepods.utils.AACPManager.Companion.StemPressType
import kotlin.io.encoding.ExperimentalEncodingApi
private var debounceJob: Job? = null
@SuppressLint("DefaultLocale")
@ExperimentalHazeMaterialsApi
@OptIn(ExperimentalMaterial3Api::class, ExperimentalEncodingApi::class)
@Composable
fun CameraControlScreen(navController: NavController) {
val isDarkTheme = isSystemInDarkTheme()
val context = LocalContext.current
val sharedPreferences = context.getSharedPreferences("settings", Context.MODE_PRIVATE)
val service = ServiceManager.getService()!!
var currentCameraAction by remember {
mutableStateOf(
sharedPreferences.getString("camera_action", null)?.let { StemPressType.valueOf(it) }
)
}
fun isAppListenerServiceEnabled(context: Context): Boolean {
val am = context.getSystemService(Context.ACCESSIBILITY_SERVICE) as AccessibilityManager
val enabledServices = am.getEnabledAccessibilityServiceList(AccessibilityServiceInfo.FEEDBACK_ALL_MASK)
val serviceComponent = ComponentName(context, AppListenerService::class.java)
return enabledServices.any { it.resolveInfo.serviceInfo.packageName == serviceComponent.packageName && it.resolveInfo.serviceInfo.name == serviceComponent.className }
}
val cameraOptions = listOf(
SelectItem(
name = stringResource(R.string.off),
selected = currentCameraAction == null,
onClick = {
sharedPreferences.edit { remove("camera_action") }
currentCameraAction = null
}
),
SelectItem(
name = stringResource(R.string.press_once),
selected = currentCameraAction == StemPressType.SINGLE_PRESS,
onClick = {
if (!isAppListenerServiceEnabled(context)) {
context.startActivity(Intent(Settings.ACTION_ACCESSIBILITY_SETTINGS))
} else {
sharedPreferences.edit { putString("camera_action", StemPressType.SINGLE_PRESS.name) }
currentCameraAction = StemPressType.SINGLE_PRESS
}
}
),
SelectItem(
name = stringResource(R.string.press_and_hold_airpods),
selected = currentCameraAction == StemPressType.LONG_PRESS,
onClick = {
if (!isAppListenerServiceEnabled(context)) {
context.startActivity(Intent(Settings.ACTION_ACCESSIBILITY_SETTINGS))
} else {
sharedPreferences.edit { putString("camera_action", StemPressType.LONG_PRESS.name) }
currentCameraAction = StemPressType.LONG_PRESS
}
}
)
)
val backdrop = rememberLayerBackdrop()
StyledScaffold(
title = stringResource(R.string.camera_control)
) { spacerHeight ->
Column(
modifier = Modifier
.fillMaxSize()
.layerBackdrop(backdrop)
.padding(horizontal = 16.dp),
verticalArrangement = Arrangement.spacedBy(16.dp)
) {
Spacer(modifier = Modifier.height(spacerHeight))
StyledSelectList(items = cameraOptions)
}
}
}

View File

@@ -0,0 +1,524 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
@file:OptIn(ExperimentalHazeMaterialsApi::class, ExperimentalEncodingApi::class)
package me.kavishdevar.librepods.screens
import android.annotation.SuppressLint
import android.content.ClipData
import android.content.ClipboardManager
import android.content.Context
import android.os.Build
import android.widget.Toast
import androidx.annotation.RequiresApi
import androidx.compose.foundation.ExperimentalFoundationApi
import androidx.compose.foundation.background
import androidx.compose.foundation.combinedClickable
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.ExperimentalLayoutApi
import androidx.compose.foundation.layout.Row
import androidx.compose.foundation.layout.Spacer
import androidx.compose.foundation.layout.fillMaxSize
import androidx.compose.foundation.layout.fillMaxWidth
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.navigationBarsPadding
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.layout.width
import androidx.compose.foundation.lazy.LazyColumn
import androidx.compose.foundation.lazy.rememberLazyListState
import androidx.compose.foundation.shape.RoundedCornerShape
import androidx.compose.material.icons.Icons
import androidx.compose.material.icons.filled.Send
import androidx.compose.material3.Card
import androidx.compose.material3.CardDefaults
import androidx.compose.material3.ExperimentalMaterial3Api
import androidx.compose.material3.HorizontalDivider
import androidx.compose.material3.Icon
import androidx.compose.material3.IconButton
import androidx.compose.material3.Text
import androidx.compose.material3.TextField
import androidx.compose.material3.TextFieldDefaults
import androidx.compose.runtime.Composable
import androidx.compose.runtime.LaunchedEffect
import androidx.compose.runtime.collectAsState
import androidx.compose.runtime.mutableIntStateOf
import androidx.compose.runtime.mutableStateOf
import androidx.compose.runtime.remember
import androidx.compose.runtime.rememberCoroutineScope
import androidx.compose.ui.Alignment
import androidx.compose.ui.Modifier
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.platform.LocalContext
import androidx.compose.ui.platform.LocalFocusManager
import androidx.compose.ui.text.TextStyle
import androidx.compose.ui.text.font.Font
import androidx.compose.ui.text.font.FontFamily
import androidx.compose.ui.text.font.FontWeight
import androidx.compose.ui.text.input.TextFieldValue
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.sp
import androidx.navigation.NavController
import com.kyant.backdrop.backdrops.layerBackdrop
import com.kyant.backdrop.backdrops.rememberLayerBackdrop
import dev.chrisbanes.haze.hazeSource
import dev.chrisbanes.haze.materials.ExperimentalHazeMaterialsApi
import kotlinx.coroutines.delay
import kotlinx.coroutines.launch
import me.kavishdevar.librepods.R
import me.kavishdevar.librepods.composables.StyledIconButton
import me.kavishdevar.librepods.composables.StyledScaffold
import me.kavishdevar.librepods.constants.BatteryStatus
import me.kavishdevar.librepods.constants.isHeadTrackingData
import me.kavishdevar.librepods.services.ServiceManager
import kotlin.io.encoding.ExperimentalEncodingApi
data class PacketInfo(
val type: String,
val description: String,
val rawData: String,
val parsedData: Map<String, String> = emptyMap(),
val isUnknown: Boolean = false
)
fun parsePacket(message: String): PacketInfo {
val rawData = if (message.startsWith("Sent")) message.substring(5) else message.substring(9)
val bytes = rawData.split(" ").mapNotNull {
it.takeIf { it.isNotEmpty() }?.toIntOrNull(16)?.toByte()
}.toByteArray()
val airPodsService = ServiceManager.getService()
if (airPodsService != null) {
return when {
message.startsWith("Sent") -> parseOutgoingPacket(bytes, rawData)
airPodsService.batteryNotification.isBatteryData(bytes) -> {
val batteryInfo = mutableMapOf<String, String>()
airPodsService.batteryNotification.setBattery(bytes)
val batteries = airPodsService.batteryNotification.getBattery()
val batteryInfoString = batteries.joinToString(", ") { battery ->
"${battery.getComponentName() ?: "Unknown"}: ${battery.level}% ${if (battery.status == BatteryStatus.CHARGING) "(Charging)" else ""}"
}
batteries.forEach { battery ->
if (battery.status != BatteryStatus.DISCONNECTED) {
batteryInfo[battery.getComponentName() ?: "Unknown"] =
"${battery.level}% ${if (battery.status == BatteryStatus.CHARGING) "(Charging)" else ""}"
}
}
PacketInfo(
"Battery",
batteryInfoString,
rawData,
batteryInfo
)
}
airPodsService.ancNotification.isANCData(bytes) -> {
airPodsService.ancNotification.setStatus(bytes)
val mode = when (airPodsService.ancNotification.status) {
1 -> "Off"
2 -> "Noise Cancellation"
3 -> "Transparency"
4 -> "Adaptive"
else -> "Unknown"
}
PacketInfo(
"Noise Control",
"Mode: $mode",
rawData,
mapOf("Mode" to mode)
)
}
airPodsService.earDetectionNotification.isEarDetectionData(bytes) -> {
airPodsService.earDetectionNotification.setStatus(bytes)
val status = airPodsService.earDetectionNotification.status
val primaryStatus = if (status[0] == 0.toByte()) "In ear" else "Out of ear"
val secondaryStatus = if (status[1] == 0.toByte()) "In ear" else "Out of ear"
PacketInfo(
"Ear Detection",
"Primary: $primaryStatus, Secondary: $secondaryStatus",
rawData,
mapOf("Primary" to primaryStatus, "Secondary" to secondaryStatus)
)
}
airPodsService.conversationAwarenessNotification.isConversationalAwarenessData(bytes) -> {
airPodsService.conversationAwarenessNotification.setData(bytes)
val statusMap = mapOf(
1.toByte() to "Started speaking",
2.toByte() to "Speaking",
8.toByte() to "Stopped speaking",
9.toByte() to "Not speaking"
)
val status = statusMap[airPodsService.conversationAwarenessNotification.status] ?:
"Unknown (${airPodsService.conversationAwarenessNotification.status})"
PacketInfo(
"Conversation Awareness",
"Status: $status",
rawData,
mapOf("Status" to status)
)
}
isHeadTrackingData(bytes) -> {
val horizontal = if (bytes.size >= 53)
"${bytes[51].toInt() and 0xFF or (bytes[52].toInt() shl 8)}" else "Unknown"
val vertical = if (bytes.size >= 55)
"${bytes[53].toInt() and 0xFF or (bytes[54].toInt() shl 8)}" else "Unknown"
PacketInfo(
"Head Tracking",
"Position data",
rawData,
mapOf("Horizontal" to horizontal, "Vertical" to vertical)
)
}
else -> PacketInfo("Unknown", "Unknown packet format", rawData, emptyMap(), true)
}
} else {
return if (message.startsWith("Sent")) {
parseOutgoingPacket(bytes, rawData)
} else {
PacketInfo("Unknown", "Unknown packet format", rawData, emptyMap(), true)
}
}
}
fun parseOutgoingPacket(bytes: ByteArray, rawData: String): PacketInfo {
if (bytes.size < 7) {
return PacketInfo("Unknown", "Unknown outgoing packet", rawData, emptyMap(), true)
}
return when {
bytes.size >= 16 &&
bytes[0] == 0x00.toByte() &&
bytes[1] == 0x00.toByte() &&
bytes[2] == 0x04.toByte() &&
bytes[3] == 0x00.toByte() -> {
PacketInfo("Handshake", "Initial handshake with AirPods", rawData)
}
bytes.size >= 11 &&
bytes[0] == 0x04.toByte() &&
bytes[1] == 0x00.toByte() &&
bytes[2] == 0x04.toByte() &&
bytes[3] == 0x00.toByte() &&
bytes[4] == 0x09.toByte() &&
bytes[5] == 0x00.toByte() &&
bytes[6] == 0x0d.toByte() -> {
val mode = when (bytes[7].toInt()) {
1 -> "Off"
2 -> "Noise Cancellation"
3 -> "Transparency"
4 -> "Adaptive"
else -> "Unknown"
}
PacketInfo("Noise Control", "Set mode to $mode", rawData, mapOf("Mode" to mode))
}
bytes.size >= 11 &&
bytes[0] == 0x04.toByte() &&
bytes[1] == 0x00.toByte() &&
bytes[2] == 0x04.toByte() &&
bytes[3] == 0x00.toByte() &&
bytes[4] == 0x09.toByte() &&
bytes[5] == 0x00.toByte() &&
bytes[6] == 0x28.toByte() -> {
val mode = if (bytes[7].toInt() == 1) "On" else "Off"
PacketInfo("Conversation Awareness", "Set mode to $mode", rawData, mapOf("Mode" to mode))
}
bytes.size > 10 &&
bytes[0] == 0x04.toByte() &&
bytes[1] == 0x00.toByte() &&
bytes[2] == 0x04.toByte() &&
bytes[3] == 0x00.toByte() &&
bytes[4] == 0x17.toByte() -> {
val action = if (bytes.joinToString(" ") { "%02X".format(it) }.contains("A1 02")) "Start" else "Stop"
PacketInfo("Head Tracking", "$action head tracking", rawData)
}
bytes.size >= 11 &&
bytes[0] == 0x04.toByte() &&
bytes[1] == 0x00.toByte() &&
bytes[2] == 0x04.toByte() &&
bytes[3] == 0x00.toByte() &&
bytes[4] == 0x09.toByte() &&
bytes[5] == 0x00.toByte() &&
bytes[6] == 0x1A.toByte() -> {
PacketInfo("Long Press Config", "Change long press modes", rawData)
}
bytes.size >= 9 &&
bytes[0] == 0x04.toByte() &&
bytes[1] == 0x00.toByte() &&
bytes[2] == 0x04.toByte() &&
bytes[3] == 0x00.toByte() &&
bytes[4] == 0x4d.toByte() -> {
PacketInfo("Feature Request", "Set specific features", rawData)
}
bytes.size >= 9 &&
bytes[0] == 0x04.toByte() &&
bytes[1] == 0x00.toByte() &&
bytes[2] == 0x04.toByte() &&
bytes[3] == 0x00.toByte() &&
bytes[4] == 0x0f.toByte() -> {
PacketInfo("Notifications", "Request notifications", rawData)
}
else -> PacketInfo("Unknown", "Unknown outgoing packet", rawData, emptyMap(), true)
}
}
@RequiresApi(Build.VERSION_CODES.Q)
@OptIn(ExperimentalMaterial3Api::class, ExperimentalLayoutApi::class, ExperimentalFoundationApi::class)
@SuppressLint("UnusedMaterial3ScaffoldPaddingParameter", "UnspecifiedRegisterReceiverFlag")
@Composable
fun DebugScreen(navController: NavController) {
val context = LocalContext.current
val listState = rememberLazyListState()
val focusManager = LocalFocusManager.current
val coroutineScope = rememberCoroutineScope()
val airPodsService = remember { ServiceManager.getService() }
val packetLogs = airPodsService?.packetLogsFlow?.collectAsState(emptySet())?.value ?: emptySet()
val refreshTrigger = remember { mutableIntStateOf(0) }
LaunchedEffect(refreshTrigger.intValue) {
while(true) {
delay(1000)
refreshTrigger.intValue += 1
}
}
val expandedItems = remember { mutableStateOf(setOf<Int>()) }
fun copyToClipboard(text: String) {
val clipboard = context.getSystemService(Context.CLIPBOARD_SERVICE) as ClipboardManager
val clip = ClipData.newPlainText("Packet Data", text)
clipboard.setPrimaryClip(clip)
Toast.makeText(context, "Packet copied to clipboard", Toast.LENGTH_SHORT).show()
}
LaunchedEffect(packetLogs.size, refreshTrigger.intValue) {
if (packetLogs.isNotEmpty()) {
listState.animateScrollToItem(packetLogs.size - 1)
}
}
val isDarkTheme = isSystemInDarkTheme()
val backdrop = rememberLayerBackdrop()
StyledScaffold(
title = "Debug",
actionButtons = listOf(
{scaffoldBackdrop ->
StyledIconButton(
onClick = {
airPodsService?.clearLogs()
expandedItems.value = emptySet()
},
icon = "􀈑",
darkMode = isDarkTheme,
backdrop = scaffoldBackdrop
)
}
),
) { spacerHeight, hazeState ->
Column(
modifier = Modifier
.fillMaxSize()
.hazeSource(hazeState)
.navigationBarsPadding()
.layerBackdrop(backdrop)
.padding(horizontal = 16.dp)
) {
Spacer(modifier = Modifier.height(spacerHeight))
LazyColumn(
state = listState,
modifier = Modifier
.fillMaxWidth()
.weight(1f),
content = {
items(packetLogs.size) { index ->
val message = packetLogs.elementAt(index)
val isSent = message.startsWith("Sent")
val isExpanded = expandedItems.value.contains(index)
val packetInfo = parsePacket(message)
Card(
modifier = Modifier
.fillMaxWidth()
.padding(vertical = 2.dp)
.combinedClickable(
onClick = {
expandedItems.value = if (isExpanded) {
expandedItems.value - index
} else {
expandedItems.value + index
}
},
onLongClick = {
copyToClipboard(packetInfo.rawData)
}
),
elevation = CardDefaults.cardElevation(defaultElevation = 2.dp),
shape = RoundedCornerShape(4.dp),
colors = CardDefaults.cardColors(
containerColor = if (isSystemInDarkTheme()) Color(0xFF1C1B20) else Color(0xFFF2F2F7),
)
) {
Row(verticalAlignment = Alignment.CenterVertically) {
Text(
text = if (isSent) "􀆉" else "􀆊",
style = TextStyle(
fontSize = 16.sp,
fontFamily = FontFamily(Font(R.font.sf_pro)),
color = if (isSent) Color(0xFF4CD964) else Color(0xFFFF3B30)
),
)
Spacer(modifier = Modifier.width(4.dp))
Column {
Text(
text = if (packetInfo.isUnknown) {
val shortenedData = packetInfo.rawData.take(60) +
(if (packetInfo.rawData.length > 60) "..." else "")
shortenedData
} else {
"${packetInfo.type}: ${packetInfo.description}"
},
style = TextStyle(
fontSize = 12.sp,
fontWeight = FontWeight.Medium,
fontFamily = FontFamily(Font(R.font.hack))
)
)
if (isExpanded) {
Spacer(modifier = Modifier.height(4.dp))
if (packetInfo.parsedData.isNotEmpty()) {
packetInfo.parsedData.forEach { (key, value) ->
Row {
Text(
text = "$key: ",
style = TextStyle(
fontSize = 12.sp,
fontWeight = FontWeight.Bold,
fontFamily = FontFamily(Font(R.font.hack))
),
color = Color.Gray
)
Text(
text = value,
style = TextStyle(
fontSize = 12.sp,
fontFamily = FontFamily(Font(R.font.hack))
),
color = Color.Gray
)
}
}
Spacer(modifier = Modifier.height(4.dp))
}
Text(
text = "Raw: ${packetInfo.rawData}",
style = TextStyle(
fontSize = 12.sp,
fontFamily = FontFamily(Font(R.font.hack))
),
color = Color.Gray
)
}
}
}
}
}
}
)
Spacer(modifier = Modifier.height(8.dp))
val airPodsService = ServiceManager.getService()?.let { mutableStateOf(it) }
HorizontalDivider()
Row(
modifier = Modifier
.fillMaxWidth()
.background(if (isSystemInDarkTheme()) Color(0xFF1C1B20) else Color(0xFFF2F2F7)),
verticalAlignment = Alignment.CenterVertically
) {
val packet = remember { mutableStateOf(TextFieldValue("")) }
TextField(
value = packet.value,
onValueChange = { packet.value = it },
label = { Text("Packet") },
modifier = Modifier
.fillMaxWidth()
.padding(horizontal = 8.dp)
.padding(bottom = 5.dp),
trailingIcon = {
IconButton(
onClick = {
if (packet.value.text.isNotBlank()) {
airPodsService?.value?.aacpManager?.sendPacket(
packet.value.text
.split(" ")
.map { it.toInt(16).toByte() }
.toByteArray()
)
packet.value = TextFieldValue("")
focusManager.clearFocus()
if (packetLogs.isNotEmpty()) {
coroutineScope.launch {
try {
delay(100)
listState.animateScrollToItem(
index = (packetLogs.size - 1).coerceAtLeast(0),
scrollOffset = 0
)
} catch (e: Exception) {
e.printStackTrace()
listState.scrollToItem(
index = (packetLogs.size - 1).coerceAtLeast(0)
)
}
}
}
}
}
) {
@Suppress("DEPRECATION")
Icon(Icons.Filled.Send, contentDescription = "Send")
}
},
colors = TextFieldDefaults.colors(
focusedContainerColor = if (isSystemInDarkTheme()) Color(0xFF1C1B20) else Color(0xFFF2F2F7),
unfocusedContainerColor = if (isSystemInDarkTheme()) Color(0xFF1C1B20) else Color(0xFFF2F2F7),
focusedIndicatorColor = Color.Transparent,
unfocusedIndicatorColor = Color.Transparent,
focusedTextColor = if (isSystemInDarkTheme()) Color.White else Color.Black,
unfocusedTextColor = if (isSystemInDarkTheme()) Color.White else Color.Black.copy(alpha = 0.6f),
focusedLabelColor = if (isSystemInDarkTheme()) Color.White.copy(alpha = 0.6f) else Color.Black,
unfocusedLabelColor = if (isSystemInDarkTheme()) Color.White.copy(alpha = 0.6f) else Color.Black.copy(alpha = 0.6f),
),
shape = RoundedCornerShape(12.dp)
)
}
}
}
}

View File

@@ -0,0 +1,747 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
@file:OptIn(ExperimentalEncodingApi::class)
package me.kavishdevar.librepods.screens
import android.content.Context
import android.os.Build
import android.util.Log
import androidx.annotation.RequiresApi
import androidx.compose.animation.AnimatedContent
import androidx.compose.animation.ExperimentalAnimationApi
import androidx.compose.animation.core.tween
import androidx.compose.animation.fadeIn
import androidx.compose.animation.fadeOut
import androidx.compose.animation.slideInVertically
import androidx.compose.animation.togetherWith
import androidx.compose.foundation.Canvas
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Box
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.Spacer
import androidx.compose.foundation.layout.aspectRatio
import androidx.compose.foundation.layout.fillMaxSize
import androidx.compose.foundation.layout.fillMaxWidth
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.rememberScrollState
import androidx.compose.foundation.verticalScroll
import androidx.compose.material3.Card
import androidx.compose.material3.CardDefaults
import androidx.compose.material3.ExperimentalMaterial3Api
import androidx.compose.material3.Text
import androidx.compose.runtime.Composable
import androidx.compose.runtime.DisposableEffect
import androidx.compose.runtime.LaunchedEffect
import androidx.compose.runtime.collectAsState
import androidx.compose.runtime.getValue
import androidx.compose.runtime.mutableFloatStateOf
import androidx.compose.runtime.mutableLongStateOf
import androidx.compose.runtime.mutableStateListOf
import androidx.compose.runtime.mutableStateOf
import androidx.compose.runtime.remember
import androidx.compose.runtime.rememberCoroutineScope
import androidx.compose.runtime.setValue
import androidx.compose.ui.Alignment
import androidx.compose.ui.Modifier
import androidx.compose.ui.geometry.CornerRadius
import androidx.compose.ui.geometry.Offset
import androidx.compose.ui.geometry.Size
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.graphics.Path
import androidx.compose.ui.graphics.StrokeCap
import androidx.compose.ui.graphics.asAndroidPath
import androidx.compose.ui.graphics.drawscope.Stroke
import androidx.compose.ui.graphics.nativeCanvas
import androidx.compose.ui.graphics.toArgb
import androidx.compose.ui.platform.LocalContext
import androidx.compose.ui.res.stringResource
import androidx.compose.ui.text.TextStyle
import androidx.compose.ui.text.drawText
import androidx.compose.ui.text.font.Font
import androidx.compose.ui.text.font.FontFamily
import androidx.compose.ui.text.font.FontWeight
import androidx.compose.ui.text.rememberTextMeasurer
import androidx.compose.ui.text.style.TextAlign
import androidx.compose.ui.tooling.preview.Preview
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.sp
import androidx.navigation.NavController
import com.kyant.backdrop.backdrops.layerBackdrop
import com.kyant.backdrop.backdrops.rememberLayerBackdrop
import dev.chrisbanes.haze.hazeSource
import dev.chrisbanes.haze.materials.ExperimentalHazeMaterialsApi
import kotlinx.coroutines.CoroutineScope
import kotlinx.coroutines.delay
import kotlinx.coroutines.launch
import me.kavishdevar.librepods.R
import me.kavishdevar.librepods.composables.StyledButton
import me.kavishdevar.librepods.composables.StyledIconButton
import me.kavishdevar.librepods.composables.StyledScaffold
import me.kavishdevar.librepods.composables.StyledToggle
import me.kavishdevar.librepods.services.ServiceManager
import me.kavishdevar.librepods.utils.HeadTracking
import kotlin.io.encoding.ExperimentalEncodingApi
import kotlin.math.abs
import kotlin.math.cos
import kotlin.math.sin
import kotlin.random.Random
@ExperimentalHazeMaterialsApi
@RequiresApi(Build.VERSION_CODES.Q)
@OptIn(ExperimentalMaterial3Api::class, ExperimentalAnimationApi::class)
@Composable
fun HeadTrackingScreen(navController: NavController) {
DisposableEffect(Unit) {
ServiceManager.getService()?.startHeadTracking()
onDispose {
ServiceManager.getService()?.stopHeadTracking()
}
}
val isDarkTheme = isSystemInDarkTheme()
if (isDarkTheme) Color(0xFF1C1C1E) else Color(0xFFFFFFFF)
val textColor = if (isDarkTheme) Color.White else Color.Black
val scrollState = rememberScrollState()
val backdrop = rememberLayerBackdrop()
StyledScaffold(
title = stringResource(R.string.head_tracking),
actionButtons = listOf(
{ scaffoldBackdrop ->
var isActive by remember { mutableStateOf(ServiceManager.getService()?.isHeadTrackingActive == true) }
StyledIconButton(
onClick = {
if (ServiceManager.getService()?.isHeadTrackingActive == false) {
ServiceManager.getService()?.startHeadTracking()
Log.d("HeadTrackingScreen", "Head tracking started")
} else {
ServiceManager.getService()?.stopHeadTracking()
Log.d("HeadTrackingScreen", "Head tracking stopped")
}
},
icon = if (isActive) "􀊅" else "􀊃",
darkMode = isDarkTheme,
backdrop = scaffoldBackdrop
)
}
),
) { spacerHeight, hazeState ->
val sharedPreferences = LocalContext.current.getSharedPreferences("settings", Context.MODE_PRIVATE)
var gestureText by remember { mutableStateOf("") }
val coroutineScope = rememberCoroutineScope()
var lastClickTime by remember { mutableLongStateOf(0L) }
var shouldExplode by remember { mutableStateOf(false) }
Column(
modifier = Modifier
.fillMaxWidth(),
horizontalAlignment = Alignment.CenterHorizontally
) {
Column (
modifier = Modifier
.fillMaxWidth()
.hazeSource(state = hazeState)
.layerBackdrop(backdrop)
.padding(top = 8.dp)
.padding(horizontal = 16.dp)
.verticalScroll(scrollState)
) {
Spacer(modifier = Modifier.height(spacerHeight))
StyledToggle(
label = "Head Gestures",
sharedPreferences = sharedPreferences,
sharedPreferenceKey = "head_gestures",
)
Spacer(modifier = Modifier.height(2.dp))
Text(
stringResource(R.string.head_gestures_details),
style = TextStyle(
fontSize = 14.sp,
fontWeight = FontWeight.Normal,
fontFamily = FontFamily(Font(R.font.sf_pro)),
color = textColor.copy(0.6f)
),
modifier = Modifier.padding(start = 4.dp)
)
Spacer(modifier = Modifier.height(16.dp))
Text(
"Head Orientation",
style = TextStyle(
fontSize = 18.sp,
fontWeight = FontWeight.Medium,
fontFamily = FontFamily(Font(R.font.sf_pro)),
color = textColor
),
modifier = Modifier.padding(start = 4.dp, bottom = 8.dp, top = 8.dp)
)
HeadVisualization()
Spacer(modifier = Modifier.height(16.dp))
Text(
"Velocity",
style = TextStyle(
fontSize = 18.sp,
fontWeight = FontWeight.Medium,
fontFamily = FontFamily(Font(R.font.sf_pro)),
color = textColor
),
modifier = Modifier.padding(start = 4.dp, bottom = 8.dp, top = 8.dp)
)
AccelerationPlot()
Spacer(modifier = Modifier.height(16.dp))
LaunchedEffect(gestureText) {
if (gestureText.isNotEmpty()) {
lastClickTime = System.currentTimeMillis()
delay(3000)
if (System.currentTimeMillis() - lastClickTime >= 3000) {
shouldExplode = true
}
}
}
}
val gestureTextValue = stringResource(R.string.shake_your_head_or_nod)
StyledButton(
onClick = {
gestureText = gestureTextValue
coroutineScope.launch {
val accepted = ServiceManager.getService()?.testHeadGestures() ?: false
gestureText = if (accepted) "\"Yes\" gesture detected." else "\"No\" gesture detected."
}
},
backdrop = backdrop,
modifier = Modifier.fillMaxWidth(0.75f),
maxScale = 0.05f
) {
Text(
"Test Head Gestures",
style = TextStyle(
fontSize = 16.sp,
fontWeight = FontWeight.Medium,
fontFamily = FontFamily(Font(R.font.sf_pro)),
color = textColor
),
)
}
Box(
contentAlignment = Alignment.Center,
modifier = Modifier.padding(top = 12.dp, bottom = 24.dp)
) {
AnimatedContent(
targetState = gestureText,
transitionSpec = {
(fadeIn(
animationSpec = tween(300)
) + slideInVertically(
initialOffsetY = { 40 },
animationSpec = tween(300)
)).togetherWith(fadeOut(animationSpec = tween(150)))
}
) { text ->
if (shouldExplode) {
LaunchedEffect(Unit) {
CoroutineScope(coroutineScope.coroutineContext).launch {
delay(750)
gestureText = ""
}
}
ParticleText(
text = text,
style = TextStyle(
fontSize = 20.sp,
fontWeight = FontWeight.Medium,
fontFamily = FontFamily(Font(R.font.sf_pro)),
color = textColor,
textAlign = TextAlign.Center
),
onAnimationComplete = {
shouldExplode = false
},
)
} else {
Text(
text = text,
style = TextStyle(
fontSize = 20.sp,
fontWeight = FontWeight.Medium,
fontFamily = FontFamily(Font(R.font.sf_pro)),
color = textColor,
textAlign = TextAlign.Center
),
modifier = Modifier
.fillMaxWidth()
)
}
}
}
}
}
}
private data class Particle(
val initialPosition: Offset,
val velocity: Offset,
var alpha: Float = 1f
)
@Composable
private fun ParticleText(
text: String,
style: TextStyle,
onAnimationComplete: () -> Unit,
) {
val particles = remember { mutableStateListOf<Particle>() }
val textMeasurer = rememberTextMeasurer()
var isAnimating by remember { mutableStateOf(true) }
var textVisible by remember { mutableStateOf(true) }
Canvas(modifier = Modifier.fillMaxWidth()) {
val textLayoutResult = textMeasurer.measure(text, style)
val textBounds = textLayoutResult.size
val centerX = (size.width - textBounds.width) / 2
val centerY = size.height / 2
if (textVisible && particles.isEmpty()) {
drawText(
textMeasurer = textMeasurer,
text = text,
style = style,
topLeft = Offset(centerX, centerY - textBounds.height / 2)
)
}
if (particles.isEmpty()) {
val random = Random(System.currentTimeMillis())
for (@Suppress("Unused")i in 0..100) {
val x = centerX + random.nextFloat() * textBounds.width
val y = centerY - textBounds.height / 2 + random.nextFloat() * textBounds.height
val vx = (random.nextFloat() - 0.5f) * 20
val vy = (random.nextFloat() - 0.5f) * 20
particles.add(Particle(Offset(x, y), Offset(vx, vy)))
}
}
particles.forEach { particle ->
drawCircle(
color = style.color.copy(alpha = particle.alpha),
radius = 0.5.dp.toPx(),
center = particle.initialPosition
)
}
}
LaunchedEffect(text) {
while (isAnimating) {
delay(16)
particles.forEachIndexed { index, particle ->
particles[index] = particle.copy(
initialPosition = particle.initialPosition + particle.velocity,
alpha = (particle.alpha - 0.02f).coerceAtLeast(0f)
)
}
if (particles.all { it.alpha <= 0f }) {
isAnimating = false
onAnimationComplete()
}
}
}
}
@Composable
private fun HeadVisualization() {
val orientation by HeadTracking.orientation.collectAsState()
val darkTheme = isSystemInDarkTheme()
val backgroundColor = if (darkTheme) Color(0xFF1C1C1E) else Color.White
val strokeColor = if (darkTheme) Color.White else Color.Black
Card(
modifier = Modifier
.fillMaxWidth()
.aspectRatio(2f),
colors = CardDefaults.cardColors(
containerColor = backgroundColor
)
) {
Box(
modifier = Modifier.fillMaxSize(),
contentAlignment = Alignment.Center
) {
Canvas(
modifier = Modifier
.fillMaxSize()
.padding(16.dp)
) {
val width = size.width
val height = size.height
val center = Offset(width / 2, height / 2)
val faceRadius = height * 0.35f
val pitch = Math.toRadians(orientation.pitch.toDouble())
val yaw = Math.toRadians(orientation.yaw.toDouble())
val cosY = cos(yaw).toFloat()
val sinY = sin(yaw).toFloat()
val cosP = cos(pitch).toFloat()
val sinP = sin(pitch).toFloat()
fun rotate3D(point: Triple<Float, Float, Float>): Triple<Float, Float, Float> {
val (x, y, z) = point
val x1 = x * cosY - z * sinY
val z1 = x * sinY + z * cosY
val y2 = y * cosP - z1 * sinP
val z2 = y * sinP + z1 * cosP
return Triple(x1, y2, z2)
}
fun project(point: Triple<Float, Float, Float>): Pair<Float, Float> {
val (x, y, z) = point
val scale = 1f + (z / width)
return Pair(center.x + x * scale, center.y + y * scale)
}
val earWidth = height * 0.08f
val earHeight = height * 0.2f
val earOffsetX = height * 0.4f
val earOffsetY = 0f
val earZ = 0f
for (xSign in listOf(-1f, 1f)) {
val rotated = rotate3D(Triple(earOffsetX * xSign, earOffsetY, earZ))
val (earX, earY) = project(rotated)
drawRoundRect(
color = strokeColor,
topLeft = Offset(earX - earWidth/2, earY - earHeight/2),
size = Size(earWidth, earHeight),
cornerRadius = CornerRadius(earWidth/2),
style = Stroke(width = 4.dp.toPx())
)
}
val spherePath = Path()
val firstPoint = project(rotate3D(Triple(faceRadius, 0f, 0f)))
spherePath.moveTo(firstPoint.first, firstPoint.second)
for (i in 1..32) {
val angle = (i * 2 * Math.PI / 32).toFloat()
val point = project(rotate3D(Triple(
cos(angle) * faceRadius,
sin(angle) * faceRadius,
0f
)))
spherePath.lineTo(point.first, point.second)
}
spherePath.close()
drawContext.canvas.nativeCanvas.apply {
val paint = android.graphics.Paint().apply {
style = android.graphics.Paint.Style.FILL
shader = android.graphics.RadialGradient(
center.x + sinY * faceRadius * 0.3f,
center.y - sinP * faceRadius * 0.3f,
faceRadius * 1.4f,
intArrayOf(
backgroundColor.copy(alpha = 1f).toArgb(),
backgroundColor.copy(alpha = 0.95f).toArgb(),
backgroundColor.copy(alpha = 0.9f).toArgb(),
backgroundColor.copy(alpha = 0.8f).toArgb(),
backgroundColor.copy(alpha = 0.7f).toArgb()
),
floatArrayOf(0.3f, 0.5f, 0.7f, 0.8f, 1f),
android.graphics.Shader.TileMode.CLAMP
)
}
drawPath(spherePath.asAndroidPath(), paint)
val highlightPaint = android.graphics.Paint().apply {
style = android.graphics.Paint.Style.FILL
shader = android.graphics.RadialGradient(
center.x - faceRadius * 0.4f - sinY * faceRadius * 0.5f,
center.y - faceRadius * 0.4f - sinP * faceRadius * 0.5f,
faceRadius * 0.9f,
intArrayOf(
android.graphics.Color.WHITE,
android.graphics.Color.argb(100, 255, 255, 255),
android.graphics.Color.TRANSPARENT
),
floatArrayOf(0f, 0.3f, 1f),
android.graphics.Shader.TileMode.CLAMP
)
alpha = if (darkTheme) 30 else 60
}
drawPath(spherePath.asAndroidPath(), highlightPaint)
val secondaryHighlightPaint = android.graphics.Paint().apply {
style = android.graphics.Paint.Style.FILL
shader = android.graphics.RadialGradient(
center.x + faceRadius * 0.3f + sinY * faceRadius * 0.3f,
center.y + faceRadius * 0.3f - sinP * faceRadius * 0.3f,
faceRadius * 0.7f,
intArrayOf(
android.graphics.Color.WHITE,
android.graphics.Color.TRANSPARENT
),
floatArrayOf(0f, 1f),
android.graphics.Shader.TileMode.CLAMP
)
alpha = if (darkTheme) 15 else 30
}
drawPath(spherePath.asAndroidPath(), secondaryHighlightPaint)
val shadowPaint = android.graphics.Paint().apply {
style = android.graphics.Paint.Style.FILL
shader = android.graphics.RadialGradient(
center.x + sinY * faceRadius * 0.5f,
center.y - sinP * faceRadius * 0.5f,
faceRadius * 1.1f,
intArrayOf(
android.graphics.Color.TRANSPARENT,
android.graphics.Color.BLACK
),
floatArrayOf(0.7f, 1f),
android.graphics.Shader.TileMode.CLAMP
)
alpha = if (darkTheme) 40 else 20
}
drawPath(spherePath.asAndroidPath(), shadowPaint)
}
drawPath(
path = spherePath,
color = strokeColor,
style = Stroke(width = 4.dp.toPx())
)
val smileRadius = faceRadius * 0.5f
val smileStartAngle = -340f
val smileSweepAngle = 140f
val smileOffsetY = faceRadius * 0.1f
val smilePath = Path()
for (i in 0..32) {
val angle = Math.toRadians(smileStartAngle + (smileSweepAngle * i / 32.0))
val x = cos(angle.toFloat()) * smileRadius
val y = sin(angle.toFloat()) * smileRadius + smileOffsetY
val rotated = rotate3D(Triple(x, y, 0f))
val projected = project(rotated)
if (i == 0) {
smilePath.moveTo(projected.first, projected.second)
} else {
smilePath.lineTo(projected.first, projected.second)
}
}
drawPath(
path = smilePath,
color = strokeColor,
style = Stroke(
width = 4.dp.toPx(),
cap = StrokeCap.Round
)
)
val eyeOffsetX = height * 0.15f
val eyeOffsetY = height * 0.1f
val eyeLength = height * 0.08f
for (xSign in listOf(-1f, 1f)) {
val rotated = rotate3D(Triple(eyeOffsetX * xSign, -eyeOffsetY, 0f))
val (eyeX, eyeY) = project(rotated)
drawLine(
color = strokeColor,
start = Offset(eyeX, eyeY - eyeLength/2),
end = Offset(eyeX, eyeY + eyeLength/2),
strokeWidth = 4.dp.toPx(),
cap = StrokeCap.Round
)
}
drawContext.canvas.nativeCanvas.apply {
val paint = android.graphics.Paint().apply {
color = if (darkTheme) android.graphics.Color.WHITE else android.graphics.Color.BLACK
textSize = 12.sp.toPx()
textAlign = android.graphics.Paint.Align.RIGHT
typeface = android.graphics.Typeface.create(
"SF Pro",
android.graphics.Typeface.NORMAL
)
}
val pitch = orientation.pitch.toInt()
val yaw = orientation.yaw.toInt()
val text = "Pitch: ${pitch}° Yaw: ${yaw}°"
drawText(
text,
width - 8.dp.toPx(),
height - 8.dp.toPx(),
paint
)
}
}
}
}
}
@Composable
private fun AccelerationPlot() {
val acceleration by HeadTracking.acceleration.collectAsState()
val maxPoints = 100
val points = remember { mutableStateListOf<Pair<Float, Float>>() }
val darkTheme = isSystemInDarkTheme()
var maxAbs by remember { mutableFloatStateOf(1000f) }
LaunchedEffect(acceleration) {
points.add(Pair(acceleration.horizontal, acceleration.vertical))
if (points.size > maxPoints) {
points.removeAt(0)
}
val currentMax = points.maxOf { maxOf(abs(it.first), abs(it.second)) }
maxAbs = maxOf(currentMax * 1.2f, 1000f)
}
Card(
modifier = Modifier
.fillMaxWidth()
.height(300.dp),
colors = CardDefaults.cardColors(
containerColor = if (darkTheme) Color(0xFF1C1C1E) else Color.White
)
) {
Box(
modifier = Modifier
.fillMaxSize()
.padding(16.dp)
) {
Canvas(
modifier = Modifier.fillMaxSize()
) {
val width = size.width
val height = size.height
val xScale = width / maxPoints
val yScale = (height - 40.dp.toPx()) / (maxAbs * 2)
val zeroY = height / 2
val gridColor = if (darkTheme) Color.White.copy(alpha = 0.1f) else Color.Black.copy(alpha = 0.1f)
for (i in 0..maxPoints step 10) {
val x = i * xScale
drawLine(
color = gridColor,
start = Offset(x, 0f),
end = Offset(x, height),
strokeWidth = 1.dp.toPx()
)
}
val gridStep = maxAbs / 4
for (value in (-maxAbs.toInt()..maxAbs.toInt()) step gridStep.toInt()) {
val y = zeroY - value * yScale
drawLine(
color = gridColor,
start = Offset(0f, y),
end = Offset(width, y),
strokeWidth = 1.dp.toPx()
)
}
drawLine(
color = if (darkTheme) Color.White.copy(alpha = 0.3f) else Color.Black.copy(alpha = 0.3f),
start = Offset(0f, zeroY),
end = Offset(width, zeroY),
strokeWidth = 1.5f.dp.toPx()
)
if (points.size > 1) {
for (i in 0 until points.size - 1) {
val x1 = i * xScale
val x2 = (i + 1) * xScale
drawLine(
color = Color(0xFF007AFF),
start = Offset(x1, zeroY - points[i].first * yScale),
end = Offset(x2, zeroY - points[i + 1].first * yScale),
strokeWidth = 2.dp.toPx()
)
drawLine(
color = Color(0xFFFF3B30),
start = Offset(x1, zeroY - points[i].second * yScale),
end = Offset(x2, zeroY - points[i + 1].second * yScale),
strokeWidth = 2.dp.toPx()
)
}
}
drawContext.canvas.nativeCanvas.apply {
val paint = android.graphics.Paint().apply {
color = if (darkTheme) android.graphics.Color.WHITE else android.graphics.Color.BLACK
textSize = 12.sp.toPx()
textAlign = android.graphics.Paint.Align.RIGHT
}
drawText("${maxAbs.toInt()}", 30.dp.toPx(), 20.dp.toPx(), paint)
drawText("0", 30.dp.toPx(), height/2, paint)
drawText("-${maxAbs.toInt()}", 30.dp.toPx(), height - 10.dp.toPx(), paint)
}
val legendY = 15.dp.toPx()
val textOffsetY = legendY + 5.dp.toPx() / 2
drawCircle(Color(0xFF007AFF), 5.dp.toPx(), Offset(width - 150.dp.toPx(), legendY))
drawContext.canvas.nativeCanvas.apply {
val paint = android.graphics.Paint().apply {
color = if (darkTheme) android.graphics.Color.WHITE else android.graphics.Color.BLACK
textSize = 12.sp.toPx()
textAlign = android.graphics.Paint.Align.LEFT
}
drawText("Horizontal", width - 140.dp.toPx(), textOffsetY, paint)
}
drawCircle(Color(0xFFFF3B30), 5.dp.toPx(), Offset(width - 70.dp.toPx(), legendY))
drawContext.canvas.nativeCanvas.apply {
val paint = android.graphics.Paint().apply {
color = if (darkTheme) android.graphics.Color.WHITE else android.graphics.Color.BLACK
textSize = 12.sp.toPx()
textAlign = android.graphics.Paint.Align.LEFT
}
drawText("Vertical", width - 60.dp.toPx(), textOffsetY, paint)
}
}
}
}
}
@ExperimentalHazeMaterialsApi
@RequiresApi(Build.VERSION_CODES.Q)
@Preview
@Composable
fun HeadTrackingScreenPreview() {
HeadTrackingScreen(navController = NavController(LocalContext.current))
}

View File

@@ -0,0 +1,341 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.screens
import android.annotation.SuppressLint
import android.util.Log
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Arrangement
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.Spacer
import androidx.compose.foundation.layout.fillMaxSize
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.rememberScrollState
import androidx.compose.foundation.verticalScroll
import androidx.compose.material3.ExperimentalMaterial3Api
import androidx.compose.runtime.Composable
import androidx.compose.runtime.DisposableEffect
import androidx.compose.runtime.LaunchedEffect
import androidx.compose.runtime.MutableState
import androidx.compose.runtime.mutableFloatStateOf
import androidx.compose.runtime.mutableIntStateOf
import androidx.compose.runtime.mutableStateOf
import androidx.compose.runtime.remember
import androidx.compose.ui.Modifier
import androidx.compose.ui.res.stringResource
import androidx.compose.ui.unit.dp
import androidx.navigation.NavController
import com.kyant.backdrop.backdrops.layerBackdrop
import com.kyant.backdrop.backdrops.rememberLayerBackdrop
import dev.chrisbanes.haze.HazeState
import dev.chrisbanes.haze.hazeSource
import dev.chrisbanes.haze.materials.ExperimentalHazeMaterialsApi
import kotlinx.coroutines.Job
import kotlinx.coroutines.delay
import me.kavishdevar.librepods.R
import me.kavishdevar.librepods.composables.StyledScaffold
import me.kavishdevar.librepods.composables.StyledSlider
import me.kavishdevar.librepods.composables.StyledToggle
import me.kavishdevar.librepods.services.ServiceManager
import me.kavishdevar.librepods.utils.AACPManager
import me.kavishdevar.librepods.utils.ATTHandles
import me.kavishdevar.librepods.utils.HearingAidSettings
import me.kavishdevar.librepods.utils.parseHearingAidSettingsResponse
import me.kavishdevar.librepods.utils.sendHearingAidSettings
import java.io.IOException
import kotlin.io.encoding.ExperimentalEncodingApi
private var debounceJob: MutableState<Job?> = mutableStateOf(null)
private const val TAG = "HearingAidAdjustments"
@SuppressLint("DefaultLocale")
@ExperimentalHazeMaterialsApi
@OptIn(ExperimentalMaterial3Api::class, ExperimentalEncodingApi::class)
@Composable
fun HearingAidAdjustmentsScreen(@Suppress("unused") navController: NavController) {
isSystemInDarkTheme()
val verticalScrollState = rememberScrollState()
val hazeState = remember { HazeState() }
val attManager = ServiceManager.getService()?.attManager ?: throw IllegalStateException("ATTManager not available")
val aacpManager = remember { ServiceManager.getService()?.aacpManager }
val backdrop = rememberLayerBackdrop()
StyledScaffold(
title = stringResource(R.string.adjustments)
) { spacerHeight ->
Column(
modifier = Modifier
.hazeSource(hazeState)
.fillMaxSize()
.layerBackdrop(backdrop)
.verticalScroll(verticalScrollState)
.padding(horizontal = 16.dp),
verticalArrangement = Arrangement.spacedBy(16.dp)
) {
Spacer(modifier = Modifier.height(spacerHeight))
val amplificationSliderValue = remember { mutableFloatStateOf(0.5f) }
val balanceSliderValue = remember { mutableFloatStateOf(0.5f) }
val toneSliderValue = remember { mutableFloatStateOf(0.5f) }
val ambientNoiseReductionSliderValue = remember { mutableFloatStateOf(0.0f) }
val conversationBoostEnabled = remember { mutableStateOf(false) }
val eq = remember { mutableStateOf(FloatArray(8)) }
val ownVoiceAmplification = remember { mutableFloatStateOf(0.5f) }
val phoneMediaEQ = remember { mutableStateOf(FloatArray(8) { 0.5f }) }
val phoneEQEnabled = remember { mutableStateOf(false) }
val mediaEQEnabled = remember { mutableStateOf(false) }
val initialLoadComplete = remember { mutableStateOf(false) }
val initialReadSucceeded = remember { mutableStateOf(false) }
val initialReadAttempts = remember { mutableIntStateOf(0) }
val hearingAidSettings = remember {
mutableStateOf(
HearingAidSettings(
leftEQ = eq.value,
rightEQ = eq.value,
leftAmplification = amplificationSliderValue.floatValue + (0.5f - balanceSliderValue.floatValue) * amplificationSliderValue.floatValue * 2,
rightAmplification = amplificationSliderValue.floatValue + (balanceSliderValue.floatValue - 0.5f) * amplificationSliderValue.floatValue * 2,
leftTone = toneSliderValue.floatValue,
rightTone = toneSliderValue.floatValue,
leftConversationBoost = conversationBoostEnabled.value,
rightConversationBoost = conversationBoostEnabled.value,
leftAmbientNoiseReduction = ambientNoiseReductionSliderValue.floatValue,
rightAmbientNoiseReduction = ambientNoiseReductionSliderValue.floatValue,
netAmplification = amplificationSliderValue.floatValue,
balance = balanceSliderValue.floatValue,
ownVoiceAmplification = ownVoiceAmplification.floatValue
)
)
}
val hearingAidEnabled = remember {
val aidStatus = aacpManager?.controlCommandStatusList?.find { it.identifier == AACPManager.Companion.ControlCommandIdentifiers.HEARING_AID }
val assistStatus = aacpManager?.controlCommandStatusList?.find { it.identifier == AACPManager.Companion.ControlCommandIdentifiers.HEARING_ASSIST_CONFIG }
mutableStateOf((aidStatus?.value?.getOrNull(1) == 0x01.toByte()) && (assistStatus?.value?.getOrNull(0) == 0x01.toByte()))
}
val hearingAidListener = remember {
object : AACPManager.ControlCommandListener {
override fun onControlCommandReceived(controlCommand: AACPManager.ControlCommand) {
if (controlCommand.identifier == AACPManager.Companion.ControlCommandIdentifiers.HEARING_AID.value ||
controlCommand.identifier == AACPManager.Companion.ControlCommandIdentifiers.HEARING_ASSIST_CONFIG.value) {
val aidStatus = aacpManager?.controlCommandStatusList?.find { it.identifier == AACPManager.Companion.ControlCommandIdentifiers.HEARING_AID }
val assistStatus = aacpManager?.controlCommandStatusList?.find { it.identifier == AACPManager.Companion.ControlCommandIdentifiers.HEARING_ASSIST_CONFIG }
hearingAidEnabled.value = (aidStatus?.value?.getOrNull(1) == 0x01.toByte()) && (assistStatus?.value?.getOrNull(0) == 0x01.toByte())
}
}
}
}
val hearingAidATTListener = remember {
object : (ByteArray) -> Unit {
override fun invoke(value: ByteArray) {
val parsed = parseHearingAidSettingsResponse(value)
if (parsed != null) {
amplificationSliderValue.floatValue = parsed.netAmplification
balanceSliderValue.floatValue = parsed.balance
toneSliderValue.floatValue = parsed.leftTone
ambientNoiseReductionSliderValue.floatValue = parsed.leftAmbientNoiseReduction
conversationBoostEnabled.value = parsed.leftConversationBoost
eq.value = parsed.leftEQ.copyOf()
ownVoiceAmplification.floatValue = parsed.ownVoiceAmplification
Log.d(TAG, "Updated hearing aid settings from notification")
} else {
Log.w(TAG, "Failed to parse hearing aid settings from notification")
}
}
}
}
LaunchedEffect(Unit) {
aacpManager?.registerControlCommandListener(AACPManager.Companion.ControlCommandIdentifiers.HEARING_AID, hearingAidListener)
aacpManager?.registerControlCommandListener(AACPManager.Companion.ControlCommandIdentifiers.HEARING_ASSIST_CONFIG, hearingAidListener)
}
DisposableEffect(Unit) {
onDispose {
aacpManager?.unregisterControlCommandListener(AACPManager.Companion.ControlCommandIdentifiers.HEARING_AID, hearingAidListener)
aacpManager?.unregisterControlCommandListener(AACPManager.Companion.ControlCommandIdentifiers.HEARING_ASSIST_CONFIG, hearingAidListener)
attManager.unregisterListener(ATTHandles.HEARING_AID, hearingAidATTListener)
}
}
LaunchedEffect(amplificationSliderValue.floatValue, balanceSliderValue.floatValue, toneSliderValue.floatValue, conversationBoostEnabled.value, ambientNoiseReductionSliderValue.floatValue, ownVoiceAmplification.floatValue, initialLoadComplete.value, initialReadSucceeded.value) {
if (!initialLoadComplete.value) {
Log.d(TAG, "Initial device load not complete - skipping send")
return@LaunchedEffect
}
if (!initialReadSucceeded.value) {
Log.d(TAG, "Initial device read not successful yet - skipping send until read succeeds")
return@LaunchedEffect
}
hearingAidSettings.value = HearingAidSettings(
leftEQ = eq.value,
rightEQ = eq.value,
leftAmplification = amplificationSliderValue.floatValue + if (balanceSliderValue.floatValue < 0) -balanceSliderValue.floatValue else 0f,
rightAmplification = amplificationSliderValue.floatValue + if (balanceSliderValue.floatValue > 0) balanceSliderValue.floatValue else 0f,
leftTone = toneSliderValue.floatValue,
rightTone = toneSliderValue.floatValue,
leftConversationBoost = conversationBoostEnabled.value,
rightConversationBoost = conversationBoostEnabled.value,
leftAmbientNoiseReduction = ambientNoiseReductionSliderValue.floatValue,
rightAmbientNoiseReduction = ambientNoiseReductionSliderValue.floatValue,
netAmplification = amplificationSliderValue.floatValue,
balance = balanceSliderValue.floatValue,
ownVoiceAmplification = ownVoiceAmplification.floatValue
)
Log.d(TAG, "Updated settings: ${hearingAidSettings.value}")
sendHearingAidSettings(attManager, hearingAidSettings.value, debounceJob)
}
LaunchedEffect(Unit) {
Log.d(TAG, "Connecting to ATT...")
try {
attManager.enableNotifications(ATTHandles.HEARING_AID)
attManager.registerListener(ATTHandles.HEARING_AID, hearingAidATTListener)
try {
if (aacpManager != null) {
Log.d(TAG, "Found AACPManager, reading cached EQ data")
val aacpEQ = aacpManager.eqData
if (aacpEQ.isNotEmpty()) {
eq.value = aacpEQ.copyOf()
phoneMediaEQ.value = aacpEQ.copyOf()
phoneEQEnabled.value = aacpManager.eqOnPhone
mediaEQEnabled.value = aacpManager.eqOnMedia
Log.d(TAG, "Populated EQ from AACPManager: ${aacpEQ.toList()}")
} else {
Log.d(TAG, "AACPManager EQ data empty")
}
} else {
Log.d(TAG, "No AACPManager available")
}
} catch (e: Exception) {
Log.w(TAG, "Error reading EQ from AACPManager: ${e.message}")
}
var parsedSettings: HearingAidSettings? = null
for (attempt in 1..3) {
initialReadAttempts.intValue = attempt
try {
val data = attManager.read(ATTHandles.HEARING_AID)
parsedSettings = parseHearingAidSettingsResponse(data = data)
if (parsedSettings != null) {
Log.d(TAG, "Parsed settings on attempt $attempt")
break
} else {
Log.d(TAG, "Parsing returned null on attempt $attempt")
}
} catch (e: Exception) {
Log.w(TAG, "Read attempt $attempt failed: ${e.message}")
}
delay(200)
}
if (parsedSettings != null) {
Log.d(TAG, "Initial hearing aid settings: $parsedSettings")
amplificationSliderValue.floatValue = parsedSettings.netAmplification
balanceSliderValue.floatValue = parsedSettings.balance
toneSliderValue.floatValue = parsedSettings.leftTone
ambientNoiseReductionSliderValue.floatValue = parsedSettings.leftAmbientNoiseReduction
conversationBoostEnabled.value = parsedSettings.leftConversationBoost
eq.value = parsedSettings.leftEQ.copyOf()
ownVoiceAmplification.floatValue = parsedSettings.ownVoiceAmplification
initialReadSucceeded.value = true
} else {
Log.d(TAG, "Failed to read/parse initial hearing aid settings after ${initialReadAttempts.intValue} attempts")
}
} catch (e: IOException) {
e.printStackTrace()
} finally {
initialLoadComplete.value = true
}
}
StyledSlider(
label = stringResource(R.string.amplification),
valueRange = -1f..1f,
mutableFloatState = amplificationSliderValue,
onValueChange = {
amplificationSliderValue.floatValue = it
},
startIcon = "􀊥",
endIcon = "􀊩",
independent = true,
)
StyledToggle(
label = stringResource(R.string.swipe_to_control_amplification),
controlCommandIdentifier = AACPManager.Companion.ControlCommandIdentifiers.HPS_GAIN_SWIPE,
description = stringResource(R.string.swipe_amplification_description)
)
StyledSlider(
label = stringResource(R.string.balance),
valueRange = -1f..1f,
mutableFloatState = balanceSliderValue,
onValueChange = {
balanceSliderValue.floatValue = it
},
snapPoints = listOf(-1f, 0f, 1f),
startLabel = stringResource(R.string.left),
endLabel = stringResource(R.string.right),
independent = true,
)
StyledSlider(
label = stringResource(R.string.tone),
valueRange = -1f..1f,
mutableFloatState = toneSliderValue,
onValueChange = {
toneSliderValue.floatValue = it
},
startLabel = stringResource(R.string.darker),
endLabel = stringResource(R.string.brighter),
independent = true,
)
StyledSlider(
label = stringResource(R.string.ambient_noise_reduction),
valueRange = 0f..1f,
mutableFloatState = ambientNoiseReductionSliderValue,
onValueChange = {
ambientNoiseReductionSliderValue.floatValue = it
},
startLabel = stringResource(R.string.less),
endLabel = stringResource(R.string.more),
independent = true,
)
StyledToggle(
label = stringResource(R.string.conversation_boost),
checkedState = conversationBoostEnabled,
independent = true,
description = stringResource(R.string.conversation_boost_description)
)
}
}
}

View File

@@ -0,0 +1,294 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.screens
import android.annotation.SuppressLint
import android.util.Log
import androidx.compose.foundation.background
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Arrangement
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.Spacer
import androidx.compose.foundation.layout.fillMaxSize
import androidx.compose.foundation.layout.fillMaxWidth
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.rememberScrollState
import androidx.compose.foundation.shape.RoundedCornerShape
import androidx.compose.foundation.verticalScroll
import androidx.compose.material3.ExperimentalMaterial3Api
import androidx.compose.material3.HorizontalDivider
import androidx.compose.material3.SnackbarHostState
import androidx.compose.material3.Text
import androidx.compose.runtime.Composable
import androidx.compose.runtime.DisposableEffect
import androidx.compose.runtime.LaunchedEffect
import androidx.compose.runtime.mutableStateOf
import androidx.compose.runtime.remember
import androidx.compose.ui.Modifier
import androidx.compose.ui.draw.clip
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.res.stringResource
import androidx.compose.ui.text.TextStyle
import androidx.compose.ui.text.font.Font
import androidx.compose.ui.text.font.FontFamily
import androidx.compose.ui.text.font.FontWeight
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.sp
import androidx.navigation.NavController
import com.kyant.backdrop.backdrops.layerBackdrop
import com.kyant.backdrop.backdrops.rememberLayerBackdrop
import dev.chrisbanes.haze.HazeState
import dev.chrisbanes.haze.hazeSource
import dev.chrisbanes.haze.materials.ExperimentalHazeMaterialsApi
import kotlinx.coroutines.CoroutineScope
import kotlinx.coroutines.Dispatchers
import kotlinx.coroutines.launch
import me.kavishdevar.librepods.R
import me.kavishdevar.librepods.composables.ConfirmationDialog
import me.kavishdevar.librepods.composables.NavigationButton
import me.kavishdevar.librepods.composables.StyledScaffold
import me.kavishdevar.librepods.composables.StyledToggle
import me.kavishdevar.librepods.services.ServiceManager
import me.kavishdevar.librepods.utils.AACPManager
import me.kavishdevar.librepods.utils.ATTHandles
import me.kavishdevar.librepods.utils.parseTransparencySettingsResponse
import me.kavishdevar.librepods.utils.sendTransparencySettings
import kotlin.io.encoding.ExperimentalEncodingApi
private const val TAG = "AccessibilitySettings"
@SuppressLint("DefaultLocale")
@ExperimentalHazeMaterialsApi
@OptIn(ExperimentalMaterial3Api::class, ExperimentalEncodingApi::class)
@Composable
fun HearingAidScreen(navController: NavController) {
val isDarkTheme = isSystemInDarkTheme()
val textColor = if (isDarkTheme) Color.White else Color.Black
val verticalScrollState = rememberScrollState()
val snackbarHostState = remember { SnackbarHostState() }
val attManager = ServiceManager.getService()?.attManager ?: return
val aacpManager = remember { ServiceManager.getService()?.aacpManager }
val showDialog = remember { mutableStateOf(false) }
val backdrop = rememberLayerBackdrop()
val initialLoad = remember { mutableStateOf(true) }
val hearingAidEnabled = remember {
val aidStatus = aacpManager?.controlCommandStatusList?.find { it.identifier == AACPManager.Companion.ControlCommandIdentifiers.HEARING_AID }
val assistStatus = aacpManager?.controlCommandStatusList?.find { it.identifier == AACPManager.Companion.ControlCommandIdentifiers.HEARING_ASSIST_CONFIG }
mutableStateOf((aidStatus?.value?.getOrNull(1) == 0x01.toByte()) && (assistStatus?.value?.getOrNull(0) == 0x01.toByte()))
}
val hazeStateS = remember { mutableStateOf(HazeState()) } // dont question this. i could possibly use something other than initializing it with an empty state and then replacing it with the the one provided by the scaffold
StyledScaffold(
title = stringResource(R.string.hearing_aid),
snackbarHostState = snackbarHostState,
) { spacerHeight, hazeState ->
Column(
modifier = Modifier
.layerBackdrop(backdrop)
.hazeSource(hazeState)
.fillMaxSize()
.verticalScroll(verticalScrollState)
.padding(horizontal = 16.dp),
verticalArrangement = Arrangement.spacedBy(8.dp)
) {
hazeStateS.value = hazeState
Spacer(modifier = Modifier.height(spacerHeight))
val hearingAidListener = remember {
object : AACPManager.ControlCommandListener {
override fun onControlCommandReceived(controlCommand: AACPManager.ControlCommand) {
if (controlCommand.identifier == AACPManager.Companion.ControlCommandIdentifiers.HEARING_AID.value ||
controlCommand.identifier == AACPManager.Companion.ControlCommandIdentifiers.HEARING_ASSIST_CONFIG.value) {
val aidStatus = aacpManager?.controlCommandStatusList?.find { it.identifier == AACPManager.Companion.ControlCommandIdentifiers.HEARING_AID }
val assistStatus = aacpManager?.controlCommandStatusList?.find { it.identifier == AACPManager.Companion.ControlCommandIdentifiers.HEARING_ASSIST_CONFIG }
hearingAidEnabled.value = (aidStatus?.value?.getOrNull(1) == 0x01.toByte()) && (assistStatus?.value?.getOrNull(0) == 0x01.toByte())
}
}
}
}
// val mediaAssistEnabled = remember { mutableStateOf(false) }
// val adjustMediaEnabled = remember { mutableStateOf(false) }
// val adjustPhoneEnabled = remember { mutableStateOf(false) }
LaunchedEffect(Unit) {
aacpManager?.registerControlCommandListener(AACPManager.Companion.ControlCommandIdentifiers.HEARING_AID, hearingAidListener)
aacpManager?.registerControlCommandListener(AACPManager.Companion.ControlCommandIdentifiers.HEARING_ASSIST_CONFIG, hearingAidListener)
}
DisposableEffect(Unit) {
onDispose {
aacpManager?.unregisterControlCommandListener(AACPManager.Companion.ControlCommandIdentifiers.HEARING_AID, hearingAidListener)
aacpManager?.unregisterControlCommandListener(AACPManager.Companion.ControlCommandIdentifiers.HEARING_ASSIST_CONFIG, hearingAidListener)
}
}
LaunchedEffect(hearingAidEnabled.value) {
if (hearingAidEnabled.value && !initialLoad.value) {
showDialog.value = true
} else if (!hearingAidEnabled.value && !initialLoad.value) {
aacpManager?.sendControlCommand(AACPManager.Companion.ControlCommandIdentifiers.HEARING_AID.value, byteArrayOf(0x01, 0x02))
aacpManager?.sendControlCommand(AACPManager.Companion.ControlCommandIdentifiers.HEARING_ASSIST_CONFIG.value, 0x02.toByte())
hearingAidEnabled.value = false
}
initialLoad.value = false
}
// fun onAdjustPhoneChange(value: Boolean) {
// // TODO
// }
// fun onAdjustMediaChange(value: Boolean) {
// // TODO
// }
Text(
text = stringResource(R.string.hearing_aid),
style = TextStyle(
fontSize = 14.sp,
fontWeight = FontWeight.Bold,
color = textColor.copy(alpha = 0.6f),
fontFamily = FontFamily(Font(R.font.sf_pro))
),
modifier = Modifier.padding(16.dp, bottom = 2.dp)
)
val backgroundColor = if (isDarkTheme) Color(0xFF1C1C1E) else Color(0xFFFFFFFF)
Column(
modifier = Modifier
.fillMaxWidth()
.background(backgroundColor, RoundedCornerShape(28.dp))
.clip(
RoundedCornerShape(28.dp)
)
) {
StyledToggle(
label = stringResource(R.string.hearing_aid),
checkedState = hearingAidEnabled,
independent = false
)
HorizontalDivider(
thickness = 1.dp,
color = Color(0x40888888),
modifier = Modifier
.padding(horizontal = 12.dp)
)
NavigationButton(
to = "hearing_aid_adjustments",
name = stringResource(R.string.adjustments),
navController,
independent = false
)
}
Text(
text = stringResource(R.string.hearing_aid_description),
style = TextStyle(
fontSize = 12.sp,
fontWeight = FontWeight.Light,
color = (if (isSystemInDarkTheme()) Color.White else Color.Black).copy(alpha = 0.6f),
fontFamily = FontFamily(Font(R.font.sf_pro))
),
modifier = Modifier.padding(horizontal = 16.dp)
)
Spacer(modifier = Modifier.height(16.dp))
NavigationButton(
to = "update_hearing_test",
name = stringResource(R.string.update_hearing_test),
navController,
independent = true
)
// not implemented yet
// StyledToggle(
// title = stringResource(R.string.media_assist),
// label = stringResource(R.string.media_assist),
// checkedState = mediaAssistEnabled,
// independent = true,
// description = stringResource(R.string.media_assist_description)
// )
// Spacer(modifier = Modifier.height(8.dp))
// Column (
// modifier = Modifier
// .fillMaxWidth()
// .background(backgroundColor, RoundedCornerShape(28.dp))
// ) {
// StyledToggle(
// label = stringResource(R.string.adjust_media),
// checkedState = adjustMediaEnabled,
// onCheckedChange = { onAdjustMediaChange(it) },
// independent = false
// )
// HorizontalDivider(
// thickness = 1.dp,
// color = Color(0x40888888),
// modifier = Modifier
// .padding(horizontal = 12.dp)
// )
// StyledToggle(
// label = stringResource(R.string.adjust_calls),
// checkedState = adjustPhoneEnabled,
// onCheckedChange = { onAdjustPhoneChange(it) },
// independent = false
// )
// }
}
}
ConfirmationDialog(
showDialog = showDialog,
title = "Enable Hearing Aid",
message = "Enabling Hearing Aid will disable Headphone Accommodation and Customized Transparency Mode.",
confirmText = "Enable",
dismissText = "Cancel",
onConfirm = {
showDialog.value = false
val enrolled = aacpManager?.controlCommandStatusList?.find { it.identifier == AACPManager.Companion.ControlCommandIdentifiers.HEARING_AID }?.value?.getOrNull(0) == 0x01.toByte()
if (!enrolled) {
aacpManager?.sendControlCommand(AACPManager.Companion.ControlCommandIdentifiers.HEARING_AID.value, byteArrayOf(0x01, 0x01))
} else {
aacpManager.sendControlCommand(AACPManager.Companion.ControlCommandIdentifiers.HEARING_AID.value, byteArrayOf(0x01, 0x01))
}
aacpManager?.sendControlCommand(AACPManager.Companion.ControlCommandIdentifiers.HEARING_ASSIST_CONFIG.value, 0x01.toByte())
hearingAidEnabled.value = true
CoroutineScope(Dispatchers.IO).launch {
try {
val data = attManager.read(ATTHandles.TRANSPARENCY)
val parsed = parseTransparencySettingsResponse(data)
val disabledSettings = parsed.copy(enabled = false)
sendTransparencySettings(attManager, disabledSettings)
} catch (e: Exception) {
Log.e(TAG, "Error disabling transparency: ${e.message}")
}
}
},
hazeState = hazeStateS.value,
// backdrop = backdrop
)
}

View File

@@ -0,0 +1,90 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.screens
import android.annotation.SuppressLint
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.Spacer
import androidx.compose.foundation.layout.fillMaxSize
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.padding
import androidx.compose.material3.ExperimentalMaterial3Api
import androidx.compose.runtime.Composable
import androidx.compose.ui.Modifier
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.res.stringResource
import androidx.compose.ui.unit.dp
import androidx.navigation.NavController
import com.kyant.backdrop.backdrops.layerBackdrop
import com.kyant.backdrop.backdrops.rememberLayerBackdrop
import dev.chrisbanes.haze.materials.ExperimentalHazeMaterialsApi
import kotlinx.coroutines.Job
import me.kavishdevar.librepods.R
import me.kavishdevar.librepods.composables.StyledScaffold
import me.kavishdevar.librepods.composables.StyledToggle
import me.kavishdevar.librepods.services.ServiceManager
import me.kavishdevar.librepods.utils.AACPManager
import me.kavishdevar.librepods.utils.ATTHandles
import kotlin.io.encoding.ExperimentalEncodingApi
private var debounceJob: Job? = null
@SuppressLint("DefaultLocale")
@ExperimentalHazeMaterialsApi
@OptIn(ExperimentalMaterial3Api::class, ExperimentalEncodingApi::class)
@Composable
fun HearingProtectionScreen(navController: NavController) {
val isDarkTheme = isSystemInDarkTheme()
val service = ServiceManager.getService()
if (service == null) return
val backgroundColor = if (isDarkTheme) Color(0xFF1C1C1E) else Color(0xFFFFFFFF)
val textColor = if (isDarkTheme) Color.White else Color.Black
val backdrop = rememberLayerBackdrop()
StyledScaffold(
title = stringResource(R.string.hearing_protection),
) { spacerHeight ->
Column(
modifier = Modifier
.fillMaxSize()
.layerBackdrop(backdrop)
.padding(horizontal = 16.dp)
) {
Spacer(modifier = Modifier.height(spacerHeight))
StyledToggle(
title = stringResource(R.string.environmental_noise),
label = stringResource(R.string.loud_sound_reduction),
description = stringResource(R.string.loud_sound_reduction_description),
attHandle = ATTHandles.LOUD_SOUND_REDUCTION
)
Spacer(modifier = Modifier.height(12.dp))
StyledToggle(
title = stringResource(R.string.workspace_use),
label = stringResource(R.string.ppe),
description = stringResource(R.string.workspace_use_description),
controlCommandIdentifier = AACPManager.Companion.ControlCommandIdentifiers.PPE_TOGGLE_CONFIG
)
}
}
}

View File

@@ -0,0 +1,643 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.screens
import android.content.Context
import android.util.Log
import androidx.compose.animation.AnimatedContent
import androidx.compose.animation.core.animateFloatAsState
import androidx.compose.animation.fadeIn
import androidx.compose.animation.fadeOut
import androidx.compose.animation.togetherWith
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Arrangement
import androidx.compose.foundation.layout.Box
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.Spacer
import androidx.compose.foundation.layout.fillMaxSize
import androidx.compose.foundation.layout.fillMaxWidth
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.layout.size
import androidx.compose.foundation.shape.RoundedCornerShape
import androidx.compose.material.icons.Icons
import androidx.compose.material.icons.filled.Check
import androidx.compose.material.icons.filled.Clear
import androidx.compose.material.icons.filled.Settings
import androidx.compose.material3.AlertDialog
import androidx.compose.material3.Button
import androidx.compose.material3.ButtonDefaults
import androidx.compose.material3.Card
import androidx.compose.material3.CardDefaults
import androidx.compose.material3.CircularProgressIndicator
import androidx.compose.material3.ExperimentalMaterial3Api
import androidx.compose.material3.Icon
import androidx.compose.material3.LinearProgressIndicator
import androidx.compose.material3.Text
import androidx.compose.material3.TextButton
import androidx.compose.runtime.Composable
import androidx.compose.runtime.LaunchedEffect
import androidx.compose.runtime.collectAsState
import androidx.compose.runtime.getValue
import androidx.compose.runtime.mutableStateOf
import androidx.compose.runtime.remember
import androidx.compose.runtime.setValue
import androidx.compose.ui.Alignment
import androidx.compose.ui.Modifier
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.graphics.StrokeCap
import androidx.compose.ui.platform.LocalContext
import androidx.compose.ui.res.stringResource
import androidx.compose.ui.text.TextStyle
import androidx.compose.ui.text.font.Font
import androidx.compose.ui.text.font.FontFamily
import androidx.compose.ui.text.font.FontWeight
import androidx.compose.ui.text.style.TextAlign
import androidx.compose.ui.tooling.preview.Preview
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.sp
import androidx.core.content.edit
import androidx.navigation.NavController
import com.kyant.backdrop.backdrops.layerBackdrop
import com.kyant.backdrop.backdrops.rememberLayerBackdrop
import dev.chrisbanes.haze.materials.ExperimentalHazeMaterialsApi
import kotlinx.coroutines.Dispatchers
import kotlinx.coroutines.launch
import kotlinx.coroutines.withContext
import me.kavishdevar.librepods.R
import me.kavishdevar.librepods.composables.StyledIconButton
import me.kavishdevar.librepods.composables.StyledScaffold
import me.kavishdevar.librepods.utils.RadareOffsetFinder
@ExperimentalHazeMaterialsApi
@OptIn(ExperimentalMaterial3Api::class)
@Composable
fun Onboarding(navController: NavController, activityContext: Context) {
val isDarkTheme = isSystemInDarkTheme()
val backgroundColor = if (isDarkTheme) Color(0xFF1C1C1E) else Color.White
val textColor = if (isDarkTheme) Color.White else Color.Black
val accentColor = if (isDarkTheme) Color(0xFF007AFF) else Color(0xFF3C6DF5)
val radareOffsetFinder = remember { RadareOffsetFinder(activityContext) }
val progressState by radareOffsetFinder.progressState.collectAsState()
var isComplete by remember { mutableStateOf(false) }
var hasStarted by remember { mutableStateOf(false) }
var rootCheckPassed by remember { mutableStateOf(false) }
var checkingRoot by remember { mutableStateOf(false) }
var rootCheckFailed by remember { mutableStateOf(false) }
var moduleEnabled by remember { mutableStateOf(false) }
var bluetoothToggled by remember { mutableStateOf(false) }
var showSkipDialog by remember { mutableStateOf(false) }
fun checkRootAccess() {
checkingRoot = true
rootCheckFailed = false
kotlinx.coroutines.MainScope().launch {
withContext(Dispatchers.IO) {
try {
val process = Runtime.getRuntime().exec("su -c id")
val exitValue = process.waitFor() // no idea why i have this, probably don't need to do this
withContext(Dispatchers.Main) {
rootCheckPassed = (exitValue == 0)
rootCheckFailed = (exitValue != 0)
checkingRoot = false
}
} catch (e: Exception) {
Log.e("Onboarding", "Root check failed", e)
withContext(Dispatchers.Main) {
rootCheckPassed = false
rootCheckFailed = true
checkingRoot = false
}
}
}
}
}
LaunchedEffect(hasStarted) {
if (hasStarted && rootCheckPassed) {
Log.d("Onboarding", "Checking if hook offset is available...")
val isHookReady = radareOffsetFinder.isHookOffsetAvailable()
Log.d("Onboarding", "Hook offset ready: $isHookReady")
if (isHookReady) {
Log.d("Onboarding", "Hook is ready")
isComplete = true
} else {
Log.d("Onboarding", "Hook not ready, starting setup process...")
withContext(Dispatchers.IO) {
radareOffsetFinder.setupAndFindOffset()
}
}
}
}
LaunchedEffect(progressState) {
if (progressState is RadareOffsetFinder.ProgressState.Success) {
isComplete = true
}
}
val backdrop = rememberLayerBackdrop()
StyledScaffold(
title = "Setting Up",
actionButtons = listOf(
{scaffoldBackdrop ->
StyledIconButton(
onClick = {
showSkipDialog = true
},
icon = "􀊋",
darkMode = isDarkTheme,
backdrop = scaffoldBackdrop
)
}
)
) { spacerHeight ->
Column(
modifier = Modifier
.fillMaxSize()
.layerBackdrop(backdrop)
.padding(horizontal = 16.dp),
horizontalAlignment = Alignment.CenterHorizontally,
verticalArrangement = Arrangement.spacedBy(16.dp)
) {
Spacer(modifier = Modifier.height(spacerHeight))
Card(
modifier = Modifier.fillMaxWidth(),
colors = CardDefaults.cardColors(containerColor = backgroundColor),
shape = RoundedCornerShape(12.dp)
) {
Column(
modifier = Modifier
.fillMaxWidth()
.padding(24.dp),
horizontalAlignment = Alignment.CenterHorizontally
) {
if (!rootCheckPassed && !hasStarted) {
Icon(
imageVector = Icons.Default.Settings,
contentDescription = "Root Access",
tint = accentColor,
modifier = Modifier.size(50.dp)
)
Spacer(modifier = Modifier.height(24.dp))
Text(
text = stringResource(R.string.root_access_required),
style = TextStyle(
fontSize = 22.sp,
fontWeight = FontWeight.Bold,
textAlign = TextAlign.Center,
fontFamily = FontFamily(Font(R.font.sf_pro)),
color = textColor
)
)
Spacer(modifier = Modifier.height(8.dp))
Text(
text = stringResource(R.string.this_app_needs_root_access_to_hook_onto_the_bluetooth_library),
style = TextStyle(
fontSize = 16.sp,
fontWeight = FontWeight.Normal,
textAlign = TextAlign.Center,
fontFamily = FontFamily(Font(R.font.sf_pro)),
color = textColor.copy(alpha = 0.7f)
)
)
if (rootCheckFailed) {
Spacer(modifier = Modifier.height(8.dp))
Text(
text = stringResource(R.string.root_access_denied),
style = TextStyle(
fontSize = 14.sp,
fontWeight = FontWeight.Normal,
textAlign = TextAlign.Center,
fontFamily = FontFamily(Font(R.font.sf_pro)),
color = Color(0xFFFF453A)
)
)
}
Spacer(modifier = Modifier.height(24.dp))
Button(
onClick = { checkRootAccess() },
modifier = Modifier
.fillMaxWidth()
.height(50.dp),
colors = ButtonDefaults.buttonColors(
containerColor = accentColor
),
shape = RoundedCornerShape(8.dp),
enabled = !checkingRoot
) {
if (checkingRoot) {
CircularProgressIndicator(
modifier = Modifier.size(24.dp),
color = Color.White,
strokeWidth = 2.dp
)
} else {
Text(
"Check Root Access",
style = TextStyle(
fontSize = 16.sp,
fontWeight = FontWeight.Medium,
fontFamily = FontFamily(Font(R.font.sf_pro))
),
)
}
}
} else {
StatusIcon(if (hasStarted) progressState else RadareOffsetFinder.ProgressState.Idle, isDarkTheme)
Spacer(modifier = Modifier.height(24.dp))
AnimatedContent(
targetState = if (hasStarted) getStatusTitle(progressState,
moduleEnabled, bluetoothToggled) else "Setup Required",
transitionSpec = { fadeIn() togetherWith fadeOut() }
) { text ->
Text(
text = text,
style = TextStyle(
fontSize = 22.sp,
fontWeight = FontWeight.Bold,
textAlign = TextAlign.Center,
fontFamily = FontFamily(Font(R.font.sf_pro)),
color = textColor
)
)
}
Spacer(modifier = Modifier.height(8.dp))
AnimatedContent(
targetState = if (hasStarted)
getStatusDescription(progressState, moduleEnabled, bluetoothToggled)
else
"AirPods functionality requires one-time setup for hooking into Bluetooth library",
transitionSpec = { fadeIn() togetherWith fadeOut() }
) { text ->
Text(
text = text,
style = TextStyle(
fontSize = 16.sp,
fontWeight = FontWeight.Normal,
textAlign = TextAlign.Center,
fontFamily = FontFamily(Font(R.font.sf_pro)),
color = textColor.copy(alpha = 0.7f)
)
)
}
Spacer(modifier = Modifier.height(24.dp))
if (!hasStarted) {
Button(
onClick = { hasStarted = true },
modifier = Modifier
.fillMaxWidth()
.height(50.dp),
colors = ButtonDefaults.buttonColors(
containerColor = accentColor
),
shape = RoundedCornerShape(8.dp)
) {
Text(
"Start Setup",
style = TextStyle(
fontSize = 16.sp,
fontWeight = FontWeight.Medium,
fontFamily = FontFamily(Font(R.font.sf_pro))
),
)
}
} else {
when (progressState) {
is RadareOffsetFinder.ProgressState.DownloadProgress -> {
val progress = (progressState as RadareOffsetFinder.ProgressState.DownloadProgress).progress
val animatedProgress by animateFloatAsState(
targetValue = progress,
label = "Download Progress"
)
Column(
modifier = Modifier.fillMaxWidth(),
horizontalAlignment = Alignment.CenterHorizontally
) {
LinearProgressIndicator(
progress = { animatedProgress },
modifier = Modifier
.fillMaxWidth()
.height(8.dp),
strokeCap = StrokeCap.Round,
color = accentColor
)
Spacer(modifier = Modifier.height(8.dp))
Text(
text = "${(progress * 100).toInt()}%",
style = TextStyle(
fontSize = 14.sp,
fontWeight = FontWeight.Medium,
fontFamily = FontFamily(Font(R.font.sf_pro)),
color = textColor.copy(alpha = 0.6f)
)
)
}
}
is RadareOffsetFinder.ProgressState.Success -> {
if (!moduleEnabled) {
Button(
onClick = { moduleEnabled = true },
modifier = Modifier
.fillMaxWidth()
.height(50.dp),
colors = ButtonDefaults.buttonColors(
containerColor = accentColor
),
shape = RoundedCornerShape(8.dp)
) {
Text(
"I've Enabled/Reactivated the Module",
style = TextStyle(
fontSize = 16.sp,
fontWeight = FontWeight.Medium,
fontFamily = FontFamily(Font(R.font.sf_pro))
),
)
}
} else if (!bluetoothToggled) {
Button(
onClick = { bluetoothToggled = true },
modifier = Modifier
.fillMaxWidth()
.height(50.dp),
colors = ButtonDefaults.buttonColors(
containerColor = accentColor
),
shape = RoundedCornerShape(8.dp)
) {
Text(
"I've Toggled Bluetooth",
style = TextStyle(
fontSize = 16.sp,
fontWeight = FontWeight.Medium,
fontFamily = FontFamily(Font(R.font.sf_pro))
),
)
}
} else {
Button(
onClick = {
navController.navigate("settings") {
popUpTo("onboarding") { inclusive = true }
}
},
modifier = Modifier
.fillMaxWidth()
.height(50.dp),
colors = ButtonDefaults.buttonColors(
containerColor = accentColor
),
shape = RoundedCornerShape(8.dp)
) {
Text(
"Continue to Settings",
style = TextStyle(
fontSize = 16.sp,
fontWeight = FontWeight.Medium,
fontFamily = FontFamily(Font(R.font.sf_pro))
),
)
}
}
}
is RadareOffsetFinder.ProgressState.Idle,
is RadareOffsetFinder.ProgressState.Error -> {
// No specific UI for these states
}
else -> {
LinearProgressIndicator(
modifier = Modifier
.fillMaxWidth()
.height(8.dp),
strokeCap = StrokeCap.Round,
color = accentColor
)
}
}
}
}
}
}
Spacer(modifier = Modifier.weight(1f))
if (progressState is RadareOffsetFinder.ProgressState.Error && !isComplete && hasStarted) {
Button(
onClick = {
Log.d("Onboarding", "Trying to find offset again...")
kotlinx.coroutines.MainScope().launch {
withContext(Dispatchers.IO) {
radareOffsetFinder.setupAndFindOffset()
}
}
},
modifier = Modifier
.fillMaxWidth()
.height(55.dp),
colors = ButtonDefaults.buttonColors(
containerColor = accentColor
),
shape = RoundedCornerShape(8.dp)
) {
Text(
"Try Again",
style = TextStyle(
fontSize = 16.sp,
fontWeight = FontWeight.Medium,
fontFamily = FontFamily(Font(R.font.sf_pro))
),
)
}
}
}
if (showSkipDialog) {
AlertDialog(
onDismissRequest = { showSkipDialog = false },
title = { Text("Skip Setup") },
text = {
Text(
"Have you installed the root module that patches the Bluetooth library directly? This option is for users who have manually patched their system instead of using the dynamic hook.",
style = TextStyle(
fontSize = 16.sp,
fontFamily = FontFamily(Font(R.font.sf_pro))
)
)
},
confirmButton = {
val sharedPreferences = activityContext.getSharedPreferences("settings", Context.MODE_PRIVATE)
TextButton(
onClick = {
showSkipDialog = false
RadareOffsetFinder.clearHookOffsets()
sharedPreferences.edit { putBoolean("skip_setup", true) }
navController.navigate("settings") {
popUpTo("onboarding") { inclusive = true }
}
}
) {
Text(
"Yes, Skip Setup",
color = accentColor,
fontWeight = FontWeight.Bold
)
}
},
dismissButton = {
TextButton(
onClick = { showSkipDialog = false }
) {
Text("Cancel")
}
},
containerColor = backgroundColor,
textContentColor = textColor,
titleContentColor = textColor
)
}
}
}
@Composable
private fun StatusIcon(
progressState: RadareOffsetFinder.ProgressState,
isDarkTheme: Boolean
) {
val accentColor = if (isDarkTheme) Color(0xFF007AFF) else Color(0xFF3C6DF5)
val errorColor = if (isDarkTheme) Color(0xFFFF453A) else Color(0xFFFF3B30)
val successColor = if (isDarkTheme) Color(0xFF30D158) else Color(0xFF34C759)
Box(
modifier = Modifier.size(80.dp),
contentAlignment = Alignment.Center
) {
when (progressState) {
is RadareOffsetFinder.ProgressState.Error -> {
Icon(
imageVector = Icons.Default.Clear,
contentDescription = "Error",
tint = errorColor,
modifier = Modifier.size(50.dp)
)
}
is RadareOffsetFinder.ProgressState.Success -> {
Icon(
imageVector = Icons.Default.Check,
contentDescription = "Success",
tint = successColor,
modifier = Modifier.size(50.dp)
)
}
is RadareOffsetFinder.ProgressState.Idle -> {
Icon(
imageVector = Icons.Default.Settings,
contentDescription = "Settings",
tint = accentColor,
modifier = Modifier.size(50.dp)
)
}
else -> {
CircularProgressIndicator(
modifier = Modifier.size(50.dp),
color = accentColor,
strokeWidth = 4.dp
)
}
}
}
}
private fun getStatusTitle(
state: RadareOffsetFinder.ProgressState,
moduleEnabled: Boolean,
bluetoothToggled: Boolean
): String {
return when (state) {
is RadareOffsetFinder.ProgressState.Success -> {
when {
!moduleEnabled -> "Enable Xposed Module"
!bluetoothToggled -> "Toggle Bluetooth"
else -> "Setup Complete"
}
}
is RadareOffsetFinder.ProgressState.Idle -> "Getting Ready"
is RadareOffsetFinder.ProgressState.CheckingExisting -> "Checking if radare2 already downloaded"
is RadareOffsetFinder.ProgressState.Downloading -> "Downloading radare2"
is RadareOffsetFinder.ProgressState.DownloadProgress -> "Downloading radare2"
is RadareOffsetFinder.ProgressState.Extracting -> "Extracting radare2"
is RadareOffsetFinder.ProgressState.MakingExecutable -> "Setting executable permissions"
is RadareOffsetFinder.ProgressState.FindingOffset -> "Finding function offset"
is RadareOffsetFinder.ProgressState.SavingOffset -> "Saving offset"
is RadareOffsetFinder.ProgressState.Cleaning -> "Cleaning Up"
is RadareOffsetFinder.ProgressState.Error -> "Setup Failed"
}
}
private fun getStatusDescription(
state: RadareOffsetFinder.ProgressState,
moduleEnabled: Boolean,
bluetoothToggled: Boolean
): String {
return when (state) {
is RadareOffsetFinder.ProgressState.Success -> {
when {
!moduleEnabled -> "Please enable the LibrePods Xposed module in your Xposed manager (e.g. LSPosed). If already enabled, disable and re-enable it."
!bluetoothToggled -> "Please turn off and then turn on Bluetooth to apply the changes."
else -> "All set! You can now use your AirPods with enhanced functionality."
}
}
is RadareOffsetFinder.ProgressState.Idle -> "Preparing"
is RadareOffsetFinder.ProgressState.CheckingExisting -> "Checking if radare2 are already installed"
is RadareOffsetFinder.ProgressState.Downloading -> "Starting radare2 download"
is RadareOffsetFinder.ProgressState.DownloadProgress -> "Downloading radare2"
is RadareOffsetFinder.ProgressState.Extracting -> "Extracting radare2"
is RadareOffsetFinder.ProgressState.MakingExecutable -> "Setting executable permissions on radare2 binaries"
is RadareOffsetFinder.ProgressState.FindingOffset -> "Looking for the required Bluetooth function in system libraries"
is RadareOffsetFinder.ProgressState.SavingOffset -> "Saving the function offset"
is RadareOffsetFinder.ProgressState.Cleaning -> "Removing temporary extracted files"
is RadareOffsetFinder.ProgressState.Error -> state.message
}
}
@ExperimentalHazeMaterialsApi
@Preview
@Composable
fun OnboardingPreview() {
Onboarding(navController = NavController(LocalContext.current), activityContext = LocalContext.current)
}

View File

@@ -0,0 +1,93 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.screens
import android.annotation.SuppressLint
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Arrangement
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.Spacer
import androidx.compose.foundation.layout.fillMaxSize
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.padding
import androidx.compose.material3.ExperimentalMaterial3Api
import androidx.compose.runtime.Composable
import androidx.compose.runtime.DisposableEffect
import androidx.compose.runtime.LaunchedEffect
import androidx.compose.runtime.mutableFloatStateOf
import androidx.compose.runtime.remember
import androidx.compose.runtime.getValue
import androidx.compose.ui.Modifier
import androidx.compose.ui.res.stringResource
import androidx.compose.ui.unit.dp
import androidx.navigation.NavController
import com.kyant.backdrop.backdrops.layerBackdrop
import com.kyant.backdrop.backdrops.rememberLayerBackdrop
import com.mikepenz.aboutlibraries.ui.compose.m3.LibrariesContainer
import com.mikepenz.aboutlibraries.ui.compose.produceLibraries
import dev.chrisbanes.haze.materials.ExperimentalHazeMaterialsApi
import kotlinx.coroutines.CoroutineScope
import kotlinx.coroutines.Dispatchers
import kotlinx.coroutines.Job
import kotlinx.coroutines.delay
import kotlinx.coroutines.launch
import me.kavishdevar.librepods.R
import me.kavishdevar.librepods.composables.StyledIconButton
import me.kavishdevar.librepods.composables.StyledScaffold
import me.kavishdevar.librepods.composables.StyledSlider
import me.kavishdevar.librepods.services.ServiceManager
import me.kavishdevar.librepods.utils.AACPManager
import kotlin.io.encoding.ExperimentalEncodingApi
private var debounceJob: Job? = null
@SuppressLint("DefaultLocale")
@ExperimentalHazeMaterialsApi
@OptIn(ExperimentalMaterial3Api::class, ExperimentalEncodingApi::class)
@Composable
fun OpenSourceLicensesScreen(navController: NavController) {
val isDarkTheme = isSystemInDarkTheme()
val backdrop = rememberLayerBackdrop()
StyledScaffold(
title = stringResource(R.string.open_source_licenses)
) { spacerHeight ->
Column(
modifier = Modifier
.fillMaxSize()
.layerBackdrop(backdrop)
.padding(horizontal = 16.dp),
verticalArrangement = Arrangement.spacedBy(16.dp)
) {
Spacer(modifier = Modifier.height(spacerHeight))
val context = androidx.compose.ui.platform.LocalContext.current
val libraries by produceLibraries {
context.resources.openRawResource(R.raw.aboutlibraries)
.bufferedReader()
.use { it.readText() }
}
LibrariesContainer(
libraries = libraries,
modifier = Modifier
.padding(0.dp)
.fillMaxSize()
)
}
}
}

View File

@@ -0,0 +1,311 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
@file:OptIn(ExperimentalStdlibApi::class, ExperimentalEncodingApi::class)
package me.kavishdevar.librepods.screens
import android.content.Context
import android.util.Log
import androidx.compose.animation.animateColorAsState
import androidx.compose.animation.core.animateFloatAsState
import androidx.compose.animation.core.tween
import androidx.compose.foundation.background
import androidx.compose.foundation.gestures.detectTapGestures
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Arrangement
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.Row
import androidx.compose.foundation.layout.Spacer
import androidx.compose.foundation.layout.fillMaxSize
import androidx.compose.foundation.layout.fillMaxWidth
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.layout.wrapContentWidth
import androidx.compose.foundation.shape.RoundedCornerShape
import androidx.compose.material3.ExperimentalMaterial3Api
import androidx.compose.material3.HorizontalDivider
import androidx.compose.material3.Icon
import androidx.compose.material3.Text
import androidx.compose.runtime.Composable
import androidx.compose.runtime.getValue
import androidx.compose.runtime.mutableStateOf
import androidx.compose.runtime.remember
import androidx.compose.runtime.setValue
import androidx.compose.ui.Alignment
import androidx.compose.ui.Modifier
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.input.pointer.pointerInput
import androidx.compose.ui.platform.LocalContext
import androidx.compose.ui.res.painterResource
import androidx.compose.ui.res.stringResource
import androidx.compose.ui.text.TextStyle
import androidx.compose.ui.text.font.Font
import androidx.compose.ui.text.font.FontFamily
import androidx.compose.ui.text.font.FontWeight
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.sp
import androidx.core.content.edit
import androidx.navigation.NavController
import com.kyant.backdrop.backdrops.layerBackdrop
import com.kyant.backdrop.backdrops.rememberLayerBackdrop
import dev.chrisbanes.haze.materials.ExperimentalHazeMaterialsApi
import me.kavishdevar.librepods.R
import me.kavishdevar.librepods.composables.SelectItem
import me.kavishdevar.librepods.composables.StyledIconButton
import me.kavishdevar.librepods.composables.StyledScaffold
import me.kavishdevar.librepods.composables.StyledSelectList
import me.kavishdevar.librepods.constants.StemAction
import me.kavishdevar.librepods.services.ServiceManager
import me.kavishdevar.librepods.utils.AACPManager
import kotlin.experimental.and
import kotlin.io.encoding.ExperimentalEncodingApi
@Composable
fun RightDivider() {
HorizontalDivider(
thickness = 1.dp,
color = Color(0x40888888),
modifier = Modifier
.padding(start = 72.dp, end = 20.dp)
)
}
@Composable
fun RightDividerNoIcon() {
HorizontalDivider(
thickness = 1.dp,
color = Color(0x40888888),
modifier = Modifier
.padding(start = 20.dp, end = 20.dp)
)
}
@ExperimentalHazeMaterialsApi
@OptIn(ExperimentalMaterial3Api::class)
@Composable
fun LongPress(navController: NavController, name: String) {
val isDarkTheme = isSystemInDarkTheme()
val textColor = if (isDarkTheme) Color.White else Color.Black
val modesByte = ServiceManager.getService()!!.aacpManager.controlCommandStatusList.find {
it.identifier == AACPManager.Companion.ControlCommandIdentifiers.LISTENING_MODE_CONFIGS
}?.value?.takeIf { it.isNotEmpty() }?.get(0)
if (modesByte != null) {
Log.d("PressAndHoldSettingsScreen", "Current modes state: ${modesByte.toString(2)}")
Log.d("PressAndHoldSettingsScreen", "Off mode: ${(modesByte and 0x01) != 0.toByte()}")
Log.d("PressAndHoldSettingsScreen", "Transparency mode: ${(modesByte and 0x04) != 0.toByte()}")
Log.d("PressAndHoldSettingsScreen", "Noise Cancellation mode: ${(modesByte and 0x02) != 0.toByte()}")
Log.d("PressAndHoldSettingsScreen", "Adaptive mode: ${(modesByte and 0x08) != 0.toByte()}")
}
val context = LocalContext.current
val sharedPreferences = context.getSharedPreferences("settings", Context.MODE_PRIVATE)
val prefKey = if (name.lowercase() == "left") "left_long_press_action" else "right_long_press_action"
val longPressActionPref = sharedPreferences.getString(prefKey, StemAction.CYCLE_NOISE_CONTROL_MODES.name)
Log.d("PressAndHoldSettingsScreen", "Long press action preference ($prefKey): $longPressActionPref")
var longPressAction by remember { mutableStateOf(StemAction.valueOf(longPressActionPref ?: StemAction.CYCLE_NOISE_CONTROL_MODES.name)) }
val backdrop = rememberLayerBackdrop()
StyledScaffold(
title = name
) { spacerHeight ->
val backgroundColor = if (isDarkTheme) Color(0xFF1C1C1E) else Color(0xFFFFFFFF)
Column (
modifier = Modifier
.layerBackdrop(backdrop)
.fillMaxSize()
.padding(top = 8.dp)
.padding(horizontal = 16.dp)
) {
Spacer(modifier = Modifier.height(spacerHeight))
val actionItems = listOf(
SelectItem(
name = stringResource(R.string.noise_control),
selected = longPressAction == StemAction.CYCLE_NOISE_CONTROL_MODES,
onClick = {
longPressAction = StemAction.CYCLE_NOISE_CONTROL_MODES
sharedPreferences.edit { putString(prefKey, StemAction.CYCLE_NOISE_CONTROL_MODES.name) }
}
),
SelectItem(
name = stringResource(R.string.digital_assistant),
selected = longPressAction == StemAction.DIGITAL_ASSISTANT,
onClick = {
longPressAction = StemAction.DIGITAL_ASSISTANT
sharedPreferences.edit { putString(prefKey, StemAction.DIGITAL_ASSISTANT.name) }
}
)
)
StyledSelectList(items = actionItems)
if (longPressAction == StemAction.CYCLE_NOISE_CONTROL_MODES) {
Spacer(modifier = Modifier.height(32.dp))
Text(
text = stringResource(R.string.noise_control),
style = TextStyle(
fontSize = 14.sp,
fontWeight = FontWeight.Bold,
color = textColor.copy(alpha = 0.6f),
),
fontFamily = FontFamily(Font(R.font.sf_pro)),
modifier = Modifier
.padding(horizontal = 18.dp)
)
Spacer(modifier = Modifier.height(8.dp))
val offListeningModeValue = ServiceManager.getService()!!.aacpManager.controlCommandStatusList.find {
it.identifier == AACPManager.Companion.ControlCommandIdentifiers.ALLOW_OFF_OPTION
}?.value?.takeIf { it.isNotEmpty() }?.get(0)
Log.d("PressAndHoldSettingsScreen", "Allow Off state: $offListeningModeValue")
val allowOff = offListeningModeValue == 1.toByte()
Log.d("PressAndHoldSettingsScreen", "Allow Off option: $allowOff")
val initialByte = ServiceManager.getService()!!.aacpManager.controlCommandStatusList.find {
it.identifier == AACPManager.Companion.ControlCommandIdentifiers.LISTENING_MODE_CONFIGS
}?.value?.takeIf { it.isNotEmpty() }?.get(0)?.toInt() ?: sharedPreferences.getInt("long_press_byte", 0b0101)
var currentByte by remember { mutableStateOf(initialByte) }
val listeningModeItems = mutableListOf<SelectItem>()
if (allowOff) {
listeningModeItems.add(
SelectItem(
name = stringResource(R.string.off),
description = "Turns off noise management",
iconRes = R.drawable.noise_cancellation,
selected = (currentByte and 0x01) != 0,
onClick = {
val bit = 0x01
val newValue = if ((currentByte and bit) != 0) {
val temp = currentByte and bit.inv()
if (countEnabledModes(temp) >= 2) temp else currentByte
} else {
currentByte or bit
}
ServiceManager.getService()!!.aacpManager.sendControlCommand(
AACPManager.Companion.ControlCommandIdentifiers.LISTENING_MODE_CONFIGS.value,
newValue.toByte()
)
sharedPreferences.edit {
putInt("long_press_byte", newValue)
}
currentByte = newValue
}
)
)
}
listeningModeItems.addAll(listOf(
SelectItem(
name = stringResource(R.string.transparency),
description = "Lets in external sounds",
iconRes = R.drawable.transparency,
selected = (currentByte and 0x04) != 0,
onClick = {
val bit = 0x04
val newValue = if ((currentByte and bit) != 0) {
val temp = currentByte and bit.inv()
if (countEnabledModes(temp) >= 2) temp else currentByte
} else {
currentByte or bit
}
ServiceManager.getService()!!.aacpManager.sendControlCommand(
AACPManager.Companion.ControlCommandIdentifiers.LISTENING_MODE_CONFIGS.value,
newValue.toByte()
)
sharedPreferences.edit {
putInt("long_press_byte", newValue)
}
currentByte = newValue
}
),
SelectItem(
name = stringResource(R.string.adaptive),
description = "Dynamically adjust external noise",
iconRes = R.drawable.adaptive,
selected = (currentByte and 0x08) != 0,
onClick = {
val bit = 0x08
val newValue = if ((currentByte and bit) != 0) {
val temp = currentByte and bit.inv()
if (countEnabledModes(temp) >= 2) temp else currentByte
} else {
currentByte or bit
}
ServiceManager.getService()!!.aacpManager.sendControlCommand(
AACPManager.Companion.ControlCommandIdentifiers.LISTENING_MODE_CONFIGS.value,
newValue.toByte()
)
sharedPreferences.edit {
putInt("long_press_byte", newValue)
}
currentByte = newValue
}
),
SelectItem(
name = stringResource(R.string.noise_cancellation),
description = "Blocks out external sounds",
iconRes = R.drawable.noise_cancellation,
selected = (currentByte and 0x02) != 0,
onClick = {
val bit = 0x02
val newValue = if ((currentByte and bit) != 0) {
val temp = currentByte and bit.inv()
if (countEnabledModes(temp) >= 2) temp else currentByte
} else {
currentByte or bit
}
ServiceManager.getService()!!.aacpManager.sendControlCommand(
AACPManager.Companion.ControlCommandIdentifiers.LISTENING_MODE_CONFIGS.value,
newValue.toByte()
)
sharedPreferences.edit {
putInt("long_press_byte", newValue)
}
currentByte = newValue
}
)
))
StyledSelectList(items = listeningModeItems)
Spacer(modifier = Modifier.height(8.dp))
Text(
text = stringResource(R.string.press_and_hold_noise_control_description),
style = TextStyle(
fontSize = 12.sp,
fontWeight = FontWeight.Light,
color = textColor.copy(alpha = 0.6f),
fontFamily = FontFamily(Font(R.font.sf_pro))
),
modifier = Modifier
.padding(horizontal = 18.dp)
)
}
}
}
Log.d("PressAndHoldSettingsScreen", "Current byte: ${ServiceManager.getService()!!.aacpManager.controlCommandStatusList.find {
it.identifier == AACPManager.Companion.ControlCommandIdentifiers.LISTENING_MODE_CONFIGS
}?.value?.takeIf { it.isNotEmpty() }?.get(0)?.toString(2)}")
}
fun countEnabledModes(byteValue: Int): Int {
var count = 0
if ((byteValue and 0x01) != 0) count++
if ((byteValue and 0x02) != 0) count++
if ((byteValue and 0x04) != 0) count++
if ((byteValue and 0x08) != 0) count++
return count
}

View File

@@ -0,0 +1,167 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
@file:OptIn(ExperimentalEncodingApi::class)
package me.kavishdevar.librepods.screens
import android.content.Context
import androidx.compose.foundation.background
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.Row
import androidx.compose.foundation.layout.Spacer
import androidx.compose.foundation.layout.fillMaxSize
import androidx.compose.foundation.layout.fillMaxWidth
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.shape.RoundedCornerShape
import androidx.compose.foundation.text.BasicTextField
import androidx.compose.material3.ExperimentalMaterial3Api
import androidx.compose.material3.IconButton
import androidx.compose.material3.Text
import androidx.compose.runtime.Composable
import androidx.compose.runtime.LaunchedEffect
import androidx.compose.runtime.mutableStateOf
import androidx.compose.runtime.remember
import androidx.compose.ui.Alignment
import androidx.compose.ui.Modifier
import androidx.compose.ui.focus.FocusRequester
import androidx.compose.ui.focus.focusRequester
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.graphics.SolidColor
import androidx.compose.ui.platform.LocalContext
import androidx.compose.ui.platform.LocalSoftwareKeyboardController
import androidx.compose.ui.res.stringResource
import androidx.compose.ui.text.TextRange
import androidx.compose.ui.text.TextStyle
import androidx.compose.ui.text.font.Font
import androidx.compose.ui.text.font.FontFamily
import androidx.compose.ui.text.input.TextFieldValue
import androidx.compose.ui.tooling.preview.Preview
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.sp
import androidx.core.content.edit
import androidx.navigation.NavController
import com.kyant.backdrop.backdrops.layerBackdrop
import com.kyant.backdrop.backdrops.rememberLayerBackdrop
import dev.chrisbanes.haze.materials.ExperimentalHazeMaterialsApi
import me.kavishdevar.librepods.R
import me.kavishdevar.librepods.composables.StyledIconButton
import me.kavishdevar.librepods.composables.StyledScaffold
import me.kavishdevar.librepods.services.ServiceManager
import kotlin.io.encoding.ExperimentalEncodingApi
@OptIn(ExperimentalMaterial3Api::class, ExperimentalHazeMaterialsApi::class)
@Composable
fun RenameScreen(navController: NavController) {
val sharedPreferences = LocalContext.current.getSharedPreferences("settings", Context.MODE_PRIVATE)
val isDarkTheme = isSystemInDarkTheme()
val name = remember { mutableStateOf(TextFieldValue(sharedPreferences.getString("name", "") ?: "")) }
val focusRequester = remember { FocusRequester() }
val keyboardController = LocalSoftwareKeyboardController.current
LaunchedEffect(Unit) {
focusRequester.requestFocus()
keyboardController?.show()
name.value = name.value.copy(selection = TextRange(name.value.text.length))
}
val backdrop = rememberLayerBackdrop()
StyledScaffold(
title = stringResource(R.string.name),
) { spacerHeight ->
Column(
modifier = Modifier
.fillMaxSize()
.layerBackdrop(backdrop)
.padding(horizontal = 16.dp)
) {
Spacer(modifier = Modifier.height(spacerHeight))
val isDarkTheme = isSystemInDarkTheme()
val backgroundColor = if (isDarkTheme) Color(0xFF1C1C1E) else Color(0xFFFFFFFF)
val textColor = if (isDarkTheme) Color.White else Color.Black
val cursorColor = if (isDarkTheme) Color.White else Color.Black
Row(
verticalAlignment = Alignment.CenterVertically,
modifier = Modifier
.fillMaxWidth()
.height(58.dp)
.background(
backgroundColor,
RoundedCornerShape(28.dp)
)
.padding(horizontal = 16.dp, vertical = 8.dp)
) {
BasicTextField(
value = name.value,
onValueChange = {
name.value = it
sharedPreferences.edit {putString("name", it.text)}
ServiceManager.getService()?.setName(it.text)
},
textStyle = TextStyle(
fontSize = 16.sp,
color = textColor,
fontFamily = FontFamily(Font(R.font.sf_pro))
),
singleLine = true,
cursorBrush = SolidColor(cursorColor),
decorationBox = { innerTextField ->
Row(
verticalAlignment = Alignment.CenterVertically,
) {
Row(
modifier = Modifier
.weight(1f)
) {
innerTextField()
}
IconButton(
onClick = {
name.value = TextFieldValue("")
}
) {
Text(
text = "􀁡",
style = TextStyle(
fontSize = 16.sp,
fontFamily = FontFamily(Font(R.font.sf_pro)),
color = if (isDarkTheme) Color.White.copy(alpha = 0.6f) else Color.Black.copy(alpha = 0.6f)
),
)
}
}
},
modifier = Modifier
.fillMaxWidth()
.padding(start = 8.dp)
.focusRequester(focusRequester)
)
}
}
}
}
@Preview
@Composable
fun RenameScreenPreview() {
RenameScreen(navController = NavController(LocalContext.current))
}

View File

@@ -0,0 +1,448 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.screens
import android.annotation.SuppressLint
import android.util.Log
import androidx.compose.foundation.background
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Arrangement
import androidx.compose.foundation.layout.Box
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.Row
import androidx.compose.foundation.layout.Spacer
import androidx.compose.foundation.layout.fillMaxSize
import androidx.compose.foundation.layout.fillMaxWidth
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.layout.size
import androidx.compose.foundation.rememberScrollState
import androidx.compose.foundation.shape.CircleShape
import androidx.compose.foundation.shape.RoundedCornerShape
import androidx.compose.foundation.verticalScroll
import androidx.compose.material3.ExperimentalMaterial3Api
import androidx.compose.material3.Slider
import androidx.compose.material3.SliderDefaults
import androidx.compose.material3.Text
import androidx.compose.runtime.Composable
import androidx.compose.runtime.DisposableEffect
import androidx.compose.runtime.LaunchedEffect
import androidx.compose.runtime.mutableFloatStateOf
import androidx.compose.runtime.mutableIntStateOf
import androidx.compose.runtime.mutableStateOf
import androidx.compose.runtime.remember
import androidx.compose.ui.Alignment
import androidx.compose.ui.Modifier
import androidx.compose.ui.draw.shadow
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.res.stringResource
import androidx.compose.ui.text.TextStyle
import androidx.compose.ui.text.font.Font
import androidx.compose.ui.text.font.FontFamily
import androidx.compose.ui.text.font.FontWeight
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.sp
import androidx.navigation.NavController
import com.kyant.backdrop.backdrops.layerBackdrop
import com.kyant.backdrop.backdrops.rememberLayerBackdrop
import dev.chrisbanes.haze.hazeSource
import dev.chrisbanes.haze.materials.ExperimentalHazeMaterialsApi
import kotlinx.coroutines.delay
import me.kavishdevar.librepods.R
import me.kavishdevar.librepods.composables.StyledIconButton
import me.kavishdevar.librepods.composables.StyledScaffold
import me.kavishdevar.librepods.composables.StyledSlider
import me.kavishdevar.librepods.composables.StyledToggle
import me.kavishdevar.librepods.services.ServiceManager
import me.kavishdevar.librepods.utils.ATTHandles
import me.kavishdevar.librepods.utils.RadareOffsetFinder
import me.kavishdevar.librepods.utils.TransparencySettings
import me.kavishdevar.librepods.utils.parseTransparencySettingsResponse
import me.kavishdevar.librepods.utils.sendTransparencySettings
import java.io.IOException
import kotlin.io.encoding.ExperimentalEncodingApi
private const val TAG = "TransparencySettings"
@SuppressLint("DefaultLocale")
@ExperimentalHazeMaterialsApi
@OptIn(ExperimentalMaterial3Api::class, ExperimentalEncodingApi::class)
@Composable
fun TransparencySettingsScreen(navController: NavController) {
val isDarkTheme = isSystemInDarkTheme()
val textColor = if (isDarkTheme) Color.White else Color.Black
val verticalScrollState = rememberScrollState()
val attManager = ServiceManager.getService()?.attManager ?: return
val aacpManager = remember { ServiceManager.getService()?.aacpManager }
val isSdpOffsetAvailable =
remember { mutableStateOf(RadareOffsetFinder.isSdpOffsetAvailable()) }
val trackColor = if (isDarkTheme) Color(0xFFB3B3B3) else Color(0xFF929491)
val activeTrackColor = if (isDarkTheme) Color(0xFF007AFF) else Color(0xFF3C6DF5)
val thumbColor = if (isDarkTheme) Color(0xFFFFFFFF) else Color(0xFFFFFFFF)
val backdrop = rememberLayerBackdrop()
StyledScaffold(
title = stringResource(R.string.customize_transparency_mode)
){ spacerHeight, hazeState ->
Column(
modifier = Modifier
.hazeSource(hazeState)
.layerBackdrop(backdrop)
.fillMaxSize()
.verticalScroll(verticalScrollState)
.padding(horizontal = 16.dp),
verticalArrangement = Arrangement.spacedBy(16.dp)
) {
Spacer(modifier = Modifier.height(spacerHeight))
val backgroundColor = if (isDarkTheme) Color(0xFF1C1C1E) else Color(0xFFFFFFFF)
val enabled = remember { mutableStateOf(false) }
val amplificationSliderValue = remember { mutableFloatStateOf(0.5f) }
val balanceSliderValue = remember { mutableFloatStateOf(0.5f) }
val toneSliderValue = remember { mutableFloatStateOf(0.5f) }
val ambientNoiseReductionSliderValue = remember { mutableFloatStateOf(0.0f) }
val conversationBoostEnabled = remember { mutableStateOf(false) }
val eq = remember { mutableStateOf(FloatArray(8)) }
val phoneMediaEQ = remember { mutableStateOf(FloatArray(8) { 0.5f }) }
val initialLoadComplete = remember { mutableStateOf(false) }
val initialReadSucceeded = remember { mutableStateOf(false) }
val initialReadAttempts = remember { mutableIntStateOf(0) }
val transparencySettings = remember {
mutableStateOf(
TransparencySettings(
enabled = enabled.value,
leftEQ = eq.value,
rightEQ = eq.value,
leftAmplification = amplificationSliderValue.floatValue + (0.5f - balanceSliderValue.floatValue) * amplificationSliderValue.floatValue * 2,
rightAmplification = amplificationSliderValue.floatValue + (balanceSliderValue.floatValue - 0.5f) * amplificationSliderValue.floatValue * 2,
leftTone = toneSliderValue.floatValue,
rightTone = toneSliderValue.floatValue,
leftConversationBoost = conversationBoostEnabled.value,
rightConversationBoost = conversationBoostEnabled.value,
leftAmbientNoiseReduction = ambientNoiseReductionSliderValue.floatValue,
rightAmbientNoiseReduction = ambientNoiseReductionSliderValue.floatValue,
netAmplification = amplificationSliderValue.floatValue,
balance = balanceSliderValue.floatValue
)
)
}
val transparencyListener = remember {
object : (ByteArray) -> Unit {
override fun invoke(value: ByteArray) {
val parsed = parseTransparencySettingsResponse(value)
enabled.value = parsed.enabled
amplificationSliderValue.floatValue = parsed.netAmplification
balanceSliderValue.floatValue = parsed.balance
toneSliderValue.floatValue = parsed.leftTone
ambientNoiseReductionSliderValue.floatValue =
parsed.leftAmbientNoiseReduction
conversationBoostEnabled.value = parsed.leftConversationBoost
eq.value = parsed.leftEQ.copyOf()
Log.d(TAG, "Updated transparency settings from notification")
}
}
}
LaunchedEffect(
enabled.value,
amplificationSliderValue.floatValue,
balanceSliderValue.floatValue,
toneSliderValue.floatValue,
conversationBoostEnabled.value,
ambientNoiseReductionSliderValue.floatValue,
eq.value,
initialLoadComplete.value,
initialReadSucceeded.value
) {
if (!initialLoadComplete.value) {
Log.d(TAG, "Initial device load not complete - skipping send")
return@LaunchedEffect
}
if (!initialReadSucceeded.value) {
Log.d(
TAG,
"Initial device read not successful yet - skipping send until read succeeds"
)
return@LaunchedEffect
}
transparencySettings.value = TransparencySettings(
enabled = enabled.value,
leftEQ = eq.value,
rightEQ = eq.value,
leftAmplification = amplificationSliderValue.floatValue + if (balanceSliderValue.floatValue < 0) -balanceSliderValue.floatValue else 0f,
rightAmplification = amplificationSliderValue.floatValue + if (balanceSliderValue.floatValue > 0) balanceSliderValue.floatValue else 0f,
leftTone = toneSliderValue.floatValue,
rightTone = toneSliderValue.floatValue,
leftConversationBoost = conversationBoostEnabled.value,
rightConversationBoost = conversationBoostEnabled.value,
leftAmbientNoiseReduction = ambientNoiseReductionSliderValue.floatValue,
rightAmbientNoiseReduction = ambientNoiseReductionSliderValue.floatValue,
netAmplification = amplificationSliderValue.floatValue,
balance = balanceSliderValue.floatValue
)
Log.d("TransparencySettings", "Updated settings: ${transparencySettings.value}")
sendTransparencySettings(attManager, transparencySettings.value)
}
DisposableEffect(Unit) {
onDispose {
attManager.unregisterListener(ATTHandles.TRANSPARENCY, transparencyListener)
}
}
LaunchedEffect(Unit) {
Log.d(TAG, "Connecting to ATT...")
try {
attManager.enableNotifications(ATTHandles.TRANSPARENCY)
attManager.registerListener(ATTHandles.TRANSPARENCY, transparencyListener)
// If we have an AACP manager, prefer its EQ data to populate EQ controls first
try {
if (aacpManager != null) {
Log.d(TAG, "Found AACPManager, reading cached EQ data")
val aacpEQ = aacpManager.eqData
if (aacpEQ.isNotEmpty()) {
eq.value = aacpEQ.copyOf()
phoneMediaEQ.value = aacpEQ.copyOf()
Log.d(TAG, "Populated EQ from AACPManager: ${aacpEQ.toList()}")
} else {
Log.d(TAG, "AACPManager EQ data empty")
}
} else {
Log.d(TAG, "No AACPManager available")
}
} catch (e: Exception) {
Log.w(TAG, "Error reading EQ from AACPManager: ${e.message}")
}
var parsedSettings: TransparencySettings? = null
for (attempt in 1..3) {
initialReadAttempts.intValue = attempt
try {
val data = attManager.read(ATTHandles.TRANSPARENCY)
parsedSettings = parseTransparencySettingsResponse(data = data)
Log.d(TAG, "Parsed settings on attempt $attempt")
} catch (e: Exception) {
Log.w(TAG, "Read attempt $attempt failed: ${e.message}")
}
delay(200)
}
if (parsedSettings != null) {
Log.d(TAG, "Initial transparency settings: $parsedSettings")
enabled.value = parsedSettings.enabled
amplificationSliderValue.floatValue = parsedSettings.netAmplification
balanceSliderValue.floatValue = parsedSettings.balance
toneSliderValue.floatValue = parsedSettings.leftTone
ambientNoiseReductionSliderValue.floatValue =
parsedSettings.leftAmbientNoiseReduction
conversationBoostEnabled.value = parsedSettings.leftConversationBoost
eq.value = parsedSettings.leftEQ.copyOf()
initialReadSucceeded.value = true
} else {
Log.d(
TAG,
"Failed to read/parse initial transparency settings after ${initialReadAttempts.intValue} attempts"
)
}
} catch (e: IOException) {
e.printStackTrace()
} finally {
initialLoadComplete.value = true
}
}
// Only show transparency mode section if SDP offset is available
if (isSdpOffsetAvailable.value) {
StyledToggle(
label = stringResource(R.string.transparency_mode),
checkedState = enabled,
independent = true,
description = stringResource(R.string.customize_transparency_mode_description)
)
Spacer(modifier = Modifier.height(4.dp))
StyledSlider(
label = stringResource(R.string.amplification),
valueRange = -1f..1f,
mutableFloatState = amplificationSliderValue,
onValueChange = {
amplificationSliderValue.floatValue = it
},
startIcon = "􀊥",
endIcon = "􀊩",
independent = true
)
StyledSlider(
label = stringResource(R.string.balance),
valueRange = -1f..1f,
mutableFloatState = balanceSliderValue,
onValueChange = {
balanceSliderValue.floatValue = it
},
snapPoints = listOf(-1f, 0f, 1f),
startLabel = stringResource(R.string.left),
endLabel = stringResource(R.string.right),
independent = true,
)
StyledSlider(
label = stringResource(R.string.tone),
valueRange = -1f..1f,
mutableFloatState = toneSliderValue,
onValueChange = {
toneSliderValue.floatValue = it
},
startLabel = stringResource(R.string.darker),
endLabel = stringResource(R.string.brighter),
independent = true,
)
StyledSlider(
label = stringResource(R.string.ambient_noise_reduction),
valueRange = 0f..1f,
mutableFloatState = ambientNoiseReductionSliderValue,
onValueChange = {
ambientNoiseReductionSliderValue.floatValue = it
},
startLabel = stringResource(R.string.less),
endLabel = stringResource(R.string.more),
independent = true,
)
StyledToggle(
label = stringResource(R.string.conversation_boost),
checkedState = conversationBoostEnabled,
independent = true,
description = stringResource(R.string.conversation_boost_description)
)
}
// Only show transparency mode EQ section if SDP offset is available
if (isSdpOffsetAvailable.value) {
Text(
text = stringResource(R.string.equalizer),
style = TextStyle(
fontSize = 14.sp,
fontWeight = FontWeight.Bold,
color = textColor.copy(alpha = 0.6f),
fontFamily = FontFamily(Font(R.font.sf_pro))
),
modifier = Modifier.padding(16.dp, bottom = 4.dp)
)
Column(
modifier = Modifier
.fillMaxWidth()
.background(backgroundColor, RoundedCornerShape(28.dp))
.padding(16.dp),
horizontalAlignment = Alignment.CenterHorizontally,
verticalArrangement = Arrangement.SpaceBetween
) {
for (i in 0 until 8) {
val eqValue = remember(eq.value[i]) { mutableFloatStateOf(eq.value[i]) }
Row(
horizontalArrangement = Arrangement.SpaceBetween,
verticalAlignment = Alignment.CenterVertically,
modifier = Modifier
.fillMaxWidth()
.height(38.dp)
) {
Text(
text = String.format("%.2f", eqValue.floatValue),
fontSize = 12.sp,
color = textColor,
modifier = Modifier.padding(bottom = 4.dp)
)
Slider(
value = eqValue.floatValue,
onValueChange = { newVal ->
eqValue.floatValue = newVal
val newEQ = eq.value.copyOf()
newEQ[i] = eqValue.floatValue
eq.value = newEQ
},
valueRange = 0f..100f,
modifier = Modifier
.fillMaxWidth(0.9f)
.height(36.dp),
colors = SliderDefaults.colors(
thumbColor = thumbColor,
activeTrackColor = activeTrackColor,
inactiveTrackColor = trackColor
),
thumb = {
Box(
modifier = Modifier
.size(24.dp)
.shadow(4.dp, CircleShape)
.background(thumbColor, CircleShape)
)
},
track = {
Box(
modifier = Modifier
.fillMaxWidth()
.height(12.dp),
contentAlignment = Alignment.CenterStart
)
{
Box(
modifier = Modifier
.fillMaxWidth()
.height(4.dp)
.background(trackColor, RoundedCornerShape(4.dp))
)
Box(
modifier = Modifier
.fillMaxWidth(eqValue.floatValue / 100f)
.height(4.dp)
.background(
activeTrackColor,
RoundedCornerShape(4.dp)
)
)
}
}
)
Text(
text = stringResource(R.string.band_label, i + 1),
fontSize = 12.sp,
color = textColor,
modifier = Modifier.padding(top = 4.dp)
)
}
}
}
Spacer(modifier = Modifier.height(16.dp))
}
}
}
}

View File

@@ -0,0 +1,918 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.screens
import android.content.Intent
import android.widget.Toast
import androidx.activity.compose.rememberLauncherForActivityResult
import androidx.activity.result.contract.ActivityResultContracts
import androidx.compose.animation.AnimatedVisibility
import androidx.compose.animation.core.animateFloatAsState
import androidx.compose.animation.core.tween
import androidx.compose.animation.fadeIn
import androidx.compose.animation.fadeOut
import androidx.compose.animation.slideInVertically
import androidx.compose.animation.slideOutVertically
import androidx.compose.foundation.background
import androidx.compose.foundation.clickable
import androidx.compose.foundation.horizontalScroll
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Arrangement
import androidx.compose.foundation.layout.Box
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.Row
import androidx.compose.foundation.layout.Spacer
import androidx.compose.foundation.layout.fillMaxSize
import androidx.compose.foundation.layout.fillMaxWidth
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.layout.width
import androidx.compose.foundation.rememberScrollState
import androidx.compose.foundation.shape.RoundedCornerShape
import androidx.compose.foundation.verticalScroll
import androidx.compose.material.icons.Icons
import androidx.compose.material.icons.filled.Delete
import androidx.compose.material.icons.filled.Share
import androidx.compose.material3.AlertDialog
import androidx.compose.material3.Button
import androidx.compose.material3.ButtonDefaults
import androidx.compose.material3.CircularProgressIndicator
import androidx.compose.material3.ExperimentalMaterial3Api
import androidx.compose.material3.Icon
import androidx.compose.material3.MaterialTheme
import androidx.compose.material3.ModalBottomSheet
import androidx.compose.material3.Text
import androidx.compose.material3.TextButton
import androidx.compose.material3.rememberModalBottomSheetState
import androidx.compose.runtime.Composable
import androidx.compose.runtime.DisposableEffect
import androidx.compose.runtime.LaunchedEffect
import androidx.compose.runtime.getValue
import androidx.compose.runtime.mutableIntStateOf
import androidx.compose.runtime.mutableStateListOf
import androidx.compose.runtime.mutableStateOf
import androidx.compose.runtime.remember
import androidx.compose.runtime.rememberCoroutineScope
import androidx.compose.runtime.setValue
import androidx.compose.ui.Alignment
import androidx.compose.ui.Modifier
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.platform.LocalContext
import androidx.compose.ui.res.painterResource
import androidx.compose.ui.res.stringResource
import androidx.compose.ui.text.TextStyle
import androidx.compose.ui.text.font.Font
import androidx.compose.ui.text.font.FontFamily
import androidx.compose.ui.text.font.FontWeight
import androidx.compose.ui.text.style.TextOverflow
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.sp
import androidx.core.content.FileProvider
import androidx.navigation.NavController
import com.kyant.backdrop.backdrops.layerBackdrop
import com.kyant.backdrop.backdrops.rememberLayerBackdrop
import dev.chrisbanes.haze.hazeSource
import dev.chrisbanes.haze.materials.ExperimentalHazeMaterialsApi
import kotlinx.coroutines.Dispatchers
import kotlinx.coroutines.delay
import kotlinx.coroutines.launch
import kotlinx.coroutines.withContext
import me.kavishdevar.librepods.R
import me.kavishdevar.librepods.composables.StyledScaffold
import me.kavishdevar.librepods.utils.LogCollector
import java.io.File
import java.text.SimpleDateFormat
import java.util.Date
import java.util.Locale
@Composable
fun CustomIconButton(
onClick: () -> Unit,
content: @Composable () -> Unit
) {
Box(
modifier = Modifier
.clickable(onClick = onClick)
.padding(8.dp),
contentAlignment = Alignment.Center
) {
content()
}
}
@OptIn(ExperimentalMaterial3Api::class, ExperimentalHazeMaterialsApi::class)
@Composable
fun TroubleshootingScreen(navController: NavController) {
val context = LocalContext.current
val scrollState = rememberScrollState()
val coroutineScope = rememberCoroutineScope()
val logCollector = remember { LogCollector(context) }
val savedLogs = remember { mutableStateListOf<File>() }
var isCollectingLogs by remember { mutableStateOf(false) }
var showTroubleshootingSteps by remember { mutableStateOf(false) }
var currentStep by remember { mutableIntStateOf(0) }
var logContent by remember { mutableStateOf("") }
var selectedLogFile by remember { mutableStateOf<File?>(null) }
var showDeleteDialog by remember { mutableStateOf(false) }
var showDeleteAllDialog by remember { mutableStateOf(false) }
var isLoadingLogContent by remember { mutableStateOf(false) }
var logContentLoaded by remember { mutableStateOf(false) }
LaunchedEffect(isCollectingLogs) {
while (isCollectingLogs) {
delay(250)
delay(250)
}
}
val sheetState = rememberModalBottomSheetState(skipPartiallyExpanded = false)
var showBottomSheet by remember { mutableStateOf(false) }
val backgroundColor = if (isSystemInDarkTheme()) Color(0xFF1C1C1E) else Color(0xFFFFFFFF)
val textColor = if (isSystemInDarkTheme()) Color.White else Color.Black
val accentColor = if (isSystemInDarkTheme()) Color(0xFF007AFF) else Color(0xFF3C6DF5)
val buttonBgColor = if (isSystemInDarkTheme()) Color(0xFF333333) else Color(0xFFDDDDDD)
var instructionText by remember { mutableStateOf("") }
val isDarkTheme = isSystemInDarkTheme()
LaunchedEffect(Unit) {
withContext(Dispatchers.IO) {
val logsDir = File(context.filesDir, "logs")
if (logsDir.exists()) {
savedLogs.clear()
savedLogs.addAll(logsDir.listFiles()?.filter { it.name.endsWith(".txt") }
?.sortedByDescending { it.lastModified() } ?: emptyList())
}
}
}
val saveLauncher = rememberLauncherForActivityResult(
contract = ActivityResultContracts.CreateDocument("text/plain")
) { uri ->
if (uri != null) {
coroutineScope.launch(Dispatchers.IO) {
try {
context.contentResolver.openOutputStream(uri)?.use { outputStream ->
outputStream.write(logContent.toByteArray())
}
withContext(Dispatchers.Main) {
Toast.makeText(context, "Log saved successfully", Toast.LENGTH_SHORT).show()
}
} catch (e: Exception) {
withContext(Dispatchers.Main) {
Toast.makeText(
context,
"Failed to save log: ${e.localizedMessage}",
Toast.LENGTH_SHORT
).show()
}
}
}
}
}
LaunchedEffect(currentStep) {
instructionText = when (currentStep) {
0 -> "First, let's ensure Xposed module is properly configured. Tap the button below to check Xposed scope settings."
1 -> "Please put your AirPods in the case and close it, so they disconnectForCD completely."
2 -> "Preparing to collect logs... Please wait."
3 -> "Now, open the AirPods case and connect your AirPods. Logs are being collected. Connection will be detected automatically, or you can manually stop logging when you're done."
4 -> "Log collection complete! You can now save or share the logs."
else -> ""
}
}
fun openLogBottomSheet(file: File) {
selectedLogFile = file
logContent = ""
isLoadingLogContent = false
logContentLoaded = false
showBottomSheet = true
}
val backdrop = rememberLayerBackdrop()
Box(
modifier = Modifier.fillMaxSize()
) {
StyledScaffold(
title = stringResource(R.string.troubleshooting)
){ spacerHeight, hazeState ->
Column(
modifier = Modifier
.fillMaxSize()
.layerBackdrop(backdrop)
.hazeSource(state = hazeState)
.verticalScroll(scrollState)
.padding(horizontal = 16.dp)
) {
Spacer(modifier = Modifier.height(spacerHeight))
Text(
text = stringResource(R.string.saved_logs),
style = TextStyle(
fontSize = 14.sp,
fontWeight = FontWeight.Bold,
color = textColor.copy(alpha = 0.6f),
fontFamily = FontFamily(Font(R.font.sf_pro))
),
modifier = Modifier.padding(16.dp, bottom = 4.dp, top = 8.dp)
)
Spacer(modifier = Modifier.height(2.dp))
if (savedLogs.isEmpty()) {
Column(
modifier = Modifier
.fillMaxWidth()
.background(
backgroundColor,
RoundedCornerShape(28.dp)
)
.padding(16.dp),
horizontalAlignment = Alignment.CenterHorizontally
) {
Text(
text = stringResource(R.string.no_logs_found),
fontSize = 16.sp,
color = textColor
)
}
} else {
Column(
modifier = Modifier
.fillMaxWidth()
.background(
backgroundColor,
RoundedCornerShape(28.dp)
)
.padding(horizontal = 16.dp, vertical = 8.dp)
) {
Row(
modifier = Modifier
.fillMaxWidth()
.padding(vertical = 8.dp),
horizontalArrangement = Arrangement.SpaceBetween,
verticalAlignment = Alignment.CenterVertically
) {
Text(
text = "Total Logs: ${savedLogs.size}",
fontSize = 16.sp,
fontWeight = FontWeight.Medium,
color = textColor
)
if (savedLogs.size > 1) {
TextButton(
onClick = { showDeleteAllDialog = true },
colors = ButtonDefaults.textButtonColors(
contentColor = MaterialTheme.colorScheme.error
)
) {
Text("Delete All")
}
}
}
savedLogs.forEach { logFile ->
Row(
modifier = Modifier
.fillMaxWidth()
.padding(vertical = 8.dp)
.clickable {
openLogBottomSheet(logFile)
},
verticalAlignment = Alignment.CenterVertically
) {
Column(modifier = Modifier.weight(1f)) {
Text(
text = logFile.name,
fontSize = 16.sp,
color = textColor,
maxLines = 1,
overflow = TextOverflow.Ellipsis
)
Text(
text = SimpleDateFormat("MMM dd, yyyy HH:mm", Locale.US)
.format(Date(logFile.lastModified())),
fontSize = 14.sp,
color = textColor.copy(alpha = 0.6f)
)
}
CustomIconButton(
onClick = {
selectedLogFile = logFile
showDeleteDialog = true
}
) {
Icon(
Icons.Default.Delete,
contentDescription = "Delete",
tint = MaterialTheme.colorScheme.error
)
}
}
}
}
}
Spacer(modifier = Modifier.height(16.dp))
AnimatedVisibility(
visible = !showTroubleshootingSteps,
enter = fadeIn(animationSpec = tween(300)),
exit = fadeOut(animationSpec = tween(300))
) {
Button(
onClick = { showTroubleshootingSteps = true },
modifier = Modifier.fillMaxWidth(),
shape = RoundedCornerShape(10.dp),
colors = ButtonDefaults.buttonColors(
containerColor = buttonBgColor,
contentColor = textColor
),
enabled = !isCollectingLogs
) {
Text(stringResource(R.string.collect_logs))
}
}
AnimatedVisibility(
visible = showTroubleshootingSteps,
enter = fadeIn(animationSpec = tween(300)) +
slideInVertically(animationSpec = tween(300)) { it / 2 },
exit = fadeOut(animationSpec = tween(300)) +
slideOutVertically(animationSpec = tween(300)) { it / 2 }
) {
Column {
Spacer(modifier = Modifier.height(16.dp))
Text(
text = stringResource(R.string.troubleshooting_steps),
style = TextStyle(
fontSize = 14.sp,
fontWeight = FontWeight.Light,
color = textColor.copy(alpha = 0.6f),
fontFamily = FontFamily(Font(R.font.sf_pro))
),
modifier = Modifier.padding(16.dp, bottom = 2.dp, top = 8.dp)
)
Spacer(modifier = Modifier.height(2.dp))
Column(
modifier = Modifier
.fillMaxWidth()
.background(
backgroundColor,
RoundedCornerShape(28.dp)
)
.padding(16.dp)
) {
val textAlpha = animateFloatAsState(
targetValue = 1f,
animationSpec = tween(durationMillis = 300),
label = "textAlpha"
)
Text(
text = instructionText,
fontSize = 16.sp,
color = textColor.copy(alpha = textAlpha.value),
lineHeight = 22.sp
)
Spacer(modifier = Modifier.height(16.dp))
when (currentStep) {
0 -> {
Button(
onClick = {
coroutineScope.launch {
logCollector.openXposedSettings(context)
delay(2000)
currentStep = 1
}
},
modifier = Modifier.fillMaxWidth(),
shape = RoundedCornerShape(10.dp),
colors = ButtonDefaults.buttonColors(
containerColor = buttonBgColor,
contentColor = textColor
)
) {
Text("Open Xposed Settings")
}
}
1 -> {
Button(
onClick = {
currentStep = 2
isCollectingLogs = true
coroutineScope.launch {
try {
logCollector.clearLogs()
logCollector.addLogMarker(LogCollector.LogMarkerType.START)
logCollector.killBluetoothService()
withContext(Dispatchers.Main) {
delay(500)
currentStep = 3
}
val timestamp = SimpleDateFormat(
"yyyyMMdd_HHmmss",
Locale.US
).format(Date())
logContent =
logCollector.startLogCollection(
listener = { /* Removed live log display */ },
connectionDetectedCallback = {
launch {
delay(5000)
withContext(Dispatchers.Main) {
if (isCollectingLogs) {
logCollector.stopLogCollection()
currentStep = 4
isCollectingLogs =
false
}
}
}
}
)
val logFile =
logCollector.saveLogToInternalStorage(
"airpods_log_$timestamp.txt",
logContent
)
logFile?.let {
withContext(Dispatchers.Main) {
savedLogs.add(0, it)
selectedLogFile = it
Toast.makeText(
context,
"Log saved: ${it.name}",
Toast.LENGTH_SHORT
).show()
}
}
} catch (e: Exception) {
withContext(Dispatchers.Main) {
Toast.makeText(
context,
"Error collecting logs: ${e.message}",
Toast.LENGTH_SHORT
).show()
isCollectingLogs = false
currentStep = 0
}
}
}
},
modifier = Modifier.fillMaxWidth(),
shape = RoundedCornerShape(10.dp),
colors = ButtonDefaults.buttonColors(
containerColor = buttonBgColor,
contentColor = textColor
)
) {
Text("Continue")
}
}
2, 3 -> {
Column(
modifier = Modifier.fillMaxWidth(),
horizontalAlignment = Alignment.CenterHorizontally
) {
CircularProgressIndicator(
color = accentColor
)
Spacer(modifier = Modifier.height(8.dp))
Text(
text = if (currentStep == 2) "Preparing..." else "Collecting logs...",
fontSize = 14.sp,
color = textColor
)
if (currentStep == 3) {
Spacer(modifier = Modifier.height(16.dp))
Button(
onClick = {
coroutineScope.launch {
logCollector.addLogMarker(
LogCollector.LogMarkerType.CUSTOM,
"Manual stop requested by user"
)
delay(1000)
logCollector.stopLogCollection()
delay(500)
withContext(Dispatchers.Main) {
currentStep = 4
isCollectingLogs = false
Toast.makeText(
context,
"Log collection stopped",
Toast.LENGTH_SHORT
).show()
}
}
},
shape = RoundedCornerShape(10.dp),
colors = ButtonDefaults.buttonColors(
containerColor = buttonBgColor,
contentColor = textColor
),
modifier = Modifier
.fillMaxWidth()
) {
Text("Stop Collection")
}
}
}
}
4 -> {
Row(
modifier = Modifier.fillMaxWidth(),
horizontalArrangement = Arrangement.Center
) {
Button(
onClick = {
selectedLogFile?.let { file ->
val fileUri = FileProvider.getUriForFile(
context,
"${context.packageName}.provider",
file
)
val shareIntent =
Intent(Intent.ACTION_SEND).apply {
type = "text/plain"
putExtra(
Intent.EXTRA_STREAM,
fileUri
)
addFlags(Intent.FLAG_GRANT_READ_URI_PERMISSION)
}
context.startActivity(
Intent.createChooser(
shareIntent,
"Share log file"
)
)
}
},
shape = RoundedCornerShape(10.dp),
colors = ButtonDefaults.buttonColors(
containerColor = buttonBgColor,
contentColor = textColor
),
modifier = Modifier.width(150.dp)
) {
Icon(
imageVector = Icons.Default.Share,
contentDescription = "Share"
)
Spacer(modifier = Modifier.width(8.dp))
Text("Share")
}
Spacer(modifier = Modifier.width(16.dp))
Button(
onClick = {
selectedLogFile?.let { file ->
saveLauncher.launch(
file.absolutePath
)
}
},
shape = RoundedCornerShape(10.dp),
colors = ButtonDefaults.buttonColors(
containerColor = buttonBgColor,
contentColor = textColor
),
modifier = Modifier.width(150.dp)
) {
Icon(
painter = painterResource(id = R.drawable.ic_save),
contentDescription = "Save"
)
Spacer(modifier = Modifier.width(8.dp))
Text("Save")
}
}
Spacer(modifier = Modifier.height(16.dp))
Button(
onClick = {
currentStep = 0
showTroubleshootingSteps = false
},
modifier = Modifier.fillMaxWidth(),
shape = RoundedCornerShape(10.dp),
colors = ButtonDefaults.buttonColors(
containerColor = buttonBgColor,
contentColor = textColor
)
) {
Text("Done")
}
}
}
}
}
}
if (showDeleteDialog && selectedLogFile != null) {
AlertDialog(
onDismissRequest = { showDeleteDialog = false },
title = { Text("Delete Log File") },
text = {
Text("Are you sure you want to delete this log file? This action cannot be undone.")
},
confirmButton = {
TextButton(
onClick = {
selectedLogFile?.let { file ->
if (file.delete()) {
savedLogs.remove(file)
Toast.makeText(
context,
"Log file deleted",
Toast.LENGTH_SHORT
)
.show()
} else {
Toast.makeText(
context,
"Failed to delete log file",
Toast.LENGTH_SHORT
).show()
}
}
showDeleteDialog = false
}
) {
Text("Delete", color = MaterialTheme.colorScheme.error)
}
},
dismissButton = {
TextButton(onClick = { showDeleteDialog = false }) {
Text("Cancel")
}
}
)
}
if (showDeleteAllDialog) {
AlertDialog(
onDismissRequest = { showDeleteAllDialog = false },
title = { Text("Delete All Logs") },
text = {
Text("Are you sure you want to delete all log files? This action cannot be undone and will remove ${savedLogs.size} log files.")
},
confirmButton = {
TextButton(
onClick = {
coroutineScope.launch(Dispatchers.IO) {
var deletedCount = 0
savedLogs.forEach { file ->
if (file.delete()) {
deletedCount++
}
}
withContext(Dispatchers.Main) {
if (deletedCount > 0) {
savedLogs.clear()
Toast.makeText(
context,
"Deleted $deletedCount log files",
Toast.LENGTH_SHORT
).show()
} else {
Toast.makeText(
context,
"Failed to delete log files",
Toast.LENGTH_SHORT
).show()
}
}
}
showDeleteAllDialog = false
}
) {
Text("Delete All", color = MaterialTheme.colorScheme.error)
}
},
dismissButton = {
TextButton(onClick = { showDeleteAllDialog = false }) {
Text("Cancel")
}
}
)
}
}
}
if (showBottomSheet) {
ModalBottomSheet(
onDismissRequest = { showBottomSheet = false },
sheetState = sheetState,
containerColor = if (isDarkTheme) Color(0xFF1C1C1E) else Color(0xFFF2F2F7),
shape = RoundedCornerShape(topStart = 28.dp, topEnd = 28.dp),
tonalElevation = 8.dp
) {
LaunchedEffect(selectedLogFile) {
if (!logContentLoaded) {
delay(300)
withContext(Dispatchers.IO) {
isLoadingLogContent = true
logContent = try {
selectedLogFile?.readText() ?: ""
} catch (e: Exception) {
"Error loading log content: ${e.message}"
}
isLoadingLogContent = false
logContentLoaded = true
}
}
}
Column(
modifier = Modifier
.fillMaxWidth()
.padding(horizontal = 16.dp, vertical = 12.dp)
.padding(bottom = 32.dp)
) {
Column(
modifier = Modifier
.fillMaxWidth()
.padding(bottom = 12.dp),
) {
Text(
text = selectedLogFile?.name ?: "Log Content",
style = TextStyle(
fontWeight = FontWeight.Bold,
fontSize = 20.sp,
fontFamily = FontFamily(Font(R.font.sf_pro))
),
color = textColor
)
Text(
text = SimpleDateFormat("MMM dd, yyyy HH:mm", Locale.US)
.format(Date(selectedLogFile?.lastModified() ?: 0)),
fontSize = 14.sp,
color = textColor.copy(alpha = 0.7f),
fontFamily = FontFamily(Font(R.font.sf_pro))
)
}
if (isLoadingLogContent) {
Box(
modifier = Modifier
.fillMaxWidth()
.height(300.dp),
contentAlignment = Alignment.Center
) {
CircularProgressIndicator(color = accentColor)
}
} else {
Box(
modifier = Modifier
.fillMaxWidth()
.height(300.dp)
.background(
color = Color.Black,
shape = RoundedCornerShape(8.dp)
)
) {
val horizontalScrollState = rememberScrollState()
val verticalScrollState = rememberScrollState()
Box(
modifier = Modifier
.fillMaxSize()
.padding(8.dp)
.horizontalScroll(horizontalScrollState)
.verticalScroll(verticalScrollState)
) {
Text(
text = logContent,
fontSize = 14.sp,
color = Color.LightGray,
lineHeight = 20.sp,
fontFamily = FontFamily.Monospace,
softWrap = false
)
}
}
}
Row(
modifier = Modifier
.fillMaxWidth()
.padding(top = 16.dp),
horizontalArrangement = Arrangement.spacedBy(12.dp)
) {
Button(
onClick = {
selectedLogFile?.let { file ->
val fileUri = FileProvider.getUriForFile(
context,
"${context.packageName}.provider",
file
)
val shareIntent = Intent(Intent.ACTION_SEND).apply {
type = "text/plain"
putExtra(Intent.EXTRA_STREAM, fileUri)
addFlags(Intent.FLAG_GRANT_READ_URI_PERMISSION)
}
context.startActivity(
Intent.createChooser(
shareIntent,
"Share log file"
)
)
}
},
shape = RoundedCornerShape(10.dp),
colors = ButtonDefaults.buttonColors(
containerColor = buttonBgColor,
contentColor = textColor
),
modifier = Modifier.weight(1f)
) {
Icon(
imageVector = Icons.Default.Share,
contentDescription = "Share"
)
Spacer(modifier = Modifier.width(8.dp))
Text("Share")
}
Button(
onClick = {
selectedLogFile?.let { file ->
saveLauncher.launch(file.absolutePath)
}
},
shape = RoundedCornerShape(10.dp),
colors = ButtonDefaults.buttonColors(
containerColor = buttonBgColor,
contentColor = textColor
),
modifier = Modifier.weight(1f)
) {
Icon(
painter = painterResource(id = R.drawable.ic_save),
contentDescription = "Save"
)
Spacer(modifier = Modifier.width(8.dp))
Text("Save")
}
}
}
}
}
}
DisposableEffect(Unit) {
onDispose {
logCollector.stopLogCollection()
}
}
}

View File

@@ -0,0 +1,359 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.screens
import android.annotation.SuppressLint
import android.util.Log
import androidx.compose.foundation.layout.Arrangement
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.Row
import androidx.compose.foundation.layout.Spacer
import androidx.compose.foundation.layout.fillMaxSize
import androidx.compose.foundation.layout.fillMaxWidth
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.layout.width
import androidx.compose.foundation.rememberScrollState
import androidx.compose.foundation.text.KeyboardOptions
import androidx.compose.foundation.verticalScroll
import androidx.compose.material3.ExperimentalMaterial3Api
import androidx.compose.material3.OutlinedTextField
import androidx.compose.material3.Text
import androidx.compose.runtime.Composable
import androidx.compose.runtime.DisposableEffect
import androidx.compose.runtime.LaunchedEffect
import androidx.compose.runtime.MutableState
import androidx.compose.runtime.mutableIntStateOf
import androidx.compose.runtime.mutableStateOf
import androidx.compose.runtime.remember
import androidx.compose.ui.Alignment
import androidx.compose.ui.Modifier
import androidx.compose.ui.res.stringResource
import androidx.compose.ui.text.TextStyle
import androidx.compose.ui.text.font.Font
import androidx.compose.ui.text.font.FontFamily
import androidx.compose.ui.text.input.KeyboardType
import androidx.compose.ui.text.style.TextAlign
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.sp
import androidx.navigation.NavController
import com.kyant.backdrop.backdrops.layerBackdrop
import com.kyant.backdrop.backdrops.rememberLayerBackdrop
import dev.chrisbanes.haze.hazeSource
import dev.chrisbanes.haze.materials.ExperimentalHazeMaterialsApi
import kotlinx.coroutines.Job
import kotlinx.coroutines.delay
import me.kavishdevar.librepods.R
import me.kavishdevar.librepods.composables.StyledScaffold
import me.kavishdevar.librepods.services.ServiceManager
import me.kavishdevar.librepods.utils.AACPManager
import me.kavishdevar.librepods.utils.ATTHandles
import me.kavishdevar.librepods.utils.HearingAidSettings
import me.kavishdevar.librepods.utils.parseHearingAidSettingsResponse
import me.kavishdevar.librepods.utils.sendHearingAidSettings
import java.io.IOException
import kotlin.io.encoding.ExperimentalEncodingApi
private var debounceJob: MutableState<Job?> = mutableStateOf(null)
private const val TAG = "HearingAidAdjustments"
@SuppressLint("DefaultLocale")
@ExperimentalHazeMaterialsApi
@OptIn(ExperimentalMaterial3Api::class, ExperimentalEncodingApi::class)
@Composable
fun UpdateHearingTestScreen(@Suppress("unused") navController: NavController) {
val verticalScrollState = rememberScrollState()
val attManager = ServiceManager.getService()?.attManager
if (attManager == null) {
Text(
text = stringResource(R.string.att_manager_is_null_try_reconnecting),
modifier = Modifier
.fillMaxSize()
.padding(16.dp),
textAlign = TextAlign.Center
)
return
}
val aacpManager = remember { ServiceManager.getService()?.aacpManager }
val backdrop = rememberLayerBackdrop()
StyledScaffold(
title = stringResource(R.string.hearing_test)
) { spacerHeight, hazeState ->
Column(
modifier = Modifier
.hazeSource(hazeState)
.fillMaxSize()
.layerBackdrop(backdrop)
.verticalScroll(verticalScrollState)
.padding(horizontal = 16.dp),
verticalArrangement = Arrangement.spacedBy(16.dp)
) {
Spacer(modifier = Modifier.height(spacerHeight))
Text(
text = stringResource(R.string.hearing_test_value_instruction),
fontSize = 16.sp,
modifier = Modifier.fillMaxWidth(),
textAlign = TextAlign.Center,
fontFamily = FontFamily(Font(R.font.sf_pro))
)
val conversationBoostEnabled = remember { mutableStateOf(false) }
val leftEQ = remember { mutableStateOf(FloatArray(8)) }
val rightEQ = remember { mutableStateOf(FloatArray(8)) }
val initialLoadComplete = remember { mutableStateOf(false) }
val initialReadSucceeded = remember { mutableStateOf(false) }
val initialReadAttempts = remember { mutableIntStateOf(0) }
val hearingAidSettings = remember {
mutableStateOf(
HearingAidSettings(
leftEQ = leftEQ.value,
rightEQ = rightEQ.value,
leftAmplification = 0.5f,
rightAmplification = 0.5f,
leftTone = 0.5f,
rightTone = 0.5f,
leftConversationBoost = conversationBoostEnabled.value,
rightConversationBoost = conversationBoostEnabled.value,
leftAmbientNoiseReduction = 0.0f,
rightAmbientNoiseReduction = 0.0f,
netAmplification = 0.5f,
balance = 0.5f,
ownVoiceAmplification = 0.5f
)
)
}
val hearingAidEnabled = remember {
val aidStatus = aacpManager?.controlCommandStatusList?.find { it.identifier == AACPManager.Companion.ControlCommandIdentifiers.HEARING_AID }
val assistStatus = aacpManager?.controlCommandStatusList?.find { it.identifier == AACPManager.Companion.ControlCommandIdentifiers.HEARING_ASSIST_CONFIG }
mutableStateOf((aidStatus?.value?.getOrNull(1) == 0x01.toByte()) && (assistStatus?.value?.getOrNull(0) == 0x01.toByte()))
}
val hearingAidListener = remember {
object : AACPManager.ControlCommandListener {
override fun onControlCommandReceived(controlCommand: AACPManager.ControlCommand) {
if (controlCommand.identifier == AACPManager.Companion.ControlCommandIdentifiers.HEARING_AID.value ||
controlCommand.identifier == AACPManager.Companion.ControlCommandIdentifiers.HEARING_ASSIST_CONFIG.value) {
val aidStatus = aacpManager?.controlCommandStatusList?.find { it.identifier == AACPManager.Companion.ControlCommandIdentifiers.HEARING_AID }
val assistStatus = aacpManager?.controlCommandStatusList?.find { it.identifier == AACPManager.Companion.ControlCommandIdentifiers.HEARING_ASSIST_CONFIG }
hearingAidEnabled.value = (aidStatus?.value?.getOrNull(1) == 0x01.toByte()) && (assistStatus?.value?.getOrNull(0) == 0x01.toByte())
}
}
}
}
val hearingAidATTListener = remember {
object : (ByteArray) -> Unit {
override fun invoke(value: ByteArray) {
val parsed = parseHearingAidSettingsResponse(value)
if (parsed != null) {
leftEQ.value = parsed.leftEQ.copyOf()
rightEQ.value = parsed.rightEQ.copyOf()
conversationBoostEnabled.value = parsed.leftConversationBoost
Log.d(TAG, "Updated hearing aid settings from notification")
} else {
Log.w(TAG, "Failed to parse hearing aid settings from notification")
}
}
}
}
LaunchedEffect(Unit) {
aacpManager?.registerControlCommandListener(AACPManager.Companion.ControlCommandIdentifiers.HEARING_AID, hearingAidListener)
aacpManager?.registerControlCommandListener(AACPManager.Companion.ControlCommandIdentifiers.HEARING_ASSIST_CONFIG, hearingAidListener)
}
DisposableEffect(Unit) {
onDispose {
aacpManager?.unregisterControlCommandListener(AACPManager.Companion.ControlCommandIdentifiers.HEARING_AID, hearingAidListener)
aacpManager?.unregisterControlCommandListener(AACPManager.Companion.ControlCommandIdentifiers.HEARING_ASSIST_CONFIG, hearingAidListener)
attManager.unregisterListener(ATTHandles.HEARING_AID, hearingAidATTListener)
}
}
LaunchedEffect(leftEQ.value, rightEQ.value, conversationBoostEnabled.value, initialLoadComplete.value, initialReadSucceeded.value) {
if (!initialLoadComplete.value) {
Log.d(TAG, "Initial device load not complete - skipping send")
return@LaunchedEffect
}
if (!initialReadSucceeded.value) {
Log.d(TAG, "Initial device read not successful yet - skipping send until read succeeds")
return@LaunchedEffect
}
hearingAidSettings.value = HearingAidSettings(
leftEQ = leftEQ.value,
rightEQ = rightEQ.value,
leftAmplification = 0.5f,
rightAmplification = 0.5f,
leftTone = 0.5f,
rightTone = 0.5f,
leftConversationBoost = conversationBoostEnabled.value,
rightConversationBoost = conversationBoostEnabled.value,
leftAmbientNoiseReduction = 0.0f,
rightAmbientNoiseReduction = 0.0f,
netAmplification = 0.5f,
balance = 0.5f,
ownVoiceAmplification = 0.5f
)
Log.d(TAG, "Updated settings: ${hearingAidSettings.value}")
sendHearingAidSettings(attManager, hearingAidSettings.value, debounceJob)
}
LaunchedEffect(Unit) {
Log.d(TAG, "Connecting to ATT...")
try {
attManager.enableNotifications(ATTHandles.HEARING_AID)
attManager.registerListener(ATTHandles.HEARING_AID, hearingAidATTListener)
try {
if (aacpManager != null) {
Log.d(TAG, "Found AACPManager, reading cached EQ data")
val aacpEQ = aacpManager.eqData
if (aacpEQ.isNotEmpty()) {
leftEQ.value = aacpEQ.copyOf()
rightEQ.value = aacpEQ.copyOf()
Log.d(TAG, "Populated EQ from AACPManager: ${aacpEQ.toList()}")
} else {
Log.d(TAG, "AACPManager EQ data empty")
}
} else {
Log.d(TAG, "No AACPManager available")
}
} catch (e: Exception) {
Log.w(TAG, "Error reading EQ from AACPManager: ${e.message}")
}
var parsedSettings: HearingAidSettings? = null
for (attempt in 1..3) {
initialReadAttempts.intValue = attempt
try {
val data = attManager.read(ATTHandles.HEARING_AID)
parsedSettings = parseHearingAidSettingsResponse(data = data)
if (parsedSettings != null) {
Log.d(TAG, "Parsed settings on attempt $attempt")
break
} else {
Log.d(TAG, "Parsing returned null on attempt $attempt")
}
} catch (e: Exception) {
Log.w(TAG, "Read attempt $attempt failed: ${e.message}")
}
delay(200)
}
if (parsedSettings != null) {
Log.d(TAG, "Initial hearing aid settings: $parsedSettings")
leftEQ.value = parsedSettings.leftEQ.copyOf()
rightEQ.value = parsedSettings.rightEQ.copyOf()
conversationBoostEnabled.value = parsedSettings.leftConversationBoost
initialReadSucceeded.value = true
} else {
Log.d(TAG, "Failed to read/parse initial hearing aid settings after ${initialReadAttempts.intValue} attempts")
}
} catch (e: IOException) {
e.printStackTrace()
} finally {
initialLoadComplete.value = true
}
}
val frequencies = listOf("250Hz", "500Hz", "1kHz", "2kHz", "3kHz", "4kHz", "6kHz", "8kHz")
Row(
modifier = Modifier.fillMaxWidth(),
horizontalArrangement = Arrangement.spacedBy(8.dp)
) {
Spacer(modifier = Modifier.width(60.dp))
Text(
text = stringResource(R.string.left),
fontSize = 18.sp,
modifier = Modifier.weight(1f),
textAlign = TextAlign.Center,
fontFamily = FontFamily(Font(R.font.sf_pro))
)
Text(
text = stringResource(R.string.right),
fontSize = 18.sp,
modifier = Modifier.weight(1f),
textAlign = TextAlign.Center,
fontFamily = FontFamily(Font(R.font.sf_pro))
)
}
frequencies.forEachIndexed { index, freq ->
Row(
modifier = Modifier.fillMaxWidth(),
horizontalArrangement = Arrangement.spacedBy(8.dp)
) {
Text(
text = freq,
modifier = Modifier
.width(60.dp)
.align(Alignment.CenterVertically),
textAlign = TextAlign.End,
fontSize = 16.sp,
fontFamily = FontFamily(Font(R.font.sf_pro)),
)
OutlinedTextField(
value = leftEQ.value[index].toString(),
onValueChange = { newValue ->
val parsed = newValue.toFloatOrNull()
if (parsed != null) {
val newArray = leftEQ.value.copyOf()
newArray[index] = parsed
leftEQ.value = newArray
}
},
// label = { Text("Value", fontSize = 14.sp, fontFamily = FontFamily(Font(R.font.sf_pro))) },
keyboardOptions = KeyboardOptions(keyboardType = KeyboardType.Number),
textStyle = TextStyle(
fontFamily = FontFamily(Font(R.font.sf_pro)),
fontSize = 14.sp
),
modifier = Modifier.weight(1f)
)
OutlinedTextField(
value = rightEQ.value[index].toString(),
onValueChange = { newValue ->
val parsed = newValue.toFloatOrNull()
if (parsed != null) {
val newArray = rightEQ.value.copyOf()
newArray[index] = parsed
rightEQ.value = newArray
}
},
// label = { Text("Value", fontSize = 14.sp, fontFamily = FontFamily(Font(R.font.sf_pro))) },
keyboardOptions = KeyboardOptions(keyboardType = KeyboardType.Number),
textStyle = TextStyle(
fontFamily = FontFamily(Font(R.font.sf_pro)),
fontSize = 14.sp
),
modifier = Modifier.weight(1f)
)
}
}
}
}
}

View File

@@ -0,0 +1,192 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.screens
import androidx.compose.foundation.background
import android.annotation.SuppressLint
import androidx.compose.foundation.isSystemInDarkTheme
import androidx.compose.foundation.layout.Arrangement
import androidx.compose.foundation.layout.Box
import androidx.compose.foundation.layout.Column
import androidx.compose.foundation.layout.Spacer
import androidx.compose.foundation.layout.Row
import androidx.compose.foundation.layout.fillMaxWidth
import androidx.compose.foundation.layout.fillMaxSize
import androidx.compose.foundation.layout.height
import androidx.compose.foundation.layout.padding
import androidx.compose.foundation.shape.RoundedCornerShape
import androidx.compose.material3.ExperimentalMaterial3Api
import androidx.compose.material3.HorizontalDivider
import androidx.compose.material3.Text
import androidx.compose.runtime.Composable
import androidx.compose.ui.Modifier
import androidx.compose.ui.draw.clip
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.res.stringResource
import androidx.compose.ui.text.TextStyle
import androidx.compose.ui.text.font.Font
import androidx.compose.ui.text.font.FontFamily
import androidx.compose.ui.text.font.FontWeight
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.sp
import androidx.navigation.NavController
import com.kyant.backdrop.backdrops.layerBackdrop
import com.kyant.backdrop.backdrops.rememberLayerBackdrop
import dev.chrisbanes.haze.materials.ExperimentalHazeMaterialsApi
import kotlinx.coroutines.Job
import me.kavishdevar.librepods.R
import me.kavishdevar.librepods.composables.StyledScaffold
import me.kavishdevar.librepods.services.ServiceManager
import kotlin.io.encoding.ExperimentalEncodingApi
private var debounceJob: Job? = null
@SuppressLint("DefaultLocale")
@ExperimentalHazeMaterialsApi
@OptIn(ExperimentalMaterial3Api::class, ExperimentalEncodingApi::class)
@Composable
fun VersionScreen(navController: NavController) {
val isDarkTheme = isSystemInDarkTheme()
val service = ServiceManager.getService()
if (service == null) return
val airpodsInstance = service.airpodsInstance
if (airpodsInstance == null) return
val backgroundColor = if (isDarkTheme) Color(0xFF1C1C1E) else Color(0xFFFFFFFF)
val textColor = if (isDarkTheme) Color.White else Color.Black
val backdrop = rememberLayerBackdrop()
StyledScaffold(
title = stringResource(R.string.customize_adaptive_audio)
) { spacerHeight ->
Column(
modifier = Modifier
.fillMaxSize()
.layerBackdrop(backdrop)
.padding(horizontal = 16.dp)
) {
Spacer(modifier = Modifier.height(spacerHeight))
Box(
modifier = Modifier
.background(if (isDarkTheme) Color(0xFF000000) else Color(0xFFF2F2F7))
.padding(horizontal = 16.dp, vertical = 4.dp)
){
Text(
text = stringResource(R.string.version),
style = TextStyle(
fontSize = 14.sp,
fontWeight = FontWeight.Bold,
color = textColor.copy(alpha = 0.6f)
)
)
}
Column(
modifier = Modifier
.clip(RoundedCornerShape(28.dp))
.fillMaxWidth()
.background(backgroundColor, RoundedCornerShape(28.dp))
.padding(top = 2.dp)
) {
Row(
modifier = Modifier
.fillMaxWidth()
.padding(16.dp),
horizontalArrangement = Arrangement.SpaceBetween,
) {
Text(
text = stringResource(R.string.version) + " 1",
style = TextStyle(
fontSize = 16.sp,
color = textColor,
fontFamily = FontFamily(Font(R.font.sf_pro))
)
)
Text(
text = airpodsInstance.version1 ?: "N/A",
style = TextStyle(
fontSize = 16.sp,
color = textColor.copy(0.8f),
fontFamily = FontFamily(Font(R.font.sf_pro))
)
)
}
HorizontalDivider(
thickness = 1.dp,
color = Color(0x40888888),
modifier = Modifier
.padding(horizontal = 12.dp)
)
Row(
modifier = Modifier
.fillMaxWidth()
.padding(16.dp),
horizontalArrangement = Arrangement.SpaceBetween,
) {
Text(
text = stringResource(R.string.version) + " 2",
style = TextStyle(
fontSize = 16.sp,
color = textColor,
fontFamily = FontFamily(Font(R.font.sf_pro))
)
)
Text(
text = airpodsInstance.version2 ?: "N/A",
style = TextStyle(
fontSize = 16.sp,
color = textColor.copy(0.8f),
fontFamily = FontFamily(Font(R.font.sf_pro))
)
)
}
HorizontalDivider(
thickness = 1.dp,
color = Color(0x40888888),
modifier = Modifier
.padding(horizontal = 12.dp)
)
Row(
modifier = Modifier
.fillMaxWidth()
.padding(16.dp),
horizontalArrangement = Arrangement.SpaceBetween,
) {
Text(
text = stringResource(R.string.version) + " 3",
style = TextStyle(
fontSize = 16.sp,
color = textColor,
fontFamily = FontFamily(Font(R.font.sf_pro))
)
)
Text(
text = airpodsInstance.version3 ?: "N/A",
style = TextStyle(
fontSize = 16.sp,
color = textColor.copy(0.8f),
fontFamily = FontFamily(Font(R.font.sf_pro))
)
)
}
}
}
}
}

View File

@@ -0,0 +1,276 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods Contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
@file:OptIn(ExperimentalEncodingApi::class)
package me.kavishdevar.librepods.services
import android.annotation.SuppressLint
import android.app.PendingIntent
import android.content.BroadcastReceiver
import android.content.Context
import android.content.Intent
import android.content.IntentFilter
import android.content.SharedPreferences
import android.graphics.drawable.Icon
import android.os.Build
import android.service.quicksettings.Tile
import android.service.quicksettings.TileService
import android.util.Log
import androidx.annotation.RequiresApi
import me.kavishdevar.librepods.QuickSettingsDialogActivity
import me.kavishdevar.librepods.R
import me.kavishdevar.librepods.constants.AirPodsNotifications
import me.kavishdevar.librepods.constants.NoiseControlMode
import me.kavishdevar.librepods.utils.AACPManager
import kotlin.io.encoding.ExperimentalEncodingApi
@RequiresApi(Build.VERSION_CODES.Q)
class AirPodsQSService : TileService() {
private lateinit var sharedPreferences: SharedPreferences
private var currentAncMode: Int = NoiseControlMode.OFF.ordinal + 1
private var isAirPodsConnected: Boolean = false
private val ancStatusReceiver = object : BroadcastReceiver() {
override fun onReceive(context: Context, intent: Intent) {
if (intent.action == AirPodsNotifications.ANC_DATA) {
val newMode = intent.getIntExtra("data", NoiseControlMode.OFF.ordinal + 1)
Log.d("AirPodsQSService", "Received ANC update: $newMode")
currentAncMode = newMode
updateTile()
}
}
}
private val availabilityReceiver = object : BroadcastReceiver() {
override fun onReceive(context: Context, intent: Intent) {
when (intent.action) {
AirPodsNotifications.AIRPODS_CONNECTED -> {
Log.d("AirPodsQSService", "Received AIRPODS_CONNECTED")
isAirPodsConnected = true
currentAncMode =
ServiceManager.getService()?.getANC() ?: (NoiseControlMode.OFF.ordinal + 1)
updateTile()
}
AirPodsNotifications.AIRPODS_DISCONNECTED -> {
Log.d("AirPodsQSService", "Received AIRPODS_DISCONNECTED")
isAirPodsConnected = false
updateTile()
}
}
}
}
private val preferenceChangeListener = SharedPreferences.OnSharedPreferenceChangeListener { _, key ->
if (key == "off_listening_mode") {
Log.d("AirPodsQSService", "Preference changed: $key")
if (currentAncMode == NoiseControlMode.OFF.ordinal + 1 && !isOffModeEnabled()) {
currentAncMode = NoiseControlMode.TRANSPARENCY.ordinal + 1
}
updateTile()
}
}
override fun onCreate() {
super.onCreate()
sharedPreferences = getSharedPreferences("settings", MODE_PRIVATE)
}
@SuppressLint("InlinedApi", "UnspecifiedRegisterReceiverFlag")
override fun onStartListening() {
super.onStartListening()
Log.d("AirPodsQSService", "onStartListening")
val service = ServiceManager.getService()
isAirPodsConnected = service?.isConnectedLocally == true
currentAncMode = service?.getANC() ?: (NoiseControlMode.OFF.ordinal + 1)
if (currentAncMode == NoiseControlMode.OFF.ordinal + 1 && !isOffModeEnabled()) {
currentAncMode = NoiseControlMode.TRANSPARENCY.ordinal + 1
}
val ancIntentFilter = IntentFilter(AirPodsNotifications.ANC_DATA)
val availabilityIntentFilter = IntentFilter().apply {
addAction(AirPodsNotifications.AIRPODS_CONNECTED)
addAction(AirPodsNotifications.AIRPODS_DISCONNECTED)
}
try {
if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.TIRAMISU) {
registerReceiver(ancStatusReceiver, ancIntentFilter, RECEIVER_EXPORTED)
registerReceiver(availabilityReceiver, availabilityIntentFilter, RECEIVER_EXPORTED)
} else {
registerReceiver(ancStatusReceiver, ancIntentFilter)
registerReceiver(availabilityReceiver, availabilityIntentFilter)
}
sharedPreferences.registerOnSharedPreferenceChangeListener(preferenceChangeListener)
Log.d("AirPodsQSService", "Receivers registered")
} catch (e: Exception) {
Log.e("AirPodsQSService", "Error registering receivers: $e")
}
updateTile()
}
override fun onStopListening() {
super.onStopListening()
Log.d("AirPodsQSService", "onStopListening")
try {
unregisterReceiver(ancStatusReceiver)
unregisterReceiver(availabilityReceiver)
sharedPreferences.unregisterOnSharedPreferenceChangeListener(preferenceChangeListener)
Log.d("AirPodsQSService", "Receivers unregistered")
} catch (e: IllegalArgumentException) {
Log.e("AirPodsQSService", "Receiver not registered or already unregistered: $e")
} catch (e: Exception) {
Log.e("AirPodsQSService", "Error unregistering receivers: $e")
}
}
override fun onClick() {
super.onClick()
Log.d("AirPodsQSService", "onClick - Current state: $isAirPodsConnected, Current mode: $currentAncMode")
if (!isAirPodsConnected) {
Log.d("AirPodsQSService", "Tile clicked but AirPods not connected.")
return
}
val clickBehavior = sharedPreferences.getString("qs_click_behavior", "dialog") ?: "dialog"
if (clickBehavior == "dialog") {
launchDialogActivity()
} else {
cycleAncMode()
}
}
private fun launchDialogActivity() {
try {
if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.UPSIDE_DOWN_CAKE) {
val pendingIntent = PendingIntent.getActivity(
this,
0,
Intent(this, QuickSettingsDialogActivity::class.java).apply {
addFlags(Intent.FLAG_ACTIVITY_NEW_TASK or Intent.FLAG_ACTIVITY_CLEAR_TASK)
},
PendingIntent.FLAG_IMMUTABLE or PendingIntent.FLAG_UPDATE_CURRENT
)
startActivityAndCollapse(pendingIntent)
} else {
val intent = Intent(this, QuickSettingsDialogActivity::class.java).apply {
addFlags(Intent.FLAG_ACTIVITY_NEW_TASK or Intent.FLAG_ACTIVITY_CLEAR_TASK)
}
@Suppress("DEPRECATION")
@SuppressLint("StartActivityAndCollapseDeprecated")
startActivityAndCollapse(intent)
}
Log.d("AirPodsQSService", "Called startActivityAndCollapse for QuickSettingsDialogActivity")
} catch (e: Exception) {
Log.e("AirPodsQSService", "Error launching QuickSettingsDialogActivity: $e")
}
}
private fun cycleAncMode() {
val service = ServiceManager.getService()
if (service == null) {
Log.d("AirPodsQSService", "Tile clicked (cycle mode) but service is null.")
return
}
val nextMode = getNextAncMode()
Log.d("AirPodsQSService", "Cycling ANC mode to: $nextMode")
service.aacpManager.sendControlCommand(
AACPManager.Companion.ControlCommandIdentifiers.LISTENING_MODE.value,
nextMode
)
}
private fun updateTile() {
val tile = qsTile ?: return
Log.d("AirPodsQSService", "updateTile - Connected: $isAirPodsConnected, Mode: $currentAncMode")
val deviceName = sharedPreferences.getString("name", "AirPods") ?: "AirPods"
if (isAirPodsConnected) {
tile.state = Tile.STATE_ACTIVE
tile.label = getModeLabel(currentAncMode)
tile.subtitle = deviceName
tile.icon = Icon.createWithResource(this, getModeIcon(currentAncMode))
} else {
tile.state = Tile.STATE_UNAVAILABLE
tile.label = "AirPods"
tile.subtitle = "Disconnected"
tile.icon = Icon.createWithResource(this, R.drawable.airpods)
}
try {
tile.updateTile()
Log.d("AirPodsQSService", "Tile updated successfully")
} catch (e: Exception) {
Log.e("AirPodsQSService", "Error updating tile: $e")
}
}
private fun isOffModeEnabled(): Boolean {
return sharedPreferences.getBoolean("off_listening_mode", true)
}
private fun getAvailableModes(): List<Int> {
val modes = mutableListOf(
NoiseControlMode.TRANSPARENCY.ordinal + 1,
NoiseControlMode.ADAPTIVE.ordinal + 1,
NoiseControlMode.NOISE_CANCELLATION.ordinal + 1
)
if (isOffModeEnabled()) {
modes.add(0, NoiseControlMode.OFF.ordinal + 1)
}
return modes
}
private fun getNextAncMode(): Int {
val availableModes = getAvailableModes()
val currentIndex = availableModes.indexOf(currentAncMode)
val nextIndex = (currentIndex + 1) % availableModes.size
return availableModes[nextIndex]
}
private fun getModeLabel(mode: Int): String {
return when (mode) {
NoiseControlMode.OFF.ordinal + 1 -> "Off"
NoiseControlMode.TRANSPARENCY.ordinal + 1 -> "Transparency"
NoiseControlMode.ADAPTIVE.ordinal + 1 -> "Adaptive"
NoiseControlMode.NOISE_CANCELLATION.ordinal + 1 -> "Noise Cancellation"
else -> "Unknown"
}
}
private fun getModeIcon(mode: Int): Int {
return when (mode) {
NoiseControlMode.OFF.ordinal + 1 -> R.drawable.noise_cancellation
NoiseControlMode.TRANSPARENCY.ordinal + 1 -> R.drawable.transparency
NoiseControlMode.ADAPTIVE.ordinal + 1 -> R.drawable.adaptive
NoiseControlMode.NOISE_CANCELLATION.ordinal + 1 -> R.drawable.noise_cancellation
else -> R.drawable.airpods
}
}
override fun onTileAdded() {
super.onTileAdded()
Log.d("AirPodsQSService", "Tile added")
}
}

File diff suppressed because it is too large Load Diff

View File

@@ -0,0 +1,98 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods Contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
@file:OptIn(ExperimentalEncodingApi::class)
package me.kavishdevar.librepods.services
import android.accessibilityservice.AccessibilityService
import android.util.Log
import android.view.accessibility.AccessibilityEvent
import kotlin.io.encoding.ExperimentalEncodingApi
private const val TAG="AppListenerService"
val cameraPackages = mutableSetOf(
"com.google.android.GoogleCamera",
"com.sec.android.app.camera",
"com.android.camera",
"com.oppo.camera",
"com.motorola.camera2",
"org.codeaurora.snapcam"
)
var cameraOpen = false
private var currentCustomPackage: String? = null
class AppListenerService : AccessibilityService() {
private lateinit var prefs: android.content.SharedPreferences
private val preferenceChangeListener = android.content.SharedPreferences.OnSharedPreferenceChangeListener { sharedPreferences, key ->
if (key == "custom_camera_package") {
val newPackage = sharedPreferences.getString(key, null)
currentCustomPackage?.let { cameraPackages.remove(it) }
if (newPackage != null && newPackage.isNotBlank()) {
cameraPackages.add(newPackage)
}
currentCustomPackage = newPackage
}
}
override fun onCreate() {
super.onCreate()
prefs = getSharedPreferences("settings", MODE_PRIVATE)
val customPackage = prefs.getString("custom_camera_package", null)
if (customPackage != null && customPackage.isNotBlank()) {
cameraPackages.add(customPackage)
currentCustomPackage = customPackage
}
prefs.registerOnSharedPreferenceChangeListener(preferenceChangeListener)
}
override fun onDestroy() {
super.onDestroy()
prefs.unregisterOnSharedPreferenceChangeListener(preferenceChangeListener)
}
override fun onAccessibilityEvent(ev: AccessibilityEvent?) {
try {
if (ev?.eventType == AccessibilityEvent.TYPE_WINDOW_STATE_CHANGED) {
val pkg = ev.packageName?.toString() ?: return
if (pkg == "com.android.systemui") return // after camera opens, systemui is opened, probably for the privacy indicators
Log.d(TAG, "Package: $pkg, cameraOpen: $cameraOpen")
if (pkg in cameraPackages) {
Log.d(TAG, "Camera app opened: $pkg")
if (!cameraOpen) cameraOpen = true
ServiceManager.getService()?.cameraOpened()
} else {
if (cameraOpen) {
cameraOpen = false
ServiceManager.getService()?.cameraClosed()
} else {
Log.d(TAG, "ignoring")
}
}
// Log.d(TAG, "Opened: $pkg")
}
} catch(e: Exception) {
Log.e(TAG, "Error in onAccessibilityEvent: ${e.message}")
}
}
override fun onInterrupt() {}
}

View File

@@ -0,0 +1,30 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.ui.theme
import androidx.compose.ui.graphics.Color
val Purple80 = Color(0xFFD0BCFF)
val PurpleGrey80 = Color(0xFFCCC2DC)
val Pink80 = Color(0xFFEFB8C8)
val Purple40 = Color(0xFF6650a4)
val PurpleGrey40 = Color(0xFF625b71)
val Pink40 = Color(0xFF7D5260)

View File

@@ -1,4 +1,22 @@
package me.kavishdevar.aln.ui.theme /*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.ui.theme
import android.os.Build import android.os.Build
import androidx.compose.foundation.isSystemInDarkTheme import androidx.compose.foundation.isSystemInDarkTheme
@@ -20,21 +38,11 @@ private val LightColorScheme = lightColorScheme(
primary = Purple40, primary = Purple40,
secondary = PurpleGrey40, secondary = PurpleGrey40,
tertiary = Pink40 tertiary = Pink40
/* Other default colors to override
background = Color(0xFFFFFBFE),
surface = Color(0xFFFFFBFE),
onPrimary = Color.White,
onSecondary = Color.White,
onTertiary = Color.White,
onBackground = Color(0xFF1C1B1F),
onSurface = Color(0xFF1C1B1F),
*/
) )
@Composable @Composable
fun ALNTheme( fun LibrePodsTheme(
darkTheme: Boolean = isSystemInDarkTheme(), darkTheme: Boolean = isSystemInDarkTheme(),
// Dynamic color is available on Android 12+
dynamicColor: Boolean = true, dynamicColor: Boolean = true,
content: @Composable () -> Unit content: @Composable () -> Unit
) { ) {

View File

@@ -1,4 +1,22 @@
package me.kavishdevar.aln.ui.theme /*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.ui.theme
import androidx.compose.material3.Typography import androidx.compose.material3.Typography
import androidx.compose.ui.text.TextStyle import androidx.compose.ui.text.TextStyle

File diff suppressed because it is too large Load Diff

View File

@@ -0,0 +1,233 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
/* This is a very basic ATT (Attribute Protocol) implementation. I have only implemented
* what is necessary for LibrePods to function, i.e. reading and writing characteristics,
* and receiving notifications. It is not a complete implementation of the ATT protocol.
*/
package me.kavishdevar.librepods.utils
import android.annotation.SuppressLint
import android.bluetooth.BluetoothDevice
import android.bluetooth.BluetoothSocket
import android.os.ParcelUuid
import android.util.Log
import kotlinx.coroutines.CoroutineScope
import kotlinx.coroutines.Dispatchers
import kotlinx.coroutines.launch
import org.lsposed.hiddenapibypass.HiddenApiBypass
import java.io.InputStream
import java.io.OutputStream
import java.util.concurrent.LinkedBlockingQueue
import java.util.concurrent.TimeUnit
enum class ATTHandles(val value: Int) {
TRANSPARENCY(0x18),
LOUD_SOUND_REDUCTION(0x1B),
HEARING_AID(0x2A),
}
enum class ATTCCCDHandles(val value: Int) {
TRANSPARENCY(ATTHandles.TRANSPARENCY.value + 1),
LOUD_SOUND_REDUCTION(ATTHandles.LOUD_SOUND_REDUCTION.value + 1),
HEARING_AID(ATTHandles.HEARING_AID.value + 1),
}
class ATTManager(private val device: BluetoothDevice) {
companion object {
private const val TAG = "ATTManager"
private const val OPCODE_READ_REQUEST: Byte = 0x0A
private const val OPCODE_WRITE_REQUEST: Byte = 0x12
private const val OPCODE_HANDLE_VALUE_NTF: Byte = 0x1B
}
var socket: BluetoothSocket? = null
private var input: InputStream? = null
private var output: OutputStream? = null
private val listeners = mutableMapOf<Int, MutableList<(ByteArray) -> Unit>>()
private var notificationJob: kotlinx.coroutines.Job? = null
// queue for non-notification PDUs (responses to requests)
private val responses = LinkedBlockingQueue<ByteArray>()
@SuppressLint("MissingPermission")
fun connect() {
HiddenApiBypass.addHiddenApiExemptions("Landroid/bluetooth/BluetoothSocket;")
val uuid = ParcelUuid.fromString("00000000-0000-0000-0000-000000000000")
socket = createBluetoothSocket(device, uuid)
socket!!.connect()
input = socket!!.inputStream
output = socket!!.outputStream
Log.d(TAG, "Connected to ATT")
notificationJob = CoroutineScope(Dispatchers.IO).launch {
while (socket?.isConnected == true) {
try {
val pdu = readPDU()
if (pdu.isNotEmpty() && pdu[0] == OPCODE_HANDLE_VALUE_NTF) {
// notification -> dispatch to listeners
val handle = (pdu[1].toInt() and 0xFF) or ((pdu[2].toInt() and 0xFF) shl 8)
val value = pdu.copyOfRange(3, pdu.size)
listeners[handle]?.forEach { listener ->
try {
listener(value)
Log.d(TAG, "Dispatched notification for handle $handle to listener, with value ${value.joinToString(" ") { String.format("%02X", it) }}")
} catch (e: Exception) {
Log.w(TAG, "Error in listener for handle $handle: ${e.message}")
}
}
} else {
// not a notification -> treat as a response for pending request(s)
responses.put(pdu)
}
} catch (e: Exception) {
Log.w(TAG, "Error reading notification/response: ${e.message}")
if (socket?.isConnected != true) break
}
}
}
}
fun disconnect() {
try {
notificationJob?.cancel()
socket?.close()
} catch (e: Exception) {
Log.w(TAG, "Error closing socket: ${e.message}")
}
}
fun registerListener(handle: ATTHandles, listener: (ByteArray) -> Unit) {
listeners.getOrPut(handle.value) { mutableListOf() }.add(listener)
}
fun unregisterListener(handle: ATTHandles, listener: (ByteArray) -> Unit) {
listeners[handle.value]?.remove(listener)
}
fun enableNotifications(handle: ATTHandles) {
write(ATTCCCDHandles.valueOf(handle.name), byteArrayOf(0x01, 0x00))
}
fun read(handle: ATTHandles): ByteArray {
val lsb = (handle.value and 0xFF).toByte()
val msb = ((handle.value shr 8) and 0xFF).toByte()
val pdu = byteArrayOf(OPCODE_READ_REQUEST, lsb, msb)
writeRaw(pdu)
// wait for response placed into responses queue by the reader coroutine
return readResponse()
}
fun write(handle: ATTHandles, value: ByteArray) {
val lsb = (handle.value and 0xFF).toByte()
val msb = ((handle.value shr 8) and 0xFF).toByte()
val pdu = byteArrayOf(OPCODE_WRITE_REQUEST, lsb, msb) + value
writeRaw(pdu)
// usually a Write Response (0x13) will arrive; wait for it (but discard return)
try {
readResponse()
} catch (e: Exception) {
Log.w(TAG, "No write response received: ${e.message}")
}
}
fun write(handle: ATTCCCDHandles, value: ByteArray) {
val lsb = (handle.value and 0xFF).toByte()
val msb = ((handle.value shr 8) and 0xFF).toByte()
val pdu = byteArrayOf(OPCODE_WRITE_REQUEST, lsb, msb) + value
writeRaw(pdu)
// usually a Write Response (0x13) will arrive; wait for it (but discard return)
try {
readResponse()
} catch (e: Exception) {
Log.w(TAG, "No write response received: ${e.message}")
}
}
private fun writeRaw(pdu: ByteArray) {
output?.write(pdu)
output?.flush()
Log.d(TAG, "writeRaw: ${pdu.joinToString(" ") { String.format("%02X", it) }}")
}
// rename / specialize: read raw PDU directly from input stream (blocking)
private fun readPDU(): ByteArray {
val inp = input ?: throw IllegalStateException("Not connected")
val buffer = ByteArray(512)
val len = inp.read(buffer)
if (len == -1) {
disconnect()
throw IllegalStateException("End of stream reached")
}
val data = buffer.copyOfRange(0, len)
Log.d(TAG, "readPDU: ${data.joinToString(" ") { String.format("%02X", it) }}")
return data
}
// wait for a response PDU produced by the background reader
private fun readResponse(timeoutMs: Long = 2000): ByteArray {
try {
val resp = responses.poll(timeoutMs, TimeUnit.MILLISECONDS)
?: throw IllegalStateException("No response read from ATT socket within $timeoutMs ms")
Log.d(TAG, "readResponse: ${resp.joinToString(" ") { String.format("%02X", it) }}")
return resp.copyOfRange(1, resp.size)
} catch (e: InterruptedException) {
Thread.currentThread().interrupt()
throw IllegalStateException("Interrupted while waiting for ATT response", e)
}
}
private fun createBluetoothSocket(device: BluetoothDevice, uuid: ParcelUuid): BluetoothSocket {
val type = 3 // L2CAP
val constructorSpecs = listOf(
arrayOf(device, type, true, true, 31, uuid),
arrayOf(device, type, 1, true, true, 31, uuid),
arrayOf(type, 1, true, true, device, 31, uuid),
arrayOf(type, true, true, device, 31, uuid)
)
val constructors = BluetoothSocket::class.java.declaredConstructors
Log.d("ATTManager", "BluetoothSocket has ${constructors.size} constructors:")
constructors.forEachIndexed { index, constructor ->
val params = constructor.parameterTypes.joinToString(", ") { it.simpleName }
Log.d("ATTManager", "Constructor $index: ($params)")
}
var lastException: Exception? = null
var attemptedConstructors = 0
for ((index, params) in constructorSpecs.withIndex()) {
try {
Log.d("ATTManager", "Trying constructor signature #${index + 1}")
attemptedConstructors++
return HiddenApiBypass.newInstance(BluetoothSocket::class.java, *params) as BluetoothSocket
} catch (e: Exception) {
Log.e("ATTManager", "Constructor signature #${index + 1} failed: ${e.message}")
lastException = e
}
}
val errorMessage = "Failed to create BluetoothSocket after trying $attemptedConstructors constructor signatures"
Log.e("ATTManager", errorMessage)
throw lastException ?: IllegalStateException(errorMessage)
}
}

View File

@@ -0,0 +1,232 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.utils
import me.kavishdevar.librepods.utils.AACPManager
import me.kavishdevar.librepods.utils.ATTManager
import me.kavishdevar.librepods.R
open class AirPodsBase(
val modelNumber: List<String>,
val name: String,
val displayName: String = "AirPods",
val manufacturer: String = "Apple Inc.",
val budCaseRes: Int,
val budsRes: Int,
val leftBudsRes: Int,
val rightBudsRes: Int,
val caseRes: Int,
val capabilities: Set<Capability>
)
enum class Capability {
LISTENING_MODE,
CONVERSATION_AWARENESS,
STEM_CONFIG,
HEAD_GESTURES,
LOUD_SOUND_REDUCTION,
PPE,
SLEEP_DETECTION,
HEARING_AID,
ADAPTIVE_AUDIO,
ADAPTIVE_VOLUME,
SWIPE_FOR_VOLUME,
HRM
}
class AirPods: AirPodsBase(
modelNumber = listOf("A1523", "A1722"),
name = "AirPods 1",
budCaseRes = R.drawable.airpods_1,
budsRes = R.drawable.airpods_1_buds,
leftBudsRes = R.drawable.airpods_1_left,
rightBudsRes = R.drawable.airpods_1_right,
caseRes = R.drawable.airpods_1_case,
capabilities = emptySet()
)
class AirPods2: AirPodsBase(
modelNumber = listOf("A2032", "A2031"),
name = "AirPods 2",
budCaseRes = R.drawable.airpods_2,
budsRes = R.drawable.airpods_2_buds,
leftBudsRes = R.drawable.airpods_2_left,
rightBudsRes = R.drawable.airpods_2_right,
caseRes = R.drawable.airpods_2_case,
capabilities = emptySet()
)
class AirPods3: AirPodsBase(
modelNumber = listOf("A2565", "A2564"),
name = "AirPods 3",
budCaseRes = R.drawable.airpods_3,
budsRes = R.drawable.airpods_3_buds,
leftBudsRes = R.drawable.airpods_3_left,
rightBudsRes = R.drawable.airpods_3_right,
caseRes = R.drawable.airpods_3_case,
capabilities = setOf(
Capability.HEAD_GESTURES
)
)
class AirPods4: AirPodsBase(
modelNumber = listOf("A3053", "A3050", "A3054"),
name = "AirPods 4",
budCaseRes = R.drawable.airpods_4,
budsRes = R.drawable.airpods_4_buds,
leftBudsRes = R.drawable.airpods_4_left,
rightBudsRes = R.drawable.airpods_4_right,
caseRes = R.drawable.airpods_4_case,
capabilities = setOf(
Capability.HEAD_GESTURES,
Capability.SLEEP_DETECTION,
Capability.ADAPTIVE_VOLUME
)
)
class AirPods4ANC: AirPodsBase(
modelNumber = listOf("A3056", "A3055", "A3057"),
name = "AirPods 4 (ANC)",
budCaseRes = R.drawable.airpods_4,
budsRes = R.drawable.airpods_4_buds,
leftBudsRes = R.drawable.airpods_4_left,
rightBudsRes = R.drawable.airpods_4_right,
caseRes = R.drawable.airpods_4_case,
capabilities = setOf(
Capability.LISTENING_MODE,
Capability.CONVERSATION_AWARENESS,
Capability.HEAD_GESTURES,
Capability.ADAPTIVE_AUDIO,
Capability.SLEEP_DETECTION,
Capability.ADAPTIVE_VOLUME
)
)
class AirPodsPro1: AirPodsBase(
modelNumber = listOf("A2084", "A2083"),
name = "AirPods Pro 1",
displayName = "AirPods Pro",
budCaseRes = R.drawable.airpods_pro_1,
budsRes = R.drawable.airpods_pro_1_buds,
leftBudsRes = R.drawable.airpods_pro_1_left,
rightBudsRes = R.drawable.airpods_pro_1_right,
caseRes = R.drawable.airpods_pro_1_case,
capabilities = setOf(
Capability.LISTENING_MODE
)
)
class AirPodsPro2Lightning: AirPodsBase(
modelNumber = listOf("A2931", "A2699", "A2698"),
name = "AirPods Pro 2 with Magsafe Charging Case (Lightning)",
displayName = "AirPods Pro",
budCaseRes = R.drawable.airpods_pro_2,
budsRes = R.drawable.airpods_pro_2_buds,
leftBudsRes = R.drawable.airpods_pro_2_left,
rightBudsRes = R.drawable.airpods_pro_2_right,
caseRes = R.drawable.airpods_pro_2_case,
capabilities = setOf(
Capability.LISTENING_MODE,
Capability.CONVERSATION_AWARENESS,
Capability.STEM_CONFIG,
Capability.LOUD_SOUND_REDUCTION,
Capability.SLEEP_DETECTION,
Capability.HEARING_AID,
Capability.ADAPTIVE_AUDIO,
Capability.ADAPTIVE_VOLUME,
Capability.SWIPE_FOR_VOLUME
)
)
class AirPodsPro2USBC: AirPodsBase(
modelNumber = listOf("A3047", "A3048", "A3049"),
name = "AirPods Pro 2 with Magsafe Charging Case (USB-C)",
displayName = "AirPods Pro",
budCaseRes = R.drawable.airpods_pro_2,
budsRes = R.drawable.airpods_pro_2_buds,
leftBudsRes = R.drawable.airpods_pro_2_left,
rightBudsRes = R.drawable.airpods_pro_2_right,
caseRes = R.drawable.airpods_pro_2_case,
capabilities = setOf(
Capability.LISTENING_MODE,
Capability.CONVERSATION_AWARENESS,
Capability.STEM_CONFIG,
Capability.LOUD_SOUND_REDUCTION,
Capability.SLEEP_DETECTION,
Capability.HEARING_AID,
Capability.ADAPTIVE_AUDIO,
Capability.ADAPTIVE_VOLUME,
Capability.SWIPE_FOR_VOLUME
)
)
class AirPodsPro3: AirPodsBase(
modelNumber = listOf("A3063", "A3064", "A3065"),
name = "AirPods Pro 3",
displayName = "AirPods Pro",
budCaseRes = R.drawable.airpods_pro_3,
budsRes = R.drawable.airpods_pro_3_buds,
leftBudsRes = R.drawable.airpods_pro_3_left,
rightBudsRes = R.drawable.airpods_pro_3_right,
caseRes = R.drawable.airpods_pro_3_case,
capabilities = setOf(
Capability.LISTENING_MODE,
Capability.CONVERSATION_AWARENESS,
Capability.STEM_CONFIG,
Capability.LOUD_SOUND_REDUCTION,
Capability.PPE,
Capability.SLEEP_DETECTION,
Capability.HEARING_AID,
Capability.ADAPTIVE_AUDIO,
Capability.ADAPTIVE_VOLUME,
Capability.SWIPE_FOR_VOLUME,
Capability.HRM
)
)
data class AirPodsInstance(
val name: String,
val model: AirPodsBase,
val actualModelNumber: String,
val serialNumber: String?,
val leftSerialNumber: String?,
val rightSerialNumber: String?,
val version1: String?,
val version2: String?,
val version3: String?,
val aacpManager: AACPManager,
val attManager: ATTManager?
)
object AirPodsModels {
val models: List<AirPodsBase> = listOf(
AirPods(),
AirPods2(),
AirPods3(),
AirPods4(),
AirPods4ANC(),
AirPodsPro1(),
AirPodsPro2Lightning(),
AirPodsPro2USBC(),
AirPodsPro3()
)
fun getModelByModelNumber(modelNumber: String): AirPodsBase? {
return models.find { modelNumber in it.modelNumber }
}
}

View File

@@ -0,0 +1,496 @@
/*
* LibrePods - AirPods liberated from Apple's ecosystem
*
* Copyright (C) 2025 LibrePods Contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.utils
import android.annotation.SuppressLint
import android.bluetooth.BluetoothManager
import android.bluetooth.le.BluetoothLeScanner
import android.bluetooth.le.ScanCallback
import android.bluetooth.le.ScanFilter
import android.bluetooth.le.ScanResult
import android.bluetooth.le.ScanSettings
import android.content.Context
import android.content.SharedPreferences
import android.os.Handler
import android.os.Looper
import android.util.Log
import javax.crypto.Cipher
import javax.crypto.spec.SecretKeySpec
import kotlin.io.encoding.Base64
import kotlin.io.encoding.ExperimentalEncodingApi
/**
* Manager for Bluetooth Low Energy scanning operations specifically for AirPods
*/
@OptIn(ExperimentalEncodingApi::class)
class BLEManager(private val context: Context) {
data class AirPodsStatus(
val address: String,
val lastSeen: Long = System.currentTimeMillis(),
val paired: Boolean = false,
val model: String = "Unknown",
val leftBattery: Int? = null,
val rightBattery: Int? = null,
val caseBattery: Int? = null,
val isLeftInEar: Boolean = false,
val isRightInEar: Boolean = false,
val isLeftCharging: Boolean = false,
val isRightCharging: Boolean = false,
val isCaseCharging: Boolean = false,
val lidOpen: Boolean = false,
val color: String = "Unknown",
val connectionState: String = "Unknown"
)
fun getMostRecentStatus(): AirPodsStatus? {
return deviceStatusMap.values.maxByOrNull { it.lastSeen }
}
interface AirPodsStatusListener {
fun onDeviceStatusChanged(device: AirPodsStatus, previousStatus: AirPodsStatus?)
fun onBroadcastFromNewAddress(device: AirPodsStatus)
fun onLidStateChanged(lidOpen: Boolean)
fun onEarStateChanged(device: AirPodsStatus, leftInEar: Boolean, rightInEar: Boolean)
fun onBatteryChanged(device: AirPodsStatus)
fun onDeviceDisappeared()
}
private var mBluetoothLeScanner: BluetoothLeScanner? = null
private var mScanCallback: ScanCallback? = null
private var airPodsStatusListener: AirPodsStatusListener? = null
private val deviceStatusMap = mutableMapOf<String, AirPodsStatus>()
private val verifiedAddresses = mutableSetOf<String>()
private val sharedPreferences: SharedPreferences = context.getSharedPreferences("settings", Context.MODE_PRIVATE)
private var currentGlobalLidState: Boolean? = null
private var lastBroadcastTime: Long = 0
private val processedAddresses = mutableSetOf<String>()
private val lastValidCaseBatteryMap = mutableMapOf<String, Int>()
private val modelNames = mapOf(
0x0E20 to "AirPods Pro",
0x1420 to "AirPods Pro 2",
0x2420 to "AirPods Pro 2 (USB-C)",
0x0220 to "AirPods 1",
0x0F20 to "AirPods 2",
0x1320 to "AirPods 3",
0x1920 to "AirPods 4",
0x1B20 to "AirPods 4 (ANC)",
0x0A20 to "AirPods Max",
0x1F20 to "AirPods Max (USB-C)"
)
val colorNames = mapOf(
0x00 to "White", 0x01 to "Black", 0x02 to "Red", 0x03 to "Blue",
0x04 to "Pink", 0x05 to "Gray", 0x06 to "Silver", 0x07 to "Gold",
0x08 to "Rose Gold", 0x09 to "Space Gray", 0x0A to "Dark Blue",
0x0B to "Light Blue", 0x0C to "Yellow"
)
val connStates = mapOf(
0x00 to "Disconnected", 0x04 to "Idle", 0x05 to "Music",
0x06 to "Call", 0x07 to "Ringing", 0x09 to "Hanging Up", 0xFF to "Unknown"
)
private val cleanupHandler = Handler(Looper.getMainLooper())
private val cleanupRunnable = object : Runnable {
override fun run() {
cleanupStaleDevices()
checkLidStateTimeout()
cleanupHandler.postDelayed(this, CLEANUP_INTERVAL_MS)
}
}
fun setAirPodsStatusListener(listener: AirPodsStatusListener) {
airPodsStatusListener = listener
}
@SuppressLint("MissingPermission")
fun startScanning() {
try {
Log.d(TAG, "Starting BLE scanner")
val btManager = context.getSystemService(Context.BLUETOOTH_SERVICE) as BluetoothManager
val btAdapter = btManager.adapter
if (btAdapter == null) {
Log.d(TAG, "No Bluetooth adapter available")
return
}
if (mBluetoothLeScanner != null && mScanCallback != null) {
mBluetoothLeScanner?.stopScan(mScanCallback)
mScanCallback = null
}
if (!btAdapter.isEnabled) {
Log.d(TAG, "Bluetooth is disabled")
return
}
mBluetoothLeScanner = btAdapter.bluetoothLeScanner
val scanSettings = ScanSettings.Builder()
.setScanMode(ScanSettings.SCAN_MODE_LOW_LATENCY)
.setMatchMode(ScanSettings.MATCH_MODE_AGGRESSIVE)
.setCallbackType(ScanSettings.CALLBACK_TYPE_ALL_MATCHES)
.setNumOfMatches(ScanSettings.MATCH_NUM_MAX_ADVERTISEMENT)
.setReportDelay(500L)
.build()
val manufacturerData = ByteArray(27)
val manufacturerDataMask = ByteArray(27)
manufacturerData[0] = 7
manufacturerData[1] = 25
manufacturerDataMask[0] = -1
manufacturerDataMask[1] = -1
val scanFilter = ScanFilter.Builder()
.setManufacturerData(76, manufacturerData, manufacturerDataMask)
.build()
mScanCallback = object : ScanCallback() {
override fun onScanResult(callbackType: Int, result: ScanResult) {
processScanResult(result)
}
override fun onBatchScanResults(results: List<ScanResult>) {
processedAddresses.clear()
for (result in results) {
processScanResult(result)
}
}
override fun onScanFailed(errorCode: Int) {
Log.e(TAG, "BLE scan failed with error code: $errorCode")
}
}
mBluetoothLeScanner?.startScan(listOf(scanFilter), scanSettings, mScanCallback)
Log.d(TAG, "BLE scanner started successfully")
cleanupHandler.postDelayed(cleanupRunnable, CLEANUP_INTERVAL_MS)
} catch (t: Throwable) {
Log.e(TAG, "Error starting BLE scanner", t)
}
}
@SuppressLint("MissingPermission")
fun stopScanning() {
try {
if (mBluetoothLeScanner != null && mScanCallback != null) {
Log.d(TAG, "Stopping BLE scanner")
mBluetoothLeScanner?.stopScan(mScanCallback)
mScanCallback = null
}
cleanupHandler.removeCallbacks(cleanupRunnable)
} catch (t: Throwable) {
Log.e(TAG, "Error stopping BLE scanner", t)
}
}
@OptIn(ExperimentalEncodingApi::class)
private fun getEncryptionKeyFromPreferences(): ByteArray? {
val keyBase64 = sharedPreferences.getString(AACPManager.Companion.ProximityKeyType.ENC_KEY.name, null)
return if (keyBase64 != null) {
try {
Base64.decode(keyBase64)
} catch (e: Exception) {
Log.e(TAG, "Failed to decode encryption key", e)
null
}
} else {
null
}
}
@SuppressLint("GetInstance")
private fun decryptLastBytes(data: ByteArray, key: ByteArray): ByteArray? {
return try {
if (data.size < 16) {
return null
}
val block = data.copyOfRange(data.size - 16, data.size)
val cipher = Cipher.getInstance("AES/ECB/NoPadding")
val secretKey = SecretKeySpec(key, "AES")
cipher.init(Cipher.DECRYPT_MODE, secretKey)
cipher.doFinal(block)
} catch (e: Exception) {
Log.e(TAG, "Error decrypting data", e)
null
}
}
private fun formatBattery(byteVal: Int): Pair<Boolean, Int> {
val charging = (byteVal and 0x80) != 0
val level = byteVal and 0x7F
return Pair(charging, level)
}
private fun processScanResult(result: ScanResult) {
try {
val scanRecord = result.scanRecord ?: return
val address = result.device.address
if (processedAddresses.contains(address)) {
return
}
val manufacturerData = scanRecord.getManufacturerSpecificData(76) ?: return
if (manufacturerData.size <= 20) return
if (!verifiedAddresses.contains(address)) {
val irk = getIrkFromPreferences()
if (irk == null || !BluetoothCryptography.verifyRPA(address, irk)) {
return
}
verifiedAddresses.add(address)
Log.d(TAG, "RPA verified and added to trusted list: $address")
}
processedAddresses.add(address)
lastBroadcastTime = System.currentTimeMillis()
val encryptionKey = getEncryptionKeyFromPreferences()
val decryptedData = if (encryptionKey != null) decryptLastBytes(manufacturerData, encryptionKey) else null
val parsedStatus = if (decryptedData != null && decryptedData.size == 16) {
parseProximityMessageWithDecryption(address, manufacturerData, decryptedData)
} else {
parseProximityMessage(address, manufacturerData)
}
val previousStatus = deviceStatusMap[address]
deviceStatusMap[address] = parsedStatus
airPodsStatusListener?.let { listener ->
if (previousStatus == null) {
listener.onBroadcastFromNewAddress(parsedStatus)
Log.d(TAG, "New AirPods device detected: $address")
if (currentGlobalLidState == null || currentGlobalLidState != parsedStatus.lidOpen) {
currentGlobalLidState = parsedStatus.lidOpen
listener.onLidStateChanged(parsedStatus.lidOpen)
Log.d(TAG, "Lid state ${if (parsedStatus.lidOpen) "opened" else "closed"} (detected from new device)")
}
} else {
if (parsedStatus != previousStatus) {
listener.onDeviceStatusChanged(parsedStatus, previousStatus)
}
if (parsedStatus.lidOpen != previousStatus.lidOpen) {
val previousGlobalState = currentGlobalLidState
currentGlobalLidState = parsedStatus.lidOpen
if (previousGlobalState != parsedStatus.lidOpen) {
listener.onLidStateChanged(parsedStatus.lidOpen)
Log.d(TAG, "Lid state changed from $previousGlobalState to ${parsedStatus.lidOpen}")
}
}
if (parsedStatus.isLeftInEar != previousStatus.isLeftInEar ||
parsedStatus.isRightInEar != previousStatus.isRightInEar) {
listener.onEarStateChanged(
parsedStatus,
parsedStatus.isLeftInEar,
parsedStatus.isRightInEar
)
Log.d(TAG, "Ear state changed - Left: ${parsedStatus.isLeftInEar}, Right: ${parsedStatus.isRightInEar}")
}
if (parsedStatus.leftBattery != previousStatus.leftBattery ||
parsedStatus.rightBattery != previousStatus.rightBattery ||
parsedStatus.caseBattery != previousStatus.caseBattery) {
listener.onBatteryChanged(parsedStatus)
Log.d(TAG, "Battery changed - Left: ${parsedStatus.leftBattery}, Right: ${parsedStatus.rightBattery}, Case: ${parsedStatus.caseBattery}")
}
}
}
} catch (t: Throwable) {
Log.e(TAG, "Error processing scan result", t)
}
}
private fun parseProximityMessageWithDecryption(address: String, data: ByteArray, decrypted: ByteArray): AirPodsStatus {
val paired = data[2].toInt() == 1
val modelId = ((data[3].toInt() and 0xFF) shl 8) or (data[4].toInt() and 0xFF)
val model = modelNames[modelId] ?: "Unknown ($modelId)"
val status = data[5].toInt() and 0xFF
// val flagsCase = data[7].toInt() and 0xFF
val lid = data[8].toInt() and 0xFF
val color = colorNames[data[9].toInt()] ?: "Unknown"
val conn = connStates[data[10].toInt()] ?: "Unknown (${data[10].toInt()})"
val primaryLeft = ((status shr 5) and 0x01) == 1
val thisInCase = ((status shr 6) and 0x01) == 1
val xorFactor = primaryLeft xor thisInCase
val isLeftInEar = if (xorFactor) (status and 0x08) != 0 else (status and 0x02) != 0
val isRightInEar = if (xorFactor) (status and 0x02) != 0 else (status and 0x08) != 0
val isFlipped = !primaryLeft
val leftByteIndex = if (isFlipped) 2 else 1
val rightByteIndex = if (isFlipped) 1 else 2
val (isLeftCharging, leftBattery) = formatBattery(decrypted[leftByteIndex].toInt() and 0xFF)
val (isRightCharging, rightBattery) = formatBattery(decrypted[rightByteIndex].toInt() and 0xFF)
val rawCaseBatteryByte = decrypted[3].toInt() and 0xFF
val (isCaseCharging, rawCaseBattery) = formatBattery(rawCaseBatteryByte)
val caseBattery = if (rawCaseBatteryByte == 0xFF || (isCaseCharging && rawCaseBattery == 127)) {
lastValidCaseBatteryMap[address]
} else {
lastValidCaseBatteryMap[address] = rawCaseBattery
rawCaseBattery
}
val lidOpen = ((lid shr 3) and 0x01) == 0
return AirPodsStatus(
address = address,
lastSeen = System.currentTimeMillis(),
paired = paired,
model = model,
leftBattery = leftBattery,
rightBattery = rightBattery,
caseBattery = caseBattery,
isLeftInEar = isLeftInEar,
isRightInEar = isRightInEar,
isLeftCharging = isLeftCharging,
isRightCharging = isRightCharging,
isCaseCharging = isCaseCharging,
lidOpen = lidOpen,
color = color,
connectionState = conn
)
}
private fun cleanupStaleDevices() {
val now = System.currentTimeMillis()
val staleCutoff = now - STALE_DEVICE_TIMEOUT_MS
val hadDevices = deviceStatusMap.isNotEmpty()
val staleDevices = deviceStatusMap.filter { it.value.lastSeen < staleCutoff }
for (device in staleDevices) {
deviceStatusMap.remove(device.key)
Log.d(TAG, "Removed stale device from tracking: ${device.key}")
}
if (hadDevices && deviceStatusMap.isEmpty()) {
airPodsStatusListener?.onDeviceDisappeared()
}
}
private fun checkLidStateTimeout() {
val currentTime = System.currentTimeMillis()
if (currentTime - lastBroadcastTime > LID_CLOSE_TIMEOUT_MS && currentGlobalLidState == true) {
Log.d(TAG, "No broadcasts for ${LID_CLOSE_TIMEOUT_MS}ms, forcing lid state to closed")
currentGlobalLidState = false
airPodsStatusListener?.onLidStateChanged(false)
}
}
@OptIn(ExperimentalEncodingApi::class)
private fun getIrkFromPreferences(): ByteArray? {
val irkBase64 = sharedPreferences.getString(AACPManager.Companion.ProximityKeyType.IRK.name, null)
return if (irkBase64 != null) {
try {
Base64.decode(irkBase64)
} catch (e: Exception) {
Log.e(TAG, "Failed to decode IRK", e)
null
}
} else {
null
}
}
private fun parseProximityMessage(address: String, data: ByteArray): AirPodsStatus {
val paired = data[2].toInt() == 1
val modelId = ((data[3].toInt() and 0xFF) shl 8) or (data[4].toInt() and 0xFF)
val model = modelNames[modelId] ?: "Unknown ($modelId)"
val status = data[5].toInt() and 0xFF
val podsBattery = data[6].toInt() and 0xFF
val flagsCase = data[7].toInt() and 0xFF
val lid = data[8].toInt() and 0xFF
val color = colorNames[data[9].toInt()] ?: "Unknown"
val conn = connStates[data[10].toInt()] ?: "Unknown (${data[10].toInt()})"
val primaryLeft = ((status shr 5) and 0x01) == 1
val thisInCase = ((status shr 6) and 0x01) == 1
val xorFactor = primaryLeft xor thisInCase
val isLeftInEar = if (xorFactor) (status and 0x08) != 0 else (status and 0x02) != 0
val isRightInEar = if (xorFactor) (status and 0x02) != 0 else (status and 0x08) != 0
val isFlipped = !primaryLeft
val leftBatteryNibble = if (isFlipped) (podsBattery shr 4) and 0x0F else podsBattery and 0x0F
val rightBatteryNibble = if (isFlipped) podsBattery and 0x0F else (podsBattery shr 4) and 0x0F
val caseBattery = flagsCase and 0x0F
val flags = (flagsCase shr 4) and 0x0F
val isLeftCharging = if (isFlipped) (flags and 0x02) != 0 else (flags and 0x01) != 0
val isRightCharging = if (isFlipped) (flags and 0x01) != 0 else (flags and 0x02) != 0
val isCaseCharging = (flags and 0x04) != 0
val lidOpen = ((lid shr 3) and 0x01) == 0
fun decodeBattery(n: Int): Int? = when (n) {
in 0x0..0x9 -> n * 10
in 0xA..0xE -> 100
0xF -> null
else -> null
}
return AirPodsStatus(
address = address,
lastSeen = System.currentTimeMillis(),
paired = paired,
model = model,
leftBattery = decodeBattery(leftBatteryNibble),
rightBattery = decodeBattery(rightBatteryNibble),
caseBattery = decodeBattery(caseBattery),
isLeftInEar = isLeftInEar,
isRightInEar = isRightInEar,
isLeftCharging = isLeftCharging,
isRightCharging = isRightCharging,
isCaseCharging = isCaseCharging,
lidOpen = lidOpen,
color = color,
connectionState = conn
)
}
companion object {
private const val TAG = "AirPodsBLE"
private const val CLEANUP_INTERVAL_MS = 10000L
private const val STALE_DEVICE_TIMEOUT_MS = 15000L
private const val LID_CLOSE_TIMEOUT_MS = 2500L
}
}

View File

@@ -0,0 +1,40 @@
/*
* LibrePods - AirPods liberated from Apple's ecosystem
*
* Copyright (C) 2025 LibrePods Contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.utils
import android.bluetooth.BluetoothDevice
import android.bluetooth.BluetoothSocket
import android.util.Log
object BluetoothConnectionManager {
private const val TAG = "BluetoothConnectionManager"
private var currentSocket: BluetoothSocket? = null
private var currentDevice: BluetoothDevice? = null
fun setCurrentConnection(socket: BluetoothSocket, device: BluetoothDevice) {
currentSocket = socket
currentDevice = device
Log.d(TAG, "Current connection set to device: ${device.address}")
}
fun getCurrentSocket(): BluetoothSocket? {
return currentSocket
}
}

View File

@@ -0,0 +1,76 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
package me.kavishdevar.librepods.utils
import android.annotation.SuppressLint
import javax.crypto.Cipher
import javax.crypto.spec.SecretKeySpec
/**
* Utilities for Bluetooth cryptography operations, particularly for
* verifying Resolvable Private Addresses (RPA) used by AirPods.
*/
object BluetoothCryptography {
/**
* Verifies if the provided Bluetooth address is an RPA that matches the given Identity Resolving Key (IRK)
*
* @param addr The Bluetooth address to verify
* @param irk The Identity Resolving Key to use for verification
* @return true if the address is verified as an RPA matching the IRK
*/
fun verifyRPA(addr: String, irk: ByteArray): Boolean {
val rpa = addr.split(":").map { it.toInt(16).toByte() }.reversed().toByteArray()
val prand = rpa.copyOfRange(3, 6)
val hash = rpa.copyOfRange(0, 3)
val computedHash = ah(irk, prand)
return hash.contentEquals(computedHash)
}
/**
* Performs E function (AES-128) as specified in Bluetooth Core Specification
*
* @param key The key for encryption
* @param data The data to encrypt
* @return The encrypted data
*/
@SuppressLint("GetInstance")
fun e(key: ByteArray, data: ByteArray): ByteArray {
val swappedKey = key.reversedArray()
val swappedData = data.reversedArray()
val cipher = Cipher.getInstance("AES/ECB/NoPadding")
val secretKey = SecretKeySpec(swappedKey, "AES")
cipher.init(Cipher.ENCRYPT_MODE, secretKey)
return cipher.doFinal(swappedData).reversedArray()
}
/**
* Performs the ah function as specified in Bluetooth Core Specification
*
* @param k The IRK key
* @param r The random part of the address
* @return The hash part of the address
*/
fun ah(k: ByteArray, r: ByteArray): ByteArray {
val rPadded = ByteArray(16)
r.copyInto(rPadded, 0, 0, 3)
val encrypted = e(k, rPadded)
return encrypted.copyOfRange(0, 3)
}
}

View File

@@ -0,0 +1,289 @@
/*
* LibrePods - AirPods liberated from Apples ecosystem
*
* Copyright (C) 2025 LibrePods contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License as published
* by the Free Software Foundation, either version 3 of the License.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Affero General Public License for more details.
*
* You should have received a copy of the GNU Affero General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
@file:OptIn(ExperimentalEncodingApi::class)
package me.kavishdevar.librepods.utils
import android.annotation.SuppressLint
import android.bluetooth.BluetoothAdapter
import android.bluetooth.BluetoothManager
import android.bluetooth.BluetoothServerSocket
import android.bluetooth.BluetoothSocket
import android.bluetooth.le.AdvertiseCallback
import android.bluetooth.le.AdvertiseData
import android.bluetooth.le.AdvertiseSettings
import android.bluetooth.le.BluetoothLeAdvertiser
import android.content.Context
import android.content.Intent
import android.content.SharedPreferences
import android.os.ParcelUuid
import android.util.Log
import androidx.core.content.edit
import kotlinx.coroutines.CoroutineScope
import kotlinx.coroutines.Dispatchers
import kotlinx.coroutines.delay
import kotlinx.coroutines.launch
import me.kavishdevar.librepods.services.ServiceManager
import java.io.IOException
import java.util.UUID
import kotlin.io.encoding.ExperimentalEncodingApi
enum class CrossDevicePackets(val packet: ByteArray) {
AIRPODS_CONNECTED(byteArrayOf(0x00, 0x01, 0x00, 0x01)),
AIRPODS_DISCONNECTED(byteArrayOf(0x00, 0x01, 0x00, 0x00)),
REQUEST_DISCONNECT(byteArrayOf(0x00, 0x02, 0x00, 0x00)),
REQUEST_BATTERY_BYTES(byteArrayOf(0x00, 0x02, 0x00, 0x01)),
REQUEST_ANC_BYTES(byteArrayOf(0x00, 0x02, 0x00, 0x02)),
REQUEST_CONNECTION_STATUS(byteArrayOf(0x00, 0x02, 0x00, 0x03)),
AIRPODS_DATA_HEADER(byteArrayOf(0x00, 0x04, 0x00, 0x01)),
}
object CrossDevice {
var initialized = false
private val uuid = UUID.fromString("1abbb9a4-10e4-4000-a75c-8953c5471342")
private var serverSocket: BluetoothServerSocket? = null
private var clientSocket: BluetoothSocket? = null
private lateinit var bluetoothAdapter: BluetoothAdapter
private lateinit var bluetoothLeAdvertiser: BluetoothLeAdvertiser
private const val MANUFACTURER_ID = 0x1234
private const val MANUFACTURER_DATA = "ALN_AirPods"
var isAvailable: Boolean = false // set to true when airpods are connected to another device
var batteryBytes: ByteArray = byteArrayOf()
var ancBytes: ByteArray = byteArrayOf()
private lateinit var sharedPreferences: SharedPreferences
private const val PACKET_LOG_KEY = "packet_log"
private var earDetectionStatus = listOf(false, false)
var disconnectionRequested = false
@SuppressLint("MissingPermission")
fun init(context: Context) {
CoroutineScope(Dispatchers.IO).launch {
Log.d("CrossDevice", "Initializing CrossDevice")
sharedPreferences = context.getSharedPreferences("packet_logs", Context.MODE_PRIVATE)
sharedPreferences.edit { putBoolean("CrossDeviceIsAvailable", false)}
this@CrossDevice.bluetoothAdapter = context.getSystemService(BluetoothManager::class.java).adapter
this@CrossDevice.bluetoothLeAdvertiser = bluetoothAdapter.bluetoothLeAdvertiser
// startAdvertising()
startServer()
initialized = true
}
}
@SuppressLint("MissingPermission")
private fun startServer() {
CoroutineScope(Dispatchers.IO).launch {
if (!bluetoothAdapter.isEnabled) return@launch
// serverSocket = bluetoothAdapter.listenUsingRfcommWithServiceRecord("ALNCrossDevice", uuid)
Log.d("CrossDevice", "Server started")
while (serverSocket != null) {
if (!bluetoothAdapter.isEnabled) {
serverSocket?.close()
break
}
if (clientSocket != null) {
try {
clientSocket!!.close()
} catch (e: IOException) {
e.printStackTrace()
}
}
try {
val socket = serverSocket!!.accept()
handleClientConnection(socket)
} catch (e: IOException) { }
}
}
}
@SuppressLint("MissingPermission", "unused")
private fun startAdvertising() {
CoroutineScope(Dispatchers.IO).launch {
val settings = AdvertiseSettings.Builder()
.setAdvertiseMode(AdvertiseSettings.ADVERTISE_MODE_LOW_LATENCY)
.setTxPowerLevel(AdvertiseSettings.ADVERTISE_TX_POWER_HIGH)
.setConnectable(true)
.build()
val data = AdvertiseData.Builder()
.setIncludeDeviceName(true)
.addManufacturerData(MANUFACTURER_ID, MANUFACTURER_DATA.toByteArray())
.addServiceUuid(ParcelUuid(uuid))
.build()
try {
bluetoothLeAdvertiser.startAdvertising(settings, data, advertiseCallback)
} catch (e: Exception) {
Log.e("CrossDevice", "Failed to start BLE Advertising: ${e.message}")
}
Log.d("CrossDevice", "BLE Advertising started")
}
}
private val advertiseCallback = object : AdvertiseCallback() {
override fun onStartSuccess(settingsInEffect: AdvertiseSettings) {
Log.d("CrossDevice", "BLE Advertising started successfully")
}
override fun onStartFailure(errorCode: Int) {
Log.e("CrossDevice", "BLE Advertising failed with error code: $errorCode")
}
}
fun setAirPodsConnected(connected: Boolean) {
if (connected) {
isAvailable = false
sharedPreferences.edit { putBoolean("CrossDeviceIsAvailable", false)}
clientSocket?.outputStream?.write(CrossDevicePackets.AIRPODS_CONNECTED.packet)
} else {
clientSocket?.outputStream?.write(CrossDevicePackets.AIRPODS_DISCONNECTED.packet)
// Reset state variables
isAvailable = true
}
}
fun sendReceivedPacket(packet: ByteArray) {
if (clientSocket == null || clientSocket!!.outputStream != null) {
return
}
clientSocket?.outputStream?.write(CrossDevicePackets.AIRPODS_DATA_HEADER.packet + packet)
}
private fun logPacket(packet: ByteArray, source: String) {
val packetHex = packet.joinToString(" ") { "%02X".format(it) }
val logEntry = "$source: $packetHex"
val logs = sharedPreferences.getStringSet(PACKET_LOG_KEY, mutableSetOf())?.toMutableSet() ?: mutableSetOf()
logs.add(logEntry)
sharedPreferences.edit { putStringSet(PACKET_LOG_KEY, logs)}
}
@SuppressLint("MissingPermission")
private fun handleClientConnection(socket: BluetoothSocket) {
Log.d("CrossDevice", "Client connected")
notifyAirPodsConnectedRemotely(ServiceManager.getService()?.applicationContext!!)
clientSocket = socket
val inputStream = socket.inputStream
val buffer = ByteArray(1024)
var bytes: Int
setAirPodsConnected(ServiceManager.getService()?.isConnectedLocally == true)
while (true) {
try {
bytes = inputStream.read(buffer)
} catch (e: IOException) {
e.printStackTrace()
notifyAirPodsDisconnectedRemotely(ServiceManager.getService()?.applicationContext!!)
val s = serverSocket?.accept()
if (s != null) {
handleClientConnection(s)
}
break
}
var packet = buffer.copyOf(bytes)
logPacket(packet, "Relay")
Log.d("CrossDevice", "Received packet: ${packet.joinToString("") { "%02x".format(it) }}")
if (bytes == -1) {
notifyAirPodsDisconnectedRemotely(ServiceManager.getService()?.applicationContext!!)
break
} else if (packet.contentEquals(CrossDevicePackets.REQUEST_DISCONNECT.packet) || packet.contentEquals(CrossDevicePackets.REQUEST_DISCONNECT.packet + CrossDevicePackets.AIRPODS_DATA_HEADER.packet)) {
ServiceManager.getService()?.disconnectForCD()
disconnectionRequested = true
CoroutineScope(Dispatchers.IO).launch {
delay(1000)
disconnectionRequested = false
}
} else if (packet.contentEquals(CrossDevicePackets.AIRPODS_CONNECTED.packet)) {
isAvailable = true
sharedPreferences.edit { putBoolean("CrossDeviceIsAvailable", true)}
} else if (packet.contentEquals(CrossDevicePackets.AIRPODS_DISCONNECTED.packet)) {
isAvailable = false
sharedPreferences.edit { putBoolean("CrossDeviceIsAvailable", false)}
} else if (packet.contentEquals(CrossDevicePackets.REQUEST_BATTERY_BYTES.packet)) {
Log.d("CrossDevice", "Received battery request, battery data: ${batteryBytes.joinToString("") { "%02x".format(it) }}")
sendRemotePacket(batteryBytes)
} else if (packet.contentEquals(CrossDevicePackets.REQUEST_ANC_BYTES.packet)) {
Log.d("CrossDevice", "Received ANC request")
sendRemotePacket(ancBytes)
} else if (packet.contentEquals(CrossDevicePackets.REQUEST_CONNECTION_STATUS.packet)) {
Log.d("CrossDevice", "Received connection status request")
sendRemotePacket(if (ServiceManager.getService()?.isConnectedLocally == true) CrossDevicePackets.AIRPODS_CONNECTED.packet else CrossDevicePackets.AIRPODS_DISCONNECTED.packet)
} else {
if (packet.sliceArray(0..3).contentEquals(CrossDevicePackets.AIRPODS_DATA_HEADER.packet)) {
isAvailable = true
sharedPreferences.edit { putBoolean("CrossDeviceIsAvailable", true) }
if (packet.size % 2 == 0) {
val half = packet.size / 2
if (packet.sliceArray(0 until half).contentEquals(packet.sliceArray(half until packet.size))) {
Log.d("CrossDevice", "Duplicated packet, trimming")
packet = packet.sliceArray(0 until half)
}
}
var trimmedPacket = packet.drop(CrossDevicePackets.AIRPODS_DATA_HEADER.packet.size).toByteArray()
Log.d("CrossDevice", "Received relayed packet: ${trimmedPacket.joinToString("") { "%02x".format(it) }}")
if (ServiceManager.getService()?.isConnectedLocally == true) {
val packetInHex = trimmedPacket.joinToString("") { "%02x".format(it) }
// ServiceManager.getService()?.sendPacket(packetInHex)
} else if (ServiceManager.getService()?.batteryNotification?.isBatteryData(trimmedPacket) == true) {
batteryBytes = trimmedPacket
ServiceManager.getService()?.batteryNotification?.setBattery(trimmedPacket)
Log.d("CrossDevice", "Battery data: ${ServiceManager.getService()?.batteryNotification?.getBattery()[0]?.level}")
ServiceManager.getService()?.updateBattery()
ServiceManager.getService()?.sendBatteryBroadcast()
ServiceManager.getService()?.sendBatteryNotification()
} else if (ServiceManager.getService()?.ancNotification?.isANCData(trimmedPacket) == true) {
ServiceManager.getService()?.ancNotification?.setStatus(trimmedPacket)
ServiceManager.getService()?.sendANCBroadcast()
ServiceManager.getService()?.updateNoiseControlWidget()
ancBytes = trimmedPacket
} else if (ServiceManager.getService()?.earDetectionNotification?.isEarDetectionData(trimmedPacket) == true) {
Log.d("CrossDevice", "Ear detection data: ${trimmedPacket.joinToString("") { "%02x".format(it) }}")
ServiceManager.getService()?.earDetectionNotification?.setStatus(trimmedPacket)
val newEarDetectionStatus = listOf(
ServiceManager.getService()?.earDetectionNotification?.status?.get(0) == 0x00.toByte(),
ServiceManager.getService()?.earDetectionNotification?.status?.get(1) == 0x00.toByte()
)
if (earDetectionStatus == listOf(false, false) && newEarDetectionStatus.contains(true)) {
ServiceManager.getService()?.applicationContext?.sendBroadcast(
Intent("me.kavishdevar.librepods.cross_device_island")
)
}
earDetectionStatus = newEarDetectionStatus
}
}
}
}
}
fun sendRemotePacket(byteArray: ByteArray) {
if (clientSocket == null || clientSocket!!.outputStream == null) {
return
}
clientSocket?.outputStream?.write(byteArray)
clientSocket?.outputStream?.flush()
logPacket(byteArray, "Sent")
Log.d("CrossDevice", "Sent packet to remote device")
}
fun notifyAirPodsConnectedRemotely(context: Context) {
val intent = Intent("me.kavishdevar.librepods.AIRPODS_CONNECTED_REMOTELY")
context.sendBroadcast(intent)
}
fun notifyAirPodsDisconnectedRemotely(context: Context) {
val intent = Intent("me.kavishdevar.librepods.AIRPODS_DISCONNECTED_REMOTELY")
context.sendBroadcast(intent)
}
}

Some files were not shown because too many files have changed in this diff Show More